Other Solvents
Filtered Search Results
Gentamicin C1A Deuterated Pentaacetate Salt, TRC
Molecular Weight (g/mol): 449.5 Synonym: O-3-Deoxy-4-C-methyl-3-(methylamino)-?-L-arabinopyranosyl-(1-6)-O-[2,6-diamino-2,3,4,6-tetradeoxy-?-D-erythro-hexopyranosyl-(1-4)]-2-deoxy-D-streptamine Pentaacetate Salt Deuterated,Gentamicin D Acetate Deuterated,Gentamycin C1a Acetate Deuterated,Gentamicin C3 Acetate Deuterated IUPAC Name: (2R,3R,4R,5R)-2-(((1S,2S,3R,4S,6R)-4,6-diamino-3-(((2R,3R,6S)-3-amino-6-(aminomethyl)tetrahydro-2H-pyran-2-yl)oxy)-2-hydroxycyclohexyl)oxy)-5-methyl-4-(methylamino)tetrahydro-2H-pyran-3,5-diol (1)acetic acid(5) SMILES: NC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@@H](O[C@@H]3[C@H](O)[C@@H](NC)[C@](O)(C)CO3)[C@H](N)C[C@@H]2N)[C@H](N)CC1
| Molecular Weight (g/mol) | 449.5 |
|---|---|
| SMILES | NC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@@H](O[C@@H]3[C@H](O)[C@@H](NC)[C@](O)(C)CO3)[C@H](N)C[C@@H]2N)[C@H](N)CC1 |
| Synonym | O-3-Deoxy-4-C-methyl-3-(methylamino)-?-L-arabinopyranosyl-(1-6)-O-[2,6-diamino-2,3,4,6-tetradeoxy-?-D-erythro-hexopyranosyl-(1-4)]-2-deoxy-D-streptamine Pentaacetate Salt Deuterated,Gentamicin D Acetate Deuterated,Gentamycin C1a Acetate Deuterated,Gentamicin C3 Acetate Deuterated |
| IUPAC Name | (2R,3R,4R,5R)-2-(((1S,2S,3R,4S,6R)-4,6-diamino-3-(((2R,3R,6S)-3-amino-6-(aminomethyl)tetrahydro-2H-pyran-2-yl)oxy)-2-hydroxycyclohexyl)oxy)-5-methyl-4-(methylamino)tetrahydro-2H-pyran-3,5-diol (1)acetic acid(5) |
Glutathione Ammonium Salt-d5, TRC
High-purity organic molecules and analytical standards, strategically delivered worldwide to empower innovation and commercial success.
| Percent Purity | >95 |
|---|---|
| Molecular Weight (g/mol) | 312.35 |
| InChI Formula | InChI=1S/C10H17N3O6S/c11-5(10(18)19)1-2-7(14)13-6(4-20)9(17)12-3-8(15)16/h5-6,20H,1-4,11H2,(H,12,17)(H,13,14)(H,15,16)(H,18,19)/t5-,6-/m0/s1/i1D2,2D2,5D |
| Chemical Name or Material | Glutathione Ammonium Salt-d5 |
| SMILES | O=C(O)CNC([C@H](CS)NC(C([2H])([2H])C([2H])([2H])[C@]([2H])(N)C(O)=O)=O)=O |
| Synonym | L-Glutamyl-L-cysteinyl-glycine Ammonium Salt-d5 |
| Purity Grade Notes | HPLC |
| Recommended Storage | -20°C |
| Molecular Formula | C10H12D5N3O6S (free acid) |
2,6-Dimethylbenzoic acid, 98+%
CAS: 632-46-2 Molecular Formula: C9H10O2 Molecular Weight (g/mol): 150.177 MDL Number: MFCD00002483 InChI Key: HCBHQDKBSKYGCK-UHFFFAOYSA-N Synonym: benzoic acid, 2,6-dimethyl,2,6-dimethylbenzoicacid,2,6-dimethyl-benzoic acid,vic-m-xylylic acid,2,6-dimethyl benzoic acid,m-xylene-2-carboxylic acid,2,6-dimethylbenzene carboxylic acid,benzoic acid, 2,6-dimethyl-7ci,8ci,9ci,zlchem 286,vic.-m-xylylic acid PubChem CID: 12439 ChEBI: CHEBI:64827 IUPAC Name: 2,6-dimethylbenzoic acid SMILES: CC1=C(C(=CC=C1)C)C(=O)O
| PubChem CID | 12439 |
|---|---|
| CAS | 632-46-2 |
| Molecular Weight (g/mol) | 150.177 |
| ChEBI | CHEBI:64827 |
| MDL Number | MFCD00002483 |
| SMILES | CC1=C(C(=CC=C1)C)C(=O)O |
| Synonym | benzoic acid, 2,6-dimethyl,2,6-dimethylbenzoicacid,2,6-dimethyl-benzoic acid,vic-m-xylylic acid,2,6-dimethyl benzoic acid,m-xylene-2-carboxylic acid,2,6-dimethylbenzene carboxylic acid,benzoic acid, 2,6-dimethyl-7ci,8ci,9ci,zlchem 286,vic.-m-xylylic acid |
| IUPAC Name | 2,6-dimethylbenzoic acid |
| InChI Key | HCBHQDKBSKYGCK-UHFFFAOYSA-N |
| Molecular Formula | C9H10O2 |
3,5-Dimethylphenylacetic acid, 98+%
CAS: 42288-46-0 Molecular Formula: C10H11O2 Molecular Weight (g/mol): 163.20 MDL Number: MFCD00082776 InChI Key: HDNBKTWQBJJYPD-UHFFFAOYSA-M Synonym: 3,5-dimethylphenylacetic acid,2-3,5-dimethylphenyl acetic acid,3,5-dimethylphenyl acetic acid,benzeneacetic acid, 3,5-dimethyl,3,5-xylyl acetic acid,acmc-20anc9,ksc238q4h,3,5-dimethylbenzeneacetic acid,3,5-dimethyl-phenyl-acetic acid PubChem CID: 4749495 IUPAC Name: 2-(3,5-dimethylphenyl)acetic acid SMILES: CC1=CC(CC([O-])=O)=CC(C)=C1
| PubChem CID | 4749495 |
|---|---|
| CAS | 42288-46-0 |
| Molecular Weight (g/mol) | 163.20 |
| MDL Number | MFCD00082776 |
| SMILES | CC1=CC(CC([O-])=O)=CC(C)=C1 |
| Synonym | 3,5-dimethylphenylacetic acid,2-3,5-dimethylphenyl acetic acid,3,5-dimethylphenyl acetic acid,benzeneacetic acid, 3,5-dimethyl,3,5-xylyl acetic acid,acmc-20anc9,ksc238q4h,3,5-dimethylbenzeneacetic acid,3,5-dimethyl-phenyl-acetic acid |
| IUPAC Name | 2-(3,5-dimethylphenyl)acetic acid |
| InChI Key | HDNBKTWQBJJYPD-UHFFFAOYSA-M |
| Molecular Formula | C10H11O2 |
3-Chlorobenzeneboronic acid, 97%
CAS: 63503-60-6 Molecular Formula: C6H6BClO2 Molecular Weight (g/mol): 156.37 MDL Number: MFCD00161354 InChI Key: SDEAGACSNFSZCU-UHFFFAOYSA-N Synonym: 3-chlorophenyl boronic acid,3-chlorobenzeneboronic acid,3-chlorophenyl boranediol,3-chlorophenylbornic acid,3-chloro benzene boronic acid,m-chlorophenylboronic acid,3-chloro-phenyl-boronic acid,boronic acid, 3-chlorophenyl,pubchem1785 PubChem CID: 2734323 IUPAC Name: (3-chlorophenyl)boronic acid SMILES: OB(O)C1=CC(Cl)=CC=C1
| PubChem CID | 2734323 |
|---|---|
| CAS | 63503-60-6 |
| Molecular Weight (g/mol) | 156.37 |
| MDL Number | MFCD00161354 |
| SMILES | OB(O)C1=CC(Cl)=CC=C1 |
| Synonym | 3-chlorophenyl boronic acid,3-chlorobenzeneboronic acid,3-chlorophenyl boranediol,3-chlorophenylbornic acid,3-chloro benzene boronic acid,m-chlorophenylboronic acid,3-chloro-phenyl-boronic acid,boronic acid, 3-chlorophenyl,pubchem1785 |
| IUPAC Name | (3-chlorophenyl)boronic acid |
| InChI Key | SDEAGACSNFSZCU-UHFFFAOYSA-N |
| Molecular Formula | C6H6BClO2 |
2,4-Dimethylbenzoic acid, 97%
CAS: 611-01-8 Molecular Formula: C9H10O2 Molecular Weight (g/mol): 150.18 MDL Number: MFCD00002480 InChI Key: BKYWPNROPGQIFZ-UHFFFAOYSA-N Synonym: benzoic acid, 2,4-dimethyl,4-carboxy-1,3-dimethylbenzene,2,4-dimethyl benzoic acid,m-xylene-4-carboxylic acid,2,4-dimethyl-benzoic acid,2,4-dimethylbenzoicacid,m-xylylic acid,pubchem15441,2,4 dimethylbenzoic acid,benzoic acid,4-dimethyl PubChem CID: 11897 ChEBI: CHEBI:64811 IUPAC Name: 2,4-dimethylbenzoic acid SMILES: CC1=CC=C(C(O)=O)C(C)=C1
| PubChem CID | 11897 |
|---|---|
| CAS | 611-01-8 |
| Molecular Weight (g/mol) | 150.18 |
| ChEBI | CHEBI:64811 |
| MDL Number | MFCD00002480 |
| SMILES | CC1=CC=C(C(O)=O)C(C)=C1 |
| Synonym | benzoic acid, 2,4-dimethyl,4-carboxy-1,3-dimethylbenzene,2,4-dimethyl benzoic acid,m-xylene-4-carboxylic acid,2,4-dimethyl-benzoic acid,2,4-dimethylbenzoicacid,m-xylylic acid,pubchem15441,2,4 dimethylbenzoic acid,benzoic acid,4-dimethyl |
| IUPAC Name | 2,4-dimethylbenzoic acid |
| InChI Key | BKYWPNROPGQIFZ-UHFFFAOYSA-N |
| Molecular Formula | C9H10O2 |
3,4-Dimethylbenzoic acid, 98%
CAS: 619-04-5 Molecular Formula: C9H10O2 Molecular Weight (g/mol): 150.177 MDL Number: MFCD00002524 InChI Key: OPVAJFQBSDUNQA-UHFFFAOYSA-N Synonym: benzoic acid, 3,4-dimethyl,3,4-dimethyl-benzoic acid,1-carboxy-3,4-dimethylbenzene,o-xylene-4-carboxylic acid,3,4-dimethylbenzoicacid,pubchem14893,3,4-dimethyl benzoic acid,asym-o-xylylic acid,acmc-1b5p1,3, 4 dimethyl benzoic acid PubChem CID: 12073 ChEBI: CHEBI:64818 IUPAC Name: 3,4-dimethylbenzoic acid SMILES: CC1=C(C=C(C=C1)C(=O)O)C
| PubChem CID | 12073 |
|---|---|
| CAS | 619-04-5 |
| Molecular Weight (g/mol) | 150.177 |
| ChEBI | CHEBI:64818 |
| MDL Number | MFCD00002524 |
| SMILES | CC1=C(C=C(C=C1)C(=O)O)C |
| Synonym | benzoic acid, 3,4-dimethyl,3,4-dimethyl-benzoic acid,1-carboxy-3,4-dimethylbenzene,o-xylene-4-carboxylic acid,3,4-dimethylbenzoicacid,pubchem14893,3,4-dimethyl benzoic acid,asym-o-xylylic acid,acmc-1b5p1,3, 4 dimethyl benzoic acid |
| IUPAC Name | 3,4-dimethylbenzoic acid |
| InChI Key | OPVAJFQBSDUNQA-UHFFFAOYSA-N |
| Molecular Formula | C9H10O2 |
4-Chlorophenylboronic acid, 97%
CAS: 1679-18-1 Molecular Formula: C6H6BClO2 Molecular Weight (g/mol): 156.37 MDL Number: MFCD00039137 InChI Key: CAYQIZIAYYNFCS-UHFFFAOYSA-N Synonym: 4-chlorophenyl boronic acid,4-chlorobenzeneboronic acid,p-chlorophenylboronic acid,benzeneboronic acid, p-chloro,p-chlorobenzeneboronic acid,boronic acid, 4-chlorophenyl,boronic acid, p-chlorophenyl,4-chlorophenyl boranediol,4-chlorophenylbornic acid PubChem CID: 74299 IUPAC Name: (4-chlorophenyl)boronic acid SMILES: OB(O)C1=CC=C(Cl)C=C1
| PubChem CID | 74299 |
|---|---|
| CAS | 1679-18-1 |
| Molecular Weight (g/mol) | 156.37 |
| MDL Number | MFCD00039137 |
| SMILES | OB(O)C1=CC=C(Cl)C=C1 |
| Synonym | 4-chlorophenyl boronic acid,4-chlorobenzeneboronic acid,p-chlorophenylboronic acid,benzeneboronic acid, p-chloro,p-chlorobenzeneboronic acid,boronic acid, 4-chlorophenyl,boronic acid, p-chlorophenyl,4-chlorophenyl boranediol,4-chlorophenylbornic acid |
| IUPAC Name | (4-chlorophenyl)boronic acid |
| InChI Key | CAYQIZIAYYNFCS-UHFFFAOYSA-N |
| Molecular Formula | C6H6BClO2 |
2,5-Dimethylbenzoic acid, 98%
CAS: 610-72-0 Molecular Formula: C9H10O2 Molecular Weight (g/mol): 150.18 MDL Number: MFCD00002482 InChI Key: XZRHNAFEYMSXRG-UHFFFAOYSA-N Synonym: benzoic acid, 2,5-dimethyl,isoxylic acid,2,5-dimethyl benzoic acid,unii-rke5pmk0h6,2,5-dimethyl-benzoic acid,2-carboxy-1,4-dimethylbenzene,rke5pmk0h6,p-xylene-2-carboxylic acid,2,5-dimethylbenzenecarboxylic acid,2,5-dimethylbenzoicacid PubChem CID: 11892 ChEBI: CHEBI:64825 IUPAC Name: 2,5-dimethylbenzoic acid SMILES: CC1=CC(=C(C=C1)C)C(=O)O
| PubChem CID | 11892 |
|---|---|
| CAS | 610-72-0 |
| Molecular Weight (g/mol) | 150.18 |
| ChEBI | CHEBI:64825 |
| MDL Number | MFCD00002482 |
| SMILES | CC1=CC(=C(C=C1)C)C(=O)O |
| Synonym | benzoic acid, 2,5-dimethyl,isoxylic acid,2,5-dimethyl benzoic acid,unii-rke5pmk0h6,2,5-dimethyl-benzoic acid,2-carboxy-1,4-dimethylbenzene,rke5pmk0h6,p-xylene-2-carboxylic acid,2,5-dimethylbenzenecarboxylic acid,2,5-dimethylbenzoicacid |
| IUPAC Name | 2,5-dimethylbenzoic acid |
| InChI Key | XZRHNAFEYMSXRG-UHFFFAOYSA-N |
| Molecular Formula | C9H10O2 |
2,6-Dimethylbenzeneboronic acid, 97%
CAS: 100379-00-8 Molecular Formula: C8H11BO2 Molecular Weight (g/mol): 149.98 MDL Number: MFCD01009693 InChI Key: ZXDTWWZIHJEZOG-UHFFFAOYSA-N Synonym: 2,6-dimethylphenyl boronic acid,2,6-dimethylbenzeneboronic acid,2,6-dimethylphenyl boranediol,2,6-dimethylboronic acid,m-xylene-2-boronic acid,2,6-dimethyl-phenylboronic acid,boronic acid, 2,6-dimethylphenyl,2-borono-m-xylene,pubchem16357,acmc-1c3za PubChem CID: 583322 IUPAC Name: (2,6-dimethylphenyl)boronic acid SMILES: CC1=CC=CC(C)=C1B(O)O
| PubChem CID | 583322 |
|---|---|
| CAS | 100379-00-8 |
| Molecular Weight (g/mol) | 149.98 |
| MDL Number | MFCD01009693 |
| SMILES | CC1=CC=CC(C)=C1B(O)O |
| Synonym | 2,6-dimethylphenyl boronic acid,2,6-dimethylbenzeneboronic acid,2,6-dimethylphenyl boranediol,2,6-dimethylboronic acid,m-xylene-2-boronic acid,2,6-dimethyl-phenylboronic acid,boronic acid, 2,6-dimethylphenyl,2-borono-m-xylene,pubchem16357,acmc-1c3za |
| IUPAC Name | (2,6-dimethylphenyl)boronic acid |
| InChI Key | ZXDTWWZIHJEZOG-UHFFFAOYSA-N |
| Molecular Formula | C8H11BO2 |
3,4-Dimethylbenzeneboronic acid, 98+%
CAS: 55499-43-9 Molecular Formula: C8H11BO2 Molecular Weight (g/mol): 149.98 MDL Number: MFCD01009694 InChI Key: KDVZJKOYSOFXRV-UHFFFAOYSA-N Synonym: 3,4-dimethylphenyl boronic acid,3,4-dimethylbenzeneboronic acid,3,4-dimethylphenyl boranediol,3,4-dimethylphenylboronicacid,4-borono-o-xylene,boronic acid, 3,4-dimethylphenyl,pubchem1832,acmc-209lna,3.4-dimethylbenzeneboronic acid,3,4-dimethyl phenylboronic acid PubChem CID: 2734348 IUPAC Name: (3,4-dimethylphenyl)boronic acid SMILES: CC1=CC=C(C=C1C)B(O)O
| PubChem CID | 2734348 |
|---|---|
| CAS | 55499-43-9 |
| Molecular Weight (g/mol) | 149.98 |
| MDL Number | MFCD01009694 |
| SMILES | CC1=CC=C(C=C1C)B(O)O |
| Synonym | 3,4-dimethylphenyl boronic acid,3,4-dimethylbenzeneboronic acid,3,4-dimethylphenyl boranediol,3,4-dimethylphenylboronicacid,4-borono-o-xylene,boronic acid, 3,4-dimethylphenyl,pubchem1832,acmc-209lna,3.4-dimethylbenzeneboronic acid,3,4-dimethyl phenylboronic acid |
| IUPAC Name | (3,4-dimethylphenyl)boronic acid |
| InChI Key | KDVZJKOYSOFXRV-UHFFFAOYSA-N |
| Molecular Formula | C8H11BO2 |
4-Chlorobenzeneboronic acid, 98+%
CAS: 1679-18-1 Molecular Formula: C6H6BClO2 Molecular Weight (g/mol): 156.37 MDL Number: MFCD00039137 InChI Key: CAYQIZIAYYNFCS-UHFFFAOYSA-N Synonym: 4-chlorophenyl boronic acid,4-chlorobenzeneboronic acid,p-chlorophenylboronic acid,benzeneboronic acid, p-chloro,p-chlorobenzeneboronic acid,boronic acid, 4-chlorophenyl,boronic acid, p-chlorophenyl,4-chlorophenyl boranediol,4-chlorophenylbornic acid PubChem CID: 74299 IUPAC Name: (4-chlorophenyl)boronic acid SMILES: OB(O)C1=CC=C(Cl)C=C1
| PubChem CID | 74299 |
|---|---|
| CAS | 1679-18-1 |
| Molecular Weight (g/mol) | 156.37 |
| MDL Number | MFCD00039137 |
| SMILES | OB(O)C1=CC=C(Cl)C=C1 |
| Synonym | 4-chlorophenyl boronic acid,4-chlorobenzeneboronic acid,p-chlorophenylboronic acid,benzeneboronic acid, p-chloro,p-chlorobenzeneboronic acid,boronic acid, 4-chlorophenyl,boronic acid, p-chlorophenyl,4-chlorophenyl boranediol,4-chlorophenylbornic acid |
| IUPAC Name | (4-chlorophenyl)boronic acid |
| InChI Key | CAYQIZIAYYNFCS-UHFFFAOYSA-N |
| Molecular Formula | C6H6BClO2 |
2-Chloromandelic acid, 98%
CAS: 10421-85-9 Molecular Formula: C8H7ClO3 Molecular Weight (g/mol): 186.59 MDL Number: MFCD00084962 InChI Key: RWOLDZZTBNYTMS-UHFFFAOYNA-N Synonym: 2-chloromandelic acid,2-2-chlorophenyl-2-hydroxyacetic acid,dl-2-chloromandelic acid,2-chlorophenyl hydroxy acetic acid,dl-2-chloro mandelic acid,2-2-chlorophenyl-2-hydroxy-acetic acid,2-chlorophenyl glycolic acid,2-chloromandelicacid,2-chloro-mandelic acid,pubchem15895 PubChem CID: 97720 IUPAC Name: 2-(2-chlorophenyl)-2-hydroxyacetic acid SMILES: OC(C(O)=O)C1=CC=CC=C1Cl
| PubChem CID | 97720 |
|---|---|
| CAS | 10421-85-9 |
| Molecular Weight (g/mol) | 186.59 |
| MDL Number | MFCD00084962 |
| SMILES | OC(C(O)=O)C1=CC=CC=C1Cl |
| Synonym | 2-chloromandelic acid,2-2-chlorophenyl-2-hydroxyacetic acid,dl-2-chloromandelic acid,2-chlorophenyl hydroxy acetic acid,dl-2-chloro mandelic acid,2-2-chlorophenyl-2-hydroxy-acetic acid,2-chlorophenyl glycolic acid,2-chloromandelicacid,2-chloro-mandelic acid,pubchem15895 |
| IUPAC Name | 2-(2-chlorophenyl)-2-hydroxyacetic acid |
| InChI Key | RWOLDZZTBNYTMS-UHFFFAOYNA-N |
| Molecular Formula | C8H7ClO3 |
4-Chlorophenylacetic acid, 98%
CAS: 1878-66-6 Molecular Formula: C8H7ClO2 Molecular Weight (g/mol): 170.59 MDL Number: MFCD00004344 InChI Key: CDPKJZJVTHSESZ-UHFFFAOYSA-N Synonym: 4-chlorophenylacetic acid,2-4-chlorophenyl acetic acid,4-chlorophenyl acetic acid,4-chlorobenzeneacetic acid,p-chlorophenylacetic acid,benzeneacetic acid, 4-chloro,p-chlorophenyl acetic acid,2-p-chlorophenyl acetic acid,acetic acid, p-chlorophenyl PubChem CID: 15880 ChEBI: CHEBI:30749 IUPAC Name: 2-(4-chlorophenyl)acetic acid SMILES: OC(=O)CC1=CC=C(Cl)C=C1
| PubChem CID | 15880 |
|---|---|
| CAS | 1878-66-6 |
| Molecular Weight (g/mol) | 170.59 |
| ChEBI | CHEBI:30749 |
| MDL Number | MFCD00004344 |
| SMILES | OC(=O)CC1=CC=C(Cl)C=C1 |
| Synonym | 4-chlorophenylacetic acid,2-4-chlorophenyl acetic acid,4-chlorophenyl acetic acid,4-chlorobenzeneacetic acid,p-chlorophenylacetic acid,benzeneacetic acid, 4-chloro,p-chlorophenyl acetic acid,2-p-chlorophenyl acetic acid,acetic acid, p-chlorophenyl |
| IUPAC Name | 2-(4-chlorophenyl)acetic acid |
| InChI Key | CDPKJZJVTHSESZ-UHFFFAOYSA-N |
| Molecular Formula | C8H7ClO2 |
3-Chlorophenylacetic acid, 98+%
CAS: 1878-65-5 Molecular Formula: C8H7ClO2 Molecular Weight (g/mol): 170.59 MDL Number: MFCD00004332 InChI Key: WFPMUFXQDKMVCO-UHFFFAOYSA-N Synonym: 3-chlorophenylacetic acid,m-chlorophenylacetic acid,2-3-chlorophenyl acetic acid,3-chlorobenzeneacetic acid,benzeneacetic acid, 3-chloro,m-chlorophenyl acetic acid,3-chlorophenyl acetic acid,3-chlorophenylaceticacid,acetic acid, m-chlorophenyl PubChem CID: 15879 IUPAC Name: 2-(3-chlorophenyl)acetic acid SMILES: OC(=O)CC1=CC=CC(Cl)=C1
| PubChem CID | 15879 |
|---|---|
| CAS | 1878-65-5 |
| Molecular Weight (g/mol) | 170.59 |
| MDL Number | MFCD00004332 |
| SMILES | OC(=O)CC1=CC=CC(Cl)=C1 |
| Synonym | 3-chlorophenylacetic acid,m-chlorophenylacetic acid,2-3-chlorophenyl acetic acid,3-chlorobenzeneacetic acid,benzeneacetic acid, 3-chloro,m-chlorophenyl acetic acid,3-chlorophenyl acetic acid,3-chlorophenylaceticacid,acetic acid, m-chlorophenyl |
| IUPAC Name | 2-(3-chlorophenyl)acetic acid |
| InChI Key | WFPMUFXQDKMVCO-UHFFFAOYSA-N |
| Molecular Formula | C8H7ClO2 |