Organic sulfuric acids and derivatives
Filtered Search Results
N,N-Dimethylsulfamide, Thermo Scientific Chemicals
CAS: 3984-14-3 Molecular Formula: C2H8N2O2S Molecular Weight (g/mol): 124.16 InChI Key: QMHAHUAQAJVBIW-UHFFFAOYSA-N IUPAC Name: (dimethylsulfamoyl)amine SMILES: CN(C)S(N)(=O)=O
| CAS | 3984-14-3 |
|---|---|
| Molecular Weight (g/mol) | 124.16 |
| SMILES | CN(C)S(N)(=O)=O |
| IUPAC Name | (dimethylsulfamoyl)amine |
| InChI Key | QMHAHUAQAJVBIW-UHFFFAOYSA-N |
| Molecular Formula | C2H8N2O2S |
Sodium cyclamate, 99%
CAS: 139-05-9 Molecular Formula: C6H12NNaO3S Molecular Weight (g/mol): 201.22 MDL Number: MFCD00003827 InChI Key: UDIPTWFVPPPURJ-UHFFFAOYSA-M Synonym: sodium cyclamate,sodium cyclohexylsulfamate,sodium n-cyclohexylsulfamate,cyclamate sodium,cyclamic acid sodium salt,assugrin,ibiosuc,suessette,suestamin,sugarin PubChem CID: 23665706 ChEBI: CHEBI:82431 IUPAC Name: sodium;N-cyclohexylsulfamate SMILES: [Na+].[O-]S(=O)(=O)NC1CCCCC1
| PubChem CID | 23665706 |
|---|---|
| CAS | 139-05-9 |
| Molecular Weight (g/mol) | 201.22 |
| ChEBI | CHEBI:82431 |
| MDL Number | MFCD00003827 |
| SMILES | [Na+].[O-]S(=O)(=O)NC1CCCCC1 |
| Synonym | sodium cyclamate,sodium cyclohexylsulfamate,sodium n-cyclohexylsulfamate,cyclamate sodium,cyclamic acid sodium salt,assugrin,ibiosuc,suessette,suestamin,sugarin |
| IUPAC Name | sodium;N-cyclohexylsulfamate |
| InChI Key | UDIPTWFVPPPURJ-UHFFFAOYSA-M |
| Molecular Formula | C6H12NNaO3S |
Phenazine methosulfate, 98%
CAS: 299-11-6 Molecular Formula: C13H11N2·CH3O4S Molecular Weight (g/mol): 306.33 MDL Number: MFCD00011923 InChI Key: RXGJTUSBYWCRBK-UHFFFAOYSA-M Synonym: phenazine methosulfate,5-methylphenazin-5-ium methyl sulfate,5-methylphenazinium methyl sulfate,n-methylphenazonium methosulfate,phenazine methosulphate,methylphenazonium methosulfate,5-methylphenazine methylsulfate,n-methylphenazinium methosulfate,n-methylphenazonium methosulphate,phenazinium, 5-methyl-, methyl sulfate PubChem CID: 9285 ChEBI: CHEBI:8055 IUPAC Name: 5-methylphenazin-5-ium;methyl sulfate SMILES: C[N+]1=C2C=CC=CC2=NC3=CC=CC=C31.COS(=O)(=O)[O-]
| PubChem CID | 9285 |
|---|---|
| CAS | 299-11-6 |
| Molecular Weight (g/mol) | 306.33 |
| ChEBI | CHEBI:8055 |
| MDL Number | MFCD00011923 |
| SMILES | C[N+]1=C2C=CC=CC2=NC3=CC=CC=C31.COS(=O)(=O)[O-] |
| Synonym | phenazine methosulfate,5-methylphenazin-5-ium methyl sulfate,5-methylphenazinium methyl sulfate,n-methylphenazonium methosulfate,phenazine methosulphate,methylphenazonium methosulfate,5-methylphenazine methylsulfate,n-methylphenazinium methosulfate,n-methylphenazonium methosulphate,phenazinium, 5-methyl-, methyl sulfate |
| IUPAC Name | 5-methylphenazin-5-ium;methyl sulfate |
| InChI Key | RXGJTUSBYWCRBK-UHFFFAOYSA-M |
| Molecular Formula | C13H11N2·CH3O4S |
Dimethyl sulfate, 99+%, AcroSeal™
CAS: 77-78-1 Molecular Formula: C2H6O4S Molecular Weight (g/mol): 126.13 MDL Number: MFCD00008416 InChI Key: VAYGXNSJCAHWJZ-UHFFFAOYSA-N Synonym: dimethyl sulphate,sulfuric acid, dimethyl ester,dimethyl monosulfate,dimethylsulfate,dimethylsulfat,sulfate dimethylique,sulfuric acid dimethyl ester,dimethylsulfaat,dimetilsolfato,dms methyl sulfate PubChem CID: 6497 ChEBI: CHEBI:59050 IUPAC Name: dimethyl sulfate SMILES: COS(=O)(=O)OC
| PubChem CID | 6497 |
|---|---|
| CAS | 77-78-1 |
| Molecular Weight (g/mol) | 126.13 |
| ChEBI | CHEBI:59050 |
| MDL Number | MFCD00008416 |
| SMILES | COS(=O)(=O)OC |
| Synonym | dimethyl sulphate,sulfuric acid, dimethyl ester,dimethyl monosulfate,dimethylsulfate,dimethylsulfat,sulfate dimethylique,sulfuric acid dimethyl ester,dimethylsulfaat,dimetilsolfato,dms methyl sulfate |
| IUPAC Name | dimethyl sulfate |
| InChI Key | VAYGXNSJCAHWJZ-UHFFFAOYSA-N |
| Molecular Formula | C2H6O4S |
Hydrazine sulfate, 99+%
CAS: 10034-93-2 Molecular Formula: H4N2·H2SO4 Molecular Weight (g/mol): 130.12 MDL Number: MFCD00044873 InChI Key: ZGCHATBSUIJLRL-UHFFFAOYSA-N Synonym: hydrazine sulfate,hydrazine monosulfate,hydrazine, sulfate,hydrazine sulphate,hydrazinium sulfate,hydrazonium sulfate,hydrazine sulfate 1:1,segidrin,sehydrin,diamine sulfate PubChem CID: 24842 IUPAC Name: hydrazine;sulfuric acid SMILES: NN.OS(=O)(=O)O
| PubChem CID | 24842 |
|---|---|
| CAS | 10034-93-2 |
| Molecular Weight (g/mol) | 130.12 |
| MDL Number | MFCD00044873 |
| SMILES | NN.OS(=O)(=O)O |
| Synonym | hydrazine sulfate,hydrazine monosulfate,hydrazine, sulfate,hydrazine sulphate,hydrazinium sulfate,hydrazonium sulfate,hydrazine sulfate 1:1,segidrin,sehydrin,diamine sulfate |
| IUPAC Name | hydrazine;sulfuric acid |
| InChI Key | ZGCHATBSUIJLRL-UHFFFAOYSA-N |
| Molecular Formula | H4N2·H2SO4 |
2-Aminoethyl hydrogen sulfate, 99%
CAS: 926-39-6 Molecular Formula: C2H7NO4S Molecular Weight (g/mol): 141.14 MDL Number: MFCD00008179 InChI Key: WSYUEVRAMDSJKL-UHFFFAOYSA-N Synonym: ethanolamine o-sulfate,aminoethyl sulfate,2-aminoethyl sulfate,mono 2-aminoethyl sulfate,2-aminoethyl hydrogen sulphate,sulfuric acid mono 2-aminoethyl ester,was-34,2-aminoethylhydrogensulfate,unii-9c8f910hlk,ethanol, 2-amino-, hydrogen sulfate ester PubChem CID: 70223 IUPAC Name: 2-aminoethyl hydrogen sulfate SMILES: NCCOS(O)(=O)=O
| PubChem CID | 70223 |
|---|---|
| CAS | 926-39-6 |
| Molecular Weight (g/mol) | 141.14 |
| MDL Number | MFCD00008179 |
| SMILES | NCCOS(O)(=O)=O |
| Synonym | ethanolamine o-sulfate,aminoethyl sulfate,2-aminoethyl sulfate,mono 2-aminoethyl sulfate,2-aminoethyl hydrogen sulphate,sulfuric acid mono 2-aminoethyl ester,was-34,2-aminoethylhydrogensulfate,unii-9c8f910hlk,ethanol, 2-amino-, hydrogen sulfate ester |
| IUPAC Name | 2-aminoethyl hydrogen sulfate |
| InChI Key | WSYUEVRAMDSJKL-UHFFFAOYSA-N |
| Molecular Formula | C2H7NO4S |
Sulfamide, 98+%
CAS: 7803-58-9 Molecular Formula: H4N2O2S Molecular Weight (g/mol): 96.10 MDL Number: MFCD00011606 InChI Key: NVBFHJWHLNUMCV-UHFFFAOYSA-N Synonym: sulfuric diamide,sulfamamide,sulfuryl amide,sulfonyl diamide,sulfuryl diamide,sulfamoylamine,sulphamide,sulphuric diamide,unii-vs7tzw634v,imidosulfamic acid PubChem CID: 82267 ChEBI: CHEBI:29368 IUPAC Name: sulfamoylamine SMILES: NS(N)(=O)=O
| PubChem CID | 82267 |
|---|---|
| CAS | 7803-58-9 |
| Molecular Weight (g/mol) | 96.10 |
| ChEBI | CHEBI:29368 |
| MDL Number | MFCD00011606 |
| SMILES | NS(N)(=O)=O |
| Synonym | sulfuric diamide,sulfamamide,sulfuryl amide,sulfonyl diamide,sulfuryl diamide,sulfamoylamine,sulphamide,sulphuric diamide,unii-vs7tzw634v,imidosulfamic acid |
| IUPAC Name | sulfamoylamine |
| InChI Key | NVBFHJWHLNUMCV-UHFFFAOYSA-N |
| Molecular Formula | H4N2O2S |
Hydroxychloroquine sulfate, 98%
CAS: 747-36-4 Molecular Formula: C18H26ClN3O·H2SO4 Molecular Weight (g/mol): 433.96 MDL Number: MFCD00078203 InChI Key: JCBIVZZPXRZKTI-UHFFFAOYSA-N Synonym: hydroxychloroquine sulfate,hydroxychloroquine sulphate,ercoquin,plaquinol,toremonil,2-4-7-chloroquinolin-4-yl amino pentyl ethyl amino ethanol sulfate,hydroxychloroquine sulfate usp,plaquenil tn,hydroxychloroquine; sulfuric acid,dsstox_cid_27788 PubChem CID: 12947 IUPAC Name: 2-[4-[(7-chloroquinolin-4-yl)amino]pentyl-ethylamino]ethanol;sulfuric acid SMILES: CCN(CCCC(C)NC1=C2C=CC(=CC2=NC=C1)Cl)CCO.OS(=O)(=O)O
| PubChem CID | 12947 |
|---|---|
| CAS | 747-36-4 |
| Molecular Weight (g/mol) | 433.96 |
| MDL Number | MFCD00078203 |
| SMILES | CCN(CCCC(C)NC1=C2C=CC(=CC2=NC=C1)Cl)CCO.OS(=O)(=O)O |
| Synonym | hydroxychloroquine sulfate,hydroxychloroquine sulphate,ercoquin,plaquinol,toremonil,2-4-7-chloroquinolin-4-yl amino pentyl ethyl amino ethanol sulfate,hydroxychloroquine sulfate usp,plaquenil tn,hydroxychloroquine; sulfuric acid,dsstox_cid_27788 |
| IUPAC Name | 2-[4-[(7-chloroquinolin-4-yl)amino]pentyl-ethylamino]ethanol;sulfuric acid |
| InChI Key | JCBIVZZPXRZKTI-UHFFFAOYSA-N |
| Molecular Formula | C18H26ClN3O·H2SO4 |
Diethyl sulfate, 99%
CAS: 64-67-5 Molecular Formula: C4H10O4S Molecular Weight (g/mol): 154.18 MDL Number: MFCD00009099 InChI Key: DENRZWYUOJLTMF-UHFFFAOYSA-N Synonym: sulfuric acid, diethyl ester,diethyl sulphate,diethylsulfate,diaethylsulfat,sulfuric acid diethyl ester,diethyl tetraoxosulfate,diaethylsulfat german,unii-k0fo4vfa7i,des van,diethylester kyseliny sirove PubChem CID: 6163 ChEBI: CHEBI:34699 IUPAC Name: diethyl sulfate SMILES: CCOS(=O)(=O)OCC
| PubChem CID | 6163 |
|---|---|
| CAS | 64-67-5 |
| Molecular Weight (g/mol) | 154.18 |
| ChEBI | CHEBI:34699 |
| MDL Number | MFCD00009099 |
| SMILES | CCOS(=O)(=O)OCC |
| Synonym | sulfuric acid, diethyl ester,diethyl sulphate,diethylsulfate,diaethylsulfat,sulfuric acid diethyl ester,diethyl tetraoxosulfate,diaethylsulfat german,unii-k0fo4vfa7i,des van,diethylester kyseliny sirove |
| IUPAC Name | diethyl sulfate |
| InChI Key | DENRZWYUOJLTMF-UHFFFAOYSA-N |
| Molecular Formula | C4H10O4S |
Dimethyl sulfate, 99+%
CAS: 77-78-1 MDL Number: MFCD00008416 InChI Key: VAYGXNSJCAHWJZ-UHFFFAOYSA-N Synonym: dimethyl sulphate,sulfuric acid, dimethyl ester,dimethyl monosulfate,dimethylsulfate,dimethylsulfat,sulfate dimethylique,sulfuric acid dimethyl ester,dimethylsulfaat,dimetilsolfato,dms methyl sulfate PubChem CID: 6497 ChEBI: CHEBI:59050 IUPAC Name: dimethyl sulfate SMILES: COS(=O)(=O)OC
| PubChem CID | 6497 |
|---|---|
| CAS | 77-78-1 |
| ChEBI | CHEBI:59050 |
| MDL Number | MFCD00008416 |
| SMILES | COS(=O)(=O)OC |
| Synonym | dimethyl sulphate,sulfuric acid, dimethyl ester,dimethyl monosulfate,dimethylsulfate,dimethylsulfat,sulfate dimethylique,sulfuric acid dimethyl ester,dimethylsulfaat,dimetilsolfato,dms methyl sulfate |
| IUPAC Name | dimethyl sulfate |
| InChI Key | VAYGXNSJCAHWJZ-UHFFFAOYSA-N |
Methylsulfuric acid sodium salt, 99%, pract.
CAS: 512-42-5 Molecular Formula: CH3NaO4S Molecular Weight (g/mol): 134.08 MDL Number: MFCD00013457 InChI Key: DZXBHDRHRFLQCJ-UHFFFAOYSA-M Synonym: sodium methyl sulfate,methylsulfuric acid sodium salt,methyl sodium sulfate,sodium methyl sulphate,sodium monomethylsulfate,unii-38w76yj3jn,sodium methylsulfate,methyl sulfate sodium salt,methyl sulfate, sodium salt,sulfuric acid, monomethyl ester, sodium salt PubChem CID: 2735086 IUPAC Name: sodium;methyl sulfate SMILES: [Na+].COS([O-])(=O)=O
| PubChem CID | 2735086 |
|---|---|
| CAS | 512-42-5 |
| Molecular Weight (g/mol) | 134.08 |
| MDL Number | MFCD00013457 |
| SMILES | [Na+].COS([O-])(=O)=O |
| Synonym | sodium methyl sulfate,methylsulfuric acid sodium salt,methyl sodium sulfate,sodium methyl sulphate,sodium monomethylsulfate,unii-38w76yj3jn,sodium methylsulfate,methyl sulfate sodium salt,methyl sulfate, sodium salt,sulfuric acid, monomethyl ester, sodium salt |
| IUPAC Name | sodium;methyl sulfate |
| InChI Key | DZXBHDRHRFLQCJ-UHFFFAOYSA-M |
| Molecular Formula | CH3NaO4S |
Methylsulfuric acid potassium salt, 97%
CAS: 562-54-9 Molecular Formula: CH3KO4S Molecular Weight (g/mol): 150.19 MDL Number: MFCD00040472 InChI Key: WBGWGHYJIFOATF-UHFFFAOYSA-M Synonym: potassium methyl sulfate,methyl potassium sulfate,methylsulfuric acid potassium salt,unii-9b0jf05o1c,sulfuric acid, monomethyl ester, potassium salt,potassium methyl sulphate,potassium monomethylsulfate,sulfuric acid, monomethyl ester, potassium salt 1:1,75-93-4 parent,potassium methylsulfate PubChem CID: 2733094 IUPAC Name: potassium;methyl sulfate SMILES: [K+].COS([O-])(=O)=O
| PubChem CID | 2733094 |
|---|---|
| CAS | 562-54-9 |
| Molecular Weight (g/mol) | 150.19 |
| MDL Number | MFCD00040472 |
| SMILES | [K+].COS([O-])(=O)=O |
| Synonym | potassium methyl sulfate,methyl potassium sulfate,methylsulfuric acid potassium salt,unii-9b0jf05o1c,sulfuric acid, monomethyl ester, potassium salt,potassium methyl sulphate,potassium monomethylsulfate,sulfuric acid, monomethyl ester, potassium salt 1:1,75-93-4 parent,potassium methylsulfate |
| IUPAC Name | potassium;methyl sulfate |
| InChI Key | WBGWGHYJIFOATF-UHFFFAOYSA-M |
| Molecular Formula | CH3KO4S |
2-Methyl-2-thiopseudourea hemisulfate, 98%
CAS: 867-44-7 MDL Number: MFCD00013055 InChI Key: BZZXQZOBAUXLHZ-UHFFFAOYSA-N Synonym: s-methylisothiourea hemisulfate,2-methyl-2-thiopseudourea hemisulfate,carbamimidothioic acid, methyl ester, sulfate 2:1,s-methylisothiourea sulfate 2:1,s-methylthiouronium sulfate 2:1,bis 2-methylisothiouronium sulphate,methyl carbamimidothioate sulfate 2:1,methylcarbamimidothioate sulfate 2:1,s-methylisothiourea, sulfate,2-methyl-2-thiopseudourea sulfate 2:1 PubChem CID: 13347 IUPAC Name: methyl carbamimidothioate;sulfuric acid SMILES: CSC(=N)N.CSC(=N)N.OS(=O)(=O)O
| PubChem CID | 13347 |
|---|---|
| CAS | 867-44-7 |
| MDL Number | MFCD00013055 |
| SMILES | CSC(=N)N.CSC(=N)N.OS(=O)(=O)O |
| Synonym | s-methylisothiourea hemisulfate,2-methyl-2-thiopseudourea hemisulfate,carbamimidothioic acid, methyl ester, sulfate 2:1,s-methylisothiourea sulfate 2:1,s-methylthiouronium sulfate 2:1,bis 2-methylisothiouronium sulphate,methyl carbamimidothioate sulfate 2:1,methylcarbamimidothioate sulfate 2:1,s-methylisothiourea, sulfate,2-methyl-2-thiopseudourea sulfate 2:1 |
| IUPAC Name | methyl carbamimidothioate;sulfuric acid |
| InChI Key | BZZXQZOBAUXLHZ-UHFFFAOYSA-N |
Decyl sodium sulfate, HPLC grade
Greener Choice Product
This product offers one or more environmental benefits itemized in the U.S. FTC Green Guides.
Learn More About the Greener Choice Program
This product offers one or more environmental benefits itemized in the U.S. FTC Green Guides.
Learn More About the Greener Choice Program
CAS: 142-87-0 MDL Number: MFCD00041881 InChI Key: XZTJQQLJJCXOLP-UHFFFAOYSA-M Synonym: sodium decyl sulfate,sodium n-decyl sulfate,decyl sodium sulfate,sulfuric acid, monodecyl ester, sodium salt,sodium decyl sulphate,unii-al92m833sy,n-decyl sodium sulfate,sodium n-decylsulphate,sulfuric acid, monodecyl ester, sodium salt 1:1,sulfuric acid, decyl ester, sodium salt PubChem CID: 23665771 IUPAC Name: sodium;decyl sulfate SMILES: CCCCCCCCCCOS(=O)(=O)[O-].[Na+]
| PubChem CID | 23665771 |
|---|---|
| CAS | 142-87-0 |
| MDL Number | MFCD00041881 |
| SMILES | CCCCCCCCCCOS(=O)(=O)[O-].[Na+] |
| Synonym | sodium decyl sulfate,sodium n-decyl sulfate,decyl sodium sulfate,sulfuric acid, monodecyl ester, sodium salt,sodium decyl sulphate,unii-al92m833sy,n-decyl sodium sulfate,sodium n-decylsulphate,sulfuric acid, monodecyl ester, sodium salt 1:1,sulfuric acid, decyl ester, sodium salt |
| IUPAC Name | sodium;decyl sulfate |
| InChI Key | XZTJQQLJJCXOLP-UHFFFAOYSA-M |