Inorganic Salts
Filtered Search Results
Sand, washed
CAS: 14808-60-7 Molecular Formula: O2Si Molecular Weight (g/mol): 60.08 MDL Number: MFCD00011232,MFCD00217788,MFCD00163736,MFCD07370733 InChI Key: VYPSYNLAJGMNEJ-UHFFFAOYSA-N Synonym: silica,silicon dioxide,quartz,cristobalite,diatomaceous earth,tridymite,silicic anhydride,aerosil,infusorial earth,silica, amorphous PubChem CID: 24261 ChEBI: CHEBI:30563 IUPAC Name: dioxosilane SMILES: O=[Si]=O
| PubChem CID | 24261 |
|---|---|
| CAS | 14808-60-7 |
| Molecular Weight (g/mol) | 60.08 |
| ChEBI | CHEBI:30563 |
| MDL Number | MFCD00011232,MFCD00217788,MFCD00163736,MFCD07370733 |
| SMILES | O=[Si]=O |
| Synonym | silica,silicon dioxide,quartz,cristobalite,diatomaceous earth,tridymite,silicic anhydride,aerosil,infusorial earth,silica, amorphous |
| IUPAC Name | dioxosilane |
| InChI Key | VYPSYNLAJGMNEJ-UHFFFAOYSA-N |
| Molecular Formula | O2Si |
(3-Chloropropyl)trimethoxysilane, 97+%, packaged under Argon in resealable ChemSeal™ bottles
CAS: 2530-87-2 Molecular Formula: C6H15ClO3Si Molecular Weight (g/mol): 198.718 MDL Number: MFCD00000997 InChI Key: OXYZDRAJMHGSMW-UHFFFAOYSA-N Synonym: 3-chloropropyl trimethoxysilane,silane, 3-chloropropyl trimethoxy,3-chloropropyltrimethyoxysilane,sila-ace s 620,cps-m,silane 3-chloropropyl tris methoxy,3-trimethoxysilyl propyl chloride,unii-t21bnl1s7f,cptmo,3-chloropropyl trimethoxysilan PubChem CID: 62449 IUPAC Name: 3-chloropropyl(trimethoxy)silane SMILES: CO[Si](CCCCl)(OC)OC
| PubChem CID | 62449 |
|---|---|
| CAS | 2530-87-2 |
| Molecular Weight (g/mol) | 198.718 |
| MDL Number | MFCD00000997 |
| SMILES | CO[Si](CCCCl)(OC)OC |
| Synonym | 3-chloropropyl trimethoxysilane,silane, 3-chloropropyl trimethoxy,3-chloropropyltrimethyoxysilane,sila-ace s 620,cps-m,silane 3-chloropropyl tris methoxy,3-trimethoxysilyl propyl chloride,unii-t21bnl1s7f,cptmo,3-chloropropyl trimethoxysilan |
| IUPAC Name | 3-chloropropyl(trimethoxy)silane |
| InChI Key | OXYZDRAJMHGSMW-UHFFFAOYSA-N |
| Molecular Formula | C6H15ClO3Si |
Boron trifluoride diethyl etherate, 46.5% BF{3} min, packaged under Argon in resealable ChemSeal™ bottles
CAS: 109-63-7 Molecular Formula: C4H10BF3O Molecular Weight (g/mol): 141.93 MDL Number: MFCD00013194 InChI Key: KZMGYPLQYOPHEL-UHFFFAOYSA-N PubChem CID: 8000 SMILES: FB(F)F.CCOCC
| PubChem CID | 8000 |
|---|---|
| CAS | 109-63-7 |
| Molecular Weight (g/mol) | 141.93 |
| MDL Number | MFCD00013194 |
| SMILES | FB(F)F.CCOCC |
| InChI Key | KZMGYPLQYOPHEL-UHFFFAOYSA-N |
| Molecular Formula | C4H10BF3O |
Zinc chloride, 1M in diethyl ether, packaged under Argon in resealable ChemSeal™ bottles, Thermo Scientific Chemicals
CAS: 7646-85-7 Molecular Formula: Cl2Zn Molecular Weight (g/mol): 136.28 MDL Number: MFCD00011295 InChI Key: JIAARYAFYJHUJI-UHFFFAOYSA-L Synonym: zinc chloride,zinc dichloride,zinc chloride zncl2,zinc butter,zinc chloride fume,zinc ii chloride,zinkchloride,zintrace,zinc chloride, anhydrous,zine dichloride PubChem CID: 5727 ChEBI: CHEBI:49976 IUPAC Name: dichlorozinc SMILES: Cl[Zn]Cl
| PubChem CID | 5727 |
|---|---|
| CAS | 7646-85-7 |
| Molecular Weight (g/mol) | 136.28 |
| ChEBI | CHEBI:49976 |
| MDL Number | MFCD00011295 |
| SMILES | Cl[Zn]Cl |
| Synonym | zinc chloride,zinc dichloride,zinc chloride zncl2,zinc butter,zinc chloride fume,zinc ii chloride,zinkchloride,zintrace,zinc chloride, anhydrous,zine dichloride |
| IUPAC Name | dichlorozinc |
| InChI Key | JIAARYAFYJHUJI-UHFFFAOYSA-L |
| Molecular Formula | Cl2Zn |
Lithium bis(trimethylsilyl)amide, 20% (ca 1.06M) soln. in THF/ethylbenzene, packaged in resealable septum cap bottle
CAS: 4039-32-1 Molecular Formula: C6H18LiNSi2 Molecular Weight (g/mol): 167.327 MDL Number: MFCD00008261 InChI Key: YNESATAKKCNGOF-UHFFFAOYSA-N Synonym: lithium bis trimethylsilyl amide,lithium hexamethyldisilazide,lihmds,lhmds,hexamethyldisilazane lithium salt,unii-rc4n1i108m,lithiumbis trimethylsilyl amide,lithium bis trimethylsilyl azanide,lithium hexamethyldisilazane,lithium bis-trimethylsilyl amide PubChem CID: 2733832 IUPAC Name: lithium;bis(trimethylsilyl)azanide SMILES: [Li+].C[Si](C)(C)[N-][Si](C)(C)C
| PubChem CID | 2733832 |
|---|---|
| CAS | 4039-32-1 |
| Molecular Weight (g/mol) | 167.327 |
| MDL Number | MFCD00008261 |
| SMILES | [Li+].C[Si](C)(C)[N-][Si](C)(C)C |
| Synonym | lithium bis trimethylsilyl amide,lithium hexamethyldisilazide,lihmds,lhmds,hexamethyldisilazane lithium salt,unii-rc4n1i108m,lithiumbis trimethylsilyl amide,lithium bis trimethylsilyl azanide,lithium hexamethyldisilazane,lithium bis-trimethylsilyl amide |
| IUPAC Name | lithium;bis(trimethylsilyl)azanide |
| InChI Key | YNESATAKKCNGOF-UHFFFAOYSA-N |
| Molecular Formula | C6H18LiNSi2 |
Boron trifluoride-dimethyl sulfide complex, purified, packaged under Argon in resealable ChemSeal™ bottles, Thermo Scientific Chemicals
CAS: 353-43-5 Molecular Formula: C2H6BF3S Molecular Weight (g/mol): 129.94 MDL Number: MFCD00013193 InChI Key: BRWZPVRDOUWXKE-UHFFFAOYSA-N Synonym: boron fluoride-dimethyl sulfide complex,dimethyl-??-sulfanylidene trifluoro-??-borane,trifluoroborane-methyl sulfide,dimethyl sulfide-trifluoroborane,trifluoro methylsulfanyl methane boron,boron trifluoride methyl sulfide complex,boron trifluoride-methyl sulfide complex,boron trifluoride-dimethyl sulfide complex, purified, packaged under argon in resealable chemseal bottles PubChem CID: 71311438 IUPAC Name: dimethylsulfonio(trifluoro)boranuide SMILES: CSC.FB(F)F
| PubChem CID | 71311438 |
|---|---|
| CAS | 353-43-5 |
| Molecular Weight (g/mol) | 129.94 |
| MDL Number | MFCD00013193 |
| SMILES | CSC.FB(F)F |
| Synonym | boron fluoride-dimethyl sulfide complex,dimethyl-??-sulfanylidene trifluoro-??-borane,trifluoroborane-methyl sulfide,dimethyl sulfide-trifluoroborane,trifluoro methylsulfanyl methane boron,boron trifluoride methyl sulfide complex,boron trifluoride-methyl sulfide complex,boron trifluoride-dimethyl sulfide complex, purified, packaged under argon in resealable chemseal bottles |
| IUPAC Name | dimethylsulfonio(trifluoro)boranuide |
| InChI Key | BRWZPVRDOUWXKE-UHFFFAOYSA-N |
| Molecular Formula | C2H6BF3S |
Sea Sand, Acid Washed and Calcinated For Laboratory Use and DAB, Chem Lab
CAS: 14808-60-7 Molecular Formula: O2Si Molecular Weight (g/mol): 60.08 MDL Number: MFCD00011232,MFCD00217788,MFCD00163736,MFCD07370733 InChI Key: VYPSYNLAJGMNEJ-UHFFFAOYSA-N IUPAC Name: silanedione SMILES: O=[Si]=O
| CAS | 14808-60-7 |
|---|---|
| Molecular Weight (g/mol) | 60.08 |
| MDL Number | MFCD00011232,MFCD00217788,MFCD00163736,MFCD07370733 |
| SMILES | O=[Si]=O |
| IUPAC Name | silanedione |
| InChI Key | VYPSYNLAJGMNEJ-UHFFFAOYSA-N |
| Molecular Formula | O2Si |
Sodium carbonate, 99.5%, extra pure, anhydrous
CAS: 497-19-8 Molecular Formula: CNa2O3 Molecular Weight (g/mol): 105.99 MDL Number: MFCD00003494 InChI Key: CDBYLPFSWZWCQE-UHFFFAOYSA-L Synonym: sodium carbonate,disodium carbonate,soda ash,carbonic acid disodium salt,calcined soda,sodium carbonate, anhydrous,carbonic acid, disodium salt,washing soda,sodiumcarbonate,solvay soda PubChem CID: 10340 ChEBI: CHEBI:29377 SMILES: [Na+].[Na+].[O-]C([O-])=O
| PubChem CID | 10340 |
|---|---|
| CAS | 497-19-8 |
| Molecular Weight (g/mol) | 105.99 |
| ChEBI | CHEBI:29377 |
| MDL Number | MFCD00003494 |
| SMILES | [Na+].[Na+].[O-]C([O-])=O |
| Synonym | sodium carbonate,disodium carbonate,soda ash,carbonic acid disodium salt,calcined soda,sodium carbonate, anhydrous,carbonic acid, disodium salt,washing soda,sodiumcarbonate,solvay soda |
| InChI Key | CDBYLPFSWZWCQE-UHFFFAOYSA-L |
| Molecular Formula | CNa2O3 |
Aluminum chloride hexahydrate, 99%, pure
CAS: 7784-13-6 Molecular Formula: AlCl3H12O6 Molecular Weight (g/mol): 241.42 MDL Number: MFCD00149134 InChI Key: JGDITNMASUZKPW-UHFFFAOYSA-K SMILES: O.O.O.O.O.O.[Al+3].[Cl-].[Cl-].[Cl-]
| CAS | 7784-13-6 |
|---|---|
| Molecular Weight (g/mol) | 241.42 |
| MDL Number | MFCD00149134 |
| SMILES | O.O.O.O.O.O.[Al+3].[Cl-].[Cl-].[Cl-] |
| InChI Key | JGDITNMASUZKPW-UHFFFAOYSA-K |
| Molecular Formula | AlCl3H12O6 |
Sodium bisulfite, ACS reagent, powder
CAS: 7631-90-5 Molecular Formula: NaO3S Molecular Weight (g/mol): 103.05 MDL Number: MFCD00003530 InChI Key: DWAQJAXMDSEUJJ-UHFFFAOYSA-L Synonym: sodium bisulfite,sodium hydrogen sulfite,sodium bisulphite,sodium hydrogensulfite,sodium sulfhydrate,monosodium sulfite,uantax sbs,sulfurous acid, monosodium salt,caswell no. 750,hydrogen sodium sulfite PubChem CID: 23665763 ChEBI: CHEBI:26709 IUPAC Name: sodium sulfite SMILES: [Na+].[O-]S([O-])=O
| PubChem CID | 23665763 |
|---|---|
| CAS | 7631-90-5 |
| Molecular Weight (g/mol) | 103.05 |
| ChEBI | CHEBI:26709 |
| MDL Number | MFCD00003530 |
| SMILES | [Na+].[O-]S([O-])=O |
| Synonym | sodium bisulfite,sodium hydrogen sulfite,sodium bisulphite,sodium hydrogensulfite,sodium sulfhydrate,monosodium sulfite,uantax sbs,sulfurous acid, monosodium salt,caswell no. 750,hydrogen sodium sulfite |
| IUPAC Name | sodium sulfite |
| InChI Key | DWAQJAXMDSEUJJ-UHFFFAOYSA-L |
| Molecular Formula | NaO3S |
Iron(II) sulfate heptahydrate, 99.5%, for analysis
CAS: 7782-63-0 Molecular Formula: FeH14O11S Molecular Weight (g/mol): 278.01 MDL Number: MFCD00149719 InChI Key: SURQXAFEQWPFPV-UHFFFAOYSA-L Synonym: iron ii sulfate heptahydrate,ferrous sulfate heptahydrate,presfersul,melanterite mineral,iron sulfate heptahydrate,iron 2+ sulfate heptahydrate,fesofor,fesotyme,haemofort,ironate PubChem CID: 62662 ChEBI: CHEBI:75836 SMILES: O.O.O.O.O.O.O.[Fe++].[O-]S([O-])(=O)=O
| PubChem CID | 62662 |
|---|---|
| CAS | 7782-63-0 |
| Molecular Weight (g/mol) | 278.01 |
| ChEBI | CHEBI:75836 |
| MDL Number | MFCD00149719 |
| SMILES | O.O.O.O.O.O.O.[Fe++].[O-]S([O-])(=O)=O |
| Synonym | iron ii sulfate heptahydrate,ferrous sulfate heptahydrate,presfersul,melanterite mineral,iron sulfate heptahydrate,iron 2+ sulfate heptahydrate,fesofor,fesotyme,haemofort,ironate |
| InChI Key | SURQXAFEQWPFPV-UHFFFAOYSA-L |
| Molecular Formula | FeH14O11S |
Sodium polyphosphate, pure
CAS: 50813-16-6 Molecular Formula: (NaO3P)n MDL Number: MFCD00134118 Synonym: hexasodium oxido oxido phosphonatooxy phosphoryl oxy phosphoryl oxy phospho phosphonato oxy phosphinate IUPAC Name: Sodium polyphosphate SMILES: [Na]OP(-*)(=O)O-*
| CAS | 50813-16-6 |
|---|---|
| MDL Number | MFCD00134118 |
| SMILES | [Na]OP(-*)(=O)O-* |
| Synonym | hexasodium oxido oxido phosphonatooxy phosphoryl oxy phosphoryl oxy phospho phosphonato oxy phosphinate |
| IUPAC Name | Sodium polyphosphate |
| Molecular Formula | (NaO3P)n |
Calcium carbonate, 99+%, ACS reagent
CAS: 471-34-1 Molecular Formula: CCaO3 Molecular Weight (g/mol): 100.09 MDL Number: MFCD00010906 InChI Key: VTYYLEPIZMXCLO-UHFFFAOYSA-L Synonym: calcium carbonate,limestone,chalk,calcite,carbonic acid calcium salt 1:1,marble,calofort u,aragonite,aeromatt,akadama PubChem CID: 10112 ChEBI: CHEBI:3311 SMILES: [Ca++].[O-]C([O-])=O
| PubChem CID | 10112 |
|---|---|
| CAS | 471-34-1 |
| Molecular Weight (g/mol) | 100.09 |
| ChEBI | CHEBI:3311 |
| MDL Number | MFCD00010906 |
| SMILES | [Ca++].[O-]C([O-])=O |
| Synonym | calcium carbonate,limestone,chalk,calcite,carbonic acid calcium salt 1:1,marble,calofort u,aragonite,aeromatt,akadama |
| InChI Key | VTYYLEPIZMXCLO-UHFFFAOYSA-L |
| Molecular Formula | CCaO3 |
Iron(II) sulfate heptahydrate, 99+%, ACS reagent
CAS: 7782-63-0 Molecular Formula: FeH14O11S Molecular Weight (g/mol): 278.01 MDL Number: MFCD00149719 InChI Key: SURQXAFEQWPFPV-UHFFFAOYSA-L Synonym: iron ii sulfate heptahydrate,ferrous sulfate heptahydrate,presfersul,melanterite mineral,iron sulfate heptahydrate,iron 2+ sulfate heptahydrate,fesofor,fesotyme,haemofort,ironate PubChem CID: 62662 ChEBI: CHEBI:75836 SMILES: O.O.O.O.O.O.O.[Fe++].[O-]S([O-])(=O)=O
| PubChem CID | 62662 |
|---|---|
| CAS | 7782-63-0 |
| Molecular Weight (g/mol) | 278.01 |
| ChEBI | CHEBI:75836 |
| MDL Number | MFCD00149719 |
| SMILES | O.O.O.O.O.O.O.[Fe++].[O-]S([O-])(=O)=O |
| Synonym | iron ii sulfate heptahydrate,ferrous sulfate heptahydrate,presfersul,melanterite mineral,iron sulfate heptahydrate,iron 2+ sulfate heptahydrate,fesofor,fesotyme,haemofort,ironate |
| InChI Key | SURQXAFEQWPFPV-UHFFFAOYSA-L |
| Molecular Formula | FeH14O11S |