Salts and Inorganics
A variety of inorganic salts and elemental metals that can be used for large-scale, industrial purposes and everyday laboratory applications. Products are available in a range of chemical compositions, quantities, purities, and reagent grades.
Inorganics are elements and compounds, including carbon monoxide, carbon dioxide, carbonates, cyanides, cyanates, and carbides, that do not contain a carbon-hydrogen bond. This group also includes carbon allotropes such as graphite and graphene.
Because organic chemicals include only those that contain carbon atoms bonded to hydrogen atoms, the majority of elements in the periodic table and most substances in the material world are considered to be inorganic chemicals.
Filtered Search Results
Sodium acetate, 1M aq. soln., pH 4.5, RNAse free
CAS: 127-09-3 Molecular Formula: C2H3NaO2 Molecular Weight (g/mol): 82.03 MDL Number: MFCD00012459 InChI Key: VMHLLURERBWHNL-UHFFFAOYSA-M Synonym: sodium acetate,acetic acid, sodium salt,sodium acetate anhydrous,sodium acetate, anhydrous,acetic acid sodium salt,anhydrous sodium acetate,sodii acetas,sodium ethanoate,natrium aceticum,octan sodny czech PubChem CID: 517045 ChEBI: CHEBI:32954 SMILES: [Na+].CC([O-])=O
| PubChem CID | 517045 |
|---|---|
| CAS | 127-09-3 |
| Molecular Weight (g/mol) | 82.03 |
| ChEBI | CHEBI:32954 |
| MDL Number | MFCD00012459 |
| SMILES | [Na+].CC([O-])=O |
| Synonym | sodium acetate,acetic acid, sodium salt,sodium acetate anhydrous,sodium acetate, anhydrous,acetic acid sodium salt,anhydrous sodium acetate,sodii acetas,sodium ethanoate,natrium aceticum,octan sodny czech |
| InChI Key | VMHLLURERBWHNL-UHFFFAOYSA-M |
| Molecular Formula | C2H3NaO2 |
Sodium acetate, 3M aq. soln., pH 5.2, RNAse free
CAS: 127-09-3 Molecular Formula: C2H3NaO2 Molecular Weight (g/mol): 82.03 MDL Number: MFCD00012459 InChI Key: VMHLLURERBWHNL-UHFFFAOYSA-M Synonym: sodium acetate,acetic acid, sodium salt,sodium acetate anhydrous,sodium acetate, anhydrous,acetic acid sodium salt,anhydrous sodium acetate,sodii acetas,sodium ethanoate,natrium aceticum,octan sodny czech PubChem CID: 517045 ChEBI: CHEBI:32954 IUPAC Name: sodium acetate SMILES: [Na+].CC([O-])=O
| PubChem CID | 517045 |
|---|---|
| CAS | 127-09-3 |
| Molecular Weight (g/mol) | 82.03 |
| ChEBI | CHEBI:32954 |
| MDL Number | MFCD00012459 |
| SMILES | [Na+].CC([O-])=O |
| Synonym | sodium acetate,acetic acid, sodium salt,sodium acetate anhydrous,sodium acetate, anhydrous,acetic acid sodium salt,anhydrous sodium acetate,sodii acetas,sodium ethanoate,natrium aceticum,octan sodny czech |
| IUPAC Name | sodium acetate |
| InChI Key | VMHLLURERBWHNL-UHFFFAOYSA-M |
| Molecular Formula | C2H3NaO2 |
Sodium fluoride, 200mM aq. soln., Thermo Scientific Chemicals
CAS: 7681-49-4 Molecular Formula: FNa Molecular Weight (g/mol): 41.99 MDL Number: MFCD00003524 InChI Key: PUZPDOWCWNUUKD-UHFFFAOYSA-M Synonym: sodium fluoride,florocid,fluoride, sodium,zymafluor,ossin,sodium fluoride naf,sodium fluoride,antibulit,floridine,fluonatril PubChem CID: 5235 ChEBI: CHEBI:28741 IUPAC Name: sodium fluoride SMILES: [F-].[Na+]
| PubChem CID | 5235 |
|---|---|
| CAS | 7681-49-4 |
| Molecular Weight (g/mol) | 41.99 |
| ChEBI | CHEBI:28741 |
| MDL Number | MFCD00003524 |
| SMILES | [F-].[Na+] |
| Synonym | sodium fluoride,florocid,fluoride, sodium,zymafluor,ossin,sodium fluoride naf,sodium fluoride,antibulit,floridine,fluonatril |
| IUPAC Name | sodium fluoride |
| InChI Key | PUZPDOWCWNUUKD-UHFFFAOYSA-M |
| Molecular Formula | FNa |
Potassium chloride, 1M aq. soln., RNAse free
CAS: 7447-40-7 Molecular Formula: ClK Molecular Weight (g/mol): 74.55 MDL Number: MFCD00011360 InChI Key: WCUXLLCKKVVCTQ-UHFFFAOYSA-M Synonym: potassium chloride,enseal,muriate of potash,klotrix,sylvite,slow-k,potassium chloride kcl,klor-con,chlorvescent,kalitabs PubChem CID: 4873 ChEBI: CHEBI:32588 SMILES: [Cl-].[K+]
| PubChem CID | 4873 |
|---|---|
| CAS | 7447-40-7 |
| Molecular Weight (g/mol) | 74.55 |
| ChEBI | CHEBI:32588 |
| MDL Number | MFCD00011360 |
| SMILES | [Cl-].[K+] |
| Synonym | potassium chloride,enseal,muriate of potash,klotrix,sylvite,slow-k,potassium chloride kcl,klor-con,chlorvescent,kalitabs |
| InChI Key | WCUXLLCKKVVCTQ-UHFFFAOYSA-M |
| Molecular Formula | ClK |
Potassium acetate, 1M aq. soln., pH 7.5, RNAse free, Thermo Scientific Chemicals
CAS: 127-08-2 Molecular Formula: C2H3KO2 Molecular Weight (g/mol): 98.142 MDL Number: MFCD00012458 InChI Key: SCVFZCLFOSHCOH-UHFFFAOYSA-M Synonym: potassium acetate,acetic acid, potassium salt,diuretic salt,potassium ethanoate,koac,octan draselny czech,potassiumacetate,acetic acid potassium salt,acok,fema no. 2920 PubChem CID: 517044 ChEBI: CHEBI:32029 IUPAC Name: potassium;acetate SMILES: CC(=O)[O-].[K+]
| PubChem CID | 517044 |
|---|---|
| CAS | 127-08-2 |
| Molecular Weight (g/mol) | 98.142 |
| ChEBI | CHEBI:32029 |
| MDL Number | MFCD00012458 |
| SMILES | CC(=O)[O-].[K+] |
| Synonym | potassium acetate,acetic acid, potassium salt,diuretic salt,potassium ethanoate,koac,octan draselny czech,potassiumacetate,acetic acid potassium salt,acok,fema no. 2920 |
| IUPAC Name | potassium;acetate |
| InChI Key | SCVFZCLFOSHCOH-UHFFFAOYSA-M |
| Molecular Formula | C2H3KO2 |
Methyltrimethoxysilane, 97%
CAS: 1185-55-3 Molecular Formula: C4H12O3Si Molecular Weight (g/mol): 136.222 MDL Number: MFCD00008342 InChI Key: BFXIKLCIZHOAAZ-UHFFFAOYSA-N Synonym: methyltrimethoxysilane,trimethoxy methyl silane,silane, trimethoxymethyl,union carbide a-163,silane, methyltrimethoxy,methyl trimethoxysilane,silane a-163,dynasylan mtms,unii-0hi0d71mci,methyl-trimethoxysilane PubChem CID: 14456 IUPAC Name: trimethoxy(methyl)silane SMILES: CO[Si](C)(OC)OC
| PubChem CID | 14456 |
|---|---|
| CAS | 1185-55-3 |
| Molecular Weight (g/mol) | 136.222 |
| MDL Number | MFCD00008342 |
| SMILES | CO[Si](C)(OC)OC |
| Synonym | methyltrimethoxysilane,trimethoxy methyl silane,silane, trimethoxymethyl,union carbide a-163,silane, methyltrimethoxy,methyl trimethoxysilane,silane a-163,dynasylan mtms,unii-0hi0d71mci,methyl-trimethoxysilane |
| IUPAC Name | trimethoxy(methyl)silane |
| InChI Key | BFXIKLCIZHOAAZ-UHFFFAOYSA-N |
| Molecular Formula | C4H12O3Si |
Sodium acetate, 3M aq. soln., pH 7.0, RNAse free, Thermo Scientific Chemicals
CAS: 127-09-3 Molecular Formula: C2H3NaO2 Molecular Weight (g/mol): 82.03 MDL Number: MFCD00012459 InChI Key: VMHLLURERBWHNL-UHFFFAOYSA-M Synonym: sodium acetate,acetic acid, sodium salt,sodium acetate anhydrous,sodium acetate, anhydrous,acetic acid sodium salt,anhydrous sodium acetate,sodii acetas,sodium ethanoate,natrium aceticum,octan sodny czech PubChem CID: 517045 ChEBI: CHEBI:32954 SMILES: [Na+].CC([O-])=O
| PubChem CID | 517045 |
|---|---|
| CAS | 127-09-3 |
| Molecular Weight (g/mol) | 82.03 |
| ChEBI | CHEBI:32954 |
| MDL Number | MFCD00012459 |
| SMILES | [Na+].CC([O-])=O |
| Synonym | sodium acetate,acetic acid, sodium salt,sodium acetate anhydrous,sodium acetate, anhydrous,acetic acid sodium salt,anhydrous sodium acetate,sodii acetas,sodium ethanoate,natrium aceticum,octan sodny czech |
| InChI Key | VMHLLURERBWHNL-UHFFFAOYSA-M |
| Molecular Formula | C2H3NaO2 |
Ytterbium(III) chloride, 35% min w/w aq. soln., 99.9% (REO)
CAS: 10361-91-8 Molecular Formula: YbCl3 MDL Number: MFCD00011288
| CAS | 10361-91-8 |
|---|---|
| MDL Number | MFCD00011288 |
| Molecular Formula | YbCl3 |
Borane-d{3}, 1M in tetrahydrofuran
CAS: 13763-62-7 Molecular Formula: BD3 Molecular Weight (g/mol): 16.85 MDL Number: MFCD00064892 InChI Key: UORVGPXVDQYIDP-FIBGUPNXSA-N Synonym: borane-d3,borane-d3, 1m in tetrahydrofuran,borane-d3, 1m in tetrahydrofuran, packaged under argon in resealable chemseal bottles PubChem CID: 11062299 SMILES: [2H]B([2H])[2H]
| PubChem CID | 11062299 |
|---|---|
| CAS | 13763-62-7 |
| Molecular Weight (g/mol) | 16.85 |
| MDL Number | MFCD00064892 |
| SMILES | [2H]B([2H])[2H] |
| Synonym | borane-d3,borane-d3, 1m in tetrahydrofuran,borane-d3, 1m in tetrahydrofuran, packaged under argon in resealable chemseal bottles |
| InChI Key | UORVGPXVDQYIDP-FIBGUPNXSA-N |
| Molecular Formula | BD3 |
(3-Mercaptopropyl)methyldimethoxysilane, 95%
CAS: 31001-77-1 Molecular Formula: C6H16O2SSi Molecular Weight (g/mol): 180.337 MDL Number: MFCD00053923 InChI Key: IKYAJDOSWUATPI-UHFFFAOYSA-N Synonym: 3-mercaptopropylmethyldimethoxysilane,3-mercaptopropylmethyldimethoxy silane,3-dimethoxymethylsilyl-1-propanethiol,3-mercaptopropyl methyldimethoxysilane,dimethoxy-3-mercaptopropyl methylsilane,3-dimethoxy methyl silyl propane-1-thiol,acmc-1aiak,ksc496q0j,3-methyldimethoxysilyl propylmercaptan PubChem CID: 2759524 IUPAC Name: 3-[dimethoxy(methyl)silyl]propane-1-thiol SMILES: CO[Si](C)(CCCS)OC
| PubChem CID | 2759524 |
|---|---|
| CAS | 31001-77-1 |
| Molecular Weight (g/mol) | 180.337 |
| MDL Number | MFCD00053923 |
| SMILES | CO[Si](C)(CCCS)OC |
| Synonym | 3-mercaptopropylmethyldimethoxysilane,3-mercaptopropylmethyldimethoxy silane,3-dimethoxymethylsilyl-1-propanethiol,3-mercaptopropyl methyldimethoxysilane,dimethoxy-3-mercaptopropyl methylsilane,3-dimethoxy methyl silyl propane-1-thiol,acmc-1aiak,ksc496q0j,3-methyldimethoxysilyl propylmercaptan |
| IUPAC Name | 3-[dimethoxy(methyl)silyl]propane-1-thiol |
| InChI Key | IKYAJDOSWUATPI-UHFFFAOYSA-N |
| Molecular Formula | C6H16O2SSi |
Bis(trimethylsiloxy)methylsilane, 97%
CAS: 1873-88-7 Molecular Formula: C7H21O2Si3 Molecular Weight (g/mol): 221.498 MDL Number: MFCD00048000 InChI Key: SWGZAKPJNWCPRY-UHFFFAOYSA-N Synonym: 1,1,1,3,5,5,5-heptamethyltrisiloxane,bis trimethylsiloxy methylsilane,unii-rvy9659r8c,trisiloxane, 1,1,1,3,5,5,5-heptamethyl,methyl-bis trimethylsilyloxy silicon,dsstox_cid_18795,methicone 20 cst,unii-6777u11mkt,methylpolysilicone,xiameter mhx-1107 fluid 20 cst PubChem CID: 6327366 IUPAC Name: methyl-bis(trimethylsilyloxy)silicon SMILES: C[Si](O[Si](C)(C)C)O[Si](C)(C)C
| PubChem CID | 6327366 |
|---|---|
| CAS | 1873-88-7 |
| Molecular Weight (g/mol) | 221.498 |
| MDL Number | MFCD00048000 |
| SMILES | C[Si](O[Si](C)(C)C)O[Si](C)(C)C |
| Synonym | 1,1,1,3,5,5,5-heptamethyltrisiloxane,bis trimethylsiloxy methylsilane,unii-rvy9659r8c,trisiloxane, 1,1,1,3,5,5,5-heptamethyl,methyl-bis trimethylsilyloxy silicon,dsstox_cid_18795,methicone 20 cst,unii-6777u11mkt,methylpolysilicone,xiameter mhx-1107 fluid 20 cst |
| IUPAC Name | methyl-bis(trimethylsilyloxy)silicon |
| InChI Key | SWGZAKPJNWCPRY-UHFFFAOYSA-N |
| Molecular Formula | C7H21O2Si3 |
| Name Note | Semi-bright finish |
|---|---|
| Form | Liquid |
| Health Hazard 3 | P201-P202-P260-P264b-P270-P271-P272-P280-P281-P285-P301+P312-P302+P352-P304+P340-P305+P351+P338-P308+P313-P330-P333+P313-P342+P311-P362-P501c |
| MDL Number | MFCD00011137 |
| Health Hazard 2 | GHS H Statement H334-H350-H360-H372-H341-H302-H315-H317 May cause allergy or asthma symptoms or breathing difficulties if inhaled. May cause cancer. May damage fertility or the unborn child. Causes damage to organs through prolonged or repeated exposure. Suspected of causing genetic defects. Harmful if swallowed. Causes skin irritation. May cause an allergic skin reaction. |
| Color | Green |
| Health Hazard 1 | H302+H332-H315-H317-H319-H334-H341-H350i-H360FD-H372 |
| UN Number | UN3287 |
| DOT Information | Transport Hazard Class: 6.1; Packing Group: III; Proper Shipping Name: TOXIC LIQUID, INORGANIC, N.O.S. |
| Chemical Name or Material | Nickel plating solution |
| TSCA | Yes |
| Recommended Storage | Ambient temperatures |