Salts and Inorganics
A variety of inorganic salts and elemental metals that can be used for large-scale, industrial purposes and everyday laboratory applications. Products are available in a range of chemical compositions, quantities, purities, and reagent grades.
Inorganics are elements and compounds, including carbon monoxide, carbon dioxide, carbonates, cyanides, cyanates, and carbides, that do not contain a carbon-hydrogen bond. This group also includes carbon allotropes such as graphite and graphene.
Because organic chemicals include only those that contain carbon atoms bonded to hydrogen atoms, the majority of elements in the periodic table and most substances in the material world are considered to be inorganic chemicals.
Filtered Search Results
Sand, washed
CAS: 14808-60-7 Molecular Formula: O2Si Molecular Weight (g/mol): 60.08 MDL Number: MFCD00011232,MFCD00217788,MFCD00163736,MFCD07370733 InChI Key: VYPSYNLAJGMNEJ-UHFFFAOYSA-N Synonym: silica,silicon dioxide,quartz,cristobalite,diatomaceous earth,tridymite,silicic anhydride,aerosil,infusorial earth,silica, amorphous PubChem CID: 24261 ChEBI: CHEBI:30563 IUPAC Name: dioxosilane SMILES: O=[Si]=O
| PubChem CID | 24261 |
|---|---|
| CAS | 14808-60-7 |
| Molecular Weight (g/mol) | 60.08 |
| ChEBI | CHEBI:30563 |
| MDL Number | MFCD00011232,MFCD00217788,MFCD00163736,MFCD07370733 |
| SMILES | O=[Si]=O |
| Synonym | silica,silicon dioxide,quartz,cristobalite,diatomaceous earth,tridymite,silicic anhydride,aerosil,infusorial earth,silica, amorphous |
| IUPAC Name | dioxosilane |
| InChI Key | VYPSYNLAJGMNEJ-UHFFFAOYSA-N |
| Molecular Formula | O2Si |
Gallium metal, packaged in polyethylene bottle, 99.9% (metals basis)
CAS: 7440-55-3 Molecular Formula: Ga Molecular Weight (g/mol): 69.72 MDL Number: MFCD00134045 InChI Key: GYHNNYVSQQEPJS-UHFFFAOYSA-N Synonym: gallium, elemental,metal,unii-ch46oc8yv4,ch46oc8yv4,ingot,pellets, 6mm dia,galio,metal, packaged in poylethylene bottle,gallium, ion ga1+,atom PubChem CID: 5360835 ChEBI: CHEBI:49631 IUPAC Name: gallium SMILES: [Ga]
| PubChem CID | 5360835 |
|---|---|
| CAS | 7440-55-3 |
| Molecular Weight (g/mol) | 69.72 |
| ChEBI | CHEBI:49631 |
| MDL Number | MFCD00134045 |
| SMILES | [Ga] |
| Synonym | gallium, elemental,metal,unii-ch46oc8yv4,ch46oc8yv4,ingot,pellets, 6mm dia,galio,metal, packaged in poylethylene bottle,gallium, ion ga1+,atom |
| IUPAC Name | gallium |
| InChI Key | GYHNNYVSQQEPJS-UHFFFAOYSA-N |
| Molecular Formula | Ga |
Gallium metal, packaged in poylethylene bottle, 99.999% (metals basis)
CAS: 7440-55-3 Molecular Formula: Ga Molecular Weight (g/mol): 69.72 MDL Number: MFCD00134045 InChI Key: GYHNNYVSQQEPJS-UHFFFAOYSA-N Synonym: gallium, elemental,metal,unii-ch46oc8yv4,ch46oc8yv4,ingot,pellets, 6mm dia,galio,metal, packaged in poylethylene bottle,gallium, ion ga1+,atom PubChem CID: 5360835 ChEBI: CHEBI:49631 IUPAC Name: gallium SMILES: [Ga]
| PubChem CID | 5360835 |
|---|---|
| CAS | 7440-55-3 |
| Molecular Weight (g/mol) | 69.72 |
| ChEBI | CHEBI:49631 |
| MDL Number | MFCD00134045 |
| SMILES | [Ga] |
| Synonym | gallium, elemental,metal,unii-ch46oc8yv4,ch46oc8yv4,ingot,pellets, 6mm dia,galio,metal, packaged in poylethylene bottle,gallium, ion ga1+,atom |
| IUPAC Name | gallium |
| InChI Key | GYHNNYVSQQEPJS-UHFFFAOYSA-N |
| Molecular Formula | Ga |
(3-Chloropropyl)trimethoxysilane, 97+%, packaged under Argon in resealable ChemSeal™ bottles
CAS: 2530-87-2 Molecular Formula: C6H15ClO3Si Molecular Weight (g/mol): 198.718 MDL Number: MFCD00000997 InChI Key: OXYZDRAJMHGSMW-UHFFFAOYSA-N Synonym: 3-chloropropyl trimethoxysilane,silane, 3-chloropropyl trimethoxy,3-chloropropyltrimethyoxysilane,sila-ace s 620,cps-m,silane 3-chloropropyl tris methoxy,3-trimethoxysilyl propyl chloride,unii-t21bnl1s7f,cptmo,3-chloropropyl trimethoxysilan PubChem CID: 62449 IUPAC Name: 3-chloropropyl(trimethoxy)silane SMILES: CO[Si](CCCCl)(OC)OC
| PubChem CID | 62449 |
|---|---|
| CAS | 2530-87-2 |
| Molecular Weight (g/mol) | 198.718 |
| MDL Number | MFCD00000997 |
| SMILES | CO[Si](CCCCl)(OC)OC |
| Synonym | 3-chloropropyl trimethoxysilane,silane, 3-chloropropyl trimethoxy,3-chloropropyltrimethyoxysilane,sila-ace s 620,cps-m,silane 3-chloropropyl tris methoxy,3-trimethoxysilyl propyl chloride,unii-t21bnl1s7f,cptmo,3-chloropropyl trimethoxysilan |
| IUPAC Name | 3-chloropropyl(trimethoxy)silane |
| InChI Key | OXYZDRAJMHGSMW-UHFFFAOYSA-N |
| Molecular Formula | C6H15ClO3Si |
Boron trifluoride diethyl etherate, 46.5% BF{3} min, packaged under Argon in resealable ChemSeal™ bottles
CAS: 109-63-7 Molecular Formula: C4H10BF3O Molecular Weight (g/mol): 141.93 MDL Number: MFCD00013194 InChI Key: KZMGYPLQYOPHEL-UHFFFAOYSA-N PubChem CID: 8000 SMILES: FB(F)F.CCOCC
| PubChem CID | 8000 |
|---|---|
| CAS | 109-63-7 |
| Molecular Weight (g/mol) | 141.93 |
| MDL Number | MFCD00013194 |
| SMILES | FB(F)F.CCOCC |
| InChI Key | KZMGYPLQYOPHEL-UHFFFAOYSA-N |
| Molecular Formula | C4H10BF3O |
Zinc chloride, 1M in diethyl ether, packaged under Argon in resealable ChemSeal™ bottles, Thermo Scientific Chemicals
CAS: 7646-85-7 Molecular Formula: Cl2Zn Molecular Weight (g/mol): 136.28 MDL Number: MFCD00011295 InChI Key: JIAARYAFYJHUJI-UHFFFAOYSA-L Synonym: zinc chloride,zinc dichloride,zinc chloride zncl2,zinc butter,zinc chloride fume,zinc ii chloride,zinkchloride,zintrace,zinc chloride, anhydrous,zine dichloride PubChem CID: 5727 ChEBI: CHEBI:49976 IUPAC Name: dichlorozinc SMILES: Cl[Zn]Cl
| PubChem CID | 5727 |
|---|---|
| CAS | 7646-85-7 |
| Molecular Weight (g/mol) | 136.28 |
| ChEBI | CHEBI:49976 |
| MDL Number | MFCD00011295 |
| SMILES | Cl[Zn]Cl |
| Synonym | zinc chloride,zinc dichloride,zinc chloride zncl2,zinc butter,zinc chloride fume,zinc ii chloride,zinkchloride,zintrace,zinc chloride, anhydrous,zine dichloride |
| IUPAC Name | dichlorozinc |
| InChI Key | JIAARYAFYJHUJI-UHFFFAOYSA-L |
| Molecular Formula | Cl2Zn |
Lithium bis(trimethylsilyl)amide, 20% (ca 1.06M) soln. in THF/ethylbenzene, packaged in resealable septum cap bottle
CAS: 4039-32-1 Molecular Formula: C6H18LiNSi2 Molecular Weight (g/mol): 167.327 MDL Number: MFCD00008261 InChI Key: YNESATAKKCNGOF-UHFFFAOYSA-N Synonym: lithium bis trimethylsilyl amide,lithium hexamethyldisilazide,lihmds,lhmds,hexamethyldisilazane lithium salt,unii-rc4n1i108m,lithiumbis trimethylsilyl amide,lithium bis trimethylsilyl azanide,lithium hexamethyldisilazane,lithium bis-trimethylsilyl amide PubChem CID: 2733832 IUPAC Name: lithium;bis(trimethylsilyl)azanide SMILES: [Li+].C[Si](C)(C)[N-][Si](C)(C)C
| PubChem CID | 2733832 |
|---|---|
| CAS | 4039-32-1 |
| Molecular Weight (g/mol) | 167.327 |
| MDL Number | MFCD00008261 |
| SMILES | [Li+].C[Si](C)(C)[N-][Si](C)(C)C |
| Synonym | lithium bis trimethylsilyl amide,lithium hexamethyldisilazide,lihmds,lhmds,hexamethyldisilazane lithium salt,unii-rc4n1i108m,lithiumbis trimethylsilyl amide,lithium bis trimethylsilyl azanide,lithium hexamethyldisilazane,lithium bis-trimethylsilyl amide |
| IUPAC Name | lithium;bis(trimethylsilyl)azanide |
| InChI Key | YNESATAKKCNGOF-UHFFFAOYSA-N |
| Molecular Formula | C6H18LiNSi2 |
Boron trifluoride-dimethyl sulfide complex, purified, packaged under Argon in resealable ChemSeal™ bottles, Thermo Scientific Chemicals
CAS: 353-43-5 Molecular Formula: C2H6BF3S Molecular Weight (g/mol): 129.94 MDL Number: MFCD00013193 InChI Key: BRWZPVRDOUWXKE-UHFFFAOYSA-N Synonym: boron fluoride-dimethyl sulfide complex,dimethyl-??-sulfanylidene trifluoro-??-borane,trifluoroborane-methyl sulfide,dimethyl sulfide-trifluoroborane,trifluoro methylsulfanyl methane boron,boron trifluoride methyl sulfide complex,boron trifluoride-methyl sulfide complex,boron trifluoride-dimethyl sulfide complex, purified, packaged under argon in resealable chemseal bottles PubChem CID: 71311438 IUPAC Name: dimethylsulfonio(trifluoro)boranuide SMILES: CSC.FB(F)F
| PubChem CID | 71311438 |
|---|---|
| CAS | 353-43-5 |
| Molecular Weight (g/mol) | 129.94 |
| MDL Number | MFCD00013193 |
| SMILES | CSC.FB(F)F |
| Synonym | boron fluoride-dimethyl sulfide complex,dimethyl-??-sulfanylidene trifluoro-??-borane,trifluoroborane-methyl sulfide,dimethyl sulfide-trifluoroborane,trifluoro methylsulfanyl methane boron,boron trifluoride methyl sulfide complex,boron trifluoride-methyl sulfide complex,boron trifluoride-dimethyl sulfide complex, purified, packaged under argon in resealable chemseal bottles |
| IUPAC Name | dimethylsulfonio(trifluoro)boranuide |
| InChI Key | BRWZPVRDOUWXKE-UHFFFAOYSA-N |
| Molecular Formula | C2H6BF3S |
Sea Sand, Acid Washed and Calcinated For Laboratory Use and DAB, Chem Lab
CAS: 14808-60-7 Molecular Formula: O2Si Molecular Weight (g/mol): 60.08 MDL Number: MFCD00011232,MFCD00217788,MFCD00163736,MFCD07370733 InChI Key: VYPSYNLAJGMNEJ-UHFFFAOYSA-N IUPAC Name: silanedione SMILES: O=[Si]=O
| CAS | 14808-60-7 |
|---|---|
| Molecular Weight (g/mol) | 60.08 |
| MDL Number | MFCD00011232,MFCD00217788,MFCD00163736,MFCD07370733 |
| SMILES | O=[Si]=O |
| IUPAC Name | silanedione |
| InChI Key | VYPSYNLAJGMNEJ-UHFFFAOYSA-N |
| Molecular Formula | O2Si |
Ammonium bicarbonate, 99%, for analysis
CAS: 1066-33-7 Molecular Formula: CH5NO3 Molecular Weight (g/mol): 79.06 MDL Number: MFCD00012138 InChI Key: ATRRKUHOCOJYRX-UHFFFAOYSA-N Synonym: ammonium bicarbonate,ammonium hydrogencarbonate,ammonium hydrogen carbonate,carbonic acid, monoammonium salt,monoammonium carbonate,ammonium acid carbonate,ammonium hydrogencarbonat,ammoniumbicarbonate,acid ammonium carbonate,ccris 7327 PubChem CID: 14013 IUPAC Name: carbonic acid amine SMILES: N.OC(O)=O
| PubChem CID | 14013 |
|---|---|
| CAS | 1066-33-7 |
| Molecular Weight (g/mol) | 79.06 |
| MDL Number | MFCD00012138 |
| SMILES | N.OC(O)=O |
| Synonym | ammonium bicarbonate,ammonium hydrogencarbonate,ammonium hydrogen carbonate,carbonic acid, monoammonium salt,monoammonium carbonate,ammonium acid carbonate,ammonium hydrogencarbonat,ammoniumbicarbonate,acid ammonium carbonate,ccris 7327 |
| IUPAC Name | carbonic acid amine |
| InChI Key | ATRRKUHOCOJYRX-UHFFFAOYSA-N |
| Molecular Formula | CH5NO3 |
Manganese(II) acetate tetrahydrate, 99+%, for analysis
CAS: 6156-78-1 Molecular Formula: C4H14MnO8 Molecular Weight (g/mol): 245.09 MDL Number: MFCD00062552 InChI Key: CESXSDZNZGSWSP-UHFFFAOYSA-L Synonym: manganese ii acetate tetrahydrate,manganese acetate tetrahydrate,manganous acetate tetrahydrate,unii-9to51d176n,manganese diacetate, tetrahydrate,manganese 2+ diacetate tetrahydrate,acetic acid, manganese 2+ salt, tetrahydrate,manganese ii acetatetetrahydrate,acmc-20akkp PubChem CID: 93021 SMILES: O.O.O.O.[Mn++].CC([O-])=O.CC([O-])=O
| PubChem CID | 93021 |
|---|---|
| CAS | 6156-78-1 |
| Molecular Weight (g/mol) | 245.09 |
| MDL Number | MFCD00062552 |
| SMILES | O.O.O.O.[Mn++].CC([O-])=O.CC([O-])=O |
| Synonym | manganese ii acetate tetrahydrate,manganese acetate tetrahydrate,manganous acetate tetrahydrate,unii-9to51d176n,manganese diacetate, tetrahydrate,manganese 2+ diacetate tetrahydrate,acetic acid, manganese 2+ salt, tetrahydrate,manganese ii acetatetetrahydrate,acmc-20akkp |
| InChI Key | CESXSDZNZGSWSP-UHFFFAOYSA-L |
| Molecular Formula | C4H14MnO8 |
Sodium bisulfite, ACS reagent, powder
CAS: 7631-90-5 Molecular Formula: NaO3S Molecular Weight (g/mol): 103.05 MDL Number: MFCD00003530 InChI Key: DWAQJAXMDSEUJJ-UHFFFAOYSA-L Synonym: sodium bisulfite,sodium hydrogen sulfite,sodium bisulphite,sodium hydrogensulfite,sodium sulfhydrate,monosodium sulfite,uantax sbs,sulfurous acid, monosodium salt,caswell no. 750,hydrogen sodium sulfite PubChem CID: 23665763 ChEBI: CHEBI:26709 IUPAC Name: sodium sulfite SMILES: [Na+].[O-]S([O-])=O
| PubChem CID | 23665763 |
|---|---|
| CAS | 7631-90-5 |
| Molecular Weight (g/mol) | 103.05 |
| ChEBI | CHEBI:26709 |
| MDL Number | MFCD00003530 |
| SMILES | [Na+].[O-]S([O-])=O |
| Synonym | sodium bisulfite,sodium hydrogen sulfite,sodium bisulphite,sodium hydrogensulfite,sodium sulfhydrate,monosodium sulfite,uantax sbs,sulfurous acid, monosodium salt,caswell no. 750,hydrogen sodium sulfite |
| IUPAC Name | sodium sulfite |
| InChI Key | DWAQJAXMDSEUJJ-UHFFFAOYSA-L |
| Molecular Formula | NaO3S |
Potassium Phosphate Dibasic (Fine White Crystalline Powder), Fisher BioReagents™
CAS: 11-4-7758 Molecular Formula: HK2O4P Molecular Weight (g/mol): 174.17 InChI Key: ZPWVASYFFYYZEW-UHFFFAOYSA-L Synonym: dipotassium hydrogen phosphate,dipotassium phosphate,dipotassium hydrogenphosphate,dibasic potassium phosphate,potassium hydrogen phosphate,potassium phosphate, dibasic,potassium dibasic phosphate,potassium phosphate dibasic,phosphoric acid, dipotassium salt,dipotassium monophosphate PubChem CID: 24450 ChEBI: CHEBI:32031 IUPAC Name: dipotassium;hydrogen phosphate SMILES: OP(=O)([O-])[O-].[K+].[K+]
| PubChem CID | 24450 |
|---|---|
| CAS | 11-4-7758 |
| Molecular Weight (g/mol) | 174.17 |
| ChEBI | CHEBI:32031 |
| SMILES | OP(=O)([O-])[O-].[K+].[K+] |
| Synonym | dipotassium hydrogen phosphate,dipotassium phosphate,dipotassium hydrogenphosphate,dibasic potassium phosphate,potassium hydrogen phosphate,potassium phosphate, dibasic,potassium dibasic phosphate,potassium phosphate dibasic,phosphoric acid, dipotassium salt,dipotassium monophosphate |
| IUPAC Name | dipotassium;hydrogen phosphate |
| InChI Key | ZPWVASYFFYYZEW-UHFFFAOYSA-L |
| Molecular Formula | HK2O4P |
Sodium polyphosphate, pure
CAS: 50813-16-6 Molecular Formula: (NaO3P)n MDL Number: MFCD00134118 Synonym: hexasodium oxido oxido phosphonatooxy phosphoryl oxy phosphoryl oxy phospho phosphonato oxy phosphinate IUPAC Name: Sodium polyphosphate SMILES: [Na]OP(-*)(=O)O-*
| CAS | 50813-16-6 |
|---|---|
| MDL Number | MFCD00134118 |
| SMILES | [Na]OP(-*)(=O)O-* |
| Synonym | hexasodium oxido oxido phosphonatooxy phosphoryl oxy phosphoryl oxy phospho phosphonato oxy phosphinate |
| IUPAC Name | Sodium polyphosphate |
| Molecular Formula | (NaO3P)n |