Organic compounds
Organic compounds are a class of chemical compounds that contain one or more atoms of carbon covalently bonded to each other and atoms of other elements such as hydrogen, oxygen, nitrogen, sulfur, etc.
Compounds or allotropes of carbon that contain only carbon atoms are classified as inorganic compounds and exhibit novel properties.
This class of chemicals has a wide range of applications and includes graphite, diamond, and the more recently discovered graphene, fullerenes, and other carbon nanotubes. In fact, the majority of elements in the periodic table of elements are inorganic compounds.
Filtered Search Results
Tyloxapol, Thermo Scientific Chemicals
CAS: 25301-02-4 MDL Number: MFCD00149002 Synonym: Ethoxylated p-tert-octylphenol formaldehyde polymer
| CAS | 25301-02-4 |
|---|---|
| MDL Number | MFCD00149002 |
| Synonym | Ethoxylated p-tert-octylphenol formaldehyde polymer |
Oleyl alcohol, tech. 80-85%, Thermo Scientific Chemicals
CAS: 143-28-2 Molecular Formula: C18H36O Molecular Weight (g/mol): 268.49 MDL Number: MFCD00002993 InChI Key: ALSTYHKOOCGGFT-KTKRTIGZSA-N Synonym: oleyl alcohol,cis-9-octadecen-1-ol,z-octadec-9-en-1-ol,ocenol,conditioner 1,dermaffine,lancol,novol,oceol,oleol PubChem CID: 5284499 ChEBI: CHEBI:73504 IUPAC Name: (9Z)-octadec-9-en-1-ol SMILES: CCCCCCCC\C=C/CCCCCCCCO
| PubChem CID | 5284499 |
|---|---|
| CAS | 143-28-2 |
| Molecular Weight (g/mol) | 268.49 |
| ChEBI | CHEBI:73504 |
| MDL Number | MFCD00002993 |
| SMILES | CCCCCCCC\C=C/CCCCCCCCO |
| Synonym | oleyl alcohol,cis-9-octadecen-1-ol,z-octadec-9-en-1-ol,ocenol,conditioner 1,dermaffine,lancol,novol,oceol,oleol |
| IUPAC Name | (9Z)-octadec-9-en-1-ol |
| InChI Key | ALSTYHKOOCGGFT-KTKRTIGZSA-N |
| Molecular Formula | C18H36O |
Coelenterazine, native, Aequorea sp., Thermo Scientific Chemicals
CAS: 55779-48-1 Molecular Formula: C26H21N3O3 Molecular Weight (g/mol): 423.472 MDL Number: MFCD00467176 InChI Key: YHIPILPTUVMWQT-UHFFFAOYSA-N Synonym: coelenterazine,oplophorus luciferin,unii-3o1cb88rrd,clzn,coelenterate luciferin,coelenterazine, native,3o1cb88rrd,8-benzyl-2-4-hydroxybenzyl-6-4-hydroxyphenyl imidazo 1,2-a pyrazin-3 7h-one,2-p-hydroxybenzyl-6-p-hydroxyphenyl-8-benzylimidazo 1,2-a pyrazin-3-7h-one,3,2-dihydro-2-p-hydroxybenzyl-6-p-hydroxyphenyl-8-benzylimidazolo 1,2-a pyrazin-3-one PubChem CID: 2830 ChEBI: CHEBI:2311 IUPAC Name: 8-benzyl-6-(4-hydroxyphenyl)-2-[(4-hydroxyphenyl)methyl]-7H-imidazo[1,2-a]pyrazin-3-one SMILES: C1=CC=C(C=C1)CC2=C3N=C(C(=O)N3C=C(N2)C4=CC=C(C=C4)O)CC5=CC=C(C=C5)O
| PubChem CID | 2830 |
|---|---|
| CAS | 55779-48-1 |
| Molecular Weight (g/mol) | 423.472 |
| ChEBI | CHEBI:2311 |
| MDL Number | MFCD00467176 |
| SMILES | C1=CC=C(C=C1)CC2=C3N=C(C(=O)N3C=C(N2)C4=CC=C(C=C4)O)CC5=CC=C(C=C5)O |
| Synonym | coelenterazine,oplophorus luciferin,unii-3o1cb88rrd,clzn,coelenterate luciferin,coelenterazine, native,3o1cb88rrd,8-benzyl-2-4-hydroxybenzyl-6-4-hydroxyphenyl imidazo 1,2-a pyrazin-3 7h-one,2-p-hydroxybenzyl-6-p-hydroxyphenyl-8-benzylimidazo 1,2-a pyrazin-3-7h-one,3,2-dihydro-2-p-hydroxybenzyl-6-p-hydroxyphenyl-8-benzylimidazolo 1,2-a pyrazin-3-one |
| IUPAC Name | 8-benzyl-6-(4-hydroxyphenyl)-2-[(4-hydroxyphenyl)methyl]-7H-imidazo[1,2-a]pyrazin-3-one |
| InChI Key | YHIPILPTUVMWQT-UHFFFAOYSA-N |
| Molecular Formula | C26H21N3O3 |
Lanolin, Thermo Scientific Chemicals
CAS: 8006-54-0 MDL Number: MFCD00081740 Synonym: dmt-2'o-tbdms-rc ac phosphoramidite,dmt-2'o-tbdms-rc ac phosphoramidite, configured for abi,dmt-2'o-tbdms-rc ac phosphoramidite, configured for mermade,ac-c-ce phosphoramidite,dmt-2'o-tbdms-rc ac amidite,dmt-2'o-tbdms-rc ac pharmadite r,dmt-2'o-tbdms-rc ac phosphoramidite, configured for ??kta r and oligopilot r,dmt-2'o-tbdms-rc ac phosphoramidite, configured for perkinelmer, configured for polygen,dmt-2'o-tbdms-rc ac phosphoramidite, configured for polygen, configured for perkinelmer
| CAS | 8006-54-0 |
|---|---|
| MDL Number | MFCD00081740 |
| Synonym | dmt-2'o-tbdms-rc ac phosphoramidite,dmt-2'o-tbdms-rc ac phosphoramidite, configured for abi,dmt-2'o-tbdms-rc ac phosphoramidite, configured for mermade,ac-c-ce phosphoramidite,dmt-2'o-tbdms-rc ac amidite,dmt-2'o-tbdms-rc ac pharmadite r,dmt-2'o-tbdms-rc ac phosphoramidite, configured for ??kta r and oligopilot r,dmt-2'o-tbdms-rc ac phosphoramidite, configured for perkinelmer, configured for polygen,dmt-2'o-tbdms-rc ac phosphoramidite, configured for polygen, configured for perkinelmer |
Deoxycholic acid, 99%, Thermo Scientific Chemicals
CAS: 83-44-3 Molecular Formula: C24H40O4 Molecular Weight (g/mol): 392.58 MDL Number: MFCD00003673 InChI Key: KXGVEGMKQFWNSR-LLQZFEROSA-N Synonym: deoxycholic acid,deoxycholate,desoxycholic acid,choleic acid,cholerebic,cholorebic,degalol,deoxycholatic acid,droxolan,pyrochol PubChem CID: 222528 ChEBI: CHEBI:28834 IUPAC Name: (4R)-4-[(3R,5R,8R,9S,10S,12S,13R,14S,17R)-3,12-dihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoic acid SMILES: [H][C@@]12CC[C@H]([C@H](C)CCC(O)=O)[C@@]1(C)[C@@H](O)C[C@@]1([H])[C@@]2([H])CC[C@]2([H])C[C@H](O)CC[C@]12C
| PubChem CID | 222528 |
|---|---|
| CAS | 83-44-3 |
| Molecular Weight (g/mol) | 392.58 |
| ChEBI | CHEBI:28834 |
| MDL Number | MFCD00003673 |
| SMILES | [H][C@@]12CC[C@H]([C@H](C)CCC(O)=O)[C@@]1(C)[C@@H](O)C[C@@]1([H])[C@@]2([H])CC[C@]2([H])C[C@H](O)CC[C@]12C |
| Synonym | deoxycholic acid,deoxycholate,desoxycholic acid,choleic acid,cholerebic,cholorebic,degalol,deoxycholatic acid,droxolan,pyrochol |
| IUPAC Name | (4R)-4-[(3R,5R,8R,9S,10S,12S,13R,14S,17R)-3,12-dihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoic acid |
| InChI Key | KXGVEGMKQFWNSR-LLQZFEROSA-N |
| Molecular Formula | C24H40O4 |
Salicylic acid, sodium salt, 99+%, Thermo Scientific Chemicals
CAS: 54-21-7 Molecular Formula: C7H5NaO3 Molecular Weight (g/mol): 160.104 MDL Number: MFCD00002440 InChI Key: ABBQHOQBGMUPJH-UHFFFAOYSA-M Synonym: sodium salicylate,sodium 2-hydroxybenzoate,salsonin,clin,enterosalicyl,enterosalil,entrosalyl,glutosalyl,kerasalicyl,magsalyl PubChem CID: 16760658 ChEBI: CHEBI:9180 IUPAC Name: sodium;2-hydroxybenzoate SMILES: C1=CC=C(C(=C1)C(=O)[O-])O.[Na+]
| PubChem CID | 16760658 |
|---|---|
| CAS | 54-21-7 |
| Molecular Weight (g/mol) | 160.104 |
| ChEBI | CHEBI:9180 |
| MDL Number | MFCD00002440 |
| SMILES | C1=CC=C(C(=C1)C(=O)[O-])O.[Na+] |
| Synonym | sodium salicylate,sodium 2-hydroxybenzoate,salsonin,clin,enterosalicyl,enterosalil,entrosalyl,glutosalyl,kerasalicyl,magsalyl |
| IUPAC Name | sodium;2-hydroxybenzoate |
| InChI Key | ABBQHOQBGMUPJH-UHFFFAOYSA-M |
| Molecular Formula | C7H5NaO3 |
L(+)-Arginine Hydrochloride, 98+%, Thermo Scientific Chemicals
CAS: 1119-34-2 Molecular Formula: C6H14N4O2·HCl Molecular Weight (g/mol): 210.67 MDL Number: MFCD00064550 InChI Key: KWTQSFXGGICVPE-WCCKRBBISA-N Synonym: l-arginine hydrochloride,arginine hydrochloride,l-arginine hcl,l-arginine monohydrochloride,h-arg-oh.hcl,r-gene,arginine monohydrochloride,argamine,l-arginine, monohydrochloride,unii-f7lth1e20y PubChem CID: 66250 IUPAC Name: (2S)-2-amino-5-(diaminomethylideneamino)pentanoic acid;hydrochloride SMILES: C(CC(C(=O)O)N)CN=C(N)N.Cl
| PubChem CID | 66250 |
|---|---|
| CAS | 1119-34-2 |
| Molecular Weight (g/mol) | 210.67 |
| MDL Number | MFCD00064550 |
| SMILES | C(CC(C(=O)O)N)CN=C(N)N.Cl |
| Synonym | l-arginine hydrochloride,arginine hydrochloride,l-arginine hcl,l-arginine monohydrochloride,h-arg-oh.hcl,r-gene,arginine monohydrochloride,argamine,l-arginine, monohydrochloride,unii-f7lth1e20y |
| IUPAC Name | (2S)-2-amino-5-(diaminomethylideneamino)pentanoic acid;hydrochloride |
| InChI Key | KWTQSFXGGICVPE-WCCKRBBISA-N |
| Molecular Formula | C6H14N4O2·HCl |
Tri-n-butyl phosphate, 98%, Thermo Scientific Chemicals
CAS: 126-73-8 Molecular Formula: C12H27O4P Molecular Weight (g/mol): 266.32 MDL Number: MFCD00009436 InChI Key: STCOOQWBFONSKY-UHFFFAOYSA-N Synonym: tri-n-butyl phosphate,tributylphosphate,butyl phosphate,phosphoric acid tributyl ester,tributylphosphat,celluphos 4,disflamoll tb,tributilfosfato,tributylfosfaat,tributyle phosphate de PubChem CID: 31357 ChEBI: CHEBI:35019 IUPAC Name: tributyl phosphate SMILES: CCCCOP(=O)(OCCCC)OCCCC
| PubChem CID | 31357 |
|---|---|
| CAS | 126-73-8 |
| Molecular Weight (g/mol) | 266.32 |
| ChEBI | CHEBI:35019 |
| MDL Number | MFCD00009436 |
| SMILES | CCCCOP(=O)(OCCCC)OCCCC |
| Synonym | tri-n-butyl phosphate,tributylphosphate,butyl phosphate,phosphoric acid tributyl ester,tributylphosphat,celluphos 4,disflamoll tb,tributilfosfato,tributylfosfaat,tributyle phosphate de |
| IUPAC Name | tributyl phosphate |
| InChI Key | STCOOQWBFONSKY-UHFFFAOYSA-N |
| Molecular Formula | C12H27O4P |
Citric acid, trilithium salt tetrahydrate, 98%, pure, Thermo Scientific Chemicals
CAS: 6080-58-6 MDL Number: MFCD00150030 InChI Key: HXGWMCJZLNWEBC-UHFFFAOYSA-K Synonym: lithium citrate tetrahydrate,unii-5z6e9k79yv,trilithium citrate tetrahydrate,lithium citrate usp,citric acid trilithium salt tetrahydrate,tri-lithium citrate tetrahydrate,lithium citrate tribasic tetrahydrate,lithonate tn,1,2,3-propanetricarboxylic acid, 2-hydroxy-trilithium salt tetrahydrate PubChem CID: 2724118 ChEBI: CHEBI:64754 IUPAC Name: trilithium;2-hydroxypropane-1,2,3-tricarboxylate;tetrahydrate SMILES: [Li+].[Li+].[Li+].C(C(=O)[O-])C(CC(=O)[O-])(C(=O)[O-])O.O.O.O.O
| PubChem CID | 2724118 |
|---|---|
| CAS | 6080-58-6 |
| ChEBI | CHEBI:64754 |
| MDL Number | MFCD00150030 |
| SMILES | [Li+].[Li+].[Li+].C(C(=O)[O-])C(CC(=O)[O-])(C(=O)[O-])O.O.O.O.O |
| Synonym | lithium citrate tetrahydrate,unii-5z6e9k79yv,trilithium citrate tetrahydrate,lithium citrate usp,citric acid trilithium salt tetrahydrate,tri-lithium citrate tetrahydrate,lithium citrate tribasic tetrahydrate,lithonate tn,1,2,3-propanetricarboxylic acid, 2-hydroxy-trilithium salt tetrahydrate |
| IUPAC Name | trilithium;2-hydroxypropane-1,2,3-tricarboxylate;tetrahydrate |
| InChI Key | HXGWMCJZLNWEBC-UHFFFAOYSA-K |
Methyl 4-hydroxybenzoate, sodium salt, 99%, Thermo Scientific Chemicals
CAS: 5026-62-0 Molecular Formula: C8H7NaO3 Molecular Weight (g/mol): 174.13 MDL Number: MFCD00016470 InChI Key: PESXGULMKCKJCC-UHFFFAOYSA-M Synonym: methylparaben sodium,sodium methylparaben,sodium 4-methoxycarbonyl phenolate,preserval ms,methyl 4-hydroxybenzoate, sodium salt,solparol,bonomold omna,methyl 4-hydroxybenzoate sodium salt,sodium 4-carbomethoxyphenolate,unii-cr6k9c2nhk PubChem CID: 23663626 IUPAC Name: sodium;4-methoxycarbonylphenolate SMILES: COC(=O)C1=CC=C(C=C1)[O-].[Na+]
| PubChem CID | 23663626 |
|---|---|
| CAS | 5026-62-0 |
| Molecular Weight (g/mol) | 174.13 |
| MDL Number | MFCD00016470 |
| SMILES | COC(=O)C1=CC=C(C=C1)[O-].[Na+] |
| Synonym | methylparaben sodium,sodium methylparaben,sodium 4-methoxycarbonyl phenolate,preserval ms,methyl 4-hydroxybenzoate, sodium salt,solparol,bonomold omna,methyl 4-hydroxybenzoate sodium salt,sodium 4-carbomethoxyphenolate,unii-cr6k9c2nhk |
| IUPAC Name | sodium;4-methoxycarbonylphenolate |
| InChI Key | PESXGULMKCKJCC-UHFFFAOYSA-M |
| Molecular Formula | C8H7NaO3 |
Diethylamine, 99+%, extra pure, Thermo Scientific Chemicals
CAS: 109-89-7 Molecular Formula: C4H11N Molecular Weight (g/mol): 73.14 MDL Number: MFCD00009032 InChI Key: HPNMFZURTQLUMO-UHFFFAOYSA-N Synonym: diethylamine,n,n-diethylamine,ethanamine, n-ethyl,diethamine,diaethylamin,dwuetyloamina,dietilamina,diethylamin,diethyl amine,n-ethyl-ethanamine PubChem CID: 8021 ChEBI: CHEBI:85259 SMILES: CCNCC
| PubChem CID | 8021 |
|---|---|
| CAS | 109-89-7 |
| Molecular Weight (g/mol) | 73.14 |
| ChEBI | CHEBI:85259 |
| MDL Number | MFCD00009032 |
| SMILES | CCNCC |
| Synonym | diethylamine,n,n-diethylamine,ethanamine, n-ethyl,diethamine,diaethylamin,dwuetyloamina,dietilamina,diethylamin,diethyl amine,n-ethyl-ethanamine |
| InChI Key | HPNMFZURTQLUMO-UHFFFAOYSA-N |
| Molecular Formula | C4H11N |
Acetylsalicylic acid, 99%, Thermo Scientific Chemicals
CAS: 50-78-2 Molecular Formula: C9H8O4 Molecular Weight (g/mol): 180.16 MDL Number: MFCD00002430 InChI Key: BSYNRYMUTXBXSQ-UHFFFAOYSA-N Synonym: aspirin,acetylsalicylic acid,2-acetoxybenzoic acid,2-acetyloxy benzoic acid,acetylsalicylate,o-acetylsalicylic acid,o-acetoxybenzoic acid,acylpyrin,polopiryna,easprin PubChem CID: 2244 ChEBI: CHEBI:15365 IUPAC Name: 2-acetyloxybenzoic acid SMILES: CC(=O)OC1=CC=CC=C1C(O)=O
| PubChem CID | 2244 |
|---|---|
| CAS | 50-78-2 |
| Molecular Weight (g/mol) | 180.16 |
| ChEBI | CHEBI:15365 |
| MDL Number | MFCD00002430 |
| SMILES | CC(=O)OC1=CC=CC=C1C(O)=O |
| Synonym | aspirin,acetylsalicylic acid,2-acetoxybenzoic acid,2-acetyloxy benzoic acid,acetylsalicylate,o-acetylsalicylic acid,o-acetoxybenzoic acid,acylpyrin,polopiryna,easprin |
| IUPAC Name | 2-acetyloxybenzoic acid |
| InChI Key | BSYNRYMUTXBXSQ-UHFFFAOYSA-N |
| Molecular Formula | C9H8O4 |
Diethylamine, 99+%, Thermo Scientific Chemicals
CAS: 109-89-7 Molecular Formula: C4H11N Molecular Weight (g/mol): 73.14 MDL Number: MFCD00009032 InChI Key: HPNMFZURTQLUMO-UHFFFAOYSA-N Synonym: diethylamine,n,n-diethylamine,ethanamine, n-ethyl,diethamine,diaethylamin,dwuetyloamina,dietilamina,diethylamin,diethyl amine,n-ethyl-ethanamine PubChem CID: 8021 ChEBI: CHEBI:85259 SMILES: CCNCC
| PubChem CID | 8021 |
|---|---|
| CAS | 109-89-7 |
| Molecular Weight (g/mol) | 73.14 |
| ChEBI | CHEBI:85259 |
| MDL Number | MFCD00009032 |
| SMILES | CCNCC |
| Synonym | diethylamine,n,n-diethylamine,ethanamine, n-ethyl,diethamine,diaethylamin,dwuetyloamina,dietilamina,diethylamin,diethyl amine,n-ethyl-ethanamine |
| InChI Key | HPNMFZURTQLUMO-UHFFFAOYSA-N |
| Molecular Formula | C4H11N |
tert-Butyllithium, 1.9M solution in pentane, AcroSeal™, Thermo Scientific Chemicals
CAS: 594-19-4 Molecular Formula: C4H9Li Molecular Weight (g/mol): 64.06 MDL Number: MFCD00008795 InChI Key: BKDLGMUIXWPYGD-UHFFFAOYSA-N Synonym: tert-butyllithium,t-butyllithium,tbuli,lithium, 1,1-dimethylethyl,t-buli,lithium 2-methylpropane,tert-butyllithium solution,tert butyllithium,t-butyllithiurn PubChem CID: 638178 SMILES: [Li]C(C)(C)C
| PubChem CID | 638178 |
|---|---|
| CAS | 594-19-4 |
| Molecular Weight (g/mol) | 64.06 |
| MDL Number | MFCD00008795 |
| SMILES | [Li]C(C)(C)C |
| Synonym | tert-butyllithium,t-butyllithium,tbuli,lithium, 1,1-dimethylethyl,t-buli,lithium 2-methylpropane,tert-butyllithium solution,tert butyllithium,t-butyllithiurn |
| InChI Key | BKDLGMUIXWPYGD-UHFFFAOYSA-N |
| Molecular Formula | C4H9Li |