Aryl chlorides
Filtered Search Results
1,2-Dichlorobenzene, 99%, pure
CAS: 95-50-1 MDL Number: MFCD00000535 InChI Key: RFFLAFLAYFXFSW-UHFFFAOYSA-N Synonym: o-dichlorobenzene,chloroben,o-dichlorbenzol,dilantin db,ortho-dichlorobenzene,2-dichlorobenzene,o-dichlorobenzol,odcb,benzene, 1,2-dichloro,cloroben PubChem CID: 7239 ChEBI: CHEBI:35290 IUPAC Name: 1,2-dichlorobenzene SMILES: C1=CC=C(C(=C1)Cl)Cl
| PubChem CID | 7239 |
|---|---|
| CAS | 95-50-1 |
| ChEBI | CHEBI:35290 |
| MDL Number | MFCD00000535 |
| SMILES | C1=CC=C(C(=C1)Cl)Cl |
| Synonym | o-dichlorobenzene,chloroben,o-dichlorbenzol,dilantin db,ortho-dichlorobenzene,2-dichlorobenzene,o-dichlorobenzol,odcb,benzene, 1,2-dichloro,cloroben |
| IUPAC Name | 1,2-dichlorobenzene |
| InChI Key | RFFLAFLAYFXFSW-UHFFFAOYSA-N |
3,5-Dichloroaniline, 98%
CAS: 626-43-7 Molecular Formula: C6H5Cl2N Molecular Weight (g/mol): 162.02 MDL Number: MFCD00007774 InChI Key: UQRLKWGPEVNVHT-UHFFFAOYSA-N Synonym: benzenamine, 3,5-dichloro,m-dichloroaniline,aniline, 3,5-dichloro,3,5-dichlorobenzenamine,3,5-dichloro benzenamine,unii-oz75zm1s3g,3,5-dichloranilin,3,5 dichloraniline,ccris 2396,3,5-dichloro aniline PubChem CID: 12281 ChEBI: CHEBI:19904 IUPAC Name: 3,5-dichloroaniline SMILES: C1=C(C=C(C=C1Cl)Cl)N
| PubChem CID | 12281 |
|---|---|
| CAS | 626-43-7 |
| Molecular Weight (g/mol) | 162.02 |
| ChEBI | CHEBI:19904 |
| MDL Number | MFCD00007774 |
| SMILES | C1=C(C=C(C=C1Cl)Cl)N |
| Synonym | benzenamine, 3,5-dichloro,m-dichloroaniline,aniline, 3,5-dichloro,3,5-dichlorobenzenamine,3,5-dichloro benzenamine,unii-oz75zm1s3g,3,5-dichloranilin,3,5 dichloraniline,ccris 2396,3,5-dichloro aniline |
| IUPAC Name | 3,5-dichloroaniline |
| InChI Key | UQRLKWGPEVNVHT-UHFFFAOYSA-N |
| Molecular Formula | C6H5Cl2N |
2,4-Dichlorotoluene, 99%
CAS: 95-73-8 Molecular Formula: C7H6Cl2 Molecular Weight (g/mol): 161.03 MDL Number: MFCD00000583 InChI Key: FUNUTBJJKQIVSY-UHFFFAOYSA-N Synonym: 2,4-dichlorotoluene,benzene, 2,4-dichloro-1-methyl,toluene, 2,4-dichloro,2,4-dichloro-1-methyl-benzene,unii-3s32n6lg3x,2,4-dichloromethylbenzene,2,4-dct,2,4-diclorotoluene,4,6-dichlorotoluene,2,4-dichloro-toluen PubChem CID: 7254 ChEBI: CHEBI:81651 IUPAC Name: 2,4-dichloro-1-methylbenzene SMILES: CC1=C(C=C(C=C1)Cl)Cl
| PubChem CID | 7254 |
|---|---|
| CAS | 95-73-8 |
| Molecular Weight (g/mol) | 161.03 |
| ChEBI | CHEBI:81651 |
| MDL Number | MFCD00000583 |
| SMILES | CC1=C(C=C(C=C1)Cl)Cl |
| Synonym | 2,4-dichlorotoluene,benzene, 2,4-dichloro-1-methyl,toluene, 2,4-dichloro,2,4-dichloro-1-methyl-benzene,unii-3s32n6lg3x,2,4-dichloromethylbenzene,2,4-dct,2,4-diclorotoluene,4,6-dichlorotoluene,2,4-dichloro-toluen |
| IUPAC Name | 2,4-dichloro-1-methylbenzene |
| InChI Key | FUNUTBJJKQIVSY-UHFFFAOYSA-N |
| Molecular Formula | C7H6Cl2 |
1,2-Dichlorobenzene, 99+%, for spectroscopy
CAS: 95-50-1 Molecular Formula: C6H4Cl2 Molecular Weight (g/mol): 147 MDL Number: MFCD00000535 InChI Key: RFFLAFLAYFXFSW-UHFFFAOYSA-N Synonym: o-dichlorobenzene,chloroben,o-dichlorbenzol,dilantin db,ortho-dichlorobenzene,2-dichlorobenzene,o-dichlorobenzol,odcb,benzene, 1,2-dichloro,cloroben PubChem CID: 7239 ChEBI: CHEBI:35290 IUPAC Name: 1,2-dichlorobenzene SMILES: C1=CC=C(C(=C1)Cl)Cl
| PubChem CID | 7239 |
|---|---|
| CAS | 95-50-1 |
| Molecular Weight (g/mol) | 147 |
| ChEBI | CHEBI:35290 |
| MDL Number | MFCD00000535 |
| SMILES | C1=CC=C(C(=C1)Cl)Cl |
| Synonym | o-dichlorobenzene,chloroben,o-dichlorbenzol,dilantin db,ortho-dichlorobenzene,2-dichlorobenzene,o-dichlorobenzol,odcb,benzene, 1,2-dichloro,cloroben |
| IUPAC Name | 1,2-dichlorobenzene |
| InChI Key | RFFLAFLAYFXFSW-UHFFFAOYSA-N |
| Molecular Formula | C6H4Cl2 |
1,2-Dichlorobenzene, 98+%, Extra Dry, AcroSeal™
CAS: 95-50-1 Molecular Formula: C6H4Cl2 Molecular Weight (g/mol): 147 MDL Number: MFCD00000535 InChI Key: RFFLAFLAYFXFSW-UHFFFAOYSA-N Synonym: o-dichlorobenzene,chloroben,o-dichlorbenzol,dilantin db,ortho-dichlorobenzene,2-dichlorobenzene,o-dichlorobenzol,odcb,benzene, 1,2-dichloro,cloroben PubChem CID: 7239 ChEBI: CHEBI:35290 IUPAC Name: 1,2-dichlorobenzene SMILES: C1=CC=C(C(=C1)Cl)Cl
| PubChem CID | 7239 |
|---|---|
| CAS | 95-50-1 |
| Molecular Weight (g/mol) | 147 |
| ChEBI | CHEBI:35290 |
| MDL Number | MFCD00000535 |
| SMILES | C1=CC=C(C(=C1)Cl)Cl |
| Synonym | o-dichlorobenzene,chloroben,o-dichlorbenzol,dilantin db,ortho-dichlorobenzene,2-dichlorobenzene,o-dichlorobenzol,odcb,benzene, 1,2-dichloro,cloroben |
| IUPAC Name | 1,2-dichlorobenzene |
| InChI Key | RFFLAFLAYFXFSW-UHFFFAOYSA-N |
| Molecular Formula | C6H4Cl2 |
1,3-Dichlorobenzene, 98%
CAS: 541-73-1 Molecular Formula: C6H4Cl2 Molecular Weight (g/mol): 147 MDL Number: MFCD00000573 InChI Key: ZPQOPVIELGIULI-UHFFFAOYSA-N Synonym: m-dichlorobenzene,m-phenylene dichloride,m-dichlorobenzol,meta-dichlorobenzene,benzene, 1,3-dichloro,metadichlorobenzene,benzene, m-dichloro,m-phenylenedichloride,m-dcb,3-dichlorobenzene PubChem CID: 10943 ChEBI: CHEBI:36693 IUPAC Name: 1,3-dichlorobenzene SMILES: C1=CC(=CC(=C1)Cl)Cl
| PubChem CID | 10943 |
|---|---|
| CAS | 541-73-1 |
| Molecular Weight (g/mol) | 147 |
| ChEBI | CHEBI:36693 |
| MDL Number | MFCD00000573 |
| SMILES | C1=CC(=CC(=C1)Cl)Cl |
| Synonym | m-dichlorobenzene,m-phenylene dichloride,m-dichlorobenzol,meta-dichlorobenzene,benzene, 1,3-dichloro,metadichlorobenzene,benzene, m-dichloro,m-phenylenedichloride,m-dcb,3-dichlorobenzene |
| IUPAC Name | 1,3-dichlorobenzene |
| InChI Key | ZPQOPVIELGIULI-UHFFFAOYSA-N |
| Molecular Formula | C6H4Cl2 |
3,4-Dichloroaniline, 98%
CAS: 95-76-1 MDL Number: MFCD00007768 InChI Key: SDYWXFYBZPNOFX-UHFFFAOYSA-N Synonym: 3,4-dichlorobenzenamine,3,4-dichloraniline,3,4-dichloranilin,4,5-dichloroaniline,benzenamine, 3,4-dichloro,1-amino-3,4-dichlorobenzene,3,4-dca,3,4-dichlorophenylamine,aniline, 3,4-dichloro,m,p-dichloroaniline PubChem CID: 7257 ChEBI: CHEBI:16767 IUPAC Name: 3,4-dichloroaniline SMILES: C1=CC(=C(C=C1N)Cl)Cl
| PubChem CID | 7257 |
|---|---|
| CAS | 95-76-1 |
| ChEBI | CHEBI:16767 |
| MDL Number | MFCD00007768 |
| SMILES | C1=CC(=C(C=C1N)Cl)Cl |
| Synonym | 3,4-dichlorobenzenamine,3,4-dichloraniline,3,4-dichloranilin,4,5-dichloroaniline,benzenamine, 3,4-dichloro,1-amino-3,4-dichlorobenzene,3,4-dca,3,4-dichlorophenylamine,aniline, 3,4-dichloro,m,p-dichloroaniline |
| IUPAC Name | 3,4-dichloroaniline |
| InChI Key | SDYWXFYBZPNOFX-UHFFFAOYSA-N |
1,4-Dichlorobenzene, 99+%
CAS: 106-46-7 Molecular Formula: C6H4Cl2 Molecular Weight (g/mol): 147 MDL Number: MFCD00000604 InChI Key: OCJBOOLMMGQPQU-UHFFFAOYSA-N Synonym: p-dichlorobenzene,paradichlorobenzene,para-dichlorobenzene,paracide,paramoth,dichlorobenzene,paranuggets,santochlor,paradow,evola PubChem CID: 4685 ChEBI: CHEBI:28618 IUPAC Name: 1,4-dichlorobenzene SMILES: C1=CC(=CC=C1Cl)Cl
| PubChem CID | 4685 |
|---|---|
| CAS | 106-46-7 |
| Molecular Weight (g/mol) | 147 |
| ChEBI | CHEBI:28618 |
| MDL Number | MFCD00000604 |
| SMILES | C1=CC(=CC=C1Cl)Cl |
| Synonym | p-dichlorobenzene,paradichlorobenzene,para-dichlorobenzene,paracide,paramoth,dichlorobenzene,paranuggets,santochlor,paradow,evola |
| IUPAC Name | 1,4-dichlorobenzene |
| InChI Key | OCJBOOLMMGQPQU-UHFFFAOYSA-N |
| Molecular Formula | C6H4Cl2 |
2,4-Dichloroaniline, 98%
CAS: 554-00-7 Molecular Formula: C6H5Cl2N Molecular Weight (g/mol): 162.02 MDL Number: MFCD00007661 InChI Key: KQCMTOWTPBNWDB-UHFFFAOYSA-N Synonym: 2,4-dichlorobenzenamine,benzenamine, 2,4-dichloro,2,4-dichloranilin,o,p-dichloroaniline,aniline, 2,4-dichloro,2,4-dca,2,4-dichlorophenylamine,2,4-dichloro-phenylamine,unii-19ae42m6ws,2,4-dichloranilin german PubChem CID: 11123 ChEBI: CHEBI:46635 IUPAC Name: 2,4-dichloroaniline SMILES: C1=CC(=C(C=C1Cl)Cl)N
| PubChem CID | 11123 |
|---|---|
| CAS | 554-00-7 |
| Molecular Weight (g/mol) | 162.02 |
| ChEBI | CHEBI:46635 |
| MDL Number | MFCD00007661 |
| SMILES | C1=CC(=C(C=C1Cl)Cl)N |
| Synonym | 2,4-dichlorobenzenamine,benzenamine, 2,4-dichloro,2,4-dichloranilin,o,p-dichloroaniline,aniline, 2,4-dichloro,2,4-dca,2,4-dichlorophenylamine,2,4-dichloro-phenylamine,unii-19ae42m6ws,2,4-dichloranilin german |
| IUPAC Name | 2,4-dichloroaniline |
| InChI Key | KQCMTOWTPBNWDB-UHFFFAOYSA-N |
| Molecular Formula | C6H5Cl2N |
2,6-Dichloroaniline, 98%
CAS: 608-31-1 Molecular Formula: C6H5Cl2N Molecular Weight (g/mol): 162.01 MDL Number: MFCD00007675 InChI Key: JDMFXJULNGEPOI-UHFFFAOYSA-N Synonym: benzenamine, 2,6-dichloro,2,6-dichlorobenzenamine,2,6 dichloraniline,2,6-dichloro aniline,2,6-dichloranilin,2,6-dichloro-phenylamine,2,6-dichlorophenylamine,2,5-dichlorobenzoic acid pestanal,clonidine impurity c,2,6-dichloro-aniline PubChem CID: 11846 ChEBI: CHEBI:46630 IUPAC Name: 2,6-dichloroaniline SMILES: NC1=C(Cl)C=CC=C1Cl
| PubChem CID | 11846 |
|---|---|
| CAS | 608-31-1 |
| Molecular Weight (g/mol) | 162.01 |
| ChEBI | CHEBI:46630 |
| MDL Number | MFCD00007675 |
| SMILES | NC1=C(Cl)C=CC=C1Cl |
| Synonym | benzenamine, 2,6-dichloro,2,6-dichlorobenzenamine,2,6 dichloraniline,2,6-dichloro aniline,2,6-dichloranilin,2,6-dichloro-phenylamine,2,6-dichlorophenylamine,2,5-dichlorobenzoic acid pestanal,clonidine impurity c,2,6-dichloro-aniline |
| IUPAC Name | 2,6-dichloroaniline |
| InChI Key | JDMFXJULNGEPOI-UHFFFAOYSA-N |
| Molecular Formula | C6H5Cl2N |
2,6-Dichlorotoluene, 99+%
CAS: 118-69-4 Molecular Formula: C7H6Cl2 Molecular Weight (g/mol): 161.03 MDL Number: MFCD00000576 InChI Key: DMEDNTFWIHCBRK-UHFFFAOYSA-N Synonym: 2,6-dichlorotoluene,benzene, 1,3-dichloro-2-methyl,toluene, 2,6-dichloro,unii-rvm09757ww,1,3-dichloro-2-methyl-benzene,toluene,6-dichloro,pubchem3701,2,6-dichloro-toluene,benzene,dichloromethyl,2,6-dichloro toluene PubChem CID: 8368 IUPAC Name: 1,3-dichloro-2-methylbenzene SMILES: CC1=C(C=CC=C1Cl)Cl
| PubChem CID | 8368 |
|---|---|
| CAS | 118-69-4 |
| Molecular Weight (g/mol) | 161.03 |
| MDL Number | MFCD00000576 |
| SMILES | CC1=C(C=CC=C1Cl)Cl |
| Synonym | 2,6-dichlorotoluene,benzene, 1,3-dichloro-2-methyl,toluene, 2,6-dichloro,unii-rvm09757ww,1,3-dichloro-2-methyl-benzene,toluene,6-dichloro,pubchem3701,2,6-dichloro-toluene,benzene,dichloromethyl,2,6-dichloro toluene |
| IUPAC Name | 1,3-dichloro-2-methylbenzene |
| InChI Key | DMEDNTFWIHCBRK-UHFFFAOYSA-N |
| Molecular Formula | C7H6Cl2 |
4,7-Dichloroquinoline, 98%
CAS: 86-98-6 Molecular Formula: C9H5Cl2N Molecular Weight (g/mol): 198.05 MDL Number: MFCD00006774 InChI Key: HXEWMTXDBOQQKO-UHFFFAOYSA-N PubChem CID: 6866 IUPAC Name: 4,7-dichloroquinoline SMILES: C1=CC2=C(C=CN=C2C=C1Cl)Cl
| PubChem CID | 6866 |
|---|---|
| CAS | 86-98-6 |
| Molecular Weight (g/mol) | 198.05 |
| MDL Number | MFCD00006774 |
| SMILES | C1=CC2=C(C=CN=C2C=C1Cl)Cl |
| IUPAC Name | 4,7-dichloroquinoline |
| InChI Key | HXEWMTXDBOQQKO-UHFFFAOYSA-N |
| Molecular Formula | C9H5Cl2N |
2,6-Dichloropurine, 97%
CAS: 5451-40-1 Molecular Formula: C5H2Cl2N4 Molecular Weight (g/mol): 189.00 MDL Number: MFCD00077725 InChI Key: RMFWVOLULURGJI-UHFFFAOYSA-N Synonym: 2,6-dichloropurine,2,6-dichloro-9h-purine,2,6-dichloro-1h-purine,9h-purine, 2,6-dichloro,2,6-dichloro purine,2,6 dichloropurine,2,6-dichioropurine,purine,6-dichloro,zlchem 226,2,6-dichloro-purine PubChem CID: 5324412 IUPAC Name: 2,6-dichloro-7H-purine SMILES: ClC1=NC(Cl)=C2NC=NC2=N1
| PubChem CID | 5324412 |
|---|---|
| CAS | 5451-40-1 |
| Molecular Weight (g/mol) | 189.00 |
| MDL Number | MFCD00077725 |
| SMILES | ClC1=NC(Cl)=C2NC=NC2=N1 |
| Synonym | 2,6-dichloropurine,2,6-dichloro-9h-purine,2,6-dichloro-1h-purine,9h-purine, 2,6-dichloro,2,6-dichloro purine,2,6 dichloropurine,2,6-dichioropurine,purine,6-dichloro,zlchem 226,2,6-dichloro-purine |
| IUPAC Name | 2,6-dichloro-7H-purine |
| InChI Key | RMFWVOLULURGJI-UHFFFAOYSA-N |
| Molecular Formula | C5H2Cl2N4 |
5-Chloroindole, 99%
CAS: 17422-32-1 Molecular Formula: C8H6ClN Molecular Weight (g/mol): 151.6 MDL Number: MFCD00005672 InChI Key: MYTGFBZJLDLWQG-UHFFFAOYSA-N Synonym: 5-chloroindole,1h-indole, 5-chloro,5-chloro indole,1h-indole, 5-chloro-9ci,5-chloroindol,5-chloro-indole,3fue,zlchem 215,5-chlor-1h-indole,indole, 5-chloro PubChem CID: 87110 IUPAC Name: 5-chloro-1H-indole SMILES: C1=CC2=C(C=CN2)C=C1Cl
| PubChem CID | 87110 |
|---|---|
| CAS | 17422-32-1 |
| Molecular Weight (g/mol) | 151.6 |
| MDL Number | MFCD00005672 |
| SMILES | C1=CC2=C(C=CN2)C=C1Cl |
| Synonym | 5-chloroindole,1h-indole, 5-chloro,5-chloro indole,1h-indole, 5-chloro-9ci,5-chloroindol,5-chloro-indole,3fue,zlchem 215,5-chlor-1h-indole,indole, 5-chloro |
| IUPAC Name | 5-chloro-1H-indole |
| InChI Key | MYTGFBZJLDLWQG-UHFFFAOYSA-N |
| Molecular Formula | C8H6ClN |
1,2-Dichlorobenzene, 99+%, for HPLC
Greener Choice Product
This product offers one or more environmental benefits itemized in the U.S. FTC Green Guides.
Learn More About the Greener Choice Program
This product offers one or more environmental benefits itemized in the U.S. FTC Green Guides.
Learn More About the Greener Choice Program
CAS: 95-50-1 Molecular Formula: C6H4Cl2 Molecular Weight (g/mol): 147 InChI Key: RFFLAFLAYFXFSW-UHFFFAOYSA-N Synonym: o-dichlorobenzene,chloroben,o-dichlorbenzol,dilantin db,ortho-dichlorobenzene,2-dichlorobenzene,o-dichlorobenzol,odcb,benzene, 1,2-dichloro,cloroben PubChem CID: 7239 ChEBI: CHEBI:35290 IUPAC Name: 1,2-dichlorobenzene SMILES: C1=CC=C(C(=C1)Cl)Cl
| PubChem CID | 7239 |
|---|---|
| CAS | 95-50-1 |
| Molecular Weight (g/mol) | 147 |
| ChEBI | CHEBI:35290 |
| SMILES | C1=CC=C(C(=C1)Cl)Cl |
| Synonym | o-dichlorobenzene,chloroben,o-dichlorbenzol,dilantin db,ortho-dichlorobenzene,2-dichlorobenzene,o-dichlorobenzol,odcb,benzene, 1,2-dichloro,cloroben |
| IUPAC Name | 1,2-dichlorobenzene |
| InChI Key | RFFLAFLAYFXFSW-UHFFFAOYSA-N |
| Molecular Formula | C6H4Cl2 |