Organonitrogen Compounds
Filtered Search Results
Guanidine hydrochloride, 98%
CAS: 50-01-1 Molecular Formula: CH6ClN3 Molecular Weight (g/mol): 95.53 MDL Number: MFCD00013026 InChI Key: PJJJBBJSCAKJQF-UHFFFAOYSA-N Synonym: guanidine hydrochloride,guanidinium chloride,guanidine, monohydrochloride,aminoformamidine hydrochloride,aminomethanamidine hydrochloride,guanidine monohydrochloride,guanidine hcl,guanidine chloride,iminourea hydrochloride,carbamidine hydrochloride PubChem CID: 5742 ChEBI: CHEBI:32735 IUPAC Name: guanidine;hydrochloride SMILES: C(=N)(N)N.Cl
| PubChem CID | 5742 |
|---|---|
| CAS | 50-01-1 |
| Molecular Weight (g/mol) | 95.53 |
| ChEBI | CHEBI:32735 |
| MDL Number | MFCD00013026 |
| SMILES | C(=N)(N)N.Cl |
| Synonym | guanidine hydrochloride,guanidinium chloride,guanidine, monohydrochloride,aminoformamidine hydrochloride,aminomethanamidine hydrochloride,guanidine monohydrochloride,guanidine hcl,guanidine chloride,iminourea hydrochloride,carbamidine hydrochloride |
| IUPAC Name | guanidine;hydrochloride |
| InChI Key | PJJJBBJSCAKJQF-UHFFFAOYSA-N |
| Molecular Formula | CH6ClN3 |
N-(1-Naphthyl)ethylenediamine dihydrochloride, 96%
CAS: 1465-25-4 Molecular Formula: C12H16Cl2N2 Molecular Weight (g/mol): 259.174 MDL Number: MFCD00012556 InChI Key: MZNYWPRCVDMOJG-UHFFFAOYSA-N Synonym: n-1-naphthyl ethylenediamine dihydrochloride,n1-naphthalen-1-yl ethane-1,2-diamine dihydrochloride,marshall's reagent,n-1-naphthylethylenediamine dihydrochloride,ccris 425,unii-h734599kjl,1,2-ethanediamine, n-1-naphthalenyl-, dihydrochloride,2-1-naphthylamino ethylamine 2hcl,bratton-marshall reagent,n-1-naphthalenyl-1,2-ethanediamine dihydrochloride PubChem CID: 15106 ChEBI: CHEBI:53452 IUPAC Name: N'-naphthalen-1-ylethane-1,2-diamine;dihydrochloride SMILES: C1=CC=C2C(=C1)C=CC=C2NCCN.Cl.Cl
| PubChem CID | 15106 |
|---|---|
| CAS | 1465-25-4 |
| Molecular Weight (g/mol) | 259.174 |
| ChEBI | CHEBI:53452 |
| MDL Number | MFCD00012556 |
| SMILES | C1=CC=C2C(=C1)C=CC=C2NCCN.Cl.Cl |
| Synonym | n-1-naphthyl ethylenediamine dihydrochloride,n1-naphthalen-1-yl ethane-1,2-diamine dihydrochloride,marshall's reagent,n-1-naphthylethylenediamine dihydrochloride,ccris 425,unii-h734599kjl,1,2-ethanediamine, n-1-naphthalenyl-, dihydrochloride,2-1-naphthylamino ethylamine 2hcl,bratton-marshall reagent,n-1-naphthalenyl-1,2-ethanediamine dihydrochloride |
| IUPAC Name | N'-naphthalen-1-ylethane-1,2-diamine;dihydrochloride |
| InChI Key | MZNYWPRCVDMOJG-UHFFFAOYSA-N |
| Molecular Formula | C12H16Cl2N2 |
Choline chloride, 98+%
CAS: 67-48-1 Molecular Formula: C5H14ClNO Molecular Weight (g/mol): 139.62 MDL Number: MFCD00011721 InChI Key: SGMZJAMFUVOLNK-UHFFFAOYSA-M Synonym: choline chloride,hepacholine,biocolina,biocoline,lipotril,paresan,luridin chloride,choline hydrochloride,cholinium chloride,bilineurin chloride PubChem CID: 6209 ChEBI: CHEBI:133341 IUPAC Name: 2-hydroxyethyl(trimethyl)azanium;chloride SMILES: [Cl-].C[N+](C)(C)CCO
| PubChem CID | 6209 |
|---|---|
| CAS | 67-48-1 |
| Molecular Weight (g/mol) | 139.62 |
| ChEBI | CHEBI:133341 |
| MDL Number | MFCD00011721 |
| SMILES | [Cl-].C[N+](C)(C)CCO |
| Synonym | choline chloride,hepacholine,biocolina,biocoline,lipotril,paresan,luridin chloride,choline hydrochloride,cholinium chloride,bilineurin chloride |
| IUPAC Name | 2-hydroxyethyl(trimethyl)azanium;chloride |
| InChI Key | SGMZJAMFUVOLNK-UHFFFAOYSA-M |
| Molecular Formula | C5H14ClNO |
Paraffin Liquid, Pure, Water White, d=0.83-0.86, Fisher Chemical™
CAS: 8042-47-5 Molecular Formula: C16H10N2Na2O7S2 Molecular Weight (g/mol): 452.363 MDL Number: 131611 InChI Key: AEOVEGJBKQQFOP-DDVLFWKVSA-L Synonym: acid orange 10,wool orange 2g,orange g,c.i. acid orange 10,c.i. orange g,c.i. food orange 4,light orange g,colacid orange g,dolkwal orange g,hexacol orange g PubChem CID: 9566064 IUPAC Name: disodium;(8Z)-7-oxo-8-(phenylhydrazinylidene)naphthalene-1,3-disulfonate SMILES: C1=CC=C(C=C1)NN=C2C(=O)C=CC3=CC(=CC(=C32)S(=O)(=O)[O-])S(=O)(=O)[O-].[Na+].[Na+]
| PubChem CID | 9566064 |
|---|---|
| CAS | 8042-47-5 |
| Molecular Weight (g/mol) | 452.363 |
| MDL Number | 131611 |
| SMILES | C1=CC=C(C=C1)NN=C2C(=O)C=CC3=CC(=CC(=C32)S(=O)(=O)[O-])S(=O)(=O)[O-].[Na+].[Na+] |
| Synonym | acid orange 10,wool orange 2g,orange g,c.i. acid orange 10,c.i. orange g,c.i. food orange 4,light orange g,colacid orange g,dolkwal orange g,hexacol orange g |
| IUPAC Name | disodium;(8Z)-7-oxo-8-(phenylhydrazinylidene)naphthalene-1,3-disulfonate |
| InChI Key | AEOVEGJBKQQFOP-DDVLFWKVSA-L |
| Molecular Formula | C16H10N2Na2O7S2 |
Diethanolamine, 99%
CAS: 111-42-2 Molecular Formula: C4H11NO2 Molecular Weight (g/mol): 105.14 MDL Number: MFCD00002843 InChI Key: ZBCBWPMODOFKDW-UHFFFAOYSA-N Synonym: diethanolamine,2,2'-iminodiethanol,diolamine,iminodiethanol,bis 2-hydroxyethyl amine,diethylolamine,n,n-diethanolamine,diethanolamin,2,2'-dihydroxydiethylamine,ethanol, 2,2'-iminobis PubChem CID: 8113 ChEBI: CHEBI:28123 IUPAC Name: 2-(2-hydroxyethylamino)ethanol SMILES: OCCNCCO
| PubChem CID | 8113 |
|---|---|
| CAS | 111-42-2 |
| Molecular Weight (g/mol) | 105.14 |
| ChEBI | CHEBI:28123 |
| MDL Number | MFCD00002843 |
| SMILES | OCCNCCO |
| Synonym | diethanolamine,2,2'-iminodiethanol,diolamine,iminodiethanol,bis 2-hydroxyethyl amine,diethylolamine,n,n-diethanolamine,diethanolamin,2,2'-dihydroxydiethylamine,ethanol, 2,2'-iminobis |
| IUPAC Name | 2-(2-hydroxyethylamino)ethanol |
| InChI Key | ZBCBWPMODOFKDW-UHFFFAOYSA-N |
| Molecular Formula | C4H11NO2 |
Tetrabutylammonium bromide, 99+%
CAS: 1643-19-2 Molecular Formula: C16H36BrN Molecular Weight (g/mol): 322.36 MDL Number: MFCD00011633 InChI Key: JRMUNVKIHCOMHV-UHFFFAOYSA-M Synonym: tetrabutylammonium bromide,tetra-n-butylammonium bromide,tbab,tetrabutylazanium bromide,tetrabutyl ammonium bromide,tetrabutyl-ammonium bromide,aliquat 100,tbabr,ipc-tba-br,unii-vjz168i98r PubChem CID: 74236 ChEBI: CHEBI:51993 IUPAC Name: tetrabutylazanium;bromide SMILES: CCCC[N+](CCCC)(CCCC)CCCC.[Br-]
| PubChem CID | 74236 |
|---|---|
| CAS | 1643-19-2 |
| Molecular Weight (g/mol) | 322.36 |
| ChEBI | CHEBI:51993 |
| MDL Number | MFCD00011633 |
| SMILES | CCCC[N+](CCCC)(CCCC)CCCC.[Br-] |
| Synonym | tetrabutylammonium bromide,tetra-n-butylammonium bromide,tbab,tetrabutylazanium bromide,tetrabutyl ammonium bromide,tetrabutyl-ammonium bromide,aliquat 100,tbabr,ipc-tba-br,unii-vjz168i98r |
| IUPAC Name | tetrabutylazanium;bromide |
| InChI Key | JRMUNVKIHCOMHV-UHFFFAOYSA-M |
| Molecular Formula | C16H36BrN |
2-Amino-2-methyl-1-propanol, 99%
CAS: 124-68-5 Molecular Formula: C4H11NO Molecular Weight (g/mol): 89.14 MDL Number: MFCD00008051 InChI Key: CBTVGIZVANVGBH-UHFFFAOYSA-N Synonym: 2-amino-2-methyl-1-propanol,isobutanol-2-amine,1-propanol, 2-amino-2-methyl,amp regular,2-aminoisobutanol,aminomethylpropanol,2-amino-2-methylpropanol,2-methyl-2-aminopropanol,2-aminodimethylethanol,hydroxy-tert-butylamine PubChem CID: 11807 IUPAC Name: 2-amino-2-methylpropan-1-ol SMILES: CC(C)(N)CO
| PubChem CID | 11807 |
|---|---|
| CAS | 124-68-5 |
| Molecular Weight (g/mol) | 89.14 |
| MDL Number | MFCD00008051 |
| SMILES | CC(C)(N)CO |
| Synonym | 2-amino-2-methyl-1-propanol,isobutanol-2-amine,1-propanol, 2-amino-2-methyl,amp regular,2-aminoisobutanol,aminomethylpropanol,2-amino-2-methylpropanol,2-methyl-2-aminopropanol,2-aminodimethylethanol,hydroxy-tert-butylamine |
| IUPAC Name | 2-amino-2-methylpropan-1-ol |
| InChI Key | CBTVGIZVANVGBH-UHFFFAOYSA-N |
| Molecular Formula | C4H11NO |
N,N-Diethyl-p-phenylenediamine sulfate, 99%
CAS: 6283-63-2 Molecular Formula: C10H16N2·H2SO4 Molecular Weight (g/mol): 262.33 MDL Number: MFCD00012993 InChI Key: AYLDJQABCMPYEN-UHFFFAOYSA-N Synonym: n,n-diethyl-p-phenylenediamine sulfate,n1,n1-diethylbenzene-1,4-diamine sulfate,4-amino-n,n-diethylaniline sulfate,diethyl-p-phenylenediamine sulfate,n,n-diethyl-1,4-phenylenediamine sulfate,unii-usp19t3gda,1,4-benzenediamine, n,n-diethyl-, sulfate 1:1,1,4-benzenediamine, n,n-diethyl-, sulfate,n,n-diethyl-1,4-benzenediamine sulfate,p-phenylenediamine, n,n-diethyl-, sulfate 1:1 PubChem CID: 80166 IUPAC Name: 4-N,4-N-diethylbenzene-1,4-diamine;sulfuric acid SMILES: CCN(CC)C1=CC=C(C=C1)N.OS(=O)(=O)O
| PubChem CID | 80166 |
|---|---|
| CAS | 6283-63-2 |
| Molecular Weight (g/mol) | 262.33 |
| MDL Number | MFCD00012993 |
| SMILES | CCN(CC)C1=CC=C(C=C1)N.OS(=O)(=O)O |
| Synonym | n,n-diethyl-p-phenylenediamine sulfate,n1,n1-diethylbenzene-1,4-diamine sulfate,4-amino-n,n-diethylaniline sulfate,diethyl-p-phenylenediamine sulfate,n,n-diethyl-1,4-phenylenediamine sulfate,unii-usp19t3gda,1,4-benzenediamine, n,n-diethyl-, sulfate 1:1,1,4-benzenediamine, n,n-diethyl-, sulfate,n,n-diethyl-1,4-benzenediamine sulfate,p-phenylenediamine, n,n-diethyl-, sulfate 1:1 |
| IUPAC Name | 4-N,4-N-diethylbenzene-1,4-diamine;sulfuric acid |
| InChI Key | AYLDJQABCMPYEN-UHFFFAOYSA-N |
| Molecular Formula | C10H16N2·H2SO4 |
Mineral oil, high purity
CAS: 8042-47-5 Molecular Formula: C16H10N2Na2O7S2 Molecular Weight (g/mol): 452.363 MDL Number: MFCD00131611 InChI Key: AEOVEGJBKQQFOP-DDVLFWKVSA-L Synonym: acid orange 10,wool orange 2g,orange g,c.i. acid orange 10,c.i. orange g,c.i. food orange 4,light orange g,colacid orange g,dolkwal orange g,hexacol orange g PubChem CID: 9566064 IUPAC Name: disodium;(8Z)-7-oxo-8-(phenylhydrazinylidene)naphthalene-1,3-disulfonate SMILES: C1=CC=C(C=C1)NN=C2C(=O)C=CC3=CC(=CC(=C32)S(=O)(=O)[O-])S(=O)(=O)[O-].[Na+].[Na+]
| PubChem CID | 9566064 |
|---|---|
| CAS | 8042-47-5 |
| Molecular Weight (g/mol) | 452.363 |
| MDL Number | MFCD00131611 |
| SMILES | C1=CC=C(C=C1)NN=C2C(=O)C=CC3=CC(=CC(=C32)S(=O)(=O)[O-])S(=O)(=O)[O-].[Na+].[Na+] |
| Synonym | acid orange 10,wool orange 2g,orange g,c.i. acid orange 10,c.i. orange g,c.i. food orange 4,light orange g,colacid orange g,dolkwal orange g,hexacol orange g |
| IUPAC Name | disodium;(8Z)-7-oxo-8-(phenylhydrazinylidene)naphthalene-1,3-disulfonate |
| InChI Key | AEOVEGJBKQQFOP-DDVLFWKVSA-L |
| Molecular Formula | C16H10N2Na2O7S2 |
Tetramethylammonium hydrogensulfate, 99+%, HPLC grade
Greener Choice Product
This product offers one or more environmental benefits itemized in the U.S. FTC Green Guides.
Learn More About the Greener Choice Program
This product offers one or more environmental benefits itemized in the U.S. FTC Green Guides.
Learn More About the Greener Choice Program
CAS: 80526-82-5 Molecular Formula: C4H13NO4S Molecular Weight (g/mol): 171.21 MDL Number: MFCD00036149 InChI Key: DWTYPCUOWWOADE-UHFFFAOYSA-M Synonym: tetramethylammonium hydrogen sulfate,tetramethylammonium bisulfate,tetramethylammonium hydrogen sulphate,tetramethylammonium hydrogensulfate,hydrogen sulfate; tetramethylazanium,methanaminium, n,n,n-trimethyl-, sulfate 1:1,hydrogen sulfate; tetramethylammonium,acmc-209pjn,ch3 4n hso4 .h2o,tetramethylammonium bisulfate solution PubChem CID: 157340 IUPAC Name: hydrogen sulfate;tetramethylazanium SMILES: C[N+](C)(C)C.OS(=O)(=O)[O-]
| PubChem CID | 157340 |
|---|---|
| CAS | 80526-82-5 |
| Molecular Weight (g/mol) | 171.21 |
| MDL Number | MFCD00036149 |
| SMILES | C[N+](C)(C)C.OS(=O)(=O)[O-] |
| Synonym | tetramethylammonium hydrogen sulfate,tetramethylammonium bisulfate,tetramethylammonium hydrogen sulphate,tetramethylammonium hydrogensulfate,hydrogen sulfate; tetramethylazanium,methanaminium, n,n,n-trimethyl-, sulfate 1:1,hydrogen sulfate; tetramethylammonium,acmc-209pjn,ch3 4n hso4 .h2o,tetramethylammonium bisulfate solution |
| IUPAC Name | hydrogen sulfate;tetramethylazanium |
| InChI Key | DWTYPCUOWWOADE-UHFFFAOYSA-M |
| Molecular Formula | C4H13NO4S |
Thermo Scientific Chemicals Tris(hydroxymethyl)aminomethane, 99.85%, for molecular biology, DNAse, RNAse and Protease free
CAS: 77-86-1 Molecular Formula: C4H11NO3 Molecular Weight (g/mol): 121.14 MDL Number: MFCD00004679 InChI Key: LENZDBCJOHFCAS-UHFFFAOYSA-N Synonym: trometamol,tris,tromethamine,tris hydroxymethyl aminomethane,tham,trisamine,tris buffer,trizma,2-amino-2-hydroxymethyl propane-1,3-diol,tris base PubChem CID: 6503 ChEBI: CHEBI:9754 IUPAC Name: 2-amino-2-(hydroxymethyl)propane-1,3-diol SMILES: C(C(CO)(CO)N)O
| PubChem CID | 6503 |
|---|---|
| CAS | 77-86-1 |
| Molecular Weight (g/mol) | 121.14 |
| ChEBI | CHEBI:9754 |
| MDL Number | MFCD00004679 |
| SMILES | C(C(CO)(CO)N)O |
| Synonym | trometamol,tris,tromethamine,tris hydroxymethyl aminomethane,tham,trisamine,tris buffer,trizma,2-amino-2-hydroxymethyl propane-1,3-diol,tris base |
| IUPAC Name | 2-amino-2-(hydroxymethyl)propane-1,3-diol |
| InChI Key | LENZDBCJOHFCAS-UHFFFAOYSA-N |
| Molecular Formula | C4H11NO3 |
Mineral oil, for spectroscopy, suitable for nujol mull preparations for IR-spect.
CAS: 8042-47-5 Molecular Formula: C16H10N2Na2O7S2 Molecular Weight (g/mol): 452.363 MDL Number: MFCD00131611 InChI Key: AEOVEGJBKQQFOP-DDVLFWKVSA-L Synonym: acid orange 10,wool orange 2g,orange g,c.i. acid orange 10,c.i. orange g,c.i. food orange 4,light orange g,colacid orange g,dolkwal orange g,hexacol orange g PubChem CID: 9566064 IUPAC Name: disodium;(8Z)-7-oxo-8-(phenylhydrazinylidene)naphthalene-1,3-disulfonate SMILES: C1=CC=C(C=C1)NN=C2C(=O)C=CC3=CC(=CC(=C32)S(=O)(=O)[O-])S(=O)(=O)[O-].[Na+].[Na+]
| PubChem CID | 9566064 |
|---|---|
| CAS | 8042-47-5 |
| Molecular Weight (g/mol) | 452.363 |
| MDL Number | MFCD00131611 |
| SMILES | C1=CC=C(C=C1)NN=C2C(=O)C=CC3=CC(=CC(=C32)S(=O)(=O)[O-])S(=O)(=O)[O-].[Na+].[Na+] |
| Synonym | acid orange 10,wool orange 2g,orange g,c.i. acid orange 10,c.i. orange g,c.i. food orange 4,light orange g,colacid orange g,dolkwal orange g,hexacol orange g |
| IUPAC Name | disodium;(8Z)-7-oxo-8-(phenylhydrazinylidene)naphthalene-1,3-disulfonate |
| InChI Key | AEOVEGJBKQQFOP-DDVLFWKVSA-L |
| Molecular Formula | C16H10N2Na2O7S2 |
2-Amino-2-methyl-1-propanol, 95%, may cont. ca 5% water
CAS: 124-68-5 Molecular Formula: C4H11NO Molecular Weight (g/mol): 89.14 MDL Number: MFCD00008051 InChI Key: CBTVGIZVANVGBH-UHFFFAOYSA-N Synonym: 2-amino-2-methyl-1-propanol,isobutanol-2-amine,1-propanol, 2-amino-2-methyl,amp regular,2-aminoisobutanol,aminomethylpropanol,2-amino-2-methylpropanol,2-methyl-2-aminopropanol,2-aminodimethylethanol,hydroxy-tert-butylamine PubChem CID: 11807 IUPAC Name: 2-amino-2-methylpropan-1-ol SMILES: CC(C)(N)CO
| PubChem CID | 11807 |
|---|---|
| CAS | 124-68-5 |
| Molecular Weight (g/mol) | 89.14 |
| MDL Number | MFCD00008051 |
| SMILES | CC(C)(N)CO |
| Synonym | 2-amino-2-methyl-1-propanol,isobutanol-2-amine,1-propanol, 2-amino-2-methyl,amp regular,2-aminoisobutanol,aminomethylpropanol,2-amino-2-methylpropanol,2-methyl-2-aminopropanol,2-aminodimethylethanol,hydroxy-tert-butylamine |
| IUPAC Name | 2-amino-2-methylpropan-1-ol |
| InChI Key | CBTVGIZVANVGBH-UHFFFAOYSA-N |
| Molecular Formula | C4H11NO |
Thermo Scientific Chemicals Tris(hydroxymethyl)aminomethane hydrochloride, 99+%
CAS: 1185-53-1 Molecular Formula: C4H12ClNO3 Molecular Weight (g/mol): 157.594 MDL Number: MFCD00012590 InChI Key: QKNYBSVHEMOAJP-UHFFFAOYSA-N Synonym: tris hydrochloride,tris hydroxymethyl aminomethane hydrochloride,2-amino-2-hydroxymethyl propane-1,3-diol hydrochloride,tromethamine hydrochloride,tris hcl,Tris-HCl,2-amino-2-hydroxymethyl-1,3-propanediol hydrochloride,tris buffer hydrochloride,1,3-propanediol, 2-amino-2-hydroxymethyl-, hydrochloride PubChem CID: 93573 IUPAC Name: 2-amino-2-(hydroxymethyl)propane-1,3-diol;hydrochloride SMILES: C(C(CO)(CO)N)O.Cl
| PubChem CID | 93573 |
|---|---|
| CAS | 1185-53-1 |
| Molecular Weight (g/mol) | 157.594 |
| MDL Number | MFCD00012590 |
| SMILES | C(C(CO)(CO)N)O.Cl |
| Synonym | tris hydrochloride,tris hydroxymethyl aminomethane hydrochloride,2-amino-2-hydroxymethyl propane-1,3-diol hydrochloride,tromethamine hydrochloride,tris hcl,Tris-HCl,2-amino-2-hydroxymethyl-1,3-propanediol hydrochloride,tris buffer hydrochloride,1,3-propanediol, 2-amino-2-hydroxymethyl-, hydrochloride |
| IUPAC Name | 2-amino-2-(hydroxymethyl)propane-1,3-diol;hydrochloride |
| InChI Key | QKNYBSVHEMOAJP-UHFFFAOYSA-N |
| Molecular Formula | C4H12ClNO3 |
Tartrazine
CAS: 1934-21-0 Molecular Formula: C16H9N4Na3O9S2 Molecular Weight (g/mol): 534.356 MDL Number: MFCD00148908 InChI Key: UJMBCXLDXJUMFB-UHFFFAOYSA-K Synonym: tartrazine,yellow 5,aizen tartrazine,trisodium salt,food yellow 4,tartrazine FD&C yellow #5,c.i. acid yellow 23,atul tartrazine,erio tartrazine,kako tartrazine PubChem CID: 164825 IUPAC Name: trisodium;5-oxo-1-(4-sulfonatophenyl)-4-[(4-sulfonatophenyl)diazenyl]-4H-pyrazole-3-carboxylate SMILES: C1=CC(=CC=C1N=NC2C(=NN(C2=O)C3=CC=C(C=C3)S(=O)(=O)[O-])C(=O)[O-])S(=O)(=O)[O-].[Na+].[Na+].[Na+]
| PubChem CID | 164825 |
|---|---|
| CAS | 1934-21-0 |
| Molecular Weight (g/mol) | 534.356 |
| MDL Number | MFCD00148908 |
| SMILES | C1=CC(=CC=C1N=NC2C(=NN(C2=O)C3=CC=C(C=C3)S(=O)(=O)[O-])C(=O)[O-])S(=O)(=O)[O-].[Na+].[Na+].[Na+] |
| Synonym | tartrazine,yellow 5,aizen tartrazine,trisodium salt,food yellow 4,tartrazine FD&C yellow #5,c.i. acid yellow 23,atul tartrazine,erio tartrazine,kako tartrazine |
| IUPAC Name | trisodium;5-oxo-1-(4-sulfonatophenyl)-4-[(4-sulfonatophenyl)diazenyl]-4H-pyrazole-3-carboxylate |
| InChI Key | UJMBCXLDXJUMFB-UHFFFAOYSA-K |
| Molecular Formula | C16H9N4Na3O9S2 |