Boronic acid derivatives
Filtered Search Results
Ethylboronic acid, 95%
CAS: 4433-63-0 Molecular Formula: C2H7BO2 Molecular Weight (g/mol): 73.89 MDL Number: MFCD01074536 InChI Key: PAVZHTXVORCEHP-UHFFFAOYSA-N Synonym: boronic acid, ethyl,ethaneboronic acid,ethyldihydroxyborane,ethyl boronic acid,boronic acid, ethyl-9ci,ethylboronicacid,pubchem7960,ethylboric acid,etb oh 2 PubChem CID: 521157 IUPAC Name: ethylboronic acid SMILES: CCB(O)O
| PubChem CID | 521157 |
|---|---|
| CAS | 4433-63-0 |
| Molecular Weight (g/mol) | 73.89 |
| MDL Number | MFCD01074536 |
| SMILES | CCB(O)O |
| Synonym | boronic acid, ethyl,ethaneboronic acid,ethyldihydroxyborane,ethyl boronic acid,boronic acid, ethyl-9ci,ethylboronicacid,pubchem7960,ethylboric acid,etb oh 2 |
| IUPAC Name | ethylboronic acid |
| InChI Key | PAVZHTXVORCEHP-UHFFFAOYSA-N |
| Molecular Formula | C2H7BO2 |
2-(1,3-Dioxolan-2-yl)ethylboronic acid pinacol ester, 97%
CAS: 1073354-07-0 Molecular Formula: C11H21BO4 Molecular Weight (g/mol): 228.095 MDL Number: MFCD03788722 InChI Key: DNBRLKJRBDIKOO-UHFFFAOYSA-N Synonym: 2-2-1,3-dioxolan-2-yl ethyl-4,4,5,5-tetramethyl-1,3,2-dioxaborolane,2-1,3-dioxolan-2-yl ethylboronic acid pinacol ester,2-1,3-dioxolan-2-yl-1-ethylboronic acid pinacol ester PubChem CID: 46739008 IUPAC Name: 2-[2-(1,3-dioxolan-2-yl)ethyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane SMILES: B1(OC(C(O1)(C)C)(C)C)CCC2OCCO2
| PubChem CID | 46739008 |
|---|---|
| CAS | 1073354-07-0 |
| Molecular Weight (g/mol) | 228.095 |
| MDL Number | MFCD03788722 |
| SMILES | B1(OC(C(O1)(C)C)(C)C)CCC2OCCO2 |
| Synonym | 2-2-1,3-dioxolan-2-yl ethyl-4,4,5,5-tetramethyl-1,3,2-dioxaborolane,2-1,3-dioxolan-2-yl ethylboronic acid pinacol ester,2-1,3-dioxolan-2-yl-1-ethylboronic acid pinacol ester |
| IUPAC Name | 2-[2-(1,3-dioxolan-2-yl)ethyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChI Key | DNBRLKJRBDIKOO-UHFFFAOYSA-N |
| Molecular Formula | C11H21BO4 |
2,5-Dimethoxybenzeneboronic acid, 98%
CAS: 107099-99-0 Molecular Formula: C8H11BO4 Molecular Weight (g/mol): 181.982 MDL Number: MFCD01318181 InChI Key: QOZLFNQLIKOGDR-UHFFFAOYSA-N Synonym: 2,5-dimethoxyphenyl boronic acid,2,5-dimethoxybenzeneboronic acid,2,5-dimethoxyphenylboronicacid,2,5-dimethoxyphenyl boranediol,boronic acid, 2,5-dimethoxyphenyl,pubchem1824,acmc-2098nk,ksc174i7n,2,5-dimethoxyphenylboronoic acid PubChem CID: 2734342 IUPAC Name: (2,5-dimethoxyphenyl)boronic acid SMILES: B(C1=C(C=CC(=C1)OC)OC)(O)O
| PubChem CID | 2734342 |
|---|---|
| CAS | 107099-99-0 |
| Molecular Weight (g/mol) | 181.982 |
| MDL Number | MFCD01318181 |
| SMILES | B(C1=C(C=CC(=C1)OC)OC)(O)O |
| Synonym | 2,5-dimethoxyphenyl boronic acid,2,5-dimethoxybenzeneboronic acid,2,5-dimethoxyphenylboronicacid,2,5-dimethoxyphenyl boranediol,boronic acid, 2,5-dimethoxyphenyl,pubchem1824,acmc-2098nk,ksc174i7n,2,5-dimethoxyphenylboronoic acid |
| IUPAC Name | (2,5-dimethoxyphenyl)boronic acid |
| InChI Key | QOZLFNQLIKOGDR-UHFFFAOYSA-N |
| Molecular Formula | C8H11BO4 |
Cyclohexylboronic acid pinacol ester, 97%
CAS: 87100-15-0 Molecular Formula: C12H23BO2 Molecular Weight (g/mol): 210.124 MDL Number: MFCD04038749 InChI Key: OUEVCDGYTKLNMJ-UHFFFAOYSA-N Synonym: cyclohexylboronic acid pinacol ester,1,3,2-dioxaborolane, 2-cyclohexyl-4,4,5,5-tetramethyl,cyclohexylboronic acid, pinacol ester,4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl cyclohexane,pubchem7924,cyclohexylboronic acid, pinacol eser,1-4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl cyclohexane PubChem CID: 3668596 IUPAC Name: 2-cyclohexyl-4,4,5,5-tetramethyl-1,3,2-dioxaborolane SMILES: B1(OC(C(O1)(C)C)(C)C)C2CCCCC2
| PubChem CID | 3668596 |
|---|---|
| CAS | 87100-15-0 |
| Molecular Weight (g/mol) | 210.124 |
| MDL Number | MFCD04038749 |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2CCCCC2 |
| Synonym | cyclohexylboronic acid pinacol ester,1,3,2-dioxaborolane, 2-cyclohexyl-4,4,5,5-tetramethyl,cyclohexylboronic acid, pinacol ester,4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl cyclohexane,pubchem7924,cyclohexylboronic acid, pinacol eser,1-4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl cyclohexane |
| IUPAC Name | 2-cyclohexyl-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChI Key | OUEVCDGYTKLNMJ-UHFFFAOYSA-N |
| Molecular Formula | C12H23BO2 |
4-Methoxybenzeneboronic acid, 97+%
CAS: 5720-07-0 Molecular Formula: C7H9BO3 Molecular Weight (g/mol): 151.96 MDL Number: MFCD00039139 InChI Key: VOAAEKKFGLPLLU-UHFFFAOYSA-N Synonym: 4-methoxyphenyl boronic acid,4-methoxybenzeneboronic acid,p-anisylboronic acid,p-methoxyphenylboronic acid,p-methoxybenzeneboronic acid,4-methoxyphenyl boranediol,benzeneboronic acid, p-methoxy,4-boronoanisole,4-methoxyphenylboronicacid PubChem CID: 201262 IUPAC Name: (4-methoxyphenyl)boronic acid SMILES: COC1=CC=C(C=C1)B(O)O
| PubChem CID | 201262 |
|---|---|
| CAS | 5720-07-0 |
| Molecular Weight (g/mol) | 151.96 |
| MDL Number | MFCD00039139 |
| SMILES | COC1=CC=C(C=C1)B(O)O |
| Synonym | 4-methoxyphenyl boronic acid,4-methoxybenzeneboronic acid,p-anisylboronic acid,p-methoxyphenylboronic acid,p-methoxybenzeneboronic acid,4-methoxyphenyl boranediol,benzeneboronic acid, p-methoxy,4-boronoanisole,4-methoxyphenylboronicacid |
| IUPAC Name | (4-methoxyphenyl)boronic acid |
| InChI Key | VOAAEKKFGLPLLU-UHFFFAOYSA-N |
| Molecular Formula | C7H9BO3 |
3,4,5-Trimethoxybenzeneboronic acid, 98%
CAS: 182163-96-8 Molecular Formula: C9H13BO5 Molecular Weight (g/mol): 212.008 MDL Number: MFCD01075676 InChI Key: RULQUTYJXDLRFL-UHFFFAOYSA-N Synonym: 3,4,5-trimethoxybenzeneboronic acid,3,4,5-trimethoxyphenyl boronic acid,3,4,5-trimethoxyphenyl boranediol,3,4,5-trimethoxylphenylboronic acid,boronic acid, 3,4,5-trimethoxyphenyl,pubchem7894,acmc-1c5iu,ksc174i9j,3,4,5-trimethoxy phenylboronic acid PubChem CID: 2734390 IUPAC Name: (3,4,5-trimethoxyphenyl)boronic acid SMILES: B(C1=CC(=C(C(=C1)OC)OC)OC)(O)O
| PubChem CID | 2734390 |
|---|---|
| CAS | 182163-96-8 |
| Molecular Weight (g/mol) | 212.008 |
| MDL Number | MFCD01075676 |
| SMILES | B(C1=CC(=C(C(=C1)OC)OC)OC)(O)O |
| Synonym | 3,4,5-trimethoxybenzeneboronic acid,3,4,5-trimethoxyphenyl boronic acid,3,4,5-trimethoxyphenyl boranediol,3,4,5-trimethoxylphenylboronic acid,boronic acid, 3,4,5-trimethoxyphenyl,pubchem7894,acmc-1c5iu,ksc174i9j,3,4,5-trimethoxy phenylboronic acid |
| IUPAC Name | (3,4,5-trimethoxyphenyl)boronic acid |
| InChI Key | RULQUTYJXDLRFL-UHFFFAOYSA-N |
| Molecular Formula | C9H13BO5 |
2,3-Dichlorobenzeneboronic acid, 98%
CAS: 151169-74-3 Molecular Formula: C6H5BCl2O2 Molecular Weight (g/mol): 190.81 MDL Number: MFCD01075703 InChI Key: TYIKXPOMOYDGCS-UHFFFAOYSA-N Synonym: 2,3-dichlorophenyl boronic acid,2,3-dichlorobenzeneboronic acid,2,3-dichlorophenyl boranediol,boronic acid, 2,3-dichlorophenyl,contains varying amounts of anhydride,pubchem1810,dichlorophenylboronic acid,acmc-1c0ur,dichlorobenzene boronic acid PubChem CID: 2734661 IUPAC Name: (2,3-dichlorophenyl)boronic acid SMILES: OB(O)C1=C(Cl)C(Cl)=CC=C1
| PubChem CID | 2734661 |
|---|---|
| CAS | 151169-74-3 |
| Molecular Weight (g/mol) | 190.81 |
| MDL Number | MFCD01075703 |
| SMILES | OB(O)C1=C(Cl)C(Cl)=CC=C1 |
| Synonym | 2,3-dichlorophenyl boronic acid,2,3-dichlorobenzeneboronic acid,2,3-dichlorophenyl boranediol,boronic acid, 2,3-dichlorophenyl,contains varying amounts of anhydride,pubchem1810,dichlorophenylboronic acid,acmc-1c0ur,dichlorobenzene boronic acid |
| IUPAC Name | (2,3-dichlorophenyl)boronic acid |
| InChI Key | TYIKXPOMOYDGCS-UHFFFAOYSA-N |
| Molecular Formula | C6H5BCl2O2 |
3,4-Dichlorobenzeneboronic acid, 97%
CAS: 151169-75-4 Molecular Formula: C6H5BCl2O2 Molecular Weight (g/mol): 190.81 MDL Number: MFCD01074646 InChI Key: JKIGHOARKAIPJI-UHFFFAOYSA-N Synonym: 3,4-dichlorophenyl boronic acid,3,4-dichlorobenzeneboronic acid,3,4-dichlorophenylboronicacid,3,4-dichlorophenyl boranediol,3,4-dichlorophenylbornic acid,chembl20776,3,4-dichloro benzene boronic acid,boronic acid, 3,4-dichlorophenyl,pubchem1812 PubChem CID: 2734330 IUPAC Name: (3,4-dichlorophenyl)boronic acid SMILES: OB(O)C1=CC=C(Cl)C(Cl)=C1
| PubChem CID | 2734330 |
|---|---|
| CAS | 151169-75-4 |
| Molecular Weight (g/mol) | 190.81 |
| MDL Number | MFCD01074646 |
| SMILES | OB(O)C1=CC=C(Cl)C(Cl)=C1 |
| Synonym | 3,4-dichlorophenyl boronic acid,3,4-dichlorobenzeneboronic acid,3,4-dichlorophenylboronicacid,3,4-dichlorophenyl boranediol,3,4-dichlorophenylbornic acid,chembl20776,3,4-dichloro benzene boronic acid,boronic acid, 3,4-dichlorophenyl,pubchem1812 |
| IUPAC Name | (3,4-dichlorophenyl)boronic acid |
| InChI Key | JKIGHOARKAIPJI-UHFFFAOYSA-N |
| Molecular Formula | C6H5BCl2O2 |
2-Carboxybenzeneboronic acid, 95%
CAS: 149105-19-1 Molecular Formula: C7H7BO4 Molecular Weight (g/mol): 165.939 MDL Number: MFCD01318118 InChI Key: KWNPRVWFJOSGMZ-UHFFFAOYSA-N Synonym: 2-carboxyphenylboronic acid,2-dihydroxyboranyl benzoic acid,2-carboxybenzeneboronic acid,2-dihydroxyboronyl benzoic acid,2-dihydroxyboryl benzoic acid,carboxyphenylboronic acid,benzoic acid, 2-borono,o-carboxyphenylboronic acid,2-carboxyphenylboronicacid,borobenzoesaure PubChem CID: 2733985 IUPAC Name: 2-boronobenzoic acid SMILES: B(C1=CC=CC=C1C(=O)O)(O)O
| PubChem CID | 2733985 |
|---|---|
| CAS | 149105-19-1 |
| Molecular Weight (g/mol) | 165.939 |
| MDL Number | MFCD01318118 |
| SMILES | B(C1=CC=CC=C1C(=O)O)(O)O |
| Synonym | 2-carboxyphenylboronic acid,2-dihydroxyboranyl benzoic acid,2-carboxybenzeneboronic acid,2-dihydroxyboronyl benzoic acid,2-dihydroxyboryl benzoic acid,carboxyphenylboronic acid,benzoic acid, 2-borono,o-carboxyphenylboronic acid,2-carboxyphenylboronicacid,borobenzoesaure |
| IUPAC Name | 2-boronobenzoic acid |
| InChI Key | KWNPRVWFJOSGMZ-UHFFFAOYSA-N |
| Molecular Formula | C7H7BO4 |
3,5-Dimethoxybenzeneboronic acid, 98%
CAS: 192182-54-0 Molecular Formula: C8H11BO4 Molecular Weight (g/mol): 181.982 MDL Number: MFCD03095127 InChI Key: XUIURRYWQBBCCK-UHFFFAOYSA-N Synonym: 3,5-dimethoxybenzeneboronic acid,3,5-dimethoxyphenyl boronic acid,3,5-dimethoxyphenylboronicacid,boronic acid, 3,5-dimethoxyphenyl,pubchem1827,acmc-1c82c,ksc174i6h,3,5-dimethoxy phenyl boronic acid,3,5-dimethoxyphenylboronic acid,boronic acid, b-3,5-dimethoxyphenyl PubChem CID: 4374257 IUPAC Name: (3,5-dimethoxyphenyl)boronic acid SMILES: B(C1=CC(=CC(=C1)OC)OC)(O)O
| PubChem CID | 4374257 |
|---|---|
| CAS | 192182-54-0 |
| Molecular Weight (g/mol) | 181.982 |
| MDL Number | MFCD03095127 |
| SMILES | B(C1=CC(=CC(=C1)OC)OC)(O)O |
| Synonym | 3,5-dimethoxybenzeneboronic acid,3,5-dimethoxyphenyl boronic acid,3,5-dimethoxyphenylboronicacid,boronic acid, 3,5-dimethoxyphenyl,pubchem1827,acmc-1c82c,ksc174i6h,3,5-dimethoxy phenyl boronic acid,3,5-dimethoxyphenylboronic acid,boronic acid, b-3,5-dimethoxyphenyl |
| IUPAC Name | (3,5-dimethoxyphenyl)boronic acid |
| InChI Key | XUIURRYWQBBCCK-UHFFFAOYSA-N |
| Molecular Formula | C8H11BO4 |
2-Aminobenzeneboronic acid, 96%
CAS: 5570-18-3 Molecular Formula: C6H8BNO2 Molecular Weight (g/mol): 136.945 MDL Number: MFCD01074645 InChI Key: DIRRKLFMHQUJCM-UHFFFAOYSA-N Synonym: 2-aminophenyl boronic acid,2-aminobenzeneboronic acid,o-aminophenylboronic acid,2-aminophenylboronicacid,2-boronoaniline,pubchem9885,acmc-1apjj,2-amino-phenylboronic acid,2-amino benzeneboronic acid PubChem CID: 2773216 IUPAC Name: (2-aminophenyl)boronic acid SMILES: B(C1=CC=CC=C1N)(O)O
| PubChem CID | 2773216 |
|---|---|
| CAS | 5570-18-3 |
| Molecular Weight (g/mol) | 136.945 |
| MDL Number | MFCD01074645 |
| SMILES | B(C1=CC=CC=C1N)(O)O |
| Synonym | 2-aminophenyl boronic acid,2-aminobenzeneboronic acid,o-aminophenylboronic acid,2-aminophenylboronicacid,2-boronoaniline,pubchem9885,acmc-1apjj,2-amino-phenylboronic acid,2-amino benzeneboronic acid |
| IUPAC Name | (2-aminophenyl)boronic acid |
| InChI Key | DIRRKLFMHQUJCM-UHFFFAOYSA-N |
| Molecular Formula | C6H8BNO2 |
3-Cyanobenzeneboronic acid, 98%
CAS: 150255-96-2 Molecular Formula: C7H6BNO2 Molecular Weight (g/mol): 146.94 MDL Number: MFCD01318967 InChI Key: XDBHWPLGGBLUHH-UHFFFAOYSA-N Synonym: 3-cyanophenyl boronic acid,3-cyanobenzeneboronic acid,3-boronobenzonitrile,3-dihydroxyboranyl benzonitrile,3-cyanobenzene boronic acid,3-cyano-phenyl-boronic acid,boronic acid, 3-cyanophenyl,pubchem1804,phenylboronic acid, 4 PubChem CID: 2734325 IUPAC Name: (3-cyanophenyl)boronic acid SMILES: OB(O)C1=CC=CC(=C1)C#N
| PubChem CID | 2734325 |
|---|---|
| CAS | 150255-96-2 |
| Molecular Weight (g/mol) | 146.94 |
| MDL Number | MFCD01318967 |
| SMILES | OB(O)C1=CC=CC(=C1)C#N |
| Synonym | 3-cyanophenyl boronic acid,3-cyanobenzeneboronic acid,3-boronobenzonitrile,3-dihydroxyboranyl benzonitrile,3-cyanobenzene boronic acid,3-cyano-phenyl-boronic acid,boronic acid, 3-cyanophenyl,pubchem1804,phenylboronic acid, 4 |
| IUPAC Name | (3-cyanophenyl)boronic acid |
| InChI Key | XDBHWPLGGBLUHH-UHFFFAOYSA-N |
| Molecular Formula | C7H6BNO2 |
2,4-Dichlorobenzeneboronic acid, 98%
CAS: 68716-47-2 Molecular Formula: C6H5BCl2O2 Molecular Weight (g/mol): 190.81 MDL Number: MFCD00013930 InChI Key: QNEGDGPAXKYZHZ-UHFFFAOYSA-N Synonym: 2,4-dichlorophenyl boronic acid,2,4-dichlorobenzeneboronic acid,2,4-dichlorophenylbornic acid,2,4-dichlorophenyl boranediol,chembl20726,2,4-dichloro benzene boronic acid,boronic acid, 2,4-dichlorophenyl,2,4-dichlorobenzeneboron dihydroxide,2,4-dichlorobenzeneboronicacid PubChem CID: 2734659 IUPAC Name: (2,4-dichlorophenyl)boronic acid SMILES: OB(O)C1=CC=C(Cl)C=C1Cl
| PubChem CID | 2734659 |
|---|---|
| CAS | 68716-47-2 |
| Molecular Weight (g/mol) | 190.81 |
| MDL Number | MFCD00013930 |
| SMILES | OB(O)C1=CC=C(Cl)C=C1Cl |
| Synonym | 2,4-dichlorophenyl boronic acid,2,4-dichlorobenzeneboronic acid,2,4-dichlorophenylbornic acid,2,4-dichlorophenyl boranediol,chembl20726,2,4-dichloro benzene boronic acid,boronic acid, 2,4-dichlorophenyl,2,4-dichlorobenzeneboron dihydroxide,2,4-dichlorobenzeneboronicacid |
| IUPAC Name | (2,4-dichlorophenyl)boronic acid |
| InChI Key | QNEGDGPAXKYZHZ-UHFFFAOYSA-N |
| Molecular Formula | C6H5BCl2O2 |
3-Aminobenzeneboronic acid, 98%
CAS: 30418-59-8 Molecular Formula: C6H8BNO2 Molecular Weight (g/mol): 136.945 MDL Number: MFCD00007755 InChI Key: JMZFEHDNIAQMNB-UHFFFAOYSA-N Synonym: 3-aminobenzeneboronic acid,3-aminophenyl boronic acid,m-aminophenylboronic acid,3-aminophenyl boranediol,m-aminophenyl boronic acid,3-amino phenylboronic acid,chembl20852,boronic acid, 3-aminophenyl,m-aminophenyl metaboric acid PubChem CID: 92269 IUPAC Name: (3-aminophenyl)boronic acid SMILES: B(C1=CC(=CC=C1)N)(O)O
| PubChem CID | 92269 |
|---|---|
| CAS | 30418-59-8 |
| Molecular Weight (g/mol) | 136.945 |
| MDL Number | MFCD00007755 |
| SMILES | B(C1=CC(=CC=C1)N)(O)O |
| Synonym | 3-aminobenzeneboronic acid,3-aminophenyl boronic acid,m-aminophenylboronic acid,3-aminophenyl boranediol,m-aminophenyl boronic acid,3-amino phenylboronic acid,chembl20852,boronic acid, 3-aminophenyl,m-aminophenyl metaboric acid |
| IUPAC Name | (3-aminophenyl)boronic acid |
| InChI Key | JMZFEHDNIAQMNB-UHFFFAOYSA-N |
| Molecular Formula | C6H8BNO2 |
4-Ethylbenzeneboronic acid, 97%
CAS: 63139-21-9 Molecular Formula: C8H11BO2 Molecular Weight (g/mol): 149.98 MDL Number: MFCD00859377 InChI Key: RZCPLOMUUCFPQA-UHFFFAOYSA-N Synonym: 4-ethylphenyl boronic acid,4-ethylbenzeneboronic acid,4-ethylphenyl boranediol,4-ethylphenylboronicacid,p-ethylphenylboronic acid,boronic acid, 4-ethylphenyl,pubchem7884,4-ethylbenzenboronic acid,acmc-1bik6 PubChem CID: 2734352 IUPAC Name: (4-ethylphenyl)boronic acid SMILES: CCC1=CC=C(C=C1)B(O)O
| PubChem CID | 2734352 |
|---|---|
| CAS | 63139-21-9 |
| Molecular Weight (g/mol) | 149.98 |
| MDL Number | MFCD00859377 |
| SMILES | CCC1=CC=C(C=C1)B(O)O |
| Synonym | 4-ethylphenyl boronic acid,4-ethylbenzeneboronic acid,4-ethylphenyl boranediol,4-ethylphenylboronicacid,p-ethylphenylboronic acid,boronic acid, 4-ethylphenyl,pubchem7884,4-ethylbenzenboronic acid,acmc-1bik6 |
| IUPAC Name | (4-ethylphenyl)boronic acid |
| InChI Key | RZCPLOMUUCFPQA-UHFFFAOYSA-N |
| Molecular Formula | C8H11BO2 |