Benzoic acid esters
Filtered Search Results
3,4-Dihydroxybenzoic Acid Methyl Ester, TRC
CAS: 2150-43-8 Molecular Formula: C8 H8 O4 Molecular Weight (g/mol): 168.15 Synonym: Benzoic acid, 3,4-dihydroxy-, methyl ester,Protocatechuic acid, methyl ester (6CI,7CI,8CI),3,4-Dihydroxybenzoic acid methyl ester,Methyl 3,4-dihydroxybenzoate,Methyl protocatechuate,NSC 146458 IUPAC Name: methyl 3,4-dihydroxybenzoate SMILES: COC(=O)c1ccc(O)c(O)c1
| CAS | 2150-43-8 |
|---|---|
| Molecular Weight (g/mol) | 168.15 |
| SMILES | COC(=O)c1ccc(O)c(O)c1 |
| Synonym | Benzoic acid, 3,4-dihydroxy-, methyl ester,Protocatechuic acid, methyl ester (6CI,7CI,8CI),3,4-Dihydroxybenzoic acid methyl ester,Methyl 3,4-dihydroxybenzoate,Methyl protocatechuate,NSC 146458 |
| IUPAC Name | methyl 3,4-dihydroxybenzoate |
| Molecular Formula | C8 H8 O4 |
Methyl 4-hydroxybenzoate, 99%
CAS: 99-76-3 Molecular Formula: C8H8O3 Molecular Weight (g/mol): 152.149 MDL Number: MFCD00002352 InChI Key: LXCFILQKKLGQFO-UHFFFAOYSA-N Synonym: methylparaben,methyl paraben,methyl p-hydroxybenzoate,nipagin,methyl parahydroxybenzoate,maseptol,p-hydroxybenzoic acid methyl ester,4-hydroxybenzoic acid methyl ester,p-carbomethoxyphenol,tegosept m PubChem CID: 7456 ChEBI: CHEBI:31835 IUPAC Name: methyl 4-hydroxybenzoate SMILES: COC(=O)C1=CC=C(C=C1)O
| PubChem CID | 7456 |
|---|---|
| CAS | 99-76-3 |
| Molecular Weight (g/mol) | 152.149 |
| ChEBI | CHEBI:31835 |
| MDL Number | MFCD00002352 |
| SMILES | COC(=O)C1=CC=C(C=C1)O |
| Synonym | methylparaben,methyl paraben,methyl p-hydroxybenzoate,nipagin,methyl parahydroxybenzoate,maseptol,p-hydroxybenzoic acid methyl ester,4-hydroxybenzoic acid methyl ester,p-carbomethoxyphenol,tegosept m |
| IUPAC Name | methyl 4-hydroxybenzoate |
| InChI Key | LXCFILQKKLGQFO-UHFFFAOYSA-N |
| Molecular Formula | C8H8O3 |
Methyl salicylate, 98%
CAS: 119-36-8 Molecular Formula: C8H8O3 Molecular Weight (g/mol): 152.149 MDL Number: MFCD00002214 InChI Key: OSWPMRLSEDHDFF-UHFFFAOYSA-N Synonym: methyl salicylate,wintergreen oil,gaultheria oil,betula oil,teaberry oil,sweet birch oil,oil of wintergreen,analgit,spicewood oil,2-hydroxybenzoic acid methyl ester PubChem CID: 4133 ChEBI: CHEBI:31832 IUPAC Name: methyl 2-hydroxybenzoate SMILES: COC(=O)C1=CC=CC=C1O
| PubChem CID | 4133 |
|---|---|
| CAS | 119-36-8 |
| Molecular Weight (g/mol) | 152.149 |
| ChEBI | CHEBI:31832 |
| MDL Number | MFCD00002214 |
| SMILES | COC(=O)C1=CC=CC=C1O |
| Synonym | methyl salicylate,wintergreen oil,gaultheria oil,betula oil,teaberry oil,sweet birch oil,oil of wintergreen,analgit,spicewood oil,2-hydroxybenzoic acid methyl ester |
| IUPAC Name | methyl 2-hydroxybenzoate |
| InChI Key | OSWPMRLSEDHDFF-UHFFFAOYSA-N |
| Molecular Formula | C8H8O3 |
Ethyl 4-hydroxybenzoate, 99%
CAS: 120-47-8 Molecular Formula: C9H10O3 Molecular Weight (g/mol): 166.18 MDL Number: MFCD00002353 InChI Key: NUVBSKCKDOMJSU-UHFFFAOYSA-N Synonym: ethylparaben,ethyl paraben,ethyl p-hydroxybenzoate,mycocten,ethyl parasept,4-hydroxybenzoic acid ethyl ester,easeptol,ethyl butex,ethyl parahydroxybenzoate,tegosept e PubChem CID: 8434 ChEBI: CHEBI:86616 IUPAC Name: ethyl 4-hydroxybenzoate SMILES: CCOC(=O)C1=CC=C(C=C1)O
| PubChem CID | 8434 |
|---|---|
| CAS | 120-47-8 |
| Molecular Weight (g/mol) | 166.18 |
| ChEBI | CHEBI:86616 |
| MDL Number | MFCD00002353 |
| SMILES | CCOC(=O)C1=CC=C(C=C1)O |
| Synonym | ethylparaben,ethyl paraben,ethyl p-hydroxybenzoate,mycocten,ethyl parasept,4-hydroxybenzoic acid ethyl ester,easeptol,ethyl butex,ethyl parahydroxybenzoate,tegosept e |
| IUPAC Name | ethyl 4-hydroxybenzoate |
| InChI Key | NUVBSKCKDOMJSU-UHFFFAOYSA-N |
| Molecular Formula | C9H10O3 |
Methyl 3,5-dihydroxybenzoate, 98%
CAS: 2150-44-9 Molecular Formula: C8H8O4 Molecular Weight (g/mol): 168.15 MDL Number: MFCD00002289 InChI Key: RNVFYQUEEMZKLR-UHFFFAOYSA-N Synonym: 3,5-dihydroxybenzoic acid methyl ester,benzoic acid, 3,5-dihydroxy-, methyl ester,methyl3,5-dihydroxybenzoate,methyl .alpha.-resorcylate,alpha-resorcinol carboxylic acid methyl ester,alpha-resorcylic acid, methyl ester,.alpha.-resorcylic acid, methyl ester,.alpha.-resorcinol carboxylic acid methyl ester,pubchem21357,methyl alpha-resorcylate PubChem CID: 75076 IUPAC Name: methyl 3,5-dihydroxybenzoate SMILES: COC(=O)C1=CC(O)=CC(O)=C1
| PubChem CID | 75076 |
|---|---|
| CAS | 2150-44-9 |
| Molecular Weight (g/mol) | 168.15 |
| MDL Number | MFCD00002289 |
| SMILES | COC(=O)C1=CC(O)=CC(O)=C1 |
| Synonym | 3,5-dihydroxybenzoic acid methyl ester,benzoic acid, 3,5-dihydroxy-, methyl ester,methyl3,5-dihydroxybenzoate,methyl .alpha.-resorcylate,alpha-resorcinol carboxylic acid methyl ester,alpha-resorcylic acid, methyl ester,.alpha.-resorcylic acid, methyl ester,.alpha.-resorcinol carboxylic acid methyl ester,pubchem21357,methyl alpha-resorcylate |
| IUPAC Name | methyl 3,5-dihydroxybenzoate |
| InChI Key | RNVFYQUEEMZKLR-UHFFFAOYSA-N |
| Molecular Formula | C8H8O4 |
Methyl 3,4-dihydroxybenzoate, 97%
CAS: 2150-43-8 Molecular Formula: C8H8O4 Molecular Weight (g/mol): 168.15 MDL Number: MFCD00016437 InChI Key: CUFLZUDASVUNOE-UHFFFAOYSA-N Synonym: methyl protocatechuate,protocatechuic acid, methyl ester,3,4-dihydroxybenzoic acid methyl ester,protocatechuic acid methyl ester,benzoic acid, 3,4-dihydroxy-, methyl ester,3,4-dihydroxymethylbenzoate,3,4-dihydroxybenzoic acid methyl,mdhb,methyl 3,4-dihydroxy,acmc-1cfbz PubChem CID: 287064 IUPAC Name: methyl 3,4-dihydroxybenzoate SMILES: COC(=O)C1=CC=C(O)C(O)=C1
| PubChem CID | 287064 |
|---|---|
| CAS | 2150-43-8 |
| Molecular Weight (g/mol) | 168.15 |
| MDL Number | MFCD00016437 |
| SMILES | COC(=O)C1=CC=C(O)C(O)=C1 |
| Synonym | methyl protocatechuate,protocatechuic acid, methyl ester,3,4-dihydroxybenzoic acid methyl ester,protocatechuic acid methyl ester,benzoic acid, 3,4-dihydroxy-, methyl ester,3,4-dihydroxymethylbenzoate,3,4-dihydroxybenzoic acid methyl,mdhb,methyl 3,4-dihydroxy,acmc-1cfbz |
| IUPAC Name | methyl 3,4-dihydroxybenzoate |
| InChI Key | CUFLZUDASVUNOE-UHFFFAOYSA-N |
| Molecular Formula | C8H8O4 |
ethyl 3,5-dichloro-4-hydroxybenzoate, Thermo Scientific™
CAS: 17302-82-8 Molecular Formula: C9H8Cl2O3 Molecular Weight (g/mol): 235.06 InChI Key: WMKNGSJJEMFQOT-UHFFFAOYSA-N Synonym: 3,5-dichloro-4-hydroxybenzoic acid ethyl ester,benzoic acid, 3,5-dichloro-4-hydroxy-, ethyl ester,3,5-dichloro-4-hydroxy-benzoic acid ethyl ester,acmc-209e5q,3-10-00-00363 beilstein handbook reference,wln: qr bg fg dvo2,ethyl 3,5-dichloro-4-hydroxy-benzoate,ethyl 3,5-bis chloranyl-4-oxidanyl-benzoate,benzoic acid,5-dichloro-4-hydroxy-, ethyl ester PubChem CID: 28460 IUPAC Name: ethyl 3,5-dichloro-4-hydroxybenzoate SMILES: CCOC(=O)C1=CC(=C(C(=C1)Cl)O)Cl
| PubChem CID | 28460 |
|---|---|
| CAS | 17302-82-8 |
| Molecular Weight (g/mol) | 235.06 |
| SMILES | CCOC(=O)C1=CC(=C(C(=C1)Cl)O)Cl |
| Synonym | 3,5-dichloro-4-hydroxybenzoic acid ethyl ester,benzoic acid, 3,5-dichloro-4-hydroxy-, ethyl ester,3,5-dichloro-4-hydroxy-benzoic acid ethyl ester,acmc-209e5q,3-10-00-00363 beilstein handbook reference,wln: qr bg fg dvo2,ethyl 3,5-dichloro-4-hydroxy-benzoate,ethyl 3,5-bis chloranyl-4-oxidanyl-benzoate,benzoic acid,5-dichloro-4-hydroxy-, ethyl ester |
| IUPAC Name | ethyl 3,5-dichloro-4-hydroxybenzoate |
| InChI Key | WMKNGSJJEMFQOT-UHFFFAOYSA-N |
| Molecular Formula | C9H8Cl2O3 |
Methyl 3,5-dihydroxybenzoate, 97%
CAS: 2150-44-9 Molecular Formula: C8H8O4 Molecular Weight (g/mol): 168.15 MDL Number: MFCD00002289 InChI Key: RNVFYQUEEMZKLR-UHFFFAOYSA-N Synonym: 3,5-dihydroxybenzoic acid methyl ester,benzoic acid, 3,5-dihydroxy-, methyl ester,methyl3,5-dihydroxybenzoate,methyl .alpha.-resorcylate,alpha-resorcinol carboxylic acid methyl ester,alpha-resorcylic acid, methyl ester,.alpha.-resorcylic acid, methyl ester,.alpha.-resorcinol carboxylic acid methyl ester,pubchem21357,methyl alpha-resorcylate PubChem CID: 75076 IUPAC Name: methyl 3,5-dihydroxybenzoate SMILES: COC(=O)C1=CC(O)=CC(O)=C1
| PubChem CID | 75076 |
|---|---|
| CAS | 2150-44-9 |
| Molecular Weight (g/mol) | 168.15 |
| MDL Number | MFCD00002289 |
| SMILES | COC(=O)C1=CC(O)=CC(O)=C1 |
| Synonym | 3,5-dihydroxybenzoic acid methyl ester,benzoic acid, 3,5-dihydroxy-, methyl ester,methyl3,5-dihydroxybenzoate,methyl .alpha.-resorcylate,alpha-resorcinol carboxylic acid methyl ester,alpha-resorcylic acid, methyl ester,.alpha.-resorcylic acid, methyl ester,.alpha.-resorcinol carboxylic acid methyl ester,pubchem21357,methyl alpha-resorcylate |
| IUPAC Name | methyl 3,5-dihydroxybenzoate |
| InChI Key | RNVFYQUEEMZKLR-UHFFFAOYSA-N |
| Molecular Formula | C8H8O4 |
Methyl 4-fluoro-3-hydroxybenzoate, 98+%
CAS: 214822-96-5 Molecular Formula: C8H7FO3 Molecular Weight (g/mol): 170.139 MDL Number: MFCD06797457 InChI Key: CUGWNEOTLGLGDG-UHFFFAOYSA-N Synonym: 4-fluoro-3-hydroxybenzoic acid methyl ester,benzoic acid, 4-fluoro-3-hydroxy-, methyl ester,pubchem3567,acmc-209fky,methyl4-fluoro-3-hydroxybenzoate,methyl 4-fluoranyl-3-oxidanyl-benzoate,3-hydroxy-4-fluorobenzoic acid methyl ester,4-fluoro-3-hydroxy-benzoic acid methyl ester,benzoic acid,4-fluoro-3-hydroxy-, methyl ester PubChem CID: 12016892 IUPAC Name: methyl 4-fluoro-3-hydroxybenzoate SMILES: COC(=O)C1=CC(=C(C=C1)F)O
| PubChem CID | 12016892 |
|---|---|
| CAS | 214822-96-5 |
| Molecular Weight (g/mol) | 170.139 |
| MDL Number | MFCD06797457 |
| SMILES | COC(=O)C1=CC(=C(C=C1)F)O |
| Synonym | 4-fluoro-3-hydroxybenzoic acid methyl ester,benzoic acid, 4-fluoro-3-hydroxy-, methyl ester,pubchem3567,acmc-209fky,methyl4-fluoro-3-hydroxybenzoate,methyl 4-fluoranyl-3-oxidanyl-benzoate,3-hydroxy-4-fluorobenzoic acid methyl ester,4-fluoro-3-hydroxy-benzoic acid methyl ester,benzoic acid,4-fluoro-3-hydroxy-, methyl ester |
| IUPAC Name | methyl 4-fluoro-3-hydroxybenzoate |
| InChI Key | CUGWNEOTLGLGDG-UHFFFAOYSA-N |
| Molecular Formula | C8H7FO3 |
Methyl 2,5-dihydroxybenzoate, 98%
CAS: 2150-46-1 Molecular Formula: C8H8O4 Molecular Weight (g/mol): 168.15 MDL Number: MFCD00016464 InChI Key: XGDPKUKRQHHZTH-UHFFFAOYSA-N Synonym: methyl gentisate,gentisic acid methyl ester,methyl2,5-dihydroxybenzoate,benzoic acid, 2,5-dihydroxy-, methyl ester,methyl dihydroxybenzoate,2,5-dihydroxybenzoic acid methyl ester,gentisic acid, methyl ester,methyl-2,5-dihydroxybenzoate,unii-ls28b004km,rarechem al bf 0043 PubChem CID: 75077 IUPAC Name: methyl 2,5-dihydroxybenzoate SMILES: COC(=O)C1=CC(O)=CC=C1O
| PubChem CID | 75077 |
|---|---|
| CAS | 2150-46-1 |
| Molecular Weight (g/mol) | 168.15 |
| MDL Number | MFCD00016464 |
| SMILES | COC(=O)C1=CC(O)=CC=C1O |
| Synonym | methyl gentisate,gentisic acid methyl ester,methyl2,5-dihydroxybenzoate,benzoic acid, 2,5-dihydroxy-, methyl ester,methyl dihydroxybenzoate,2,5-dihydroxybenzoic acid methyl ester,gentisic acid, methyl ester,methyl-2,5-dihydroxybenzoate,unii-ls28b004km,rarechem al bf 0043 |
| IUPAC Name | methyl 2,5-dihydroxybenzoate |
| InChI Key | XGDPKUKRQHHZTH-UHFFFAOYSA-N |
| Molecular Formula | C8H8O4 |
Methyl 3-hydroxybenzoate, 99%
CAS: 19438-10-9 Molecular Formula: C8H8O3 Molecular Weight (g/mol): 152.15 MDL Number: MFCD00002295 InChI Key: YKUCHDXIBAQWSF-UHFFFAOYSA-N Synonym: methyl m-hydroxybenzoate,3-hydroxybenzoic acid methyl ester,m-carbomethoxyphenol,methyl m-oxybenzoate,m-hydroxybenzoic acid methyl ester,benzoic acid, 3-hydroxy-, methyl ester,3-hydroxy-benzoic acid methyl ester,unii-569m9g3stj,3-methoxycarbonyl phenol,benzoic acid, m-hydroxy-, methyl ester PubChem CID: 88068 IUPAC Name: methyl 3-hydroxybenzoate SMILES: COC(=O)C1=CC=CC(O)=C1
| PubChem CID | 88068 |
|---|---|
| CAS | 19438-10-9 |
| Molecular Weight (g/mol) | 152.15 |
| MDL Number | MFCD00002295 |
| SMILES | COC(=O)C1=CC=CC(O)=C1 |
| Synonym | methyl m-hydroxybenzoate,3-hydroxybenzoic acid methyl ester,m-carbomethoxyphenol,methyl m-oxybenzoate,m-hydroxybenzoic acid methyl ester,benzoic acid, 3-hydroxy-, methyl ester,3-hydroxy-benzoic acid methyl ester,unii-569m9g3stj,3-methoxycarbonyl phenol,benzoic acid, m-hydroxy-, methyl ester |
| IUPAC Name | methyl 3-hydroxybenzoate |
| InChI Key | YKUCHDXIBAQWSF-UHFFFAOYSA-N |
| Molecular Formula | C8H8O3 |
Methyl 4-aminosalicylate, 97%, Thermo Scientific Chemicals
CAS: 4136-97-4 Molecular Formula: C8H9NO3 Molecular Weight (g/mol): 167.164 MDL Number: MFCD00088091 InChI Key: QQOXBFUTRLDXDP-UHFFFAOYSA-N Synonym: methyl 4-aminosalicylate,methyl p-aminosalicylate,pas methyl ester,p-aminosalicylic acid methyl ester,methyl 4-amino-2-hydroxybenzenecarboxylate,benzoic acid, 4-amino-2-hydroxy-, methyl ester,methyl 4-amino-2-hydroxy-benzoate,salicylic acid, amino-, methyl ester,4-aminosalicylic acid methyl ester,4-amino-2-hydroxy-benzoic acid methyl ester PubChem CID: 77787 ChEBI: CHEBI:35089 IUPAC Name: methyl 4-amino-2-hydroxybenzoate SMILES: COC(=O)C1=C(C=C(C=C1)N)O
| PubChem CID | 77787 |
|---|---|
| CAS | 4136-97-4 |
| Molecular Weight (g/mol) | 167.164 |
| ChEBI | CHEBI:35089 |
| MDL Number | MFCD00088091 |
| SMILES | COC(=O)C1=C(C=C(C=C1)N)O |
| Synonym | methyl 4-aminosalicylate,methyl p-aminosalicylate,pas methyl ester,p-aminosalicylic acid methyl ester,methyl 4-amino-2-hydroxybenzenecarboxylate,benzoic acid, 4-amino-2-hydroxy-, methyl ester,methyl 4-amino-2-hydroxy-benzoate,salicylic acid, amino-, methyl ester,4-aminosalicylic acid methyl ester,4-amino-2-hydroxy-benzoic acid methyl ester |
| IUPAC Name | methyl 4-amino-2-hydroxybenzoate |
| InChI Key | QQOXBFUTRLDXDP-UHFFFAOYSA-N |
| Molecular Formula | C8H9NO3 |
Ethyl 3,4-dihydroxybenzoate, 98%
CAS: 3943-89-3 Molecular Formula: C9H10O4 Molecular Weight (g/mol): 182.18 MDL Number: MFCD00002199 InChI Key: KBPUBCVJHFXPOC-UHFFFAOYSA-N Synonym: ethyl protocatechuate,3,4-dihydroxybenzoic acid ethyl ester,ethyl-3,4-dihydroxybenzoate,unii-4ygj96wtbg,benzoic acid, 3,4-dihydroxy-, ethyl ester,edhb,protocatechuic acid ethyl ester,4ygj96wtbg,3,4-dihydroxy-benzoic acid ethyl ester PubChem CID: 77547 IUPAC Name: ethyl 3,4-dihydroxybenzoate SMILES: CCOC(=O)C1=CC=C(O)C(O)=C1
| PubChem CID | 77547 |
|---|---|
| CAS | 3943-89-3 |
| Molecular Weight (g/mol) | 182.18 |
| MDL Number | MFCD00002199 |
| SMILES | CCOC(=O)C1=CC=C(O)C(O)=C1 |
| Synonym | ethyl protocatechuate,3,4-dihydroxybenzoic acid ethyl ester,ethyl-3,4-dihydroxybenzoate,unii-4ygj96wtbg,benzoic acid, 3,4-dihydroxy-, ethyl ester,edhb,protocatechuic acid ethyl ester,4ygj96wtbg,3,4-dihydroxy-benzoic acid ethyl ester |
| IUPAC Name | ethyl 3,4-dihydroxybenzoate |
| InChI Key | KBPUBCVJHFXPOC-UHFFFAOYSA-N |
| Molecular Formula | C9H10O4 |