Reactive Nonmetal Salts
Filtered Search Results
Phosphorus tribromide, 99%
CAS: 7789-60-8 Molecular Formula: Br3P Molecular Weight (g/mol): 270.69 MDL Number: MFCD00011436 InChI Key: IPNPIHIZVLFAFP-UHFFFAOYSA-N Synonym: phosphorus tribromide,phosphorous tribromide,tribromophosphine,phosphorus iii bromide,phosphorous bromide,pbr3,phosphorus bromide,phosphorus bromide pbr3,unii-58r3866pua,tribro-mophosphine PubChem CID: 24614 IUPAC Name: tribromophosphane SMILES: P(Br)(Br)Br
| PubChem CID | 24614 |
|---|---|
| CAS | 7789-60-8 |
| Molecular Weight (g/mol) | 270.69 |
| MDL Number | MFCD00011436 |
| SMILES | P(Br)(Br)Br |
| Synonym | phosphorus tribromide,phosphorous tribromide,tribromophosphine,phosphorus iii bromide,phosphorous bromide,pbr3,phosphorus bromide,phosphorus bromide pbr3,unii-58r3866pua,tribro-mophosphine |
| IUPAC Name | tribromophosphane |
| InChI Key | IPNPIHIZVLFAFP-UHFFFAOYSA-N |
| Molecular Formula | Br3P |
Sulfuryl chloride, 98.5%
CAS: 7791-25-5 Molecular Formula: Cl2O2S Molecular Weight (g/mol): 134.96 MDL Number: MFCD00011451 InChI Key: YBBRCQOCSYXUOC-UHFFFAOYSA-N Synonym: sulfuryl chloride,sulfonyl chloride,sulphuryl dichloride,sulphuryl chloride,sulfonyl dichloride,sulfuric dichloride,sulfuric oxychloride,sulfurylchlorid,caswell no. 816,sulfurylchloride PubChem CID: 24648 ChEBI: CHEBI:29291 IUPAC Name: sulfuryl dichloride SMILES: ClS(Cl)(=O)=O
| PubChem CID | 24648 |
|---|---|
| CAS | 7791-25-5 |
| Molecular Weight (g/mol) | 134.96 |
| ChEBI | CHEBI:29291 |
| MDL Number | MFCD00011451 |
| SMILES | ClS(Cl)(=O)=O |
| Synonym | sulfuryl chloride,sulfonyl chloride,sulphuryl dichloride,sulphuryl chloride,sulfonyl dichloride,sulfuric dichloride,sulfuric oxychloride,sulfurylchlorid,caswell no. 816,sulfurylchloride |
| IUPAC Name | sulfuryl dichloride |
| InChI Key | YBBRCQOCSYXUOC-UHFFFAOYSA-N |
| Molecular Formula | Cl2O2S |
Thiophosgene, 85%
CAS: 463-71-8 MDL Number: MFCD00004918 InChI Key: ZWZVWGITAAIFPS-UHFFFAOYSA-N Synonym: thiophosgene,carbonothioic dichloride,carbon chlorosulfide,thiocarbonyl chloride,thiocarbonic dichloride,dichlorothiocarbonyl,thiofosgen,phosgene, thio,thiokarbonylchlorid,carbonyl chloride, thio PubChem CID: 10040 ChEBI: CHEBI:29366 IUPAC Name: thiocarbonyl dichloride SMILES: C(=S)(Cl)Cl
| PubChem CID | 10040 |
|---|---|
| CAS | 463-71-8 |
| ChEBI | CHEBI:29366 |
| MDL Number | MFCD00004918 |
| SMILES | C(=S)(Cl)Cl |
| Synonym | thiophosgene,carbonothioic dichloride,carbon chlorosulfide,thiocarbonyl chloride,thiocarbonic dichloride,dichlorothiocarbonyl,thiofosgen,phosgene, thio,thiokarbonylchlorid,carbonyl chloride, thio |
| IUPAC Name | thiocarbonyl dichloride |
| InChI Key | ZWZVWGITAAIFPS-UHFFFAOYSA-N |
Sulfaguanidine, 98%, Thermo Scientific Chemicals
CAS: 57-67-0 Molecular Formula: C7H10N4O2S Molecular Weight (g/mol): 214.25 MDL Number: MFCD00038136 InChI Key: BRBKOPJOKNSWSG-UHFFFAOYSA-N Synonym: sulfaguanidine,sulphaguanidine,sulfaguanidin,guanicil,sulfaguine,aterian,sulfanilguanidine,sulfanilylguanidine,sulfoguanidine,abiguanil PubChem CID: 5324 IUPAC Name: 2-(4-aminophenyl)sulfonylguanidine SMILES: C1=CC(=CC=C1N)S(=O)(=O)N=C(N)N
| PubChem CID | 5324 |
|---|---|
| CAS | 57-67-0 |
| Molecular Weight (g/mol) | 214.25 |
| MDL Number | MFCD00038136 |
| SMILES | C1=CC(=CC=C1N)S(=O)(=O)N=C(N)N |
| Synonym | sulfaguanidine,sulphaguanidine,sulfaguanidin,guanicil,sulfaguine,aterian,sulfanilguanidine,sulfanilylguanidine,sulfoguanidine,abiguanil |
| IUPAC Name | 2-(4-aminophenyl)sulfonylguanidine |
| InChI Key | BRBKOPJOKNSWSG-UHFFFAOYSA-N |
| Molecular Formula | C7H10N4O2S |
| Linear Formula | PBr2 |
|---|---|
| Molecular Weight (g/mol) | 270.69 |
| Color | Colorless to Yellow |
| Physical Form | Liquid |
| Chemical Name or Material | Phosphorus tribromide |
| SMILES | P(Br)(Br)Br |
| Merck Index | 15, 7469 |
| InChI Key | IPNPIHIZVLFAFP-UHFFFAOYSA-N |
| Density | 1.4880g/mL |
| PubChem CID | 24614 |
| Name Note | 1.0M Solution in Dichloromethane |
| Concentration or Composition (by Analyte or Components) | 0.9 to 1.1M |
| CAS | 75-09-2 |
| Health Hazard 3 | GHS P Statement Wear protective gloves/protective clothing/eye protection/face protection. IF SWALLOWED: rinse mouth. Do NOT induce vomiting. IF ON SKIN (or hair): Take off immediately all contaminated clothing. Rinse skin with wat |
| MDL Number | MFCD00011436 |
| Health Hazard 2 | GHS H Statement Suspected of causing cancer if inhaled. Causes severe skin burns and eye damage. May cause respiratory irritation. May cause drowsiness or dizziness. Reacts violently with water. |
| Health Hazard 1 | GHS Signal Word: Danger |
| Synonym | phosphorus tribromide,phosphorous tribromide,tribromophosphine,phosphorus iii bromide,phosphorous bromide,pbr3,phosphorus bromide,phosphorus bromide pbr3,unii-58r3866pua,tribro-mophosphine |
| IUPAC Name | tribromophosphane |
| Molecular Formula | Br3P |
| EINECS Number | 232-178-2 |
| Formula Weight | 270.69 |
| Specific Gravity | 1.488 |