Salts and Inorganics
A variety of inorganic salts and elemental metals that can be used for large-scale, industrial purposes and everyday laboratory applications. Products are available in a range of chemical compositions, quantities, purities, and reagent grades.
Inorganics are elements and compounds, including carbon monoxide, carbon dioxide, carbonates, cyanides, cyanates, and carbides, that do not contain a carbon-hydrogen bond. This group also includes carbon allotropes such as graphite and graphene.
Because organic chemicals include only those that contain carbon atoms bonded to hydrogen atoms, the majority of elements in the periodic table and most substances in the material world are considered to be inorganic chemicals.
Filtered Search Results
Calcium sulfate dihydrate, 98%, for biochemistry
CAS: 10101-41-4 Molecular Formula: CaH4O6S Molecular Weight (g/mol): 172.16 MDL Number: MFCD00149625 InChI Key: PASHVRUKOFIRIK-UHFFFAOYSA-L Synonym: calcium sulfate dihydrate,phosphogypsum,landplaster,annaline,compactrol,gips,gypsite,primoplast,satinite,gypsum stone PubChem CID: 24928 ChEBI: CHEBI:32583 IUPAC Name: calcium;sulfate;dihydrate SMILES: O.O.[Ca++].[O-]S([O-])(=O)=O
| PubChem CID | 24928 |
|---|---|
| CAS | 10101-41-4 |
| Molecular Weight (g/mol) | 172.16 |
| ChEBI | CHEBI:32583 |
| MDL Number | MFCD00149625 |
| SMILES | O.O.[Ca++].[O-]S([O-])(=O)=O |
| Synonym | calcium sulfate dihydrate,phosphogypsum,landplaster,annaline,compactrol,gips,gypsite,primoplast,satinite,gypsum stone |
| IUPAC Name | calcium;sulfate;dihydrate |
| InChI Key | PASHVRUKOFIRIK-UHFFFAOYSA-L |
| Molecular Formula | CaH4O6S |
Thermo Scientific Chemicals Sodium azide, 99+%, for biochemistry
CAS: 26628-22-8 Molecular Formula: N3Na Molecular Weight (g/mol): 65.01 InChI Key: PXIPVTKHYLBLMZ-UHFFFAOYSA-N Synonym: sodium azide,azide, sodium,natriumazid,nemazyd,smite,kazoe,azoture de sodium,sodium azide na n3,hydrazoic acid, sodium salt,natriumazid german PubChem CID: 33557 ChEBI: CHEBI:278547 IUPAC Name: sodium;azide SMILES: [N-]=[N+]=[N-].[Na+]
| PubChem CID | 33557 |
|---|---|
| CAS | 26628-22-8 |
| Molecular Weight (g/mol) | 65.01 |
| ChEBI | CHEBI:278547 |
| SMILES | [N-]=[N+]=[N-].[Na+] |
| Synonym | sodium azide,azide, sodium,natriumazid,nemazyd,smite,kazoe,azoture de sodium,sodium azide na n3,hydrazoic acid, sodium salt,natriumazid german |
| IUPAC Name | sodium;azide |
| InChI Key | PXIPVTKHYLBLMZ-UHFFFAOYSA-N |
| Molecular Formula | N3Na |
Calcium sulfate dihydrate, 98+%, for analysis
CAS: 10101-41-4 Molecular Formula: CaH4O6S Molecular Weight (g/mol): 172.16 MDL Number: MFCD00149625 InChI Key: PASHVRUKOFIRIK-UHFFFAOYSA-L Synonym: calcium sulfate dihydrate,phosphogypsum,landplaster,annaline,compactrol,gips,gypsite,primoplast,satinite,gypsum stone PubChem CID: 24928 ChEBI: CHEBI:32583 IUPAC Name: calcium;sulfate;dihydrate SMILES: O.O.[Ca++].[O-]S([O-])(=O)=O
| PubChem CID | 24928 |
|---|---|
| CAS | 10101-41-4 |
| Molecular Weight (g/mol) | 172.16 |
| ChEBI | CHEBI:32583 |
| MDL Number | MFCD00149625 |
| SMILES | O.O.[Ca++].[O-]S([O-])(=O)=O |
| Synonym | calcium sulfate dihydrate,phosphogypsum,landplaster,annaline,compactrol,gips,gypsite,primoplast,satinite,gypsum stone |
| IUPAC Name | calcium;sulfate;dihydrate |
| InChI Key | PASHVRUKOFIRIK-UHFFFAOYSA-L |
| Molecular Formula | CaH4O6S |
Aluminum oxide, for chromatography, basic, Brockmann I, 40-300 μm, 60A
CAS: 1344-28-1 Molecular Formula: Al2O3 Molecular Weight (g/mol): 101.96 MDL Number: MFCD00003424 InChI Key: PNEYBMLMFCGWSK-UHFFFAOYSA-N Synonym: aluminum oxide,aluminum oxide,alpha-alumina,fasertonerde,abramant,abramax,abrarex,abrasit,aloxite,alundum PubChem CID: 9989226 SMILES: [O--].[O--].[O--].[Al+3].[Al+3]
| PubChem CID | 9989226 |
|---|---|
| CAS | 1344-28-1 |
| Molecular Weight (g/mol) | 101.96 |
| MDL Number | MFCD00003424 |
| SMILES | [O--].[O--].[O--].[Al+3].[Al+3] |
| Synonym | aluminum oxide,aluminum oxide,alpha-alumina,fasertonerde,abramant,abramax,abrarex,abrasit,aloxite,alundum |
| InChI Key | PNEYBMLMFCGWSK-UHFFFAOYSA-N |
| Molecular Formula | Al2O3 |
Aluminum oxide, for chromatography, acidic, Brockmann I, 40-300 μm, 60A
CAS: 1344-28-1 Molecular Formula: Al2O3 Molecular Weight (g/mol): 101.96 MDL Number: MFCD00003424 InChI Key: PNEYBMLMFCGWSK-UHFFFAOYSA-N Synonym: aluminum oxide,aluminum oxide,alpha-alumina,fasertonerde,abramant,abramax,abrarex,abrasit,aloxite,alundum PubChem CID: 9989226 SMILES: [O--].[O--].[O--].[Al+3].[Al+3]
| PubChem CID | 9989226 |
|---|---|
| CAS | 1344-28-1 |
| Molecular Weight (g/mol) | 101.96 |
| MDL Number | MFCD00003424 |
| SMILES | [O--].[O--].[O--].[Al+3].[Al+3] |
| Synonym | aluminum oxide,aluminum oxide,alpha-alumina,fasertonerde,abramant,abramax,abrarex,abrasit,aloxite,alundum |
| InChI Key | PNEYBMLMFCGWSK-UHFFFAOYSA-N |
| Molecular Formula | Al2O3 |
Sodium chloride, 99.5%, for analysis
CAS: 7647-14-5 Molecular Formula: ClNa Molecular Weight (g/mol): 58.44 MDL Number: MFCD00003477 InChI Key: FAPWRFPIFSIZLT-UHFFFAOYSA-M Synonym: sodium chloride,salt,table salt,halite,saline,rock salt,common salt,sodium chloride nacl,dendritis,purex PubChem CID: 5234 ChEBI: CHEBI:26710 IUPAC Name: sodium;chloride SMILES: [Na+].[Cl-]
| PubChem CID | 5234 |
|---|---|
| CAS | 7647-14-5 |
| Molecular Weight (g/mol) | 58.44 |
| ChEBI | CHEBI:26710 |
| MDL Number | MFCD00003477 |
| SMILES | [Na+].[Cl-] |
| Synonym | sodium chloride,salt,table salt,halite,saline,rock salt,common salt,sodium chloride nacl,dendritis,purex |
| IUPAC Name | sodium;chloride |
| InChI Key | FAPWRFPIFSIZLT-UHFFFAOYSA-M |
| Molecular Formula | ClNa |
Sodium periodate, 99%, for analysis
CAS: 7790-28-5 Molecular Formula: INaO4 Molecular Weight (g/mol): 213.89 MDL Number: MFCD00003534 InChI Key: JQWHASGSAFIOCM-UHFFFAOYSA-M Synonym: sodium periodate,sodium metaperiodate,sodium m-periodate,sodiumperiodate,sodium meta periodate,periodic acid, sodium salt,sodium meta-periodate,periodic acid hio4 , sodium salt,periodate sodium,sodium penodate PubChem CID: 23667635 ChEBI: CHEBI:75226 SMILES: [Na+].[O-][I](=O)(=O)=O
| PubChem CID | 23667635 |
|---|---|
| CAS | 7790-28-5 |
| Molecular Weight (g/mol) | 213.89 |
| ChEBI | CHEBI:75226 |
| MDL Number | MFCD00003534 |
| SMILES | [Na+].[O-][I](=O)(=O)=O |
| Synonym | sodium periodate,sodium metaperiodate,sodium m-periodate,sodiumperiodate,sodium meta periodate,periodic acid, sodium salt,sodium meta-periodate,periodic acid hio4 , sodium salt,periodate sodium,sodium penodate |
| InChI Key | JQWHASGSAFIOCM-UHFFFAOYSA-M |
| Molecular Formula | INaO4 |
Calcium oxide, 97+%, for analysis, powder
CAS: 1305-78-8 Molecular Formula: CaO Molecular Weight (g/mol): 56.08 MDL Number: MFCD00010911 InChI Key: BRPQOXSCLDDYGP-UHFFFAOYSA-N Synonym: calcium oxide,burnt lime,calcia,calxyl,gebrannter kalk,unslaked lime,calcium monoxide,airlock,calx PubChem CID: 14778 ChEBI: CHEBI:31344 SMILES: [O--].[Ca++]
| PubChem CID | 14778 |
|---|---|
| CAS | 1305-78-8 |
| Molecular Weight (g/mol) | 56.08 |
| ChEBI | CHEBI:31344 |
| MDL Number | MFCD00010911 |
| SMILES | [O--].[Ca++] |
| Synonym | calcium oxide,burnt lime,calcia,calxyl,gebrannter kalk,unslaked lime,calcium monoxide,airlock,calx |
| InChI Key | BRPQOXSCLDDYGP-UHFFFAOYSA-N |
| Molecular Formula | CaO |
Strontium nitrate, 99+%, for analysis
CAS: 10042-76-9 Molecular Formula: N2O6Sr Molecular Weight (g/mol): 211.63 MDL Number: MFCD00011248 InChI Key: DHEQXMRUPNDRPG-UHFFFAOYSA-N Synonym: strontium nitrate,strontium dinitrate,nitric acid, strontium salt,strontium ii nitrate 1:2,unii-bdg873aqzl,nitrate de strontium french,hsdb 787,strontium nitrate sr no3 2,bdg873aqzl,nitric acid, strontium salt 2:1 PubChem CID: 24848 SMILES: [Sr++].[O-][N+]([O-])=O.[O-][N+]([O-])=O
| PubChem CID | 24848 |
|---|---|
| CAS | 10042-76-9 |
| Molecular Weight (g/mol) | 211.63 |
| MDL Number | MFCD00011248 |
| SMILES | [Sr++].[O-][N+]([O-])=O.[O-][N+]([O-])=O |
| Synonym | strontium nitrate,strontium dinitrate,nitric acid, strontium salt,strontium ii nitrate 1:2,unii-bdg873aqzl,nitrate de strontium french,hsdb 787,strontium nitrate sr no3 2,bdg873aqzl,nitric acid, strontium salt 2:1 |
| InChI Key | DHEQXMRUPNDRPG-UHFFFAOYSA-N |
| Molecular Formula | N2O6Sr |
Cobalt(II) nitrate hexahydrate, 99+%, for analysis
CAS: 10026-22-9 Molecular Formula: CoH12N2O12 Molecular Weight (g/mol): 291.03 MDL Number: MFCD00149647 InChI Key: QGUAJWGNOXCYJF-UHFFFAOYSA-N Synonym: cobalt nitrate hexahydrate,cobalt ii nitrate hexahydrate,cobaltous nitrate hexahydrate,cobalt dinitrate hexahydrate,cobalt 2+ nitrate hexahydrate,cobaltous nitrate, hexahydrate,kobalt ii-nitrat-hexahydrat,nitric acid, cobalt 2+ salt, hexahydrate PubChem CID: 24821 ChEBI: CHEBI:86214 IUPAC Name: λ²-cobalt(2+) hexahydrate dinitrate SMILES: O.O.O.O.O.O.[Co++].[O-][N+]([O-])=O.[O-][N+]([O-])=O
| PubChem CID | 24821 |
|---|---|
| CAS | 10026-22-9 |
| Molecular Weight (g/mol) | 291.03 |
| ChEBI | CHEBI:86214 |
| MDL Number | MFCD00149647 |
| SMILES | O.O.O.O.O.O.[Co++].[O-][N+]([O-])=O.[O-][N+]([O-])=O |
| Synonym | cobalt nitrate hexahydrate,cobalt ii nitrate hexahydrate,cobaltous nitrate hexahydrate,cobalt dinitrate hexahydrate,cobalt 2+ nitrate hexahydrate,cobaltous nitrate, hexahydrate,kobalt ii-nitrat-hexahydrat,nitric acid, cobalt 2+ salt, hexahydrate |
| IUPAC Name | λ²-cobalt(2+) hexahydrate dinitrate |
| InChI Key | QGUAJWGNOXCYJF-UHFFFAOYSA-N |
| Molecular Formula | CoH12N2O12 |
Barium hydroxide octahydrate, 98+%, for analysis
CAS: 12230-71-6 Molecular Formula: BaH18O10 Molecular Weight (g/mol): 315.46 MDL Number: MFCD00149152 InChI Key: ZUDYPQRUOYEARG-UHFFFAOYSA-L Synonym: barium hydroxide octahydrate,unii-l5q5v03tbn,l5q5v03tbn,dihydroxybarium octahydrate,barium dihydroxide octahydrate,barium hydroxide octahydrate mi,barium hydroxide ba oh 2 , octahydrate,acmc-1an7p,barium hydroxide octa hydrate,barium hydroxide octa-hydrate PubChem CID: 17749109 SMILES: O.O.O.O.O.O.O.O.[OH-].[OH-].[Ba++]
| PubChem CID | 17749109 |
|---|---|
| CAS | 12230-71-6 |
| Molecular Weight (g/mol) | 315.46 |
| MDL Number | MFCD00149152 |
| SMILES | O.O.O.O.O.O.O.O.[OH-].[OH-].[Ba++] |
| Synonym | barium hydroxide octahydrate,unii-l5q5v03tbn,l5q5v03tbn,dihydroxybarium octahydrate,barium dihydroxide octahydrate,barium hydroxide octahydrate mi,barium hydroxide ba oh 2 , octahydrate,acmc-1an7p,barium hydroxide octa hydrate,barium hydroxide octa-hydrate |
| InChI Key | ZUDYPQRUOYEARG-UHFFFAOYSA-L |
| Molecular Formula | BaH18O10 |
Aluminum oxide, for chromatography, neutral, Brockmann I, 40-300 μm, 60A
CAS: 1344-28-1 Molecular Formula: Al2O3 Molecular Weight (g/mol): 101.96 MDL Number: MFCD00003424 InChI Key: PNEYBMLMFCGWSK-UHFFFAOYSA-N Synonym: aluminum oxide,aluminum oxide,alpha-alumina,fasertonerde,abramant,abramax,abrarex,abrasit,aloxite,alundum PubChem CID: 9989226 SMILES: [O--].[O--].[O--].[Al+3].[Al+3]
| PubChem CID | 9989226 |
|---|---|
| CAS | 1344-28-1 |
| Molecular Weight (g/mol) | 101.96 |
| MDL Number | MFCD00003424 |
| SMILES | [O--].[O--].[O--].[Al+3].[Al+3] |
| Synonym | aluminum oxide,aluminum oxide,alpha-alumina,fasertonerde,abramant,abramax,abrarex,abrasit,aloxite,alundum |
| InChI Key | PNEYBMLMFCGWSK-UHFFFAOYSA-N |
| Molecular Formula | Al2O3 |
Sodium sulfate, anhydrous, 99%
CAS: 7757-82-6 Molecular Formula: Na2O4S Molecular Weight (g/mol): 142.04 MDL Number: MFCD00003504 InChI Key: PMZURENOXWZQFD-UHFFFAOYSA-L Synonym: sodium sulfate,disodium sulfate,salt cake,thenardite,sodium sulfate anhydrous,sodium sulphate,sodium sulfate, anhydrous,sulfuric acid disodium salt,disodium sulphate,sodium sulfate 2:1 PubChem CID: 24436 ChEBI: CHEBI:32149 SMILES: [Na+].[Na+].[O-]S([O-])(=O)=O
| PubChem CID | 24436 |
|---|---|
| CAS | 7757-82-6 |
| Molecular Weight (g/mol) | 142.04 |
| ChEBI | CHEBI:32149 |
| MDL Number | MFCD00003504 |
| SMILES | [Na+].[Na+].[O-]S([O-])(=O)=O |
| Synonym | sodium sulfate,disodium sulfate,salt cake,thenardite,sodium sulfate anhydrous,sodium sulphate,sodium sulfate, anhydrous,sulfuric acid disodium salt,disodium sulphate,sodium sulfate 2:1 |
| InChI Key | PMZURENOXWZQFD-UHFFFAOYSA-L |
| Molecular Formula | Na2O4S |
Sodium hexametaphosphate, tech.
CAS: 10124-56-8 Molecular Formula: Na6O18P6 MDL Number: MFCD00136045 Synonym: Sodium metaphosphate
| CAS | 10124-56-8 |
|---|---|
| MDL Number | MFCD00136045 |
| Synonym | Sodium metaphosphate |
| Molecular Formula | Na6O18P6 |