Organic compounds
Organic compounds are a class of chemical compounds that contain one or more atoms of carbon covalently bonded to each other and atoms of other elements such as hydrogen, oxygen, nitrogen, sulfur, etc.
Compounds or allotropes of carbon that contain only carbon atoms are classified as inorganic compounds and exhibit novel properties.
This class of chemicals has a wide range of applications and includes graphite, diamond, and the more recently discovered graphene, fullerenes, and other carbon nanotubes. In fact, the majority of elements in the periodic table of elements are inorganic compounds.
Filtered Search Results
Methylene di-p-phenyl diisocyanate, 98%, flakes
CAS: 101-68-8 Molecular Formula: C15H10N2O2 Molecular Weight (g/mol): 250.26 MDL Number: MFCD00036131 InChI Key: UPMLOUAZCHDJJD-UHFFFAOYSA-N Synonym: 4,4'-diphenylmethane diisocyanate,diphenylmethane diisocyanate,isonate,4,4'-diisocyanatodiphenylmethane,p,p'-diphenylmethane diisocyanate,bis 4-isocyanatophenyl methane,4,4'-methylenebis phenyl isocyanate,methylbisphenyl isocyanate,1,1'-methylenebis 4-isocyanatobenzene,methylene diphenyl diisocyanate PubChem CID: 7570 ChEBI: CHEBI:53218 IUPAC Name: 1-isocyanato-4-[(4-isocyanatophenyl)methyl]benzene SMILES: C1=CC(=CC=C1CC2=CC=C(C=C2)N=C=O)N=C=O
| PubChem CID | 7570 |
|---|---|
| CAS | 101-68-8 |
| Molecular Weight (g/mol) | 250.26 |
| ChEBI | CHEBI:53218 |
| MDL Number | MFCD00036131 |
| SMILES | C1=CC(=CC=C1CC2=CC=C(C=C2)N=C=O)N=C=O |
| Synonym | 4,4'-diphenylmethane diisocyanate,diphenylmethane diisocyanate,isonate,4,4'-diisocyanatodiphenylmethane,p,p'-diphenylmethane diisocyanate,bis 4-isocyanatophenyl methane,4,4'-methylenebis phenyl isocyanate,methylbisphenyl isocyanate,1,1'-methylenebis 4-isocyanatobenzene,methylene diphenyl diisocyanate |
| IUPAC Name | 1-isocyanato-4-[(4-isocyanatophenyl)methyl]benzene |
| InChI Key | UPMLOUAZCHDJJD-UHFFFAOYSA-N |
| Molecular Formula | C15H10N2O2 |
Phenyl ether, 99%
CAS: 101-84-8 Molecular Formula: C12H10O Molecular Weight (g/mol): 170.21 MDL Number: MFCD00003034 InChI Key: USIUVYZYUHIAEV-UHFFFAOYSA-N Synonym: diphenyl ether,diphenyl oxide,phenyl ether,oxydibenzene,phenyl oxide,oxybisbenzene,biphenyl oxide,1,1'-oxydibenzene,benzene, 1,1'-oxybis,oxydiphenyl PubChem CID: 7583 ChEBI: CHEBI:39258 IUPAC Name: phenoxybenzene SMILES: C1=CC=C(C=C1)OC2=CC=CC=C2
| PubChem CID | 7583 |
|---|---|
| CAS | 101-84-8 |
| Molecular Weight (g/mol) | 170.21 |
| ChEBI | CHEBI:39258 |
| MDL Number | MFCD00003034 |
| SMILES | C1=CC=C(C=C1)OC2=CC=CC=C2 |
| Synonym | diphenyl ether,diphenyl oxide,phenyl ether,oxydibenzene,phenyl oxide,oxybisbenzene,biphenyl oxide,1,1'-oxydibenzene,benzene, 1,1'-oxybis,oxydiphenyl |
| IUPAC Name | phenoxybenzene |
| InChI Key | USIUVYZYUHIAEV-UHFFFAOYSA-N |
| Molecular Formula | C12H10O |
Phenyl isothiocyanate, 98%
CAS: 103-72-0 Molecular Formula: C7H5NS Molecular Weight (g/mol): 135.18 MDL Number: MFCD00004798 InChI Key: QKFJKGMPGYROCL-UHFFFAOYSA-N Synonym: phenyl isothiocyanate,phenylisothiocyanate,thiocarbanil,phenyl mustard oil,benzene, isothiocyanato,pitc,isothiocyanic acid phenyl ester,benzene-1-isothiocyanate,phenylsenfoel,phenyl thioisocyanate PubChem CID: 7673 ChEBI: CHEBI:85103 IUPAC Name: isothiocyanatobenzene SMILES: S=C=NC1=CC=CC=C1
| PubChem CID | 7673 |
|---|---|
| CAS | 103-72-0 |
| Molecular Weight (g/mol) | 135.18 |
| ChEBI | CHEBI:85103 |
| MDL Number | MFCD00004798 |
| SMILES | S=C=NC1=CC=CC=C1 |
| Synonym | phenyl isothiocyanate,phenylisothiocyanate,thiocarbanil,phenyl mustard oil,benzene, isothiocyanato,pitc,isothiocyanic acid phenyl ester,benzene-1-isothiocyanate,phenylsenfoel,phenyl thioisocyanate |
| IUPAC Name | isothiocyanatobenzene |
| InChI Key | QKFJKGMPGYROCL-UHFFFAOYSA-N |
| Molecular Formula | C7H5NS |
N-Phenyl-1-naphthylamine, 98%
CAS: 90-30-2 Molecular Formula: C16H13N Molecular Weight (g/mol): 219.29 MDL Number: MFCD00003878 InChI Key: XQVWYOYUZDUNRW-UHFFFAOYSA-N Synonym: n-phenyl-1-naphthylamine,1-anilinonaphthalene,pana,antioxidant pan,n-1-naphthyl aniline,neozone a,1-naphthalenamine, n-phenyl,phenylnaphthylamine,nonox a,aceto pan PubChem CID: 7013 ChEBI: CHEBI:34876 IUPAC Name: N-phenylnaphthalen-1-amine SMILES: C1=CC=C(C=C1)NC2=CC=CC3=CC=CC=C32
| PubChem CID | 7013 |
|---|---|
| CAS | 90-30-2 |
| Molecular Weight (g/mol) | 219.29 |
| ChEBI | CHEBI:34876 |
| MDL Number | MFCD00003878 |
| SMILES | C1=CC=C(C=C1)NC2=CC=CC3=CC=CC=C32 |
| Synonym | n-phenyl-1-naphthylamine,1-anilinonaphthalene,pana,antioxidant pan,n-1-naphthyl aniline,neozone a,1-naphthalenamine, n-phenyl,phenylnaphthylamine,nonox a,aceto pan |
| IUPAC Name | N-phenylnaphthalen-1-amine |
| InChI Key | XQVWYOYUZDUNRW-UHFFFAOYSA-N |
| Molecular Formula | C16H13N |
Phenyl sulfone, 97%
CAS: 127-63-9 Molecular Formula: C12H10O2S Molecular Weight (g/mol): 218.27 MDL Number: MFCD00007548 InChI Key: KZTYYGOKRVBIMI-UHFFFAOYSA-N Synonym: diphenyl sulfone,phenyl sulfone,sulfonyldibenzene,diphenylsulfone,sulfobenzide,diphenyl sulphone,benzene, 1,1'-sulfonylbis,sulfone, diphenyl,1,1'-sulfonyldibenzene,phenyl sulphone PubChem CID: 31386 ChEBI: CHEBI:78360 SMILES: O=S(=O)(C1=CC=CC=C1)C1=CC=CC=C1
| PubChem CID | 31386 |
|---|---|
| CAS | 127-63-9 |
| Molecular Weight (g/mol) | 218.27 |
| ChEBI | CHEBI:78360 |
| MDL Number | MFCD00007548 |
| SMILES | O=S(=O)(C1=CC=CC=C1)C1=CC=CC=C1 |
| Synonym | diphenyl sulfone,phenyl sulfone,sulfonyldibenzene,diphenylsulfone,sulfobenzide,diphenyl sulphone,benzene, 1,1'-sulfonylbis,sulfone, diphenyl,1,1'-sulfonyldibenzene,phenyl sulphone |
| InChI Key | KZTYYGOKRVBIMI-UHFFFAOYSA-N |
| Molecular Formula | C12H10O2S |
Phenyl acetate, 97%
CAS: 122-79-2 Molecular Formula: C8H8O2 Molecular Weight (g/mol): 136.15 MDL Number: MFCD00008699 InChI Key: IPBVNPXQWQGGJP-UHFFFAOYSA-N Synonym: acetic acid phenyl ester,phenol acetate,acetylphenol,acetic acid, phenyl ester,acetyl phenol,acetoxybenzene,acetates,acetic acid,phenyl ester,fenylester kyseliny octove,fenylester kyseliny octove czech PubChem CID: 31229 ChEBI: CHEBI:8082 IUPAC Name: phenyl acetate SMILES: CC(=O)OC1=CC=CC=C1
| PubChem CID | 31229 |
|---|---|
| CAS | 122-79-2 |
| Molecular Weight (g/mol) | 136.15 |
| ChEBI | CHEBI:8082 |
| MDL Number | MFCD00008699 |
| SMILES | CC(=O)OC1=CC=CC=C1 |
| Synonym | acetic acid phenyl ester,phenol acetate,acetylphenol,acetic acid, phenyl ester,acetyl phenol,acetoxybenzene,acetates,acetic acid,phenyl ester,fenylester kyseliny octove,fenylester kyseliny octove czech |
| IUPAC Name | phenyl acetate |
| InChI Key | IPBVNPXQWQGGJP-UHFFFAOYSA-N |
| Molecular Formula | C8H8O2 |
Phenyl phosphorodichloridate, 97%
CAS: 770-12-7 Molecular Formula: C6H5Cl2O2P Molecular Weight (g/mol): 210.978 MDL Number: MFCD00002067 InChI Key: TXFOLHZMICYNRM-UHFFFAOYSA-N Synonym: phenyl dichlorophosphate,phenyl phosphorodichloridate,dichlorophenoxyphosphine oxide,phosphorodichloridic acid, phenyl ester,phenylphosphoric dichloride,phenyl phosphorodichlorodate,phenoxydichlorophosphine oxide,phenyldichlorophosphate,phenoxyphosphoryl dichloride,phosphoroyl dichloride phenyl ester PubChem CID: 13038 IUPAC Name: dichlorophosphoryloxybenzene SMILES: C1=CC=C(C=C1)OP(=O)(Cl)Cl
| PubChem CID | 13038 |
|---|---|
| CAS | 770-12-7 |
| Molecular Weight (g/mol) | 210.978 |
| MDL Number | MFCD00002067 |
| SMILES | C1=CC=C(C=C1)OP(=O)(Cl)Cl |
| Synonym | phenyl dichlorophosphate,phenyl phosphorodichloridate,dichlorophenoxyphosphine oxide,phosphorodichloridic acid, phenyl ester,phenylphosphoric dichloride,phenyl phosphorodichlorodate,phenoxydichlorophosphine oxide,phenyldichlorophosphate,phenoxyphosphoryl dichloride,phosphoroyl dichloride phenyl ester |
| IUPAC Name | dichlorophosphoryloxybenzene |
| InChI Key | TXFOLHZMICYNRM-UHFFFAOYSA-N |
| Molecular Formula | C6H5Cl2O2P |
Phenyl salicylate, 99%
CAS: 118-55-8 Molecular Formula: C13H10O3 Molecular Weight (g/mol): 214.22 InChI Key: ZQBAKBUEJOMQEX-UHFFFAOYSA-N Synonym: phenyl salicylate,salol,phenol salicylate,salphenyl,musol,2-phenoxycarbonylphenol,benzoic acid, 2-hydroxy-, phenyl ester,salicylic acid, phenyl ester,2-hydroxybenzoic acid phenyl ester,phenyl-2-hydroxybenzoate PubChem CID: 8361 ChEBI: CHEBI:34918 IUPAC Name: phenyl 2-hydroxybenzoate SMILES: C1=CC=C(C=C1)OC(=O)C2=CC=CC=C2O
| PubChem CID | 8361 |
|---|---|
| CAS | 118-55-8 |
| Molecular Weight (g/mol) | 214.22 |
| ChEBI | CHEBI:34918 |
| SMILES | C1=CC=C(C=C1)OC(=O)C2=CC=CC=C2O |
| Synonym | phenyl salicylate,salol,phenol salicylate,salphenyl,musol,2-phenoxycarbonylphenol,benzoic acid, 2-hydroxy-, phenyl ester,salicylic acid, phenyl ester,2-hydroxybenzoic acid phenyl ester,phenyl-2-hydroxybenzoate |
| IUPAC Name | phenyl 2-hydroxybenzoate |
| InChI Key | ZQBAKBUEJOMQEX-UHFFFAOYSA-N |
| Molecular Formula | C13H10O3 |
Phenyl disulfide, 99%
CAS: 882-33-7 Molecular Formula: C12H10S2 Molecular Weight (g/mol): 218.33 MDL Number: MFCD00003065 InChI Key: GUUVPOWQJOLRAS-UHFFFAOYSA-N Synonym: diphenyl disulfide,phenyl disulfide,disulfide, diphenyl,diphenyldisulfide,1,2-diphenyldisulfane,phenyldisulfanyl benzene,diphenyl disulphide,biphenyl disulfide,disulfide diphenyl,phenyldithiobenzene PubChem CID: 13436 IUPAC Name: (phenyldisulfanyl)benzene SMILES: C1=CC=C(C=C1)SSC2=CC=CC=C2
| PubChem CID | 13436 |
|---|---|
| CAS | 882-33-7 |
| Molecular Weight (g/mol) | 218.33 |
| MDL Number | MFCD00003065 |
| SMILES | C1=CC=C(C=C1)SSC2=CC=CC=C2 |
| Synonym | diphenyl disulfide,phenyl disulfide,disulfide, diphenyl,diphenyldisulfide,1,2-diphenyldisulfane,phenyldisulfanyl benzene,diphenyl disulphide,biphenyl disulfide,disulfide diphenyl,phenyldithiobenzene |
| IUPAC Name | (phenyldisulfanyl)benzene |
| InChI Key | GUUVPOWQJOLRAS-UHFFFAOYSA-N |
| Molecular Formula | C12H10S2 |
Methallyl phenyl ether, 96%
CAS: 5820-22-4 Molecular Formula: C10H12O Molecular Weight (g/mol): 148.21 MDL Number: MFCD00008597 InChI Key: LECDNXOCIPRJNJ-UHFFFAOYSA-N Synonym: methallyl phenyl ether,2-methylallyloxy benzene,ether, 2-methylallyl phenyl,benzene, 2-methyl-2-propenyl oxy,2-methylallyl phenyl ether,2-methylprop-2-en-1-yl oxy benzene,2-methyl-2-propen-1-yl oxy benzene,phenyl-methallyl ether,acmc-1b20w PubChem CID: 79893 IUPAC Name: 2-methylprop-2-enoxybenzene SMILES: CC(=C)COC1=CC=CC=C1
| PubChem CID | 79893 |
|---|---|
| CAS | 5820-22-4 |
| Molecular Weight (g/mol) | 148.21 |
| MDL Number | MFCD00008597 |
| SMILES | CC(=C)COC1=CC=CC=C1 |
| Synonym | methallyl phenyl ether,2-methylallyloxy benzene,ether, 2-methylallyl phenyl,benzene, 2-methyl-2-propenyl oxy,2-methylallyl phenyl ether,2-methylprop-2-en-1-yl oxy benzene,2-methyl-2-propen-1-yl oxy benzene,phenyl-methallyl ether,acmc-1b20w |
| IUPAC Name | 2-methylprop-2-enoxybenzene |
| InChI Key | LECDNXOCIPRJNJ-UHFFFAOYSA-N |
| Molecular Formula | C10H12O |
Phenyl chlorothionoformate, 98+%
CAS: 1005-56-7 Molecular Formula: C7H5ClOS Molecular Weight (g/mol): 172.63 MDL Number: MFCD00004920 InChI Key: KOSYAAIZOGNATQ-UHFFFAOYSA-N Synonym: o-phenyl carbonochloridothioate,phenyl chlorothionoformate,o-phenyl chlorothioformate,phenyl chlorothioformate,phenyl thioxochloroformate,phenyl chlorothionocarbonate,phenoxythiocarbonyl chloride,chlorothioformic acid phenyl ester,o-phenyl chlorothionoformate,o-phenyl chlorothiocarbonate PubChem CID: 70498 SMILES: ClC(=S)OC1=CC=CC=C1
| PubChem CID | 70498 |
|---|---|
| CAS | 1005-56-7 |
| Molecular Weight (g/mol) | 172.63 |
| MDL Number | MFCD00004920 |
| SMILES | ClC(=S)OC1=CC=CC=C1 |
| Synonym | o-phenyl carbonochloridothioate,phenyl chlorothionoformate,o-phenyl chlorothioformate,phenyl chlorothioformate,phenyl thioxochloroformate,phenyl chlorothionocarbonate,phenoxythiocarbonyl chloride,chlorothioformic acid phenyl ester,o-phenyl chlorothionoformate,o-phenyl chlorothiocarbonate |
| InChI Key | KOSYAAIZOGNATQ-UHFFFAOYSA-N |
| Molecular Formula | C7H5ClOS |
Phenyl phosphorodiamidate, 97%
CAS: 7450-69-3 Molecular Formula: C6H9N2O2P Molecular Weight (g/mol): 172.124 MDL Number: MFCD00014767 InChI Key: AYRRNFHDJUXLEQ-UHFFFAOYSA-N Synonym: phenyl phosphorodiamidate,phenylphosphorodiamidate,phenyl diamidophosphate,phosphorodiamidic acid, phenyl ester,diaminophosphoryl oxy benzene,phenylphosphorodiamidat,phosphoric phenyl ester diamide,phenyl phosphordiamidate,phenyl diamidophosphate #,diaminophenoxyphosphino-1-one PubChem CID: 81954 IUPAC Name: diaminophosphoryloxybenzene SMILES: C1=CC=C(C=C1)OP(=O)(N)N
| PubChem CID | 81954 |
|---|---|
| CAS | 7450-69-3 |
| Molecular Weight (g/mol) | 172.124 |
| MDL Number | MFCD00014767 |
| SMILES | C1=CC=C(C=C1)OP(=O)(N)N |
| Synonym | phenyl phosphorodiamidate,phenylphosphorodiamidate,phenyl diamidophosphate,phosphorodiamidic acid, phenyl ester,diaminophosphoryl oxy benzene,phenylphosphorodiamidat,phosphoric phenyl ester diamide,phenyl phosphordiamidate,phenyl diamidophosphate #,diaminophenoxyphosphino-1-one |
| IUPAC Name | diaminophosphoryloxybenzene |
| InChI Key | AYRRNFHDJUXLEQ-UHFFFAOYSA-N |
| Molecular Formula | C6H9N2O2P |
Phenyl acrylate, 97%
CAS: 937-41-7 Molecular Formula: C9H8O2 Molecular Weight (g/mol): 148.161 MDL Number: MFCD00048145 InChI Key: WRAQQYDMVSCOTE-UHFFFAOYSA-N Synonym: phenyl acrylate,phenylacrylate,2-propenoic acid, phenyl ester,phenol acrylate,phenyl-acrylate,acrylic acid phenyl ester,phenyl acrylate 5g,2-propenoic acid,phenyl ester,acrylic acid phenyl ester, stabilized with bht PubChem CID: 61242 IUPAC Name: phenyl prop-2-enoate SMILES: C=CC(=O)OC1=CC=CC=C1
| PubChem CID | 61242 |
|---|---|
| CAS | 937-41-7 |
| Molecular Weight (g/mol) | 148.161 |
| MDL Number | MFCD00048145 |
| SMILES | C=CC(=O)OC1=CC=CC=C1 |
| Synonym | phenyl acrylate,phenylacrylate,2-propenoic acid, phenyl ester,phenol acrylate,phenyl-acrylate,acrylic acid phenyl ester,phenyl acrylate 5g,2-propenoic acid,phenyl ester,acrylic acid phenyl ester, stabilized with bht |
| IUPAC Name | phenyl prop-2-enoate |
| InChI Key | WRAQQYDMVSCOTE-UHFFFAOYSA-N |
| Molecular Formula | C9H8O2 |
Phenyl formate, 95%
CAS: 1864-94-4 Molecular Formula: C7H6O2 Molecular Weight (g/mol): 122.123 MDL Number: MFCD00014126 InChI Key: GEOWCLRLLWTHDN-UHFFFAOYSA-N Synonym: formic acid phenyl ester,formic acid, phenyl ester,phocho,formic acid, phenylester,acmc-1box2,phenyl formate gc PubChem CID: 74626 IUPAC Name: phenyl formate SMILES: C1=CC=C(C=C1)OC=O
| PubChem CID | 74626 |
|---|---|
| CAS | 1864-94-4 |
| Molecular Weight (g/mol) | 122.123 |
| MDL Number | MFCD00014126 |
| SMILES | C1=CC=C(C=C1)OC=O |
| Synonym | formic acid phenyl ester,formic acid, phenyl ester,phocho,formic acid, phenylester,acmc-1box2,phenyl formate gc |
| IUPAC Name | phenyl formate |
| InChI Key | GEOWCLRLLWTHDN-UHFFFAOYSA-N |
| Molecular Formula | C7H6O2 |
Phenyl isothiocyanate, 97%
CAS: 103-72-0 Molecular Formula: C7H5NS Molecular Weight (g/mol): 135.18 MDL Number: MFCD00004798 InChI Key: QKFJKGMPGYROCL-UHFFFAOYSA-N Synonym: phenyl isothiocyanate,phenylisothiocyanate,thiocarbanil,phenyl mustard oil,benzene, isothiocyanato,pitc,isothiocyanic acid phenyl ester,benzene-1-isothiocyanate,phenylsenfoel,phenyl thioisocyanate PubChem CID: 7673 ChEBI: CHEBI:85103 IUPAC Name: isothiocyanatobenzene SMILES: S=C=NC1=CC=CC=C1
| PubChem CID | 7673 |
|---|---|
| CAS | 103-72-0 |
| Molecular Weight (g/mol) | 135.18 |
| ChEBI | CHEBI:85103 |
| MDL Number | MFCD00004798 |
| SMILES | S=C=NC1=CC=CC=C1 |
| Synonym | phenyl isothiocyanate,phenylisothiocyanate,thiocarbanil,phenyl mustard oil,benzene, isothiocyanato,pitc,isothiocyanic acid phenyl ester,benzene-1-isothiocyanate,phenylsenfoel,phenyl thioisocyanate |
| IUPAC Name | isothiocyanatobenzene |
| InChI Key | QKFJKGMPGYROCL-UHFFFAOYSA-N |
| Molecular Formula | C7H5NS |