Alkaline Earth Metal Salts
Filtered Search Results
Magnesium sulfate heptahydrate, 99%, for biochemistry, Thermo Scientific Chemicals
CAS: 10034-99-8 Molecular Formula: H14MgO11S Molecular Weight (g/mol): 246.47 MDL Number: MFCD00149785 InChI Key: WRUGWIBCXHJTDG-UHFFFAOYSA-L Synonym: magnesium sulfate heptahydrate,mgso4.7h2o,magnesium sulfate 1:1 heptahydrate,magnesium sulphate heptahydrate,unii-sk47b8698t,magnesium sulfate usan:jan,sulfuric acid magnesium salt 1:1 , heptahydrate,magnesium sulfate heptahydrate mgso4.7h2o,sulfuric acid, magnesium salt 1:1 , heptahydrate,magnesium ii , sulfate, heptahydrate PubChem CID: 24843 ChEBI: CHEBI:31795 IUPAC Name: magnesium;sulfate;heptahydrate SMILES: O.O.O.O.O.O.O.[Mg++].[O-]S([O-])(=O)=O
| PubChem CID | 24843 |
|---|---|
| CAS | 10034-99-8 |
| Molecular Weight (g/mol) | 246.47 |
| ChEBI | CHEBI:31795 |
| MDL Number | MFCD00149785 |
| SMILES | O.O.O.O.O.O.O.[Mg++].[O-]S([O-])(=O)=O |
| Synonym | magnesium sulfate heptahydrate,mgso4.7h2o,magnesium sulfate 1:1 heptahydrate,magnesium sulphate heptahydrate,unii-sk47b8698t,magnesium sulfate usan:jan,sulfuric acid magnesium salt 1:1 , heptahydrate,magnesium sulfate heptahydrate mgso4.7h2o,sulfuric acid, magnesium salt 1:1 , heptahydrate,magnesium ii , sulfate, heptahydrate |
| IUPAC Name | magnesium;sulfate;heptahydrate |
| InChI Key | WRUGWIBCXHJTDG-UHFFFAOYSA-L |
| Molecular Formula | H14MgO11S |
Barium isopropoxide, Thermo Scientific Chemicals
CAS: 24363-37-9 Molecular Formula: C6H14BaO2 Molecular Weight (g/mol): 255.503 MDL Number: MFCD00050486 InChI Key: CPUJSIVIXCTVEI-UHFFFAOYSA-N Synonym: barium isopropoxide,barium 2+ ; propan-2-olate,barium diisopropoxide,acmc-20alr0,barium ii isopropoxide,barium 2+ bis propan-2-olate,barium 2+ ion bis propan-2-olate PubChem CID: 6101105 IUPAC Name: barium(2+);propan-2-olate SMILES: CC(C)[O-].CC(C)[O-].[Ba+2]
| PubChem CID | 6101105 |
|---|---|
| CAS | 24363-37-9 |
| Molecular Weight (g/mol) | 255.503 |
| MDL Number | MFCD00050486 |
| SMILES | CC(C)[O-].CC(C)[O-].[Ba+2] |
| Synonym | barium isopropoxide,barium 2+ ; propan-2-olate,barium diisopropoxide,acmc-20alr0,barium ii isopropoxide,barium 2+ bis propan-2-olate,barium 2+ ion bis propan-2-olate |
| IUPAC Name | barium(2+);propan-2-olate |
| InChI Key | CPUJSIVIXCTVEI-UHFFFAOYSA-N |
| Molecular Formula | C6H14BaO2 |
Barium silicon oxide, Thermo Scientific Chemicals
CAS: 13255-26-0 Molecular Formula: BaO3Si Molecular Weight (g/mol): 213.409 MDL Number: MFCD00014186 InChI Key: HMOQPOVBDRFNIU-UHFFFAOYSA-N Synonym: barium silicate,barium metasilicate,silicic acid, barium salt,barium silicon oxide,barium mesosilicate,barium disilicate,bariumsiliconoxide,ba.so3i,barium meta silicate,silicic acid h2sio3 , barium salt 1:1 PubChem CID: 166725 IUPAC Name: barium(2+);dioxido(oxo)silane SMILES: [O-][Si](=O)[O-].[Ba+2]
| PubChem CID | 166725 |
|---|---|
| CAS | 13255-26-0 |
| Molecular Weight (g/mol) | 213.409 |
| MDL Number | MFCD00014186 |
| SMILES | [O-][Si](=O)[O-].[Ba+2] |
| Synonym | barium silicate,barium metasilicate,silicic acid, barium salt,barium silicon oxide,barium mesosilicate,barium disilicate,bariumsiliconoxide,ba.so3i,barium meta silicate,silicic acid h2sio3 , barium salt 1:1 |
| IUPAC Name | barium(2+);dioxido(oxo)silane |
| InChI Key | HMOQPOVBDRFNIU-UHFFFAOYSA-N |
| Molecular Formula | BaO3Si |
Barium thiosulfate, pure, Thermo Scientific™
CAS: 35112-53-9 Molecular Formula: BaO3S2 Molecular Weight (g/mol): 249.46 InChI Key: ONPIOWQPHWNPOQ-UHFFFAOYSA-L Synonym: barium thiosulfate,unii-gpa80950ab,barium 2+ hypo,barium thiosulphate,barium 2+ thiosulphate,acmc-20alqo,ba.so32,thiosulfuric acid h2s2o3 , barium salt 1:1,barium thiosulfate h2o,barium 2+ ion hypo PubChem CID: 169663 IUPAC Name: barium(2+);dioxido-oxo-sulfanylidene-$l^{6}-sulfane SMILES: [O-]S(=O)(=S)[O-].[Ba+2]
| PubChem CID | 169663 |
|---|---|
| CAS | 35112-53-9 |
| Molecular Weight (g/mol) | 249.46 |
| SMILES | [O-]S(=O)(=S)[O-].[Ba+2] |
| Synonym | barium thiosulfate,unii-gpa80950ab,barium 2+ hypo,barium thiosulphate,barium 2+ thiosulphate,acmc-20alqo,ba.so32,thiosulfuric acid h2s2o3 , barium salt 1:1,barium thiosulfate h2o,barium 2+ ion hypo |
| IUPAC Name | barium(2+);dioxido-oxo-sulfanylidene-$l^{6}-sulfane |
| InChI Key | ONPIOWQPHWNPOQ-UHFFFAOYSA-L |
| Molecular Formula | BaO3S2 |
Barium carbonate, 99+%, ACS reagent, Thermo Scientific Chemicals
CAS: 513-77-9 Molecular Formula: CBaO3 Molecular Weight (g/mol): 197.34 MDL Number: MFCD00003448 InChI Key: AYJRCSIUFZENHW-UHFFFAOYSA-L Synonym: barium carbonate,carbonic acid, barium salt 1:1,barium carbonate 1:1,barium monocarbonate,carbonic acid, barium salt,pigment white 10,caswell no. 069,witherite,ci pigment white 10,bw-p PubChem CID: 10563 SMILES: [Ba++].[O-]C([O-])=O
| PubChem CID | 10563 |
|---|---|
| CAS | 513-77-9 |
| Molecular Weight (g/mol) | 197.34 |
| MDL Number | MFCD00003448 |
| SMILES | [Ba++].[O-]C([O-])=O |
| Synonym | barium carbonate,carbonic acid, barium salt 1:1,barium carbonate 1:1,barium monocarbonate,carbonic acid, barium salt,pigment white 10,caswell no. 069,witherite,ci pigment white 10,bw-p |
| InChI Key | AYJRCSIUFZENHW-UHFFFAOYSA-L |
| Molecular Formula | CBaO3 |
Barium metaphosphate, 90+%, Thermo Scientific Chemicals
CAS: 13762-83-9 Molecular Formula: BaO6P2 Molecular Weight (g/mol): 295.27 MDL Number: MFCD00061417 InChI Key: RYSCSJQMVDRYDV-UHFFFAOYSA-J Synonym: barium metaphosphate,barium 2+ ; dioxido oxo phosphanium,ba.2o3p,bismetaphosphoric acid barium salt,barium 2+ bis trioxidophosphate 1- PubChem CID: 16164194 SMILES: [Ba+4].[O-][P]([O-])=O.[O-][P]([O-])=O
| PubChem CID | 16164194 |
|---|---|
| CAS | 13762-83-9 |
| Molecular Weight (g/mol) | 295.27 |
| MDL Number | MFCD00061417 |
| SMILES | [Ba+4].[O-][P]([O-])=O.[O-][P]([O-])=O |
| Synonym | barium metaphosphate,barium 2+ ; dioxido oxo phosphanium,ba.2o3p,bismetaphosphoric acid barium salt,barium 2+ bis trioxidophosphate 1- |
| InChI Key | RYSCSJQMVDRYDV-UHFFFAOYSA-J |
| Molecular Formula | BaO6P2 |
Barium bromide, anhydrous, 99%, Thermo Scientific Chemicals
CAS: 10553-31-8 MDL Number: MFCD00003444
| CAS | 10553-31-8 |
|---|---|
| MDL Number | MFCD00003444 |
Strontium zirconium oxide, 99.3% (metals basis), Thermo Scientific Chemicals
CAS: 12036-39-4 Molecular Formula: O3SrZr Molecular Weight (g/mol): 226.84 MDL Number: MFCD00049555 InChI Key: FCCTVDGKMTZSPU-UHFFFAOYSA-N Synonym: strontium zirconate,strontium zirconium trioxide,strontium dioxido oxo zirconium,o3zr.sr,strontium zirconium oxide srzro3,strontium zirconium oxide,strontium 2+ ion oxozirconiumbis olate,strontium 2+ oxozirconiumbis olate PubChem CID: 82852 IUPAC Name: strontium;dioxido(oxo)zirconium SMILES: [Sr++].[O-][Zr]([O-])=O
| PubChem CID | 82852 |
|---|---|
| CAS | 12036-39-4 |
| Molecular Weight (g/mol) | 226.84 |
| MDL Number | MFCD00049555 |
| SMILES | [Sr++].[O-][Zr]([O-])=O |
| Synonym | strontium zirconate,strontium zirconium trioxide,strontium dioxido oxo zirconium,o3zr.sr,strontium zirconium oxide srzro3,strontium zirconium oxide,strontium 2+ ion oxozirconiumbis olate,strontium 2+ oxozirconiumbis olate |
| IUPAC Name | strontium;dioxido(oxo)zirconium |
| InChI Key | FCCTVDGKMTZSPU-UHFFFAOYSA-N |
| Molecular Formula | O3SrZr |
Beryllium sulfate tetrahydrate, 99.99% (metals basis), Thermo Scientific Chemicals
CAS: 7787-56-6 Molecular Formula: BeH8O8S Molecular Weight (g/mol): 177.128 MDL Number: MFCD00149156 InChI Key: DIMYTQPLZWDZFE-UHFFFAOYSA-L Synonym: beryllium sulfate tetrahydrate,ccris 85,beryllium sulphate tetrahydrate,beryllium monosulfate tetrahydrate,unii-2tyk3lf8zn,beryllium sulfate, tetrahydrate 1:1:4,2tyk3lf8zn,sulfuric acid, beryllium salt 1:1 , tetrahydrate,beryllium sulfate tetrahydrate beryllium and beryllium compounds,dsstox_cid_4603 PubChem CID: 62672 ChEBI: CHEBI:53502 IUPAC Name: beryllium;sulfate;tetrahydrate SMILES: [Be+2].O.O.O.O.[O-]S(=O)(=O)[O-]
| PubChem CID | 62672 |
|---|---|
| CAS | 7787-56-6 |
| Molecular Weight (g/mol) | 177.128 |
| ChEBI | CHEBI:53502 |
| MDL Number | MFCD00149156 |
| SMILES | [Be+2].O.O.O.O.[O-]S(=O)(=O)[O-] |
| Synonym | beryllium sulfate tetrahydrate,ccris 85,beryllium sulphate tetrahydrate,beryllium monosulfate tetrahydrate,unii-2tyk3lf8zn,beryllium sulfate, tetrahydrate 1:1:4,2tyk3lf8zn,sulfuric acid, beryllium salt 1:1 , tetrahydrate,beryllium sulfate tetrahydrate beryllium and beryllium compounds,dsstox_cid_4603 |
| IUPAC Name | beryllium;sulfate;tetrahydrate |
| InChI Key | DIMYTQPLZWDZFE-UHFFFAOYSA-L |
| Molecular Formula | BeH8O8S |
Beryllium oxide, 99% (metals basis), Thermo Scientific Chemicals
CAS: 1304-56-9 Molecular Formula: BeO Molecular Weight (g/mol): 25.01 MDL Number: MFCD00003457 InChI Key: LTPBRCUWZOMYOC-UHFFFAOYSA-N Synonym: beryllium oxide,beryllia,bromellete,thermalox,beryllium monoxide,natural bromellite,thermalox 995,ccris 83,beryllium oxide beryllium and beryllium compounds PubChem CID: 14775 ChEBI: CHEBI:62842 IUPAC Name: oxoberyllium SMILES: [Be]=O
| PubChem CID | 14775 |
|---|---|
| CAS | 1304-56-9 |
| Molecular Weight (g/mol) | 25.01 |
| ChEBI | CHEBI:62842 |
| MDL Number | MFCD00003457 |
| SMILES | [Be]=O |
| Synonym | beryllium oxide,beryllia,bromellete,thermalox,beryllium monoxide,natural bromellite,thermalox 995,ccris 83,beryllium oxide beryllium and beryllium compounds |
| IUPAC Name | oxoberyllium |
| InChI Key | LTPBRCUWZOMYOC-UHFFFAOYSA-N |
| Molecular Formula | BeO |
Magnesium chromate hydrate, 99.8% (metals basis), Thermo Scientific Chemicals
CAS: 16569-85-0 Molecular Formula: CrMgO4 Molecular Weight (g/mol): 140.30 MDL Number: MFCD00801009 InChI Key: CRGGPIWCSGOBDN-UHFFFAOYSA-N Synonym: Magnesium chromate IUPAC Name: magnesium(2+) dioxochromiumbis(olate) SMILES: [Mg++].[O-][Cr]([O-])(=O)=O
| CAS | 16569-85-0 |
|---|---|
| Molecular Weight (g/mol) | 140.30 |
| MDL Number | MFCD00801009 |
| SMILES | [Mg++].[O-][Cr]([O-])(=O)=O |
| Synonym | Magnesium chromate |
| IUPAC Name | magnesium(2+) dioxochromiumbis(olate) |
| InChI Key | CRGGPIWCSGOBDN-UHFFFAOYSA-N |
| Molecular Formula | CrMgO4 |
Beryllium oxide, 99.95% (metals basis), Thermo Scientific Chemicals
CAS: 1304-56-9 Molecular Formula: BeO Molecular Weight (g/mol): 25.01 MDL Number: MFCD00003457 InChI Key: LTPBRCUWZOMYOC-UHFFFAOYSA-N Synonym: beryllium oxide,beryllia,bromellete,thermalox,beryllium monoxide,natural bromellite,thermalox 995,ccris 83,beryllium oxide beryllium and beryllium compounds PubChem CID: 14775 ChEBI: CHEBI:62842 IUPAC Name: oxoberyllium SMILES: [Be]=O
| PubChem CID | 14775 |
|---|---|
| CAS | 1304-56-9 |
| Molecular Weight (g/mol) | 25.01 |
| ChEBI | CHEBI:62842 |
| MDL Number | MFCD00003457 |
| SMILES | [Be]=O |
| Synonym | beryllium oxide,beryllia,bromellete,thermalox,beryllium monoxide,natural bromellite,thermalox 995,ccris 83,beryllium oxide beryllium and beryllium compounds |
| IUPAC Name | oxoberyllium |
| InChI Key | LTPBRCUWZOMYOC-UHFFFAOYSA-N |
| Molecular Formula | BeO |
Calcium perchlorate hydrate, Reagent Grade, Thermo Scientific Chemicals
CAS: 13477-36-6 Molecular Formula: CaCl2O8 Molecular Weight (g/mol): 238.97 MDL Number: MFCD00015971 InChI Key: ZQAOXERLHGRFIC-UHFFFAOYSA-L Synonym: calcium perchlorate,calcium diperchlorate,perchloric acid,calcium salt, tetrahydrate 8ci,9ci,hydrated,perchloric acid, calcium salt,perchloric acid, calcium salt 2:1,ca.2clo4,calcium 2+ diperchlorate ion,calcium perchlorate hydrate 250g,perchloric acid calcium salt 2:1e PubChem CID: 61629 IUPAC Name: calcium;diperchlorate SMILES: [Ca++].[O-][Cl](=O)(=O)=O.[O-][Cl](=O)(=O)=O
| PubChem CID | 61629 |
|---|---|
| CAS | 13477-36-6 |
| Molecular Weight (g/mol) | 238.97 |
| MDL Number | MFCD00015971 |
| SMILES | [Ca++].[O-][Cl](=O)(=O)=O.[O-][Cl](=O)(=O)=O |
| Synonym | calcium perchlorate,calcium diperchlorate,perchloric acid,calcium salt, tetrahydrate 8ci,9ci,hydrated,perchloric acid, calcium salt,perchloric acid, calcium salt 2:1,ca.2clo4,calcium 2+ diperchlorate ion,calcium perchlorate hydrate 250g,perchloric acid calcium salt 2:1e |
| IUPAC Name | calcium;diperchlorate |
| InChI Key | ZQAOXERLHGRFIC-UHFFFAOYSA-L |
| Molecular Formula | CaCl2O8 |
Magnesium germanide, 99.99% (metals basis), Thermo Scientific Chemicals
CAS: 1310-52-7 Molecular Formula: GeMg2 Molecular Weight (g/mol): 121.24 MDL Number: MFCD11044441 InChI Key: MBWJVOFAOUBYNU-UHFFFAOYSA-N Synonym: dimagnesium germanide,magnesium germanide,germane-magnesium 1/2 PubChem CID: 76518831 IUPAC Name: germanium;magnesium SMILES: [Mg].[Mg].[Ge]
| PubChem CID | 76518831 |
|---|---|
| CAS | 1310-52-7 |
| Molecular Weight (g/mol) | 121.24 |
| MDL Number | MFCD11044441 |
| SMILES | [Mg].[Mg].[Ge] |
| Synonym | dimagnesium germanide,magnesium germanide,germane-magnesium 1/2 |
| IUPAC Name | germanium;magnesium |
| InChI Key | MBWJVOFAOUBYNU-UHFFFAOYSA-N |
| Molecular Formula | GeMg2 |
Calcium zirconium oxide, 99.2% (metals basis), Thermo Scientific Chemicals
CAS: 12013-47-7 Molecular Formula: CaO3Zr Molecular Weight (g/mol): 179.299 MDL Number: MFCD00015982 InChI Key: BJJVDFHQHSBAFC-UHFFFAOYSA-N Synonym: calcium zirconate,calcium oxozirconiumbis olate,calcium;dioxido oxo zirconium,calcium 2+ oxozirconiumbis olate PubChem CID: 16212531 IUPAC Name: calcium;dioxido(oxo)zirconium SMILES: [O-][Zr](=O)[O-].[Ca+2]
| PubChem CID | 16212531 |
|---|---|
| CAS | 12013-47-7 |
| Molecular Weight (g/mol) | 179.299 |
| MDL Number | MFCD00015982 |
| SMILES | [O-][Zr](=O)[O-].[Ca+2] |
| Synonym | calcium zirconate,calcium oxozirconiumbis olate,calcium;dioxido oxo zirconium,calcium 2+ oxozirconiumbis olate |
| IUPAC Name | calcium;dioxido(oxo)zirconium |
| InChI Key | BJJVDFHQHSBAFC-UHFFFAOYSA-N |
| Molecular Formula | CaO3Zr |