Salts and Inorganics
A variety of inorganic salts and elemental metals that can be used for large-scale, industrial purposes and everyday laboratory applications. Products are available in a range of chemical compositions, quantities, purities, and reagent grades.
Inorganics are elements and compounds, including carbon monoxide, carbon dioxide, carbonates, cyanides, cyanates, and carbides, that do not contain a carbon-hydrogen bond. This group also includes carbon allotropes such as graphite and graphene.
Because organic chemicals include only those that contain carbon atoms bonded to hydrogen atoms, the majority of elements in the periodic table and most substances in the material world are considered to be inorganic chemicals.
Filtered Search Results
Iron(III) hydroxide, alpha-phase
CAS: 20344-49-4 Molecular Formula: FeHO2 Molecular Weight (g/mol): 88.851 MDL Number: MFCD00064782 InChI Key: AEIXRCIKZIZYPM-UHFFFAOYSA-M Synonym: hydroxy oxo iron,goethite,lepidocrocite,iron hydroxide oxide,goethite fe oh o,iron hydroxide oxide fe oh o,iron iii oxide-hydroxide,ferric acid,iron pigment yellow,ferric hydroxide oxide PubChem CID: 91502 IUPAC Name: hydroxy(oxo)iron SMILES: O[Fe]=O
| PubChem CID | 91502 |
|---|---|
| CAS | 20344-49-4 |
| Molecular Weight (g/mol) | 88.851 |
| MDL Number | MFCD00064782 |
| SMILES | O[Fe]=O |
| Synonym | hydroxy oxo iron,goethite,lepidocrocite,iron hydroxide oxide,goethite fe oh o,iron hydroxide oxide fe oh o,iron iii oxide-hydroxide,ferric acid,iron pigment yellow,ferric hydroxide oxide |
| IUPAC Name | hydroxy(oxo)iron |
| InChI Key | AEIXRCIKZIZYPM-UHFFFAOYSA-M |
| Molecular Formula | FeHO2 |
Aluminum oxide, alpha-phase, 99.9% (metals basis)
CAS: 1344-28-1 Molecular Formula: Al2O3 Molecular Weight (g/mol): 101.96 MDL Number: MFCD00003424 InChI Key: PNEYBMLMFCGWSK-UHFFFAOYSA-N Synonym: aluminum oxide,aluminum oxide,alpha-alumina,fasertonerde,abramant,abramax,abrarex,abrasit,aloxite,alundum PubChem CID: 9989226 SMILES: [O--].[O--].[O--].[Al+3].[Al+3]
| PubChem CID | 9989226 |
|---|---|
| CAS | 1344-28-1 |
| Molecular Weight (g/mol) | 101.96 |
| MDL Number | MFCD00003424 |
| SMILES | [O--].[O--].[O--].[Al+3].[Al+3] |
| Synonym | aluminum oxide,aluminum oxide,alpha-alumina,fasertonerde,abramant,abramax,abrarex,abrasit,aloxite,alundum |
| InChI Key | PNEYBMLMFCGWSK-UHFFFAOYSA-N |
| Molecular Formula | Al2O3 |
Aluminum oxide, alpha-phase, 99.99% (metals basis)
CAS: 1344-28-1 Molecular Formula: Al2O3 Molecular Weight (g/mol): 101.96 MDL Number: MFCD00003424 InChI Key: PNEYBMLMFCGWSK-UHFFFAOYSA-N Synonym: aluminum oxide,aluminum oxide,alpha-alumina,fasertonerde,abramant,abramax,abrarex,abrasit,aloxite,alundum PubChem CID: 9989226 IUPAC Name: dialuminum;oxygen(2-) SMILES: [O--].[O--].[O--].[Al+3].[Al+3]
| PubChem CID | 9989226 |
|---|---|
| CAS | 1344-28-1 |
| Molecular Weight (g/mol) | 101.96 |
| MDL Number | MFCD00003424 |
| SMILES | [O--].[O--].[O--].[Al+3].[Al+3] |
| Synonym | aluminum oxide,aluminum oxide,alpha-alumina,fasertonerde,abramant,abramax,abrarex,abrasit,aloxite,alundum |
| IUPAC Name | dialuminum;oxygen(2-) |
| InChI Key | PNEYBMLMFCGWSK-UHFFFAOYSA-N |
| Molecular Formula | Al2O3 |
Silicon carbide, alpha-phase, 99.8% (metals basis)
CAS: 409-21-2 Molecular Formula: CSi Molecular Weight (g/mol): 40.10 MDL Number: MFCD00049531 InChI Key: HBMJWWWQQXIZIP-UHFFFAOYSA-N Synonym: silicon carbide,carborundum,silicon monocarbide,carborundeum,tokawhisker,betarundum,carbolon,nicalon,silundum,carbon silicide PubChem CID: 9863 ChEBI: CHEBI:29390 SMILES: [C-]#[Si+]
| PubChem CID | 9863 |
|---|---|
| CAS | 409-21-2 |
| Molecular Weight (g/mol) | 40.10 |
| ChEBI | CHEBI:29390 |
| MDL Number | MFCD00049531 |
| SMILES | [C-]#[Si+] |
| Synonym | silicon carbide,carborundum,silicon monocarbide,carborundeum,tokawhisker,betarundum,carbolon,nicalon,silundum,carbon silicide |
| InChI Key | HBMJWWWQQXIZIP-UHFFFAOYSA-N |
| Molecular Formula | CSi |
Calcium alpha-D-isosaccharinate, 98% (Assay)
CAS: 84324-95-8 Molecular Formula: C12H22CaO12 MDL Number: MFCD04039767
| CAS | 84324-95-8 |
|---|---|
| MDL Number | MFCD04039767 |
| Molecular Formula | C12H22CaO12 |
Aluminum oxide, Alpha-phase, 99.9% (metals basis)
CAS: 1344-28-1 Molecular Formula: Al2O3 Molecular Weight (g/mol): 101.96 MDL Number: MFCD00003424 InChI Key: PNEYBMLMFCGWSK-UHFFFAOYSA-N Synonym: aluminum oxide,aluminum oxide,alpha-alumina,fasertonerde,abramant,abramax,abrarex,abrasit,aloxite,alundum PubChem CID: 9989226 SMILES: [O--].[O--].[O--].[Al+3].[Al+3]
| PubChem CID | 9989226 |
|---|---|
| CAS | 1344-28-1 |
| Molecular Weight (g/mol) | 101.96 |
| MDL Number | MFCD00003424 |
| SMILES | [O--].[O--].[O--].[Al+3].[Al+3] |
| Synonym | aluminum oxide,aluminum oxide,alpha-alumina,fasertonerde,abramant,abramax,abrarex,abrasit,aloxite,alundum |
| InChI Key | PNEYBMLMFCGWSK-UHFFFAOYSA-N |
| Molecular Formula | Al2O3 |
Sodium thiosulfate pentahydrate, 99+%
CAS: 10102-17-7 Molecular Formula: H10Na2O8S2 Molecular Weight (g/mol): 248.172 MDL Number: MFCD00149186 InChI Key: PODWXQQNRWNDGD-UHFFFAOYSA-L Synonym: sodium thiosulfate pentahydrate,ametox,sodium thiosulfate, pentahydrate,antichlor,tinver,disodium thiosulfate pentahydrate,unii-hx1032v43m,ccris 3952,thiosulfuric acid, disodium salt, pentahydrate,sodium hyposulfite pentahydrate PubChem CID: 61475 ChEBI: CHEBI:32150 IUPAC Name: disodium;dioxido-oxo-sulfanylidene-$l^{6}-sulfane;pentahydrate SMILES: O.O.O.O.O.[O-]S(=O)(=S)[O-].[Na+].[Na+]
| PubChem CID | 61475 |
|---|---|
| CAS | 10102-17-7 |
| Molecular Weight (g/mol) | 248.172 |
| ChEBI | CHEBI:32150 |
| MDL Number | MFCD00149186 |
| SMILES | O.O.O.O.O.[O-]S(=O)(=S)[O-].[Na+].[Na+] |
| Synonym | sodium thiosulfate pentahydrate,ametox,sodium thiosulfate, pentahydrate,antichlor,tinver,disodium thiosulfate pentahydrate,unii-hx1032v43m,ccris 3952,thiosulfuric acid, disodium salt, pentahydrate,sodium hyposulfite pentahydrate |
| IUPAC Name | disodium;dioxido-oxo-sulfanylidene-$l^{6}-sulfane;pentahydrate |
| InChI Key | PODWXQQNRWNDGD-UHFFFAOYSA-L |
| Molecular Formula | H10Na2O8S2 |
Ammonium acetate, ACS, 97.0% min
CAS: 631-61-8 Molecular Formula: C2H7NO2 Molecular Weight (g/mol): 77.083 MDL Number: MFCD00013066 InChI Key: USFZMSVCRYTOJT-UHFFFAOYSA-N Synonym: ammonium acetate,acetic acid, ammonium salt,azanium acetate,ammoniumacetate,acetic acid ammonium salt,ammonium ethanoate,unii-rre756s6q2,aconh4,ch3coonh4,ch3co2nh4 PubChem CID: 517165 ChEBI: CHEBI:62947 IUPAC Name: azanium;acetate SMILES: CC(=O)[O-].[NH4+]
| PubChem CID | 517165 |
|---|---|
| CAS | 631-61-8 |
| Molecular Weight (g/mol) | 77.083 |
| ChEBI | CHEBI:62947 |
| MDL Number | MFCD00013066 |
| SMILES | CC(=O)[O-].[NH4+] |
| Synonym | ammonium acetate,acetic acid, ammonium salt,azanium acetate,ammoniumacetate,acetic acid ammonium salt,ammonium ethanoate,unii-rre756s6q2,aconh4,ch3coonh4,ch3co2nh4 |
| IUPAC Name | azanium;acetate |
| InChI Key | USFZMSVCRYTOJT-UHFFFAOYSA-N |
| Molecular Formula | C2H7NO2 |
Aluminum oxide, alpha-phase, 99.997% (metals basis)
CAS: 1344-28-1 Molecular Formula: Al2O3 Molecular Weight (g/mol): 101.96 MDL Number: MFCD00003424 InChI Key: PNEYBMLMFCGWSK-UHFFFAOYSA-N Synonym: aluminum oxide,aluminum oxide,alpha-alumina,fasertonerde,abramant,abramax,abrarex,abrasit,aloxite,alundum PubChem CID: 9989226 SMILES: [O--].[O--].[O--].[Al+3].[Al+3]
| PubChem CID | 9989226 |
|---|---|
| CAS | 1344-28-1 |
| Molecular Weight (g/mol) | 101.96 |
| MDL Number | MFCD00003424 |
| SMILES | [O--].[O--].[O--].[Al+3].[Al+3] |
| Synonym | aluminum oxide,aluminum oxide,alpha-alumina,fasertonerde,abramant,abramax,abrarex,abrasit,aloxite,alundum |
| InChI Key | PNEYBMLMFCGWSK-UHFFFAOYSA-N |
| Molecular Formula | Al2O3 |
Silicon(IV) nitride, alpha-phase, ca. 90%
CAS: 12033-89-5 Molecular Formula: N4Si3 Molecular Weight (g/mol): 140.28 MDL Number: MFCD00011230 InChI Key: HQVNEWCFYHHQES-UHFFFAOYSA-N Synonym: silicon nitride,silicon nitride si3n4,unii-qhb8t06idk,qhb8t06idk,silicon iv nitride, alpha phase,trisilicon tetranitride,nierite,nano silicon nitride,silicon iv nitride,silicon nitride, amorphous PubChem CID: 3084099 IUPAC Name: Silicon nitride SMILES: N12[Si]34N5[Si]11N3[Si]25N41
| PubChem CID | 3084099 |
|---|---|
| CAS | 12033-89-5 |
| Molecular Weight (g/mol) | 140.28 |
| MDL Number | MFCD00011230 |
| SMILES | N12[Si]34N5[Si]11N3[Si]25N41 |
| Synonym | silicon nitride,silicon nitride si3n4,unii-qhb8t06idk,qhb8t06idk,silicon iv nitride, alpha phase,trisilicon tetranitride,nierite,nano silicon nitride,silicon iv nitride,silicon nitride, amorphous |
| IUPAC Name | Silicon nitride |
| InChI Key | HQVNEWCFYHHQES-UHFFFAOYSA-N |
| Molecular Formula | N4Si3 |
alpha-Ketoglutaric acid sodium salt, 98%
CAS: 22202-68-2 Molecular Formula: C5H5NaO5 Molecular Weight (g/mol): 168.08 InChI Key: MOTOGHHLNTXPTI-UHFFFAOYSA-M Synonym: sodium hydrogen 2-oxoglutarate,pentanedioic acid, 2-oxo-, sodium salt,pentanedioic acid, 2-oxo-, sodium salt 1:?,2-ketoglutaric acid monosodium salt,2-oxoglutaric acid, sodium salt,glutaric acid, 2-oxo-, sodium salt,alpha-ketoglutaric acid, sodium salt,2-oxoglutaric acid 1-sodium salt,sodium 4-carboxy-4-oxobutanoate PubChem CID: 23672314 IUPAC Name: sodium;5-hydroxy-4,5-dioxopentanoate SMILES: C(CC(=O)[O-])C(=O)C(=O)O.[Na+]
| PubChem CID | 23672314 |
|---|---|
| CAS | 22202-68-2 |
| Molecular Weight (g/mol) | 168.08 |
| SMILES | C(CC(=O)[O-])C(=O)C(=O)O.[Na+] |
| Synonym | sodium hydrogen 2-oxoglutarate,pentanedioic acid, 2-oxo-, sodium salt,pentanedioic acid, 2-oxo-, sodium salt 1:?,2-ketoglutaric acid monosodium salt,2-oxoglutaric acid, sodium salt,glutaric acid, 2-oxo-, sodium salt,alpha-ketoglutaric acid, sodium salt,2-oxoglutaric acid 1-sodium salt,sodium 4-carboxy-4-oxobutanoate |
| IUPAC Name | sodium;5-hydroxy-4,5-dioxopentanoate |
| InChI Key | MOTOGHHLNTXPTI-UHFFFAOYSA-M |
| Molecular Formula | C5H5NaO5 |
Sodium hexametaphosphate, tech.
CAS: 10124-56-8 Molecular Formula: Na6O18P6 MDL Number: MFCD00136045 Synonym: Sodium metaphosphate
| CAS | 10124-56-8 |
|---|---|
| MDL Number | MFCD00136045 |
| Synonym | Sodium metaphosphate |
| Molecular Formula | Na6O18P6 |
Aluminum oxide, alpha-phase, 99.95% min (metals basis)
CAS: 1344-28-1 Molecular Formula: Al2O3 Molecular Weight (g/mol): 101.96 MDL Number: MFCD00003424 InChI Key: PNEYBMLMFCGWSK-UHFFFAOYSA-N Synonym: aluminum oxide,aluminum oxide,alpha-alumina,fasertonerde,abramant,abramax,abrarex,abrasit,aloxite,alundum PubChem CID: 9989226 SMILES: [O--].[O--].[O--].[Al+3].[Al+3]
| PubChem CID | 9989226 |
|---|---|
| CAS | 1344-28-1 |
| Molecular Weight (g/mol) | 101.96 |
| MDL Number | MFCD00003424 |
| SMILES | [O--].[O--].[O--].[Al+3].[Al+3] |
| Synonym | aluminum oxide,aluminum oxide,alpha-alumina,fasertonerde,abramant,abramax,abrarex,abrasit,aloxite,alundum |
| InChI Key | PNEYBMLMFCGWSK-UHFFFAOYSA-N |
| Molecular Formula | Al2O3 |
Silicon(IV) nitride, alpha-phase, 99.9% (metals basis)
CAS: 12033-89-5 Molecular Formula: N4Si3 Molecular Weight (g/mol): 140.28 MDL Number: MFCD00011230 InChI Key: HQVNEWCFYHHQES-UHFFFAOYSA-N Synonym: silicon nitride,silicon nitride si3n4,unii-qhb8t06idk,qhb8t06idk,silicon iv nitride, alpha phase,trisilicon tetranitride,nierite,nano silicon nitride,silicon iv nitride,silicon nitride, amorphous PubChem CID: 3084099 IUPAC Name: Silicon nitride SMILES: N12[Si]34N5[Si]11N3[Si]25N41
| PubChem CID | 3084099 |
|---|---|
| CAS | 12033-89-5 |
| Molecular Weight (g/mol) | 140.28 |
| MDL Number | MFCD00011230 |
| SMILES | N12[Si]34N5[Si]11N3[Si]25N41 |
| Synonym | silicon nitride,silicon nitride si3n4,unii-qhb8t06idk,qhb8t06idk,silicon iv nitride, alpha phase,trisilicon tetranitride,nierite,nano silicon nitride,silicon iv nitride,silicon nitride, amorphous |
| IUPAC Name | Silicon nitride |
| InChI Key | HQVNEWCFYHHQES-UHFFFAOYSA-N |
| Molecular Formula | N4Si3 |
Aluminum oxide, alpha-phase, gamma-phase, 99.99% (metals basis)
CAS: 1344-28-1 Molecular Formula: Al2O3 Molecular Weight (g/mol): 101.96 MDL Number: MFCD00003424 InChI Key: PNEYBMLMFCGWSK-UHFFFAOYSA-N Synonym: aluminum oxide,aluminum oxide,alpha-alumina,fasertonerde,abramant,abramax,abrarex,abrasit,aloxite,alundum PubChem CID: 9989226 SMILES: [O--].[O--].[O--].[Al+3].[Al+3]
| PubChem CID | 9989226 |
|---|---|
| CAS | 1344-28-1 |
| Molecular Weight (g/mol) | 101.96 |
| MDL Number | MFCD00003424 |
| SMILES | [O--].[O--].[O--].[Al+3].[Al+3] |
| Synonym | aluminum oxide,aluminum oxide,alpha-alumina,fasertonerde,abramant,abramax,abrarex,abrasit,aloxite,alundum |
| InChI Key | PNEYBMLMFCGWSK-UHFFFAOYSA-N |
| Molecular Formula | Al2O3 |