Organometallic Compounds
Filtered Search Results
N-(Trimethylsilyl)imidazole, 97%
CAS: 18156-74-6 Molecular Formula: C6H12N2Si Molecular Weight (g/mol): 140.26 MDL Number: MFCD00005280 InChI Key: YKFRUJSEPGHZFJ-UHFFFAOYSA-N Synonym: n-trimethylsilyl imidazole,1-trimethylsilyl imidazole,1-trimethylsilyl-1h-imidazole,tsim,1h-imidazole, 1-trimethylsilyl,n-trimethylsilylimidazole,trimethylsilyl imidazole,1-trimethylsilylimidazole,n-trimethylsilyl imidazol,imidazole, 1-trimethylsilyl PubChem CID: 28925 ChEBI: CHEBI:85063 IUPAC Name: imidazol-1-yl(trimethyl)silane SMILES: C[Si](C)(C)N1C=CN=C1
| PubChem CID | 28925 |
|---|---|
| CAS | 18156-74-6 |
| Molecular Weight (g/mol) | 140.26 |
| ChEBI | CHEBI:85063 |
| MDL Number | MFCD00005280 |
| SMILES | C[Si](C)(C)N1C=CN=C1 |
| Synonym | n-trimethylsilyl imidazole,1-trimethylsilyl imidazole,1-trimethylsilyl-1h-imidazole,tsim,1h-imidazole, 1-trimethylsilyl,n-trimethylsilylimidazole,trimethylsilyl imidazole,1-trimethylsilylimidazole,n-trimethylsilyl imidazol,imidazole, 1-trimethylsilyl |
| IUPAC Name | imidazol-1-yl(trimethyl)silane |
| InChI Key | YKFRUJSEPGHZFJ-UHFFFAOYSA-N |
| Molecular Formula | C6H12N2Si |
Zincon monosodium salt
CAS: 62625-22-3 Molecular Formula: C20H16N4NaO6S Molecular Weight (g/mol): 463.42 MDL Number: MFCD00064385 InChI Key: IABRINWJUBAIIE-JJECXDOKSA-N PubChem CID: 131856391 IUPAC Name: 2-[2-[(Z)-N-[(Z)-(6-oxo-3-sulfocyclohexa-2,4-dien-1-ylidene)amino]-C-phenylcarbonimidoyl]hydrazinyl]benzoic acid;sodium SMILES: C1=CC=C(C=C1)C(=NN=C2C=C(C=CC2=O)S(=O)(=O)O)NNC3=CC=CC=C3C(=O)O.[Na]
| PubChem CID | 131856391 |
|---|---|
| CAS | 62625-22-3 |
| Molecular Weight (g/mol) | 463.42 |
| MDL Number | MFCD00064385 |
| SMILES | C1=CC=C(C=C1)C(=NN=C2C=C(C=CC2=O)S(=O)(=O)O)NNC3=CC=CC=C3C(=O)O.[Na] |
| IUPAC Name | 2-[2-[(Z)-N-[(Z)-(6-oxo-3-sulfocyclohexa-2,4-dien-1-ylidene)amino]-C-phenylcarbonimidoyl]hydrazinyl]benzoic acid;sodium |
| InChI Key | IABRINWJUBAIIE-JJECXDOKSA-N |
| Molecular Formula | C20H16N4NaO6S |
Phenyltriethoxysilane, 98%
CAS: 780-69-8 Molecular Formula: C12H20O3Si Molecular Weight (g/mol): 240.37 MDL Number: MFCD00009065 InChI Key: JCVQKRGIASEUKR-UHFFFAOYSA-N Synonym: phenyltriethoxysilane,triethoxy phenyl silane,silane, triethoxyphenyl,triethoxyfenylsilan,silane, phenyltriethoxy,benzeneorthosiliconic acid, triethyl ester,phenyl triethoxysilane,benzene, triethoxysilyl,triethoxyfenylsilan czech,unii-qi310t2x15 PubChem CID: 13075 IUPAC Name: triethoxy(phenyl)silane SMILES: CCO[Si](OCC)(OCC)C1=CC=CC=C1
| PubChem CID | 13075 |
|---|---|
| CAS | 780-69-8 |
| Molecular Weight (g/mol) | 240.37 |
| MDL Number | MFCD00009065 |
| SMILES | CCO[Si](OCC)(OCC)C1=CC=CC=C1 |
| Synonym | phenyltriethoxysilane,triethoxy phenyl silane,silane, triethoxyphenyl,triethoxyfenylsilan,silane, phenyltriethoxy,benzeneorthosiliconic acid, triethyl ester,phenyl triethoxysilane,benzene, triethoxysilyl,triethoxyfenylsilan czech,unii-qi310t2x15 |
| IUPAC Name | triethoxy(phenyl)silane |
| InChI Key | JCVQKRGIASEUKR-UHFFFAOYSA-N |
| Molecular Formula | C12H20O3Si |
Vinyltrimethoxysilane, 98%, AcroSeal™
CAS: 2-7-2768 Molecular Formula: C5H12O3Si Molecular Weight (g/mol): 148.24 MDL Number: MFCD00008605 InChI Key: NKSJNEHGWDZZQF-UHFFFAOYSA-N Synonym: vinyltrimethoxysilane,trimethoxyvinylsilane,silane, ethenyltrimethoxy,trimethoxy vinyl silane,trimethoxysilyl ethene,vinyl trimethoxy silane,silane, trimethoxyvinyl,trimethoxysilyl ethylene,vtmo,vts-m PubChem CID: 76004 IUPAC Name: ethenyl(trimethoxy)silane SMILES: CO[Si](C=C)(OC)OC
| PubChem CID | 76004 |
|---|---|
| CAS | 2-7-2768 |
| Molecular Weight (g/mol) | 148.24 |
| MDL Number | MFCD00008605 |
| SMILES | CO[Si](C=C)(OC)OC |
| Synonym | vinyltrimethoxysilane,trimethoxyvinylsilane,silane, ethenyltrimethoxy,trimethoxy vinyl silane,trimethoxysilyl ethene,vinyl trimethoxy silane,silane, trimethoxyvinyl,trimethoxysilyl ethylene,vtmo,vts-m |
| IUPAC Name | ethenyl(trimethoxy)silane |
| InChI Key | NKSJNEHGWDZZQF-UHFFFAOYSA-N |
| Molecular Formula | C5H12O3Si |
Vinyltrimethoxysilane, 98%
CAS: 2-7-2768 Molecular Formula: C5H12O3Si Molecular Weight (g/mol): 148.24 MDL Number: MFCD00008605 InChI Key: NKSJNEHGWDZZQF-UHFFFAOYSA-N Synonym: vinyltrimethoxysilane,trimethoxyvinylsilane,silane, ethenyltrimethoxy,trimethoxy vinyl silane,trimethoxysilyl ethene,vinyl trimethoxy silane,silane, trimethoxyvinyl,trimethoxysilyl ethylene,vtmo,vts-m PubChem CID: 76004 IUPAC Name: ethenyl(trimethoxy)silane SMILES: CO[Si](C=C)(OC)OC
| PubChem CID | 76004 |
|---|---|
| CAS | 2-7-2768 |
| Molecular Weight (g/mol) | 148.24 |
| MDL Number | MFCD00008605 |
| SMILES | CO[Si](C=C)(OC)OC |
| Synonym | vinyltrimethoxysilane,trimethoxyvinylsilane,silane, ethenyltrimethoxy,trimethoxy vinyl silane,trimethoxysilyl ethene,vinyl trimethoxy silane,silane, trimethoxyvinyl,trimethoxysilyl ethylene,vtmo,vts-m |
| IUPAC Name | ethenyl(trimethoxy)silane |
| InChI Key | NKSJNEHGWDZZQF-UHFFFAOYSA-N |
| Molecular Formula | C5H12O3Si |
Dibutyltin oxide, 98%
CAS: 818-08-6 Molecular Formula: C8H18OSn Molecular Weight (g/mol): 248.92 MDL Number: MFCD00001992 InChI Key: JGFBRKRYDCGYKD-UHFFFAOYSA-N Synonym: dibutyltin oxide,stannane, dibutyloxo,dibutyl oxo tin,dibutyloxostannane,di-n-butyltin oxide,tin, dibutyloxo,dibutylstannane oxide,dibutyltinoxide,dibutyltin iv oxide,dibutyloxide of tin PubChem CID: 61221 IUPAC Name: dibutyl(oxo)tin SMILES: CCCC[Sn](=O)CCCC
| PubChem CID | 61221 |
|---|---|
| CAS | 818-08-6 |
| Molecular Weight (g/mol) | 248.92 |
| MDL Number | MFCD00001992 |
| SMILES | CCCC[Sn](=O)CCCC |
| Synonym | dibutyltin oxide,stannane, dibutyloxo,dibutyl oxo tin,dibutyloxostannane,di-n-butyltin oxide,tin, dibutyloxo,dibutylstannane oxide,dibutyltinoxide,dibutyltin iv oxide,dibutyloxide of tin |
| IUPAC Name | dibutyl(oxo)tin |
| InChI Key | JGFBRKRYDCGYKD-UHFFFAOYSA-N |
| Molecular Formula | C8H18OSn |
mu-Chloro-mu-methylenebis(cyclopentadienyl)titaniumdimethylaluminum, 0.5M in toluene
CAS: 67719-69-1 Molecular Formula: C13H18AlClTi MDL Number: MFCD00151575 Synonym: Tebbe Reagent
| CAS | 67719-69-1 |
|---|---|
| MDL Number | MFCD00151575 |
| Synonym | Tebbe Reagent |
| Molecular Formula | C13H18AlClTi |
Diisobutylaluminium hydride, 1.2M (20 wt%) solution in toluene, AcroSeal™
CAS: 1191-15-7 | C8H19Al | 142.22 g/mol
| Boiling Point | 110.0°C |
|---|---|
| Linear Formula | [(CH3)2CHCH2]2AIH |
| Molecular Weight (g/mol) | 142.22 |
| Physical Form | Solution |
| Chemical Name or Material | Diisobutylaluminium hydride |
| Merck Index | 15, 3212 |
| Density | 0.8480g/mL |
| Fieser | 01,260; 02,140; 03,101; 04,158; 05,224; 06,198; 07,111; 08,173; 09,171; 10,149; 11,185; 12,191; 13,115; 14,138; 15,137; 16,27; 17,123 |
| CAS | 108-88-3 |
| Health Hazard 3 | GHS P Statement IF SWALLOWED: rinse mouth. Do NOT induce vomiting. Wear eye protection/face protection. IF IN EYES: Rinse cautiously with water for several minutes. Remove contact lenses,if present and easy to do. Continue rinsi |
| MDL Number | MFCD00008928 |
| Health Hazard 2 | GHS H Statement Causes severe skin burns and eye damage. May be fatal if swallowed and enters airways. May cause damage to organs through prolonged or repeated exposure. Suspected of damaging the unborn child. May cause dro |
| Solubility Information | Solubility in water: reacts violently. Other solubilities: miscible with saturated aliphatic and aromatic,hydrocarbons |
| Flash Point | 4°C |
| Health Hazard 1 | GHS Signal Word: Danger |
| Synonym | DIBAL-H |
| Beilstein | 04, IV, 4400 |
| Molecular Formula | C8H19Al |
| EINECS Number | 214-729-9 |
| Formula Weight | 142.22 |
| Specific Gravity | 0.848 |
Trimethyltin chloride, 99%
CAS: 1066-45-1 Molecular Formula: C3H11ClSn Molecular Weight (g/mol): 201.28 MDL Number: MFCD00000520 InChI Key: FVFGWISLDLUGHX-UHFFFAOYSA-N Synonym: trimethyltin chloride,stannane, chlorotrimethyl,chlorotrimethyltin,trimethylchlorotin,trimethylstannyl chloride,trimethylchlorostannane,chloro trimethyl stannane,m&t chemicals 1222-45,stannylium, trimethyl-, chloride,trimethyltinchloride PubChem CID: 14016 IUPAC Name: chloro(trimethyl)stannane SMILES: Cl.C[SnH](C)C
| PubChem CID | 14016 |
|---|---|
| CAS | 1066-45-1 |
| Molecular Weight (g/mol) | 201.28 |
| MDL Number | MFCD00000520 |
| SMILES | Cl.C[SnH](C)C |
| Synonym | trimethyltin chloride,stannane, chlorotrimethyl,chlorotrimethyltin,trimethylchlorotin,trimethylstannyl chloride,trimethylchlorostannane,chloro trimethyl stannane,m&t chemicals 1222-45,stannylium, trimethyl-, chloride,trimethyltinchloride |
| IUPAC Name | chloro(trimethyl)stannane |
| InChI Key | FVFGWISLDLUGHX-UHFFFAOYSA-N |
| Molecular Formula | C3H11ClSn |
Methyltriethoxysilane, 98+%
CAS: 2031-67-6 Molecular Formula: C7H18O3Si Molecular Weight (g/mol): 178.30 MDL Number: MFCD00009066 InChI Key: CPUDPFPXCZDNGI-UHFFFAOYSA-N Synonym: methyltriethoxysilane,triethoxy methyl silane,methyl triethoxysilane,silane, triethoxymethyl,triethoxysilylmethane,union carbide a-162,ici-ep 5850,silane, methyltriethoxy,methaneorthosiliconic acid, triethyl ester,mtes PubChem CID: 16241 IUPAC Name: triethoxy(methyl)silane SMILES: CCO[Si](C)(OCC)OCC
| PubChem CID | 16241 |
|---|---|
| CAS | 2031-67-6 |
| Molecular Weight (g/mol) | 178.30 |
| MDL Number | MFCD00009066 |
| SMILES | CCO[Si](C)(OCC)OCC |
| Synonym | methyltriethoxysilane,triethoxy methyl silane,methyl triethoxysilane,silane, triethoxymethyl,triethoxysilylmethane,union carbide a-162,ici-ep 5850,silane, methyltriethoxy,methaneorthosiliconic acid, triethyl ester,mtes |
| IUPAC Name | triethoxy(methyl)silane |
| InChI Key | CPUDPFPXCZDNGI-UHFFFAOYSA-N |
| Molecular Formula | C7H18O3Si |
Diethoxydimethylsilane, 97%
CAS: 78-62-6 MDL Number: MFCD00009068 InChI Key: YYLGKUPAFFKGRQ-UHFFFAOYSA-N Synonym: dimethyldiethoxysilane,silane, diethoxydimethyl,diethoxy dimethyl silane,dimethyl-diethoxysilan,dimethylsilicondiethoxide,dimethyl diethoxy silane,unii-i3931j3zj2,dimethyl-diethoxysilan czech,ccris 1321,kbe 22 PubChem CID: 62322 IUPAC Name: diethoxy(dimethyl)silane SMILES: CCO[Si](C)(C)OCC
| PubChem CID | 62322 |
|---|---|
| CAS | 78-62-6 |
| MDL Number | MFCD00009068 |
| SMILES | CCO[Si](C)(C)OCC |
| Synonym | dimethyldiethoxysilane,silane, diethoxydimethyl,diethoxy dimethyl silane,dimethyl-diethoxysilan,dimethylsilicondiethoxide,dimethyl diethoxy silane,unii-i3931j3zj2,dimethyl-diethoxysilan czech,ccris 1321,kbe 22 |
| IUPAC Name | diethoxy(dimethyl)silane |
| InChI Key | YYLGKUPAFFKGRQ-UHFFFAOYSA-N |
Ethylaluminium sesquichloride, 0.4M solution in hexane, AcroSeal™
CAS: 12075-68-2 Molecular Formula: C6H15Al2Cl3 Molecular Weight (g/mol): 247.51 MDL Number: MFCD00044852 InChI Key: LDXMUMPEDOQULK-UHFFFAOYSA-K Synonym: ethylaluminum sesquichloride,ethylaluminium sesquichloride,sesquiethylaluminum chloride,easc,aluminum, trichlorotriethyldi,ethylaluminum sesquichioride,ethylaluminum sesquichloride solution,di-,i-chlorochlorotriethyldi-aluminum,chloro diethyl alumane; dichloro ethyl alumane PubChem CID: 25508 IUPAC Name: chloro(diethyl)alumane;dichloro(ethyl)alumane SMILES: CC[Al](CC)Cl.CC[Al](Cl)Cl
| PubChem CID | 25508 |
|---|---|
| CAS | 12075-68-2 |
| Molecular Weight (g/mol) | 247.51 |
| MDL Number | MFCD00044852 |
| SMILES | CC[Al](CC)Cl.CC[Al](Cl)Cl |
| Synonym | ethylaluminum sesquichloride,ethylaluminium sesquichloride,sesquiethylaluminum chloride,easc,aluminum, trichlorotriethyldi,ethylaluminum sesquichioride,ethylaluminum sesquichloride solution,di-,i-chlorochlorotriethyldi-aluminum,chloro diethyl alumane; dichloro ethyl alumane |
| IUPAC Name | chloro(diethyl)alumane;dichloro(ethyl)alumane |
| InChI Key | LDXMUMPEDOQULK-UHFFFAOYSA-K |
| Molecular Formula | C6H15Al2Cl3 |
tert-Butylchlorodimethylsilane, 98%
CAS: 18162-48-6 Molecular Formula: C6H15ClSi Molecular Weight (g/mol): 150.73 MDL Number: MFCD00000501 InChI Key: BCNZYOJHNLTNEZ-UHFFFAOYSA-N Synonym: tert-butyldimethylsilyl chloride,tert-butyldimethylchlorosilane,t-butyldimethylchlorosilane,tert-butylchlorodimethylsilane,tbdms chloride,tert-butyl chloro dimethylsilane,chloro-tert-butyldimethylsilane,silane, chloro 1,1-dimethylethyl dimethyl,tbscl,t-butyldimethylsilyl chloride PubChem CID: 28928 ChEBI: CHEBI:85071 IUPAC Name: tert-butyl-chloro-dimethylsilane SMILES: CC(C)(C)[Si](C)(C)Cl
| PubChem CID | 28928 |
|---|---|
| CAS | 18162-48-6 |
| Molecular Weight (g/mol) | 150.73 |
| ChEBI | CHEBI:85071 |
| MDL Number | MFCD00000501 |
| SMILES | CC(C)(C)[Si](C)(C)Cl |
| Synonym | tert-butyldimethylsilyl chloride,tert-butyldimethylchlorosilane,t-butyldimethylchlorosilane,tert-butylchlorodimethylsilane,tbdms chloride,tert-butyl chloro dimethylsilane,chloro-tert-butyldimethylsilane,silane, chloro 1,1-dimethylethyl dimethyl,tbscl,t-butyldimethylsilyl chloride |
| IUPAC Name | tert-butyl-chloro-dimethylsilane |
| InChI Key | BCNZYOJHNLTNEZ-UHFFFAOYSA-N |
| Molecular Formula | C6H15ClSi |
Tri-n-butyltin chloride, 95%, tech.
CAS: 1461-22-9 Molecular Formula: C12H27ClSn Molecular Weight (g/mol): 325.48 MDL Number: MFCD00000521 InChI Key: GCTFWCDSFPMHHS-UHFFFAOYSA-M Synonym: tributyltin chloride,chlorotributyltin,tri-n-butyltin chloride,tributylchlorotin,stannane, tributylchloro,chlorotri-n-butyltin,tri-n-butylchlorotin,tributyl chloro stannane,chlorotributylstannane,tributylstannyl chloride PubChem CID: 15096 ChEBI: CHEBI:79734 IUPAC Name: tributyl(chloro)stannane SMILES: CCCC[Sn](CCCC)(CCCC)Cl
| PubChem CID | 15096 |
|---|---|
| CAS | 1461-22-9 |
| Molecular Weight (g/mol) | 325.48 |
| ChEBI | CHEBI:79734 |
| MDL Number | MFCD00000521 |
| SMILES | CCCC[Sn](CCCC)(CCCC)Cl |
| Synonym | tributyltin chloride,chlorotributyltin,tri-n-butyltin chloride,tributylchlorotin,stannane, tributylchloro,chlorotri-n-butyltin,tri-n-butylchlorotin,tributyl chloro stannane,chlorotributylstannane,tributylstannyl chloride |
| IUPAC Name | tributyl(chloro)stannane |
| InChI Key | GCTFWCDSFPMHHS-UHFFFAOYSA-M |
| Molecular Formula | C12H27ClSn |