Organooxygen compounds
Filtered Search Results
tert-Butyl acetoacetate, 97%
CAS: 1694-31-1 Molecular Formula: C8H14O3 Molecular Weight (g/mol): 158.2 MDL Number: MFCD00008811 InChI Key: JKUYRAMKJLMYLO-UHFFFAOYSA-N Synonym: tert-butyl acetoacetate,t-butyl acetoacetate,butanoic acid, 3-oxo-, 1,1-dimethylethyl ester,acetoacetic acid, tert-butyl ester,tert-butyl 3-oxobutyrate,acetoacetic acid tert-butyl ester,unii-1d3dos61gx,tbaa,1d3dos61gx,t-butylacetoacetate PubChem CID: 15538 IUPAC Name: tert-butyl 3-oxobutanoate SMILES: CC(=O)CC(=O)OC(C)(C)C
| PubChem CID | 15538 |
|---|---|
| CAS | 1694-31-1 |
| Molecular Weight (g/mol) | 158.2 |
| MDL Number | MFCD00008811 |
| SMILES | CC(=O)CC(=O)OC(C)(C)C |
| Synonym | tert-butyl acetoacetate,t-butyl acetoacetate,butanoic acid, 3-oxo-, 1,1-dimethylethyl ester,acetoacetic acid, tert-butyl ester,tert-butyl 3-oxobutyrate,acetoacetic acid tert-butyl ester,unii-1d3dos61gx,tbaa,1d3dos61gx,t-butylacetoacetate |
| IUPAC Name | tert-butyl 3-oxobutanoate |
| InChI Key | JKUYRAMKJLMYLO-UHFFFAOYSA-N |
| Molecular Formula | C8H14O3 |
Methyl-Tert-Butyl Ether, for HPLC, Fisher Chemical™
C5H12O, CAS Number-1634-04-4, mtbe, methyl tert-butyl ether, methyl t-butyl ether, 2-methyl-2-methoxypropane, methyl-tert-butyl ether, methyl tertiary-butyl ether, propane, 2-methoxy-2-methyl, methyl-t-butyl ether, tert-butyl methyl ether, t-butyl methyl ether, 2.5L, 54 deg.C, CHEBI:27642, Colorless
Methyl-Tert-Butyl Ether, Extra Pure, SLR, Fisher Chemical™
CAS: 1634-04-4 Molecular Formula: C5H12O Molecular Weight (g/mol): 88.15 MDL Number: 8812 InChI Key: BZLVMXJERCGZMT-UHFFFAOYSA-N Synonym: tert-butyl methyl ether,methyl tert-butyl ether,mtbe,methyl t-butyl ether,t-butyl methyl ether,methyl tertiary-butyl ether,propane, 2-methoxy-2-methyl,methyl-tert-butyl ether,methyl-t-butyl ether,2-methyl-2-methoxypropane PubChem CID: 15413 ChEBI: CHEBI:27642 IUPAC Name: 2-methoxy-2-methylpropane SMILES: CC(C)(C)OC
| PubChem CID | 15413 |
|---|---|
| CAS | 1634-04-4 |
| Molecular Weight (g/mol) | 88.15 |
| ChEBI | CHEBI:27642 |
| MDL Number | 8812 |
| SMILES | CC(C)(C)OC |
| Synonym | tert-butyl methyl ether,methyl tert-butyl ether,mtbe,methyl t-butyl ether,t-butyl methyl ether,methyl tertiary-butyl ether,propane, 2-methoxy-2-methyl,methyl-tert-butyl ether,methyl-t-butyl ether,2-methyl-2-methoxypropane |
| IUPAC Name | 2-methoxy-2-methylpropane |
| InChI Key | BZLVMXJERCGZMT-UHFFFAOYSA-N |
| Molecular Formula | C5H12O |
Di-tert-butyl malonate, 98+%, stab. with potassium carbonate
CAS: 541-16-2 Molecular Formula: C11H20O4 Molecular Weight (g/mol): 216.277 MDL Number: MFCD00008810 InChI Key: CLPHAYNBNTVRDI-UHFFFAOYSA-N Synonym: di-tert-butyl malonate,malonic acid di-tert-butyl ester,propanedioic acid, bis 1,1-dimethylethyl ester,di-t-butylmalonate,di-t-butyl malonate,unii-7e9xwt9380,1,3-di-tert-butyl propanedioate,di tert-butyl malonate,tert-butyl 2-tert-butoxycarbonyl acetate,di-tert-butyl malonate, stab. with potassium carbonate PubChem CID: 68324 IUPAC Name: ditert-butyl propanedioate SMILES: CC(C)(C)OC(=O)CC(=O)OC(C)(C)C
| PubChem CID | 68324 |
|---|---|
| CAS | 541-16-2 |
| Molecular Weight (g/mol) | 216.277 |
| MDL Number | MFCD00008810 |
| SMILES | CC(C)(C)OC(=O)CC(=O)OC(C)(C)C |
| Synonym | di-tert-butyl malonate,malonic acid di-tert-butyl ester,propanedioic acid, bis 1,1-dimethylethyl ester,di-t-butylmalonate,di-t-butyl malonate,unii-7e9xwt9380,1,3-di-tert-butyl propanedioate,di tert-butyl malonate,tert-butyl 2-tert-butoxycarbonyl acetate,di-tert-butyl malonate, stab. with potassium carbonate |
| IUPAC Name | ditert-butyl propanedioate |
| InChI Key | CLPHAYNBNTVRDI-UHFFFAOYSA-N |
| Molecular Formula | C11H20O4 |
Di-tert-butyl malonate, 98%
CAS: 541-16-2 MDL Number: MFCD00008810 InChI Key: CLPHAYNBNTVRDI-UHFFFAOYSA-N Synonym: di-tert-butyl malonate,malonic acid di-tert-butyl ester,propanedioic acid, bis 1,1-dimethylethyl ester,di-t-butylmalonate,di-t-butyl malonate,unii-7e9xwt9380,1,3-di-tert-butyl propanedioate,di tert-butyl malonate,tert-butyl 2-tert-butoxycarbonyl acetate,di-tert-butyl malonate, stab. with potassium carbonate PubChem CID: 68324 IUPAC Name: ditert-butyl propanedioate SMILES: CC(C)(C)OC(=O)CC(=O)OC(C)(C)C
| PubChem CID | 68324 |
|---|---|
| CAS | 541-16-2 |
| MDL Number | MFCD00008810 |
| SMILES | CC(C)(C)OC(=O)CC(=O)OC(C)(C)C |
| Synonym | di-tert-butyl malonate,malonic acid di-tert-butyl ester,propanedioic acid, bis 1,1-dimethylethyl ester,di-t-butylmalonate,di-t-butyl malonate,unii-7e9xwt9380,1,3-di-tert-butyl propanedioate,di tert-butyl malonate,tert-butyl 2-tert-butoxycarbonyl acetate,di-tert-butyl malonate, stab. with potassium carbonate |
| IUPAC Name | ditert-butyl propanedioate |
| InChI Key | CLPHAYNBNTVRDI-UHFFFAOYSA-N |
tert-Butyl hydrogen malonate, 96%
CAS: 40052-13-9 Molecular Formula: C7H12O4 Molecular Weight (g/mol): 160.169 MDL Number: MFCD00191886 InChI Key: NGGGZUAEOKRHMA-UHFFFAOYSA-N Synonym: 3-tert-butoxy-3-oxopropanoic acid,malonic acid mono-tert-butyl ester,mono-tert-butyl malonate,2-tert-butoxycarbonyl acetic acid,tert-butyl hydrogen malonate,mono-t-butyl malonate,pubchem13754,malonicacidmono-tert-butylester,malonic acid mono t-butyl ester PubChem CID: 545853 IUPAC Name: 3-[(2-methylpropan-2-yl)oxy]-3-oxopropanoic acid SMILES: CC(C)(C)OC(=O)CC(=O)O
| PubChem CID | 545853 |
|---|---|
| CAS | 40052-13-9 |
| Molecular Weight (g/mol) | 160.169 |
| MDL Number | MFCD00191886 |
| SMILES | CC(C)(C)OC(=O)CC(=O)O |
| Synonym | 3-tert-butoxy-3-oxopropanoic acid,malonic acid mono-tert-butyl ester,mono-tert-butyl malonate,2-tert-butoxycarbonyl acetic acid,tert-butyl hydrogen malonate,mono-t-butyl malonate,pubchem13754,malonicacidmono-tert-butylester,malonic acid mono t-butyl ester |
| IUPAC Name | 3-[(2-methylpropan-2-yl)oxy]-3-oxopropanoic acid |
| InChI Key | NGGGZUAEOKRHMA-UHFFFAOYSA-N |
| Molecular Formula | C7H12O4 |
cis-4-(Boc-amino)cyclohexanol, 97%
CAS: 167081-25-6 Molecular Formula: C11H21NO3 Molecular Weight (g/mol): 215.29 MDL Number: MFCD03844613,MFCD03844614,MFCD06658349 InChI Key: DQARDWKWPIRJEH-UHFFFAOYSA-N Synonym: trans-4-boc-aminocyclohexanol,tert-butyl 4-hydroxycyclohexyl carbamate,boc-trans-4-aminocyclohexanol,4-boc-amino cyclohexanol,tert-butyl trans-4-hydroxycyclohexyl carbamate,tert-butyl n-4-hydroxycyclohexyl carbamate,tert-butyl cis-4-hydroxycyclohexylcarbamate,trans-n-boc-4-amino-cyclohexanol,4-n-boc-amino-cyclohexanol,tert-butyl cis-4-hydroxycyclohexyl carbamate PubChem CID: 1514287 IUPAC Name: tert-butyl N-(4-hydroxycyclohexyl)carbamate SMILES: CC(C)(C)OC(=O)NC1CCC(O)CC1
| PubChem CID | 1514287 |
|---|---|
| CAS | 167081-25-6 |
| Molecular Weight (g/mol) | 215.29 |
| MDL Number | MFCD03844613,MFCD03844614,MFCD06658349 |
| SMILES | CC(C)(C)OC(=O)NC1CCC(O)CC1 |
| Synonym | trans-4-boc-aminocyclohexanol,tert-butyl 4-hydroxycyclohexyl carbamate,boc-trans-4-aminocyclohexanol,4-boc-amino cyclohexanol,tert-butyl trans-4-hydroxycyclohexyl carbamate,tert-butyl n-4-hydroxycyclohexyl carbamate,tert-butyl cis-4-hydroxycyclohexylcarbamate,trans-n-boc-4-amino-cyclohexanol,4-n-boc-amino-cyclohexanol,tert-butyl cis-4-hydroxycyclohexyl carbamate |
| IUPAC Name | tert-butyl N-(4-hydroxycyclohexyl)carbamate |
| InChI Key | DQARDWKWPIRJEH-UHFFFAOYSA-N |
| Molecular Formula | C11H21NO3 |
Benzyl tert-butyl malonate, 95%
CAS: 72594-86-6 Molecular Formula: C14H18O4 Molecular Weight (g/mol): 250.294 MDL Number: MFCD01075175 InChI Key: XKXXXODAXXAFNP-UHFFFAOYSA-N Synonym: benzyl tert-butyl malonate,benzyltert-butylmalonate,tert-butyl benzyl malonate,1-benzyl 3-tert-butyl propanedioate,tert-butyl 2-benzyloxycarbonyl acetate,propanedioic acid, 1,1-dimethylethyl phenylmethyl ester,tert-butyl phenylmethyl propane-1,3-dioate,pubchem3938,t-butyl benzyl malonate,ksc493q0n PubChem CID: 2736712 IUPAC Name: 1-O-benzyl 3-O-tert-butyl propanedioate SMILES: CC(C)(C)OC(=O)CC(=O)OCC1=CC=CC=C1
| PubChem CID | 2736712 |
|---|---|
| CAS | 72594-86-6 |
| Molecular Weight (g/mol) | 250.294 |
| MDL Number | MFCD01075175 |
| SMILES | CC(C)(C)OC(=O)CC(=O)OCC1=CC=CC=C1 |
| Synonym | benzyl tert-butyl malonate,benzyltert-butylmalonate,tert-butyl benzyl malonate,1-benzyl 3-tert-butyl propanedioate,tert-butyl 2-benzyloxycarbonyl acetate,propanedioic acid, 1,1-dimethylethyl phenylmethyl ester,tert-butyl phenylmethyl propane-1,3-dioate,pubchem3938,t-butyl benzyl malonate,ksc493q0n |
| IUPAC Name | 1-O-benzyl 3-O-tert-butyl propanedioate |
| InChI Key | XKXXXODAXXAFNP-UHFFFAOYSA-N |
| Molecular Formula | C14H18O4 |
2-(Boc-amino)pyridine-5-carboxaldehyde, 97%, Thermo Scientific Chemicals
CAS: 199296-40-7 Molecular Formula: C11H14N2O3 Molecular Weight (g/mol): 222.244 MDL Number: MFCD08064228 InChI Key: WZROBBWIJBBWQP-UHFFFAOYSA-N Synonym: tert-butyl 5-formylpyridin-2-yl carbamate,tert-butyl 5-formylpyridin-2-ylcarbamate,tert-butyl n-5-formylpyridin-2-yl carbamate,2-boc-amino pyridine-5-carboxaldehyde,5-formyl-pyridin-2-yl-carbamic acid tert-butyl ester,5-formylpyridin-2-yl carbamic acid tert butyl ester,2-boc-aminopyridine-5-aldehyde,2-tert-butoxycarbonylamino pyridine-5-carboxaldehyde,carbamicacid, n-5-formyl-2-pyridinyl-, 1,1-dimethylethyl ester,6-aminonicotinaldehyde, 6-boc protected PubChem CID: 22034247 IUPAC Name: tert-butyl N-(5-formylpyridin-2-yl)carbamate SMILES: CC(C)(C)OC(=O)NC1=NC=C(C=C1)C=O
| PubChem CID | 22034247 |
|---|---|
| CAS | 199296-40-7 |
| Molecular Weight (g/mol) | 222.244 |
| MDL Number | MFCD08064228 |
| SMILES | CC(C)(C)OC(=O)NC1=NC=C(C=C1)C=O |
| Synonym | tert-butyl 5-formylpyridin-2-yl carbamate,tert-butyl 5-formylpyridin-2-ylcarbamate,tert-butyl n-5-formylpyridin-2-yl carbamate,2-boc-amino pyridine-5-carboxaldehyde,5-formyl-pyridin-2-yl-carbamic acid tert-butyl ester,5-formylpyridin-2-yl carbamic acid tert butyl ester,2-boc-aminopyridine-5-aldehyde,2-tert-butoxycarbonylamino pyridine-5-carboxaldehyde,carbamicacid, n-5-formyl-2-pyridinyl-, 1,1-dimethylethyl ester,6-aminonicotinaldehyde, 6-boc protected |
| IUPAC Name | tert-butyl N-(5-formylpyridin-2-yl)carbamate |
| InChI Key | WZROBBWIJBBWQP-UHFFFAOYSA-N |
| Molecular Formula | C11H14N2O3 |
Diethyl tert-butylmalonate, 96%
CAS: 759-24-0 Molecular Formula: C11H20O4 Molecular Weight (g/mol): 216.28 MDL Number: MFCD00009152 InChI Key: RJNICNBRGVKNSR-UHFFFAOYSA-N Synonym: diethyl tert-butylmalonate,diethyl t-butylmalonate,diethyl 1,1-dimethylethyl malonate,diethyl 2-tert-butyl malonate,propanedioic acid, 1,1-dimethylethyl-, diethyl ester,diethyltert-butylmalonate,diethyl 2-tert-butylmalonate #,tert-butylmalonic acid diethyl ester,1,3-diethyl 2-tert-butylpropanedioate PubChem CID: 69798 IUPAC Name: diethyl 2-tert-butylpropanedioate SMILES: CCOC(=O)C(C(=O)OCC)C(C)(C)C
| PubChem CID | 69798 |
|---|---|
| CAS | 759-24-0 |
| Molecular Weight (g/mol) | 216.28 |
| MDL Number | MFCD00009152 |
| SMILES | CCOC(=O)C(C(=O)OCC)C(C)(C)C |
| Synonym | diethyl tert-butylmalonate,diethyl t-butylmalonate,diethyl 1,1-dimethylethyl malonate,diethyl 2-tert-butyl malonate,propanedioic acid, 1,1-dimethylethyl-, diethyl ester,diethyltert-butylmalonate,diethyl 2-tert-butylmalonate #,tert-butylmalonic acid diethyl ester,1,3-diethyl 2-tert-butylpropanedioate |
| IUPAC Name | diethyl 2-tert-butylpropanedioate |
| InChI Key | RJNICNBRGVKNSR-UHFFFAOYSA-N |
| Molecular Formula | C11H20O4 |
tert-Butyl ethyl malonate, 95%
CAS: 32864-38-3 Molecular Formula: C9H16O4 Molecular Weight (g/mol): 188.223 MDL Number: MFCD00009193 InChI Key: OCOBFMZGRJOSOU-UHFFFAOYSA-N Synonym: tert-butyl ethyl malonate,t-butyl ethyl malonate,propanedioic acid, 1,1-dimethylethyl ethyl ester,1-tert-butyl 3-ethyl propanedioate,tert-butyl ethyl propanedioate,malonic acid tert-butyl ethyl ester,tert-butyl ethyl propane-1,3-dioate,zlchem 692,acmc-1cjju,1-tert-butyl ethyl malonate PubChem CID: 96345 IUPAC Name: 3-O-tert-butyl 1-O-ethyl propanedioate SMILES: CCOC(=O)CC(=O)OC(C)(C)C
| PubChem CID | 96345 |
|---|---|
| CAS | 32864-38-3 |
| Molecular Weight (g/mol) | 188.223 |
| MDL Number | MFCD00009193 |
| SMILES | CCOC(=O)CC(=O)OC(C)(C)C |
| Synonym | tert-butyl ethyl malonate,t-butyl ethyl malonate,propanedioic acid, 1,1-dimethylethyl ethyl ester,1-tert-butyl 3-ethyl propanedioate,tert-butyl ethyl propanedioate,malonic acid tert-butyl ethyl ester,tert-butyl ethyl propane-1,3-dioate,zlchem 692,acmc-1cjju,1-tert-butyl ethyl malonate |
| IUPAC Name | 3-O-tert-butyl 1-O-ethyl propanedioate |
| InChI Key | OCOBFMZGRJOSOU-UHFFFAOYSA-N |
| Molecular Formula | C9H16O4 |
4'-tert-Butylacetophenone, 98%
CAS: 943-27-1 Molecular Formula: C12H16O Molecular Weight (g/mol): 176.259 MDL Number: MFCD00017256 InChI Key: UYFJYGWNYQCHOB-UHFFFAOYSA-N Synonym: 4'-tert-butylacetophenone,1-4-tert-butylphenyl ethanone,4-tert-butylacetophenone,1-4-tert-butyl phenyl ethanone,p-tert-butylacetophenone,ethanone, 1-4-1,1-dimethylethyl phenyl,acetophenone, 4'-tert-butyl,1-4-tert-butyl phenyl ethan-1-one,p-t-butylacetophenone,1-4-tert-butyl-phenyl-ethanone PubChem CID: 13669 IUPAC Name: 1-(4-tert-butylphenyl)ethanone SMILES: CC(=O)C1=CC=C(C=C1)C(C)(C)C
| PubChem CID | 13669 |
|---|---|
| CAS | 943-27-1 |
| Molecular Weight (g/mol) | 176.259 |
| MDL Number | MFCD00017256 |
| SMILES | CC(=O)C1=CC=C(C=C1)C(C)(C)C |
| Synonym | 4'-tert-butylacetophenone,1-4-tert-butylphenyl ethanone,4-tert-butylacetophenone,1-4-tert-butyl phenyl ethanone,p-tert-butylacetophenone,ethanone, 1-4-1,1-dimethylethyl phenyl,acetophenone, 4'-tert-butyl,1-4-tert-butyl phenyl ethan-1-one,p-t-butylacetophenone,1-4-tert-butyl-phenyl-ethanone |
| IUPAC Name | 1-(4-tert-butylphenyl)ethanone |
| InChI Key | UYFJYGWNYQCHOB-UHFFFAOYSA-N |
| Molecular Formula | C12H16O |
tert.-Butyl methyl malonate, 95%
CAS: 42726-73-8 Molecular Formula: C8H14O4 Molecular Weight (g/mol): 174.2 MDL Number: MFCD00042856 InChI Key: XPSYZCWYRWHVCC-UHFFFAOYSA-N Synonym: tert-butyl methyl malonate,t-butyl methyl malonate,1-tert-butyl 3-methyl propanedioate,acmc-20ajkv,tert-butyl methylmalote,pubchem20476,methyl tert-butyl malonate,ksc493c8h,tert-butyl methyl malonaoate PubChem CID: 2733872 IUPAC Name: 3-O-tert-butyl 1-O-methyl propanedioate SMILES: CC(C)(C)OC(=O)CC(=O)OC
| PubChem CID | 2733872 |
|---|---|
| CAS | 42726-73-8 |
| Molecular Weight (g/mol) | 174.2 |
| MDL Number | MFCD00042856 |
| SMILES | CC(C)(C)OC(=O)CC(=O)OC |
| Synonym | tert-butyl methyl malonate,t-butyl methyl malonate,1-tert-butyl 3-methyl propanedioate,acmc-20ajkv,tert-butyl methylmalote,pubchem20476,methyl tert-butyl malonate,ksc493c8h,tert-butyl methyl malonaoate |
| IUPAC Name | 3-O-tert-butyl 1-O-methyl propanedioate |
| InChI Key | XPSYZCWYRWHVCC-UHFFFAOYSA-N |
| Molecular Formula | C8H14O4 |
4-tert-Butylcyclohexanol, 99%, mixture of isomers
CAS: 98-52-2 Molecular Formula: C10H20O Molecular Weight (g/mol): 156.27 MDL Number: MFCD00001473,MFCD00064952,MFCD00070476 InChI Key: CCOQPGVQAWPUPE-UHFFFAOYSA-N Synonym: 4-tert-butylcyclohexanol,cis-4-tert-butylcyclohexanol,trans-4-tert-butylcyclohexanol,4-tert-butyl cyclohexanol,cis-4-tert-butyl cyclohexanol,padaryl,p-tert-butylcyclohexanol,cyclohexanol, 4-1,1-dimethylethyl,cyclohexanol, 4-tert-butyl,4-t-butylcyclohexanol PubChem CID: 7391 IUPAC Name: 4-tert-butylcyclohexan-1-ol SMILES: CC(C)(C)C1CCC(O)CC1
| PubChem CID | 7391 |
|---|---|
| CAS | 98-52-2 |
| Molecular Weight (g/mol) | 156.27 |
| MDL Number | MFCD00001473,MFCD00064952,MFCD00070476 |
| SMILES | CC(C)(C)C1CCC(O)CC1 |
| Synonym | 4-tert-butylcyclohexanol,cis-4-tert-butylcyclohexanol,trans-4-tert-butylcyclohexanol,4-tert-butyl cyclohexanol,cis-4-tert-butyl cyclohexanol,padaryl,p-tert-butylcyclohexanol,cyclohexanol, 4-1,1-dimethylethyl,cyclohexanol, 4-tert-butyl,4-t-butylcyclohexanol |
| IUPAC Name | 4-tert-butylcyclohexan-1-ol |
| InChI Key | CCOQPGVQAWPUPE-UHFFFAOYSA-N |
| Molecular Formula | C10H20O |