Salts and Inorganics
A variety of inorganic salts and elemental metals that can be used for large-scale, industrial purposes and everyday laboratory applications. Products are available in a range of chemical compositions, quantities, purities, and reagent grades.
Inorganics are elements and compounds, including carbon monoxide, carbon dioxide, carbonates, cyanides, cyanates, and carbides, that do not contain a carbon-hydrogen bond. This group also includes carbon allotropes such as graphite and graphene.
Because organic chemicals include only those that contain carbon atoms bonded to hydrogen atoms, the majority of elements in the periodic table and most substances in the material world are considered to be inorganic chemicals.
Filtered Search Results
Thermo Scientific Chemicals Potassium chloride, 99%, Molecular Biology Grade
CAS: 7447-40-7 Molecular Formula: ClK Molecular Weight (g/mol): 74.55 MDL Number: MFCD00011360 InChI Key: WCUXLLCKKVVCTQ-UHFFFAOYSA-M Synonym: potassium chloride,enseal,muriate of potash,klotrix,sylvite,slow-k,potassium chloride kcl,klor-con,chlorvescent,kalitabs PubChem CID: 4873 ChEBI: CHEBI:32588 SMILES: [Cl-].[K+]
| PubChem CID | 4873 |
|---|---|
| CAS | 7447-40-7 |
| Molecular Weight (g/mol) | 74.55 |
| ChEBI | CHEBI:32588 |
| MDL Number | MFCD00011360 |
| SMILES | [Cl-].[K+] |
| Synonym | potassium chloride,enseal,muriate of potash,klotrix,sylvite,slow-k,potassium chloride kcl,klor-con,chlorvescent,kalitabs |
| InChI Key | WCUXLLCKKVVCTQ-UHFFFAOYSA-M |
| Molecular Formula | ClK |
Thermo Scientific Chemicals Lithium chloride, 99%, for molecular biology
CAS: 7447-41-8 Molecular Formula: ClLi Molecular Weight (g/mol): 42.39 MDL Number: MFCD00011078 InChI Key: KWGKDLIKAYFUFQ-UHFFFAOYSA-M Synonym: lithium chloride,lithium chloride licl,lithiumchloride,licl,chlorure de lithium,chlorku litu,chlorolithium,lithiumchlorid,chlorku litu polish,luthium chloride PubChem CID: 433294 ChEBI: CHEBI:48607 IUPAC Name: lithium;chloride SMILES: [Li+].[Cl-]
| PubChem CID | 433294 |
|---|---|
| CAS | 7447-41-8 |
| Molecular Weight (g/mol) | 42.39 |
| ChEBI | CHEBI:48607 |
| MDL Number | MFCD00011078 |
| SMILES | [Li+].[Cl-] |
| Synonym | lithium chloride,lithium chloride licl,lithiumchloride,licl,chlorure de lithium,chlorku litu,chlorolithium,lithiumchlorid,chlorku litu polish,luthium chloride |
| IUPAC Name | lithium;chloride |
| InChI Key | KWGKDLIKAYFUFQ-UHFFFAOYSA-M |
| Molecular Formula | ClLi |
Cesium Chloride (White Crystalline Powder/Molecular Biology), Fisher BioReagents
CAS: 7647-17-8 Molecular Formula: ClCs Molecular Weight (g/mol): 168.36 MDL Number: MFCD00010955 InChI Key: AIYUHDOJVYHVIT-UHFFFAOYSA-M Synonym: cesium chloride,caesium chloride,cesium monochloride,cesium chloride cscl,dicesium dichloride,cscl,tricesium trichloride,unii-gnr9hml8ba,gnr9hml8ba,caesium 1+ ion chloride PubChem CID: 24293 ChEBI: CHEBI:63039 IUPAC Name: caesium(1+) chloride SMILES: [Cl-].[Cs+]
| PubChem CID | 24293 |
|---|---|
| CAS | 7647-17-8 |
| Molecular Weight (g/mol) | 168.36 |
| ChEBI | CHEBI:63039 |
| MDL Number | MFCD00010955 |
| SMILES | [Cl-].[Cs+] |
| Synonym | cesium chloride,caesium chloride,cesium monochloride,cesium chloride cscl,dicesium dichloride,cscl,tricesium trichloride,unii-gnr9hml8ba,gnr9hml8ba,caesium 1+ ion chloride |
| IUPAC Name | caesium(1+) chloride |
| InChI Key | AIYUHDOJVYHVIT-UHFFFAOYSA-M |
| Molecular Formula | ClCs |
Ammonium persulfate, 99+%, for molecular biology, DNAse, RNAse and Protease free
CAS: 7727-54-0 Molecular Formula: H8N2O8S2 Molecular Weight (g/mol): 228.19 MDL Number: MFCD00003390 InChI Key: ROOXNKNUYICQNP-UHFFFAOYSA-N Synonym: ammonium persulfate,ammonium peroxydisulfate,diammonium peroxydisulfate,diammonium persulfate,ammoniumpersulfate,diammonium peroxodisulphate,diammonium peroxydisulphate,unii-22qf6l357f,ccris 1430,persulfate d'ammonium french PubChem CID: 62648 IUPAC Name: diazanium;sulfonatooxy sulfate SMILES: [NH4+].[NH4+].[O-]S(=O)(=O)OOS([O-])(=O)=O
| PubChem CID | 62648 |
|---|---|
| CAS | 7727-54-0 |
| Molecular Weight (g/mol) | 228.19 |
| MDL Number | MFCD00003390 |
| SMILES | [NH4+].[NH4+].[O-]S(=O)(=O)OOS([O-])(=O)=O |
| Synonym | ammonium persulfate,ammonium peroxydisulfate,diammonium peroxydisulfate,diammonium persulfate,ammoniumpersulfate,diammonium peroxodisulphate,diammonium peroxydisulphate,unii-22qf6l357f,ccris 1430,persulfate d'ammonium french |
| IUPAC Name | diazanium;sulfonatooxy sulfate |
| InChI Key | ROOXNKNUYICQNP-UHFFFAOYSA-N |
| Molecular Formula | H8N2O8S2 |
Thermo Scientific Chemicals Sodium chloride, 99.85%, for molecular biology, DNAse, RNAse and Protease free
CAS: 7647-14-5 Molecular Formula: ClNa Molecular Weight (g/mol): 58.44 MDL Number: MFCD00003477 InChI Key: FAPWRFPIFSIZLT-UHFFFAOYSA-M Synonym: sodium chloride,salt,table salt,halite,saline,rock salt,common salt,sodium chloride nacl,dendritis,purex PubChem CID: 5234 ChEBI: CHEBI:26710 IUPAC Name: sodium chloride SMILES: [Na+].[Cl-]
| PubChem CID | 5234 |
|---|---|
| CAS | 7647-14-5 |
| Molecular Weight (g/mol) | 58.44 |
| ChEBI | CHEBI:26710 |
| MDL Number | MFCD00003477 |
| SMILES | [Na+].[Cl-] |
| Synonym | sodium chloride,salt,table salt,halite,saline,rock salt,common salt,sodium chloride nacl,dendritis,purex |
| IUPAC Name | sodium chloride |
| InChI Key | FAPWRFPIFSIZLT-UHFFFAOYSA-M |
| Molecular Formula | ClNa |
Sodium acetate, 99+%, anhydrous, Molecular Biology Reagent, Thermo Scientific Chemicals
CAS: 127-09-3 Molecular Formula: C2H3NaO2 Molecular Weight (g/mol): 82.03 MDL Number: MFCD00012459 InChI Key: VMHLLURERBWHNL-UHFFFAOYSA-M Synonym: sodium acetate,acetic acid, sodium salt,sodium acetate anhydrous,sodium acetate, anhydrous,acetic acid sodium salt,anhydrous sodium acetate,sodii acetas,sodium ethanoate,natrium aceticum,octan sodny czech PubChem CID: 517045 ChEBI: CHEBI:32954 SMILES: [Na+].CC([O-])=O
| PubChem CID | 517045 |
|---|---|
| CAS | 127-09-3 |
| Molecular Weight (g/mol) | 82.03 |
| ChEBI | CHEBI:32954 |
| MDL Number | MFCD00012459 |
| SMILES | [Na+].CC([O-])=O |
| Synonym | sodium acetate,acetic acid, sodium salt,sodium acetate anhydrous,sodium acetate, anhydrous,acetic acid sodium salt,anhydrous sodium acetate,sodii acetas,sodium ethanoate,natrium aceticum,octan sodny czech |
| InChI Key | VMHLLURERBWHNL-UHFFFAOYSA-M |
| Molecular Formula | C2H3NaO2 |
Ammonium Persulfate, Molecular Biology Reagent, MP Biomedicals™
CAS: 7727-54-0 Molecular Formula: H8N2O8S2 Molecular Weight (g/mol): 228.19 MDL Number: MFCD00003390 InChI Key: ROOXNKNUYICQNP-UHFFFAOYSA-N Synonym: ammonium persulfate,ammonium peroxydisulfate,diammonium peroxydisulfate,diammonium persulfate,ammoniumpersulfate,diammonium peroxodisulphate,diammonium peroxydisulphate,unii-22qf6l357f,ccris 1430,persulfate d'ammonium french PubChem CID: 62648 SMILES: [NH4+].[NH4+].[O-]S(=O)(=O)OOS([O-])(=O)=O
| PubChem CID | 62648 |
|---|---|
| CAS | 7727-54-0 |
| Molecular Weight (g/mol) | 228.19 |
| MDL Number | MFCD00003390 |
| SMILES | [NH4+].[NH4+].[O-]S(=O)(=O)OOS([O-])(=O)=O |
| Synonym | ammonium persulfate,ammonium peroxydisulfate,diammonium peroxydisulfate,diammonium persulfate,ammoniumpersulfate,diammonium peroxodisulphate,diammonium peroxydisulphate,unii-22qf6l357f,ccris 1430,persulfate d'ammonium french |
| InChI Key | ROOXNKNUYICQNP-UHFFFAOYSA-N |
| Molecular Formula | H8N2O8S2 |
Sodium Chloride, Molecular Biology Reagent Grade, MP Biomedicals™
CAS: 7647-14-5 Molecular Formula: ClNa Molecular Weight (g/mol): 58.44 MDL Number: MFCD00003477 InChI Key: FAPWRFPIFSIZLT-UHFFFAOYSA-M Synonym: sodium chloride,salt,table salt,halite,saline,rock salt,common salt,sodium chloride nacl,dendritis,purex PubChem CID: 5234 ChEBI: CHEBI:26710 SMILES: [Na+].[Cl-]
| PubChem CID | 5234 |
|---|---|
| CAS | 7647-14-5 |
| Molecular Weight (g/mol) | 58.44 |
| ChEBI | CHEBI:26710 |
| MDL Number | MFCD00003477 |
| SMILES | [Na+].[Cl-] |
| Synonym | sodium chloride,salt,table salt,halite,saline,rock salt,common salt,sodium chloride nacl,dendritis,purex |
| InChI Key | FAPWRFPIFSIZLT-UHFFFAOYSA-M |
| Molecular Formula | ClNa |
Potassium Phosphate Dibasic Trihydrate, MP Biomedicals™
CAS: 16788-57-1 Molecular Formula: H7K2O7P Molecular Weight (g/mol): 228.22 MDL Number: MFCD00149926 InChI Key: XQGPKZUNMMFTAL-UHFFFAOYSA-L Synonym: dipotassium hydrogen phosphate trihydrate,dipotassium hydrogen phosphate trihydrate,unii-rjk174x3tz,potassium hydrogenphosphate trihydrate,potassium phosphate dibasic trihydrate,potassium hydrogen phosphate trihydrate,potassium phosphate, dibasic, trihydrate,phosphoric acid, dipotassium salt, trihydrate,rjk174x3tz,dipotassium phosphate trihydrate PubChem CID: 16217523 IUPAC Name: dipotassium trihydrate hydrogen phosphate SMILES: O.O.O.[K+].[K+].OP([O-])([O-])=O
| PubChem CID | 16217523 |
|---|---|
| CAS | 16788-57-1 |
| Molecular Weight (g/mol) | 228.22 |
| MDL Number | MFCD00149926 |
| SMILES | O.O.O.[K+].[K+].OP([O-])([O-])=O |
| Synonym | dipotassium hydrogen phosphate trihydrate,dipotassium hydrogen phosphate trihydrate,unii-rjk174x3tz,potassium hydrogenphosphate trihydrate,potassium phosphate dibasic trihydrate,potassium hydrogen phosphate trihydrate,potassium phosphate, dibasic, trihydrate,phosphoric acid, dipotassium salt, trihydrate,rjk174x3tz,dipotassium phosphate trihydrate |
| IUPAC Name | dipotassium trihydrate hydrogen phosphate |
| InChI Key | XQGPKZUNMMFTAL-UHFFFAOYSA-L |
| Molecular Formula | H7K2O7P |
Melford Magnesium Sulfate
Product usually ships within 24 hours. Research or further manufacturing use only, not for food or drug use.
| CAS | 7487-88-9 |
|---|---|
| Chemical Name or Material | Magnesium Sulfate |
| Purity Grade Notes | Molecular Biology Grade |
| Molecular Formula | MgSO4 |