Salts and Inorganics
A variety of inorganic salts and elemental metals that can be used for large-scale, industrial purposes and everyday laboratory applications. Products are available in a range of chemical compositions, quantities, purities, and reagent grades.
Inorganics are elements and compounds, including carbon monoxide, carbon dioxide, carbonates, cyanides, cyanates, and carbides, that do not contain a carbon-hydrogen bond. This group also includes carbon allotropes such as graphite and graphene.
Because organic chemicals include only those that contain carbon atoms bonded to hydrogen atoms, the majority of elements in the periodic table and most substances in the material world are considered to be inorganic chemicals.
Filtered Search Results
Sand, washed
CAS: 14808-60-7 Molecular Formula: O2Si Molecular Weight (g/mol): 60.08 MDL Number: MFCD00011232,MFCD00217788,MFCD00163736,MFCD07370733 InChI Key: VYPSYNLAJGMNEJ-UHFFFAOYSA-N Synonym: silica,silicon dioxide,quartz,cristobalite,diatomaceous earth,tridymite,silicic anhydride,aerosil,infusorial earth,silica, amorphous PubChem CID: 24261 ChEBI: CHEBI:30563 IUPAC Name: dioxosilane SMILES: O=[Si]=O
| PubChem CID | 24261 |
|---|---|
| CAS | 14808-60-7 |
| Molecular Weight (g/mol) | 60.08 |
| ChEBI | CHEBI:30563 |
| MDL Number | MFCD00011232,MFCD00217788,MFCD00163736,MFCD07370733 |
| SMILES | O=[Si]=O |
| Synonym | silica,silicon dioxide,quartz,cristobalite,diatomaceous earth,tridymite,silicic anhydride,aerosil,infusorial earth,silica, amorphous |
| IUPAC Name | dioxosilane |
| InChI Key | VYPSYNLAJGMNEJ-UHFFFAOYSA-N |
| Molecular Formula | O2Si |
Gallium metal, packaged in polyethylene bottle, 99.9% (metals basis)
CAS: 7440-55-3 Molecular Formula: Ga Molecular Weight (g/mol): 69.72 MDL Number: MFCD00134045 InChI Key: GYHNNYVSQQEPJS-UHFFFAOYSA-N Synonym: gallium, elemental,metal,unii-ch46oc8yv4,ch46oc8yv4,ingot,pellets, 6mm dia,galio,metal, packaged in poylethylene bottle,gallium, ion ga1+,atom PubChem CID: 5360835 ChEBI: CHEBI:49631 IUPAC Name: gallium SMILES: [Ga]
| PubChem CID | 5360835 |
|---|---|
| CAS | 7440-55-3 |
| Molecular Weight (g/mol) | 69.72 |
| ChEBI | CHEBI:49631 |
| MDL Number | MFCD00134045 |
| SMILES | [Ga] |
| Synonym | gallium, elemental,metal,unii-ch46oc8yv4,ch46oc8yv4,ingot,pellets, 6mm dia,galio,metal, packaged in poylethylene bottle,gallium, ion ga1+,atom |
| IUPAC Name | gallium |
| InChI Key | GYHNNYVSQQEPJS-UHFFFAOYSA-N |
| Molecular Formula | Ga |
Gallium metal, packaged in poylethylene bottle, 99.999% (metals basis)
CAS: 7440-55-3 Molecular Formula: Ga Molecular Weight (g/mol): 69.72 MDL Number: MFCD00134045 InChI Key: GYHNNYVSQQEPJS-UHFFFAOYSA-N Synonym: gallium, elemental,metal,unii-ch46oc8yv4,ch46oc8yv4,ingot,pellets, 6mm dia,galio,metal, packaged in poylethylene bottle,gallium, ion ga1+,atom PubChem CID: 5360835 ChEBI: CHEBI:49631 IUPAC Name: gallium SMILES: [Ga]
| PubChem CID | 5360835 |
|---|---|
| CAS | 7440-55-3 |
| Molecular Weight (g/mol) | 69.72 |
| ChEBI | CHEBI:49631 |
| MDL Number | MFCD00134045 |
| SMILES | [Ga] |
| Synonym | gallium, elemental,metal,unii-ch46oc8yv4,ch46oc8yv4,ingot,pellets, 6mm dia,galio,metal, packaged in poylethylene bottle,gallium, ion ga1+,atom |
| IUPAC Name | gallium |
| InChI Key | GYHNNYVSQQEPJS-UHFFFAOYSA-N |
| Molecular Formula | Ga |
(3-Chloropropyl)trimethoxysilane, 97+%, packaged under Argon in resealable ChemSeal™ bottles
CAS: 2530-87-2 Molecular Formula: C6H15ClO3Si Molecular Weight (g/mol): 198.718 MDL Number: MFCD00000997 InChI Key: OXYZDRAJMHGSMW-UHFFFAOYSA-N Synonym: 3-chloropropyl trimethoxysilane,silane, 3-chloropropyl trimethoxy,3-chloropropyltrimethyoxysilane,sila-ace s 620,cps-m,silane 3-chloropropyl tris methoxy,3-trimethoxysilyl propyl chloride,unii-t21bnl1s7f,cptmo,3-chloropropyl trimethoxysilan PubChem CID: 62449 IUPAC Name: 3-chloropropyl(trimethoxy)silane SMILES: CO[Si](CCCCl)(OC)OC
| PubChem CID | 62449 |
|---|---|
| CAS | 2530-87-2 |
| Molecular Weight (g/mol) | 198.718 |
| MDL Number | MFCD00000997 |
| SMILES | CO[Si](CCCCl)(OC)OC |
| Synonym | 3-chloropropyl trimethoxysilane,silane, 3-chloropropyl trimethoxy,3-chloropropyltrimethyoxysilane,sila-ace s 620,cps-m,silane 3-chloropropyl tris methoxy,3-trimethoxysilyl propyl chloride,unii-t21bnl1s7f,cptmo,3-chloropropyl trimethoxysilan |
| IUPAC Name | 3-chloropropyl(trimethoxy)silane |
| InChI Key | OXYZDRAJMHGSMW-UHFFFAOYSA-N |
| Molecular Formula | C6H15ClO3Si |
Boron trifluoride diethyl etherate, 46.5% BF{3} min, packaged under Argon in resealable ChemSeal™ bottles
CAS: 109-63-7 Molecular Formula: C4H10BF3O Molecular Weight (g/mol): 141.93 MDL Number: MFCD00013194 InChI Key: KZMGYPLQYOPHEL-UHFFFAOYSA-N PubChem CID: 8000 SMILES: FB(F)F.CCOCC
| PubChem CID | 8000 |
|---|---|
| CAS | 109-63-7 |
| Molecular Weight (g/mol) | 141.93 |
| MDL Number | MFCD00013194 |
| SMILES | FB(F)F.CCOCC |
| InChI Key | KZMGYPLQYOPHEL-UHFFFAOYSA-N |
| Molecular Formula | C4H10BF3O |
Zinc chloride, 1M in diethyl ether, packaged under Argon in resealable ChemSeal™ bottles, Thermo Scientific Chemicals
CAS: 7646-85-7 Molecular Formula: Cl2Zn Molecular Weight (g/mol): 136.28 MDL Number: MFCD00011295 InChI Key: JIAARYAFYJHUJI-UHFFFAOYSA-L Synonym: zinc chloride,zinc dichloride,zinc chloride zncl2,zinc butter,zinc chloride fume,zinc ii chloride,zinkchloride,zintrace,zinc chloride, anhydrous,zine dichloride PubChem CID: 5727 ChEBI: CHEBI:49976 IUPAC Name: dichlorozinc SMILES: Cl[Zn]Cl
| PubChem CID | 5727 |
|---|---|
| CAS | 7646-85-7 |
| Molecular Weight (g/mol) | 136.28 |
| ChEBI | CHEBI:49976 |
| MDL Number | MFCD00011295 |
| SMILES | Cl[Zn]Cl |
| Synonym | zinc chloride,zinc dichloride,zinc chloride zncl2,zinc butter,zinc chloride fume,zinc ii chloride,zinkchloride,zintrace,zinc chloride, anhydrous,zine dichloride |
| IUPAC Name | dichlorozinc |
| InChI Key | JIAARYAFYJHUJI-UHFFFAOYSA-L |
| Molecular Formula | Cl2Zn |
Lithium bis(trimethylsilyl)amide, 20% (ca 1.06M) soln. in THF/ethylbenzene, packaged in resealable septum cap bottle
CAS: 4039-32-1 Molecular Formula: C6H18LiNSi2 Molecular Weight (g/mol): 167.327 MDL Number: MFCD00008261 InChI Key: YNESATAKKCNGOF-UHFFFAOYSA-N Synonym: lithium bis trimethylsilyl amide,lithium hexamethyldisilazide,lihmds,lhmds,hexamethyldisilazane lithium salt,unii-rc4n1i108m,lithiumbis trimethylsilyl amide,lithium bis trimethylsilyl azanide,lithium hexamethyldisilazane,lithium bis-trimethylsilyl amide PubChem CID: 2733832 IUPAC Name: lithium;bis(trimethylsilyl)azanide SMILES: [Li+].C[Si](C)(C)[N-][Si](C)(C)C
| PubChem CID | 2733832 |
|---|---|
| CAS | 4039-32-1 |
| Molecular Weight (g/mol) | 167.327 |
| MDL Number | MFCD00008261 |
| SMILES | [Li+].C[Si](C)(C)[N-][Si](C)(C)C |
| Synonym | lithium bis trimethylsilyl amide,lithium hexamethyldisilazide,lihmds,lhmds,hexamethyldisilazane lithium salt,unii-rc4n1i108m,lithiumbis trimethylsilyl amide,lithium bis trimethylsilyl azanide,lithium hexamethyldisilazane,lithium bis-trimethylsilyl amide |
| IUPAC Name | lithium;bis(trimethylsilyl)azanide |
| InChI Key | YNESATAKKCNGOF-UHFFFAOYSA-N |
| Molecular Formula | C6H18LiNSi2 |
Boron trifluoride-dimethyl sulfide complex, purified, packaged under Argon in resealable ChemSeal™ bottles, Thermo Scientific Chemicals
CAS: 353-43-5 Molecular Formula: C2H6BF3S Molecular Weight (g/mol): 129.94 MDL Number: MFCD00013193 InChI Key: BRWZPVRDOUWXKE-UHFFFAOYSA-N Synonym: boron fluoride-dimethyl sulfide complex,dimethyl-??-sulfanylidene trifluoro-??-borane,trifluoroborane-methyl sulfide,dimethyl sulfide-trifluoroborane,trifluoro methylsulfanyl methane boron,boron trifluoride methyl sulfide complex,boron trifluoride-methyl sulfide complex,boron trifluoride-dimethyl sulfide complex, purified, packaged under argon in resealable chemseal bottles PubChem CID: 71311438 IUPAC Name: dimethylsulfonio(trifluoro)boranuide SMILES: CSC.FB(F)F
| PubChem CID | 71311438 |
|---|---|
| CAS | 353-43-5 |
| Molecular Weight (g/mol) | 129.94 |
| MDL Number | MFCD00013193 |
| SMILES | CSC.FB(F)F |
| Synonym | boron fluoride-dimethyl sulfide complex,dimethyl-??-sulfanylidene trifluoro-??-borane,trifluoroborane-methyl sulfide,dimethyl sulfide-trifluoroborane,trifluoro methylsulfanyl methane boron,boron trifluoride methyl sulfide complex,boron trifluoride-methyl sulfide complex,boron trifluoride-dimethyl sulfide complex, purified, packaged under argon in resealable chemseal bottles |
| IUPAC Name | dimethylsulfonio(trifluoro)boranuide |
| InChI Key | BRWZPVRDOUWXKE-UHFFFAOYSA-N |
| Molecular Formula | C2H6BF3S |
Sea Sand, Acid Washed and Calcinated For Laboratory Use and DAB, Chem Lab
CAS: 14808-60-7 Molecular Formula: O2Si Molecular Weight (g/mol): 60.08 MDL Number: MFCD00011232,MFCD00217788,MFCD00163736,MFCD07370733 InChI Key: VYPSYNLAJGMNEJ-UHFFFAOYSA-N IUPAC Name: silanedione SMILES: O=[Si]=O
| CAS | 14808-60-7 |
|---|---|
| Molecular Weight (g/mol) | 60.08 |
| MDL Number | MFCD00011232,MFCD00217788,MFCD00163736,MFCD07370733 |
| SMILES | O=[Si]=O |
| IUPAC Name | silanedione |
| InChI Key | VYPSYNLAJGMNEJ-UHFFFAOYSA-N |
| Molecular Formula | O2Si |
Sodium carbonate, 99.5%, extra pure, anhydrous
CAS: 497-19-8 Molecular Formula: CNa2O3 Molecular Weight (g/mol): 105.99 MDL Number: MFCD00003494 InChI Key: CDBYLPFSWZWCQE-UHFFFAOYSA-L Synonym: sodium carbonate,disodium carbonate,soda ash,carbonic acid disodium salt,calcined soda,sodium carbonate, anhydrous,carbonic acid, disodium salt,washing soda,sodiumcarbonate,solvay soda PubChem CID: 10340 ChEBI: CHEBI:29377 SMILES: [Na+].[Na+].[O-]C([O-])=O
| PubChem CID | 10340 |
|---|---|
| CAS | 497-19-8 |
| Molecular Weight (g/mol) | 105.99 |
| ChEBI | CHEBI:29377 |
| MDL Number | MFCD00003494 |
| SMILES | [Na+].[Na+].[O-]C([O-])=O |
| Synonym | sodium carbonate,disodium carbonate,soda ash,carbonic acid disodium salt,calcined soda,sodium carbonate, anhydrous,carbonic acid, disodium salt,washing soda,sodiumcarbonate,solvay soda |
| InChI Key | CDBYLPFSWZWCQE-UHFFFAOYSA-L |
| Molecular Formula | CNa2O3 |
Aluminum chloride hexahydrate, 99%, pure
CAS: 7784-13-6 Molecular Formula: AlCl3H12O6 Molecular Weight (g/mol): 241.42 MDL Number: MFCD00149134 InChI Key: JGDITNMASUZKPW-UHFFFAOYSA-K SMILES: O.O.O.O.O.O.[Al+3].[Cl-].[Cl-].[Cl-]
| CAS | 7784-13-6 |
|---|---|
| Molecular Weight (g/mol) | 241.42 |
| MDL Number | MFCD00149134 |
| SMILES | O.O.O.O.O.O.[Al+3].[Cl-].[Cl-].[Cl-] |
| InChI Key | JGDITNMASUZKPW-UHFFFAOYSA-K |
| Molecular Formula | AlCl3H12O6 |
Iron(II) sulfate heptahydrate, 99.5%, for analysis
CAS: 7782-63-0 Molecular Formula: FeH14O11S Molecular Weight (g/mol): 278.01 MDL Number: MFCD00149719 InChI Key: SURQXAFEQWPFPV-UHFFFAOYSA-L Synonym: iron ii sulfate heptahydrate,ferrous sulfate heptahydrate,presfersul,melanterite mineral,iron sulfate heptahydrate,iron 2+ sulfate heptahydrate,fesofor,fesotyme,haemofort,ironate PubChem CID: 62662 ChEBI: CHEBI:75836 SMILES: O.O.O.O.O.O.O.[Fe++].[O-]S([O-])(=O)=O
| PubChem CID | 62662 |
|---|---|
| CAS | 7782-63-0 |
| Molecular Weight (g/mol) | 278.01 |
| ChEBI | CHEBI:75836 |
| MDL Number | MFCD00149719 |
| SMILES | O.O.O.O.O.O.O.[Fe++].[O-]S([O-])(=O)=O |
| Synonym | iron ii sulfate heptahydrate,ferrous sulfate heptahydrate,presfersul,melanterite mineral,iron sulfate heptahydrate,iron 2+ sulfate heptahydrate,fesofor,fesotyme,haemofort,ironate |
| InChI Key | SURQXAFEQWPFPV-UHFFFAOYSA-L |
| Molecular Formula | FeH14O11S |
Sodium bisulfite, ACS reagent, powder
CAS: 7631-90-5 Molecular Formula: NaO3S Molecular Weight (g/mol): 103.05 MDL Number: MFCD00003530 InChI Key: DWAQJAXMDSEUJJ-UHFFFAOYSA-L Synonym: sodium bisulfite,sodium hydrogen sulfite,sodium bisulphite,sodium hydrogensulfite,sodium sulfhydrate,monosodium sulfite,uantax sbs,sulfurous acid, monosodium salt,caswell no. 750,hydrogen sodium sulfite PubChem CID: 23665763 ChEBI: CHEBI:26709 IUPAC Name: sodium sulfite SMILES: [Na+].[O-]S([O-])=O
| PubChem CID | 23665763 |
|---|---|
| CAS | 7631-90-5 |
| Molecular Weight (g/mol) | 103.05 |
| ChEBI | CHEBI:26709 |
| MDL Number | MFCD00003530 |
| SMILES | [Na+].[O-]S([O-])=O |
| Synonym | sodium bisulfite,sodium hydrogen sulfite,sodium bisulphite,sodium hydrogensulfite,sodium sulfhydrate,monosodium sulfite,uantax sbs,sulfurous acid, monosodium salt,caswell no. 750,hydrogen sodium sulfite |
| IUPAC Name | sodium sulfite |
| InChI Key | DWAQJAXMDSEUJJ-UHFFFAOYSA-L |
| Molecular Formula | NaO3S |
Calcium carbonate, 99+%, ACS reagent
CAS: 471-34-1 Molecular Formula: CCaO3 Molecular Weight (g/mol): 100.09 MDL Number: MFCD00010906 InChI Key: VTYYLEPIZMXCLO-UHFFFAOYSA-L Synonym: calcium carbonate,limestone,chalk,calcite,carbonic acid calcium salt 1:1,marble,calofort u,aragonite,aeromatt,akadama PubChem CID: 10112 ChEBI: CHEBI:3311 SMILES: [Ca++].[O-]C([O-])=O
| PubChem CID | 10112 |
|---|---|
| CAS | 471-34-1 |
| Molecular Weight (g/mol) | 100.09 |
| ChEBI | CHEBI:3311 |
| MDL Number | MFCD00010906 |
| SMILES | [Ca++].[O-]C([O-])=O |
| Synonym | calcium carbonate,limestone,chalk,calcite,carbonic acid calcium salt 1:1,marble,calofort u,aragonite,aeromatt,akadama |
| InChI Key | VTYYLEPIZMXCLO-UHFFFAOYSA-L |
| Molecular Formula | CCaO3 |