Organic acids and derivatives
Filtered Search Results
Ethylenediaminetetraacetic Acid, Honeywell Fluka™
CAS: 60-00-4 Molecular Formula: C10H16N2O8 Molecular Weight (g/mol): 292.24 MDL Number: MFCD00003541 InChI Key: KCXVZYZYPLLWCC-UHFFFAOYSA-N Synonym: edta,edetic acid,ethylenediaminetetraacetic acid,edathamil,versene,endrate,havidote,titriplex,edta acid,sequestrol PubChem CID: 6049 ChEBI: CHEBI:42191 SMILES: OC(=O)CN(CCN(CC(O)=O)CC(O)=O)CC(O)=O
| PubChem CID | 6049 |
|---|---|
| CAS | 60-00-4 |
| Molecular Weight (g/mol) | 292.24 |
| ChEBI | CHEBI:42191 |
| MDL Number | MFCD00003541 |
| SMILES | OC(=O)CN(CCN(CC(O)=O)CC(O)=O)CC(O)=O |
| Synonym | edta,edetic acid,ethylenediaminetetraacetic acid,edathamil,versene,endrate,havidote,titriplex,edta acid,sequestrol |
| InChI Key | KCXVZYZYPLLWCC-UHFFFAOYSA-N |
| Molecular Formula | C10H16N2O8 |
1,2-Diaminocyclohexanetetraacetic acid monohydrate, Honeywell Fluka™
CAS: 145819-99-4 Molecular Formula: C14H24N2O9 Molecular Weight (g/mol): 364.351 MDL Number: MFCD00150952 InChI Key: VASZYFIKPKYGNC-UHFFFAOYSA-N Synonym: cdta hydrate,glycine, n,n'-1,2-cyclohexanediylbis n-carboxymethyl-, monohydrate,trans-1,2-cyclohexanediamine-n,n,n',n'-tetraacetic acid monohydrate,acmc-20n4nc,1,2-diaminocyclohexanetetraacetic acid monohydrate,trans-1,2-cyclohexanediamine-n,n,n',n-tetraacetic acid,2,2',2,2'-cyclohexane-1,2-diylbis azanetriyl tetraacetic acid hydrate,2,2',2,2'-cyclohexane-1,2-diyldinitrilo tetraacetic acid-water 1/1,2-2-bis carboxymethyl amino cyclohexyl-carboxymethyl amino acetic acid hydrate,1,2-diaminocyclohexanetetraacetic acid monohydrate for complexometry, inverted exclamation marky PubChem CID: 18674933 IUPAC Name: 2-[[2-[bis(carboxymethyl)amino]cyclohexyl]-(carboxymethyl)amino]acetic acid;hydrate SMILES: C1CCC(C(C1)N(CC(=O)O)CC(=O)O)N(CC(=O)O)CC(=O)O.O
| PubChem CID | 18674933 |
|---|---|
| CAS | 145819-99-4 |
| Molecular Weight (g/mol) | 364.351 |
| MDL Number | MFCD00150952 |
| SMILES | C1CCC(C(C1)N(CC(=O)O)CC(=O)O)N(CC(=O)O)CC(=O)O.O |
| Synonym | cdta hydrate,glycine, n,n'-1,2-cyclohexanediylbis n-carboxymethyl-, monohydrate,trans-1,2-cyclohexanediamine-n,n,n',n'-tetraacetic acid monohydrate,acmc-20n4nc,1,2-diaminocyclohexanetetraacetic acid monohydrate,trans-1,2-cyclohexanediamine-n,n,n',n-tetraacetic acid,2,2',2,2'-cyclohexane-1,2-diylbis azanetriyl tetraacetic acid hydrate,2,2',2,2'-cyclohexane-1,2-diyldinitrilo tetraacetic acid-water 1/1,2-2-bis carboxymethyl amino cyclohexyl-carboxymethyl amino acetic acid hydrate,1,2-diaminocyclohexanetetraacetic acid monohydrate for complexometry, inverted exclamation marky |
| IUPAC Name | 2-[[2-[bis(carboxymethyl)amino]cyclohexyl]-(carboxymethyl)amino]acetic acid;hydrate |
| InChI Key | VASZYFIKPKYGNC-UHFFFAOYSA-N |
| Molecular Formula | C14H24N2O9 |
Butyl Acetate, puriss. p.a., ACS Reagent, ≥99.5% (GC), Honeywell Riedel-de Haën™
CAS: 123-86-4 Molecular Formula: C6H12O2 Molecular Weight (g/mol): 116.16 MDL Number: MFCD00009445 InChI Key: DKPFZGUDAPQIHT-UHFFFAOYSA-N Synonym: n-butyl acetate,acetic acid, butyl ester,1-butyl acetate,butyl ethanoate,acetic acid butyl ester,n-butyl ethanoate,n-butylacetate,butylacetat,acetic acid n-butyl ester,acetate de butyle PubChem CID: 31272 ChEBI: CHEBI:31328 IUPAC Name: butyl acetate SMILES: CCCCOC(C)=O
| PubChem CID | 31272 |
|---|---|
| CAS | 123-86-4 |
| Molecular Weight (g/mol) | 116.16 |
| ChEBI | CHEBI:31328 |
| MDL Number | MFCD00009445 |
| SMILES | CCCCOC(C)=O |
| Synonym | n-butyl acetate,acetic acid, butyl ester,1-butyl acetate,butyl ethanoate,acetic acid butyl ester,n-butyl ethanoate,n-butylacetate,butylacetat,acetic acid n-butyl ester,acetate de butyle |
| IUPAC Name | butyl acetate |
| InChI Key | DKPFZGUDAPQIHT-UHFFFAOYSA-N |
| Molecular Formula | C6H12O2 |
Isopropyl Acetate, Puriss p.a., ≥99.5% (GC), Honeywell Riedel-de Haën™
CAS: 108-21-4 Molecular Formula: C5H10O2 Molecular Weight (g/mol): 102.133 MDL Number: MFCD00008877 InChI Key: JMMWKPVZQRWMSS-UHFFFAOYSA-N Synonym: isopropyl acetate,2-propyl acetate,2-acetoxypropane,acetic acid, 1-methylethyl ester,isopropyl ethanoate,isopropylacetat,paracetat,isopropylacetaat,1-methylethyl acetate,acetic acid, isopropyl ester PubChem CID: 7915 IUPAC Name: propan-2-yl acetate SMILES: CC(C)OC(=O)C
| PubChem CID | 7915 |
|---|---|
| CAS | 108-21-4 |
| Molecular Weight (g/mol) | 102.133 |
| MDL Number | MFCD00008877 |
| SMILES | CC(C)OC(=O)C |
| Synonym | isopropyl acetate,2-propyl acetate,2-acetoxypropane,acetic acid, 1-methylethyl ester,isopropyl ethanoate,isopropylacetat,paracetat,isopropylacetaat,1-methylethyl acetate,acetic acid, isopropyl ester |
| IUPAC Name | propan-2-yl acetate |
| InChI Key | JMMWKPVZQRWMSS-UHFFFAOYSA-N |
| Molecular Formula | C5H10O2 |
Butyl acetate, CHROMASOLV™ Plus, for HPLC, 99.7%, Honeywell Riedel-de Haën™
CAS: 123-86-4 Molecular Formula: C6H12O2 Molecular Weight (g/mol): 116.16 MDL Number: MFCD00009445 InChI Key: DKPFZGUDAPQIHT-UHFFFAOYSA-N Synonym: n-butyl acetate,acetic acid, butyl ester,1-butyl acetate,butyl ethanoate,acetic acid butyl ester,n-butyl ethanoate,n-butylacetate,butylacetat,acetic acid n-butyl ester,acetate de butyle PubChem CID: 31272 ChEBI: CHEBI:31328 IUPAC Name: butyl acetate SMILES: CCCCOC(C)=O
| PubChem CID | 31272 |
|---|---|
| CAS | 123-86-4 |
| Molecular Weight (g/mol) | 116.16 |
| ChEBI | CHEBI:31328 |
| MDL Number | MFCD00009445 |
| SMILES | CCCCOC(C)=O |
| Synonym | n-butyl acetate,acetic acid, butyl ester,1-butyl acetate,butyl ethanoate,acetic acid butyl ester,n-butyl ethanoate,n-butylacetate,butylacetat,acetic acid n-butyl ester,acetate de butyle |
| IUPAC Name | butyl acetate |
| InChI Key | DKPFZGUDAPQIHT-UHFFFAOYSA-N |
| Molecular Formula | C6H12O2 |
Iron(III) oxalate hexahydrate
CAS: 166897-40-1 Molecular Formula: C6H12Fe2O18 Molecular Weight (g/mol): 483.834 MDL Number: MFCD00054430 InChI Key: FWXIZVVTJVNNRX-UHFFFAOYSA-H Synonym: ferric oxalate hexahydrate PubChem CID: 131849393 IUPAC Name: iron(3+);oxalate;hexahydrate SMILES: C(=O)(C(=O)[O-])[O-].C(=O)(C(=O)[O-])[O-].C(=O)(C(=O)[O-])[O-].O.O.O.O.O.O.[Fe+3].[Fe+3]
| PubChem CID | 131849393 |
|---|---|
| CAS | 166897-40-1 |
| Molecular Weight (g/mol) | 483.834 |
| MDL Number | MFCD00054430 |
| SMILES | C(=O)(C(=O)[O-])[O-].C(=O)(C(=O)[O-])[O-].C(=O)(C(=O)[O-])[O-].O.O.O.O.O.O.[Fe+3].[Fe+3] |
| Synonym | ferric oxalate hexahydrate |
| IUPAC Name | iron(3+);oxalate;hexahydrate |
| InChI Key | FWXIZVVTJVNNRX-UHFFFAOYSA-H |
| Molecular Formula | C6H12Fe2O18 |
Strontium oxalate, 95%, Thermo Scientific Chemicals
CAS: 814-95-9 Molecular Formula: C2O4Sr Molecular Weight (g/mol): 175.638 MDL Number: MFCD00050803 InChI Key: KQAGKTURZUKUCH-UHFFFAOYSA-L Synonym: strontium oxalate,unii-7iaw7e69ni,7iaw7e69ni,strontium oxalate, src2o4,ethanedioic acid, strontium salt 1:1,oxalic acid, monostrontium salt,strontium 2+ ion oxalate,oxalic acid, strontium salt 1:1 8ci PubChem CID: 69947 IUPAC Name: strontium;oxalate SMILES: C(=O)(C(=O)[O-])[O-].[Sr+2]
| PubChem CID | 69947 |
|---|---|
| CAS | 814-95-9 |
| Molecular Weight (g/mol) | 175.638 |
| MDL Number | MFCD00050803 |
| SMILES | C(=O)(C(=O)[O-])[O-].[Sr+2] |
| Synonym | strontium oxalate,unii-7iaw7e69ni,7iaw7e69ni,strontium oxalate, src2o4,ethanedioic acid, strontium salt 1:1,oxalic acid, monostrontium salt,strontium 2+ ion oxalate,oxalic acid, strontium salt 1:1 8ci |
| IUPAC Name | strontium;oxalate |
| InChI Key | KQAGKTURZUKUCH-UHFFFAOYSA-L |
| Molecular Formula | C2O4Sr |
Antimony(III) acetate, 97%
CAS: 6923-52-0 Molecular Formula: C6H9O6Sb Molecular Weight (g/mol): 298.892 MDL Number: MFCD00014974 InChI Key: JVLRYPRBKSMEBF-UHFFFAOYSA-K Synonym: antimony triacetate,antimony iii acetate,antimony acetate,acetic acid, antimony 3+ salt,octan antimonity czech,antimony 3+ triacetate,acetic acid, antimony 3+ salt 3:1,acetic acid, trianhydride with antimonic acid h3sbo3,acetic acid, antimony salt,octan antimonity PubChem CID: 23354 IUPAC Name: antimony(3+);triacetate SMILES: CC(=O)[O-].CC(=O)[O-].CC(=O)[O-].[Sb+3]
| PubChem CID | 23354 |
|---|---|
| CAS | 6923-52-0 |
| Molecular Weight (g/mol) | 298.892 |
| MDL Number | MFCD00014974 |
| SMILES | CC(=O)[O-].CC(=O)[O-].CC(=O)[O-].[Sb+3] |
| Synonym | antimony triacetate,antimony iii acetate,antimony acetate,acetic acid, antimony 3+ salt,octan antimonity czech,antimony 3+ triacetate,acetic acid, antimony 3+ salt 3:1,acetic acid, trianhydride with antimonic acid h3sbo3,acetic acid, antimony salt,octan antimonity |
| IUPAC Name | antimony(3+);triacetate |
| InChI Key | JVLRYPRBKSMEBF-UHFFFAOYSA-K |
| Molecular Formula | C6H9O6Sb |
Iron(II) oxalate hydrate, 96%
CAS: 516-03-0 Molecular Formula: C2FeO4 Molecular Weight (g/mol): 143.86 MDL Number: MFCD00012475 InChI Key: OWZIYWAUNZMLRT-UHFFFAOYSA-L Synonym: ferrous oxalate,iron ii oxalate,unii-dzp4yv3icv,dzp4yv3icv,iron protoxalate,iron, ethanedioato 2--.kappa.o1,.kappa.o2,iron 2+ oxalate,iron oxalate fec2o4,hsdb 463,iron 2+ ; oxalate PubChem CID: 10589 IUPAC Name: iron(2+);oxalate SMILES: [Fe++].[O-]C(=O)C([O-])=O
| PubChem CID | 10589 |
|---|---|
| CAS | 516-03-0 |
| Molecular Weight (g/mol) | 143.86 |
| MDL Number | MFCD00012475 |
| SMILES | [Fe++].[O-]C(=O)C([O-])=O |
| Synonym | ferrous oxalate,iron ii oxalate,unii-dzp4yv3icv,dzp4yv3icv,iron protoxalate,iron, ethanedioato 2--.kappa.o1,.kappa.o2,iron 2+ oxalate,iron oxalate fec2o4,hsdb 463,iron 2+ ; oxalate |
| IUPAC Name | iron(2+);oxalate |
| InChI Key | OWZIYWAUNZMLRT-UHFFFAOYSA-L |
| Molecular Formula | C2FeO4 |
Tin(II) oxalate
CAS: 814-94-8 Molecular Formula: C2O4Sn Molecular Weight (g/mol): 206.728 MDL Number: MFCD00040678 InChI Key: OQBLGYCUQGDOOR-UHFFFAOYSA-L Synonym: stannous oxalate,tin ii oxalate,tin oxalate,tin 2+ oxalate,ethanedioic acid, tin 2+ salt 1:1,stavelan cinaty czech,unii-sar72fe8eh,sar72fe8eh,stavelan cinaty PubChem CID: 13149 IUPAC Name: oxalate;tin(2+) SMILES: C(=O)(C(=O)[O-])[O-].[Sn+2]
| PubChem CID | 13149 |
|---|---|
| CAS | 814-94-8 |
| Molecular Weight (g/mol) | 206.728 |
| MDL Number | MFCD00040678 |
| SMILES | C(=O)(C(=O)[O-])[O-].[Sn+2] |
| Synonym | stannous oxalate,tin ii oxalate,tin oxalate,tin 2+ oxalate,ethanedioic acid, tin 2+ salt 1:1,stavelan cinaty czech,unii-sar72fe8eh,sar72fe8eh,stavelan cinaty |
| IUPAC Name | oxalate;tin(2+) |
| InChI Key | OQBLGYCUQGDOOR-UHFFFAOYSA-L |
| Molecular Formula | C2O4Sn |
Hydrazine sulfate, 99+%
CAS: 10034-93-2 Molecular Formula: H6N2O4S Molecular Weight (g/mol): 130.118 MDL Number: MFCD00044873 InChI Key: ZGCHATBSUIJLRL-UHFFFAOYSA-N Synonym: hydrazine sulfate,hydrazine monosulfate,hydrazine, sulfate,hydrazine sulphate,hydrazinium sulfate,hydrazonium sulfate,hydrazine sulfate 1:1,segidrin,sehydrin,diamine sulfate PubChem CID: 24842 IUPAC Name: hydrazine;sulfuric acid SMILES: NN.OS(=O)(=O)O
| PubChem CID | 24842 |
|---|---|
| CAS | 10034-93-2 |
| Molecular Weight (g/mol) | 130.118 |
| MDL Number | MFCD00044873 |
| SMILES | NN.OS(=O)(=O)O |
| Synonym | hydrazine sulfate,hydrazine monosulfate,hydrazine, sulfate,hydrazine sulphate,hydrazinium sulfate,hydrazonium sulfate,hydrazine sulfate 1:1,segidrin,sehydrin,diamine sulfate |
| IUPAC Name | hydrazine;sulfuric acid |
| InChI Key | ZGCHATBSUIJLRL-UHFFFAOYSA-N |
| Molecular Formula | H6N2O4S |
Isopropyl Acetate, 98%, Honeywell™
CAS: 108-21-4 Molecular Formula: C5H10O2 Molecular Weight (g/mol): 102.133 MDL Number: MFCD00008877 InChI Key: JMMWKPVZQRWMSS-UHFFFAOYSA-N Synonym: isopropyl acetate,2-propyl acetate,2-acetoxypropane,acetic acid, 1-methylethyl ester,isopropyl ethanoate,isopropylacetat,paracetat,isopropylacetaat,1-methylethyl acetate,acetic acid, isopropyl ester PubChem CID: 7915 IUPAC Name: propan-2-yl acetate SMILES: CC(C)OC(=O)C
| PubChem CID | 7915 |
|---|---|
| CAS | 108-21-4 |
| Molecular Weight (g/mol) | 102.133 |
| MDL Number | MFCD00008877 |
| SMILES | CC(C)OC(=O)C |
| Synonym | isopropyl acetate,2-propyl acetate,2-acetoxypropane,acetic acid, 1-methylethyl ester,isopropyl ethanoate,isopropylacetat,paracetat,isopropylacetaat,1-methylethyl acetate,acetic acid, isopropyl ester |
| IUPAC Name | propan-2-yl acetate |
| InChI Key | JMMWKPVZQRWMSS-UHFFFAOYSA-N |
| Molecular Formula | C5H10O2 |
Isobutyl Acetate, 99%, Honeywell™
CAS: 110-19-0 Molecular Formula: C6H12O2 Molecular Weight (g/mol): 116.16 MDL Number: MFCD00008932 InChI Key: GJRQTCIYDGXPES-UHFFFAOYSA-N Synonym: isobutyl acetate,isobutyl ethanoate,acetic acid, 2-methylpropyl ester,2-methyl-1-propyl acetate,2-methylpropyl ethanoate,acetic acid, isobutyl ester,acetic acid isobutyl ester,acetate d'isobutyle,iso-butyl acetate,beta-methylpropyl ethanoate PubChem CID: 8038 ChEBI: CHEBI:50569 IUPAC Name: 2-methylpropyl acetate SMILES: CC(C)COC(C)=O
| PubChem CID | 8038 |
|---|---|
| CAS | 110-19-0 |
| Molecular Weight (g/mol) | 116.16 |
| ChEBI | CHEBI:50569 |
| MDL Number | MFCD00008932 |
| SMILES | CC(C)COC(C)=O |
| Synonym | isobutyl acetate,isobutyl ethanoate,acetic acid, 2-methylpropyl ester,2-methyl-1-propyl acetate,2-methylpropyl ethanoate,acetic acid, isobutyl ester,acetic acid isobutyl ester,acetate d'isobutyle,iso-butyl acetate,beta-methylpropyl ethanoate |
| IUPAC Name | 2-methylpropyl acetate |
| InChI Key | GJRQTCIYDGXPES-UHFFFAOYSA-N |
| Molecular Formula | C6H12O2 |