Diphenylmethanes
Filtered Search Results
Thermo Scientific Chemicals Rosolic acid
CAS: 603-45-2 Molecular Formula: C19H14O3 Molecular Weight (g/mol): 290.32 MDL Number: MFCD00001624 InChI Key: FYEHYMARPSSOBO-UHFFFAOYSA-N Synonym: aurin,rosolic acid,corallin,p-rosolic acid,aurine,spirit aurine,corallin spirit soluble,4,4'-dihydroxyfuchsone,aurin no. 555,4-bis 4-hydroxyphenyl methylene cyclohexa-2,5-dienone PubChem CID: 5100 ChEBI: CHEBI:34544 IUPAC Name: 4-[bis(4-hydroxyphenyl)methylidene]cyclohexa-2,5-dien-1-one SMILES: OC1=CC=C(C=C1)C(C1=CC=C(O)C=C1)=C1C=CC(=O)C=C1
| PubChem CID | 5100 |
|---|---|
| CAS | 603-45-2 |
| Molecular Weight (g/mol) | 290.32 |
| ChEBI | CHEBI:34544 |
| MDL Number | MFCD00001624 |
| SMILES | OC1=CC=C(C=C1)C(C1=CC=C(O)C=C1)=C1C=CC(=O)C=C1 |
| Synonym | aurin,rosolic acid,corallin,p-rosolic acid,aurine,spirit aurine,corallin spirit soluble,4,4'-dihydroxyfuchsone,aurin no. 555,4-bis 4-hydroxyphenyl methylene cyclohexa-2,5-dienone |
| IUPAC Name | 4-[bis(4-hydroxyphenyl)methylidene]cyclohexa-2,5-dien-1-one |
| InChI Key | FYEHYMARPSSOBO-UHFFFAOYSA-N |
| Molecular Formula | C19H14O3 |
Methylene di-p-phenyl diisocyanate, 98%, flakes
CAS: 101-68-8 Molecular Formula: C15H10N2O2 Molecular Weight (g/mol): 250.26 MDL Number: MFCD00036131 InChI Key: UPMLOUAZCHDJJD-UHFFFAOYSA-N Synonym: 4,4'-diphenylmethane diisocyanate,diphenylmethane diisocyanate,isonate,4,4'-diisocyanatodiphenylmethane,p,p'-diphenylmethane diisocyanate,bis 4-isocyanatophenyl methane,4,4'-methylenebis phenyl isocyanate,methylbisphenyl isocyanate,1,1'-methylenebis 4-isocyanatobenzene,methylene diphenyl diisocyanate PubChem CID: 7570 ChEBI: CHEBI:53218 IUPAC Name: 1-isocyanato-4-[(4-isocyanatophenyl)methyl]benzene SMILES: C1=CC(=CC=C1CC2=CC=C(C=C2)N=C=O)N=C=O
| PubChem CID | 7570 |
|---|---|
| CAS | 101-68-8 |
| Molecular Weight (g/mol) | 250.26 |
| ChEBI | CHEBI:53218 |
| MDL Number | MFCD00036131 |
| SMILES | C1=CC(=CC=C1CC2=CC=C(C=C2)N=C=O)N=C=O |
| Synonym | 4,4'-diphenylmethane diisocyanate,diphenylmethane diisocyanate,isonate,4,4'-diisocyanatodiphenylmethane,p,p'-diphenylmethane diisocyanate,bis 4-isocyanatophenyl methane,4,4'-methylenebis phenyl isocyanate,methylbisphenyl isocyanate,1,1'-methylenebis 4-isocyanatobenzene,methylene diphenyl diisocyanate |
| IUPAC Name | 1-isocyanato-4-[(4-isocyanatophenyl)methyl]benzene |
| InChI Key | UPMLOUAZCHDJJD-UHFFFAOYSA-N |
| Molecular Formula | C15H10N2O2 |
Thermo Scientific Chemicals Crystal violet, ACS reagent
CAS: 548-62-9 | C25H30ClN3 | 407.99 g/mol
| Molecular Weight (g/mol) | 407.99 |
|---|---|
| ChEBI | CHEBI:41688 |
| Grade | ACS Reagent |
| SMILES | CN(C)C1=CC=C(C=C1)C(=C2C=CC(=[N+](C)C)C=C2)C3=CC=C(C=C3)N(C)C.[Cl-] |
| Merck Index | 15,443 |
| InChI Key | ZXJXZNDDNMQXFV-UHFFFAOYSA-M |
| PubChem CID | 11057 |
| CAS | 90-94-8 |
| Health Hazard 3 | GHS P Statement IF SWALLOWED: rinse mouth. Do NOT induce vomiting. IF IN EYES: Rinse cautiously with water for several minutes. Remove contact lenses,if present and easy to do. Continue rinsing. Immediately call a POISON CENTER |
| Health Hazard 2 | GHS H Statement Very toxic to aquatic life with long lasting effects. Harmful if swallowed. Causes serious eye damage. Suspected of causing cancer. |
| Solubility Information | Solubility in water: 16g/L (25°C). Other solubilities: soluble in chloroform,1g/10 mL alcohol,1g/15 mL glycerin,practically insoluble in ether |
| Health Hazard 1 | GHS Signal Word: Danger |
| Synonym | crystal violet,gentian violet,basic violet 3,methylrosaniline chloride,aniline violet,hexamethyl violet,gentiaverm,hexamethylpararosaniline chloride,pyoktanin,adergon |
| IUPAC Name | [4-[bis[4-(dimethylamino)phenyl]methylidene]cyclohexa-2,5-dien-1-ylidene]-dimethylazanium;chloride |
| Molecular Formula | C25H30ClN3 |
| EINECS Number | 208-953-6 |
| Formula Weight | 407.99 |
| Melting Point | 173°C |
4,4'-Methylenebis(N,N-dimethylaniline), 98%
CAS: 101-61-1 Molecular Formula: C17H22N2 Molecular Weight (g/mol): 254.37 MDL Number: MFCD00008317 InChI Key: JNRLEMMIVRBKJE-UHFFFAOYSA-N Synonym: 4,4'-methylenebis n,n-dimethylaniline,tetra-base,tetrabase,michler's base,methane base,methylene base,michler's hydride,michler's methane,4,4'-bis dimethylamino diphenylmethane,reduced michler's ketone PubChem CID: 7567 ChEBI: CHEBI:34370 IUPAC Name: 4-[[4-(dimethylamino)phenyl]methyl]-N,N-dimethylaniline SMILES: CN(C)C1=CC=C(C=C1)CC2=CC=C(C=C2)N(C)C
| PubChem CID | 7567 |
|---|---|
| CAS | 101-61-1 |
| Molecular Weight (g/mol) | 254.37 |
| ChEBI | CHEBI:34370 |
| MDL Number | MFCD00008317 |
| SMILES | CN(C)C1=CC=C(C=C1)CC2=CC=C(C=C2)N(C)C |
| Synonym | 4,4'-methylenebis n,n-dimethylaniline,tetra-base,tetrabase,michler's base,methane base,methylene base,michler's hydride,michler's methane,4,4'-bis dimethylamino diphenylmethane,reduced michler's ketone |
| IUPAC Name | 4-[[4-(dimethylamino)phenyl]methyl]-N,N-dimethylaniline |
| InChI Key | JNRLEMMIVRBKJE-UHFFFAOYSA-N |
| Molecular Formula | C17H22N2 |
Benzophenone oxime, 98%
CAS: 574-66-3 Molecular Formula: C13H11NO Molecular Weight (g/mol): 197.24 MDL Number: MFCD00051461 InChI Key: DNYZBFWKVMKMRM-UHFFFAOYSA-N Synonym: benzophenone oxime,diphenylmethanone oxime,benzophenoxime,methanone, diphenyl-, oxime,diphenyl ketoxime,benzophenoneoxime,diphenylmethylene hydroxylamine,benzophenone, oxime,unii-2dlj8c37dq,diphenylketone oxime PubChem CID: 11324 IUPAC Name: N-benzhydrylidenehydroxylamine SMILES: ON=C(C1=CC=CC=C1)C1=CC=CC=C1
| PubChem CID | 11324 |
|---|---|
| CAS | 574-66-3 |
| Molecular Weight (g/mol) | 197.24 |
| MDL Number | MFCD00051461 |
| SMILES | ON=C(C1=CC=CC=C1)C1=CC=CC=C1 |
| Synonym | benzophenone oxime,diphenylmethanone oxime,benzophenoxime,methanone, diphenyl-, oxime,diphenyl ketoxime,benzophenoneoxime,diphenylmethylene hydroxylamine,benzophenone, oxime,unii-2dlj8c37dq,diphenylketone oxime |
| IUPAC Name | N-benzhydrylidenehydroxylamine |
| InChI Key | DNYZBFWKVMKMRM-UHFFFAOYSA-N |
| Molecular Formula | C13H11NO |
Diphenhydramine hydrochloride, 99%
CAS: 147-24-0 Molecular Formula: C17H22ClNO Molecular Weight (g/mol): 291.82 MDL Number: MFCD00012479 InChI Key: PCHPORCSPXIHLZ-UHFFFAOYSA-N Synonym: diphenhydramine hydrochloride,dimedrol,diphenhydramine hcl,carphenamine,bendylate,carphenex,cathejell,denydryl,diphamine,eldadryl PubChem CID: 8980 ChEBI: CHEBI:4637 IUPAC Name: 2-benzhydryloxy-N,N-dimethylethanamine;hydrochloride SMILES: [H+].[Cl-].CN(C)CCOC(C1=CC=CC=C1)C1=CC=CC=C1
| PubChem CID | 8980 |
|---|---|
| CAS | 147-24-0 |
| Molecular Weight (g/mol) | 291.82 |
| ChEBI | CHEBI:4637 |
| MDL Number | MFCD00012479 |
| SMILES | [H+].[Cl-].CN(C)CCOC(C1=CC=CC=C1)C1=CC=CC=C1 |
| Synonym | diphenhydramine hydrochloride,dimedrol,diphenhydramine hcl,carphenamine,bendylate,carphenex,cathejell,denydryl,diphamine,eldadryl |
| IUPAC Name | 2-benzhydryloxy-N,N-dimethylethanamine;hydrochloride |
| InChI Key | PCHPORCSPXIHLZ-UHFFFAOYSA-N |
| Molecular Formula | C17H22ClNO |
Diphenylmethane, 99%
CAS: 101-81-5 Molecular Formula: C13H12 Molecular Weight (g/mol): 168.24 MDL Number: MFCD00004781 InChI Key: CZZYITDELCSZES-UHFFFAOYSA-N Synonym: diphenylmethane,ditan,ditane,benzene, 1,1'-methylenebis,diphenyl methane,benzene, benzyl,methane, diphenyl,1,1'-dimethylenebis benzene,benzene, phenylmethyl,methylenedibenzene PubChem CID: 7580 ChEBI: CHEBI:38884 IUPAC Name: benzylbenzene SMILES: C(C1=CC=CC=C1)C1=CC=CC=C1
| PubChem CID | 7580 |
|---|---|
| CAS | 101-81-5 |
| Molecular Weight (g/mol) | 168.24 |
| ChEBI | CHEBI:38884 |
| MDL Number | MFCD00004781 |
| SMILES | C(C1=CC=CC=C1)C1=CC=CC=C1 |
| Synonym | diphenylmethane,ditan,ditane,benzene, 1,1'-methylenebis,diphenyl methane,benzene, benzyl,methane, diphenyl,1,1'-dimethylenebis benzene,benzene, phenylmethyl,methylenedibenzene |
| IUPAC Name | benzylbenzene |
| InChI Key | CZZYITDELCSZES-UHFFFAOYSA-N |
| Molecular Formula | C13H12 |
Aluminon, ACS
CAS: 569-58-4 Molecular Formula: C22H23N3O9 Molecular Weight (g/mol): 473.438 MDL Number: MFCD00040925 InChI Key: AIPNSHNRCQOTRI-UHFFFAOYSA-N Synonym: aluminon,ammonium aurintricarboxylate,aurintricarboxylic acid ammonium salt,aurintricarboxylic acid, acs PubChem CID: 54729869 ChEBI: CHEBI:87398 IUPAC Name: triazanium;5-[(3-carboxy-4-oxidophenyl)-(3-carboxy-4-oxocyclohexa-2,5-dien-1-ylidene)methyl]-2-oxidobenzoate SMILES: C1=CC(=C(C=C1C(=C2C=CC(=O)C(=C2)C(=O)O)C3=CC(=C(C=C3)[O-])C(=O)[O-])C(=O)O)[O-].[NH4+].[NH4+].[NH4+]
| PubChem CID | 54729869 |
|---|---|
| CAS | 569-58-4 |
| Molecular Weight (g/mol) | 473.438 |
| ChEBI | CHEBI:87398 |
| MDL Number | MFCD00040925 |
| SMILES | C1=CC(=C(C=C1C(=C2C=CC(=O)C(=C2)C(=O)O)C3=CC(=C(C=C3)[O-])C(=O)[O-])C(=O)O)[O-].[NH4+].[NH4+].[NH4+] |
| Synonym | aluminon,ammonium aurintricarboxylate,aurintricarboxylic acid ammonium salt,aurintricarboxylic acid, acs |
| IUPAC Name | triazanium;5-[(3-carboxy-4-oxidophenyl)-(3-carboxy-4-oxocyclohexa-2,5-dien-1-ylidene)methyl]-2-oxidobenzoate |
| InChI Key | AIPNSHNRCQOTRI-UHFFFAOYSA-N |
| Molecular Formula | C22H23N3O9 |
1-(Diphenylmethyl)piperazine, 97%
CAS: 841-77-0 MDL Number: MFCD00038379 InChI Key: NWVNXDKZIQLBNM-UHFFFAOYSA-N Synonym: 1-diphenylmethyl piperazine,benzhydrylpiperazine,n-benzhydrylpiperazine,1-benzhydryl-piperazine,diphenylmethylpiperazine,norcyclizine,normethylcyclizine,piperazine, 1-diphenylmethyl,4-benzhydrylpiperazine,n-diphenylmethyl piperazine PubChem CID: 70048 IUPAC Name: 1-benzhydrylpiperazine SMILES: C1CN(CCN1)C(C2=CC=CC=C2)C3=CC=CC=C3
| PubChem CID | 70048 |
|---|---|
| CAS | 841-77-0 |
| MDL Number | MFCD00038379 |
| SMILES | C1CN(CCN1)C(C2=CC=CC=C2)C3=CC=CC=C3 |
| Synonym | 1-diphenylmethyl piperazine,benzhydrylpiperazine,n-benzhydrylpiperazine,1-benzhydryl-piperazine,diphenylmethylpiperazine,norcyclizine,normethylcyclizine,piperazine, 1-diphenylmethyl,4-benzhydrylpiperazine,n-diphenylmethyl piperazine |
| IUPAC Name | 1-benzhydrylpiperazine |
| InChI Key | NWVNXDKZIQLBNM-UHFFFAOYSA-N |
Aluminon, ACS reagent
CAS: 569-58-4 Molecular Formula: C22H23N3O9 Molecular Weight (g/mol): 473.44 InChI Key: AIPNSHNRCQOTRI-UHFFFAOYSA-N Synonym: aluminon,ammonium aurintricarboxylate,aurintricarboxylic acid ammonium salt,aurintricarboxylic acid, acs PubChem CID: 54729869 ChEBI: CHEBI:87398 IUPAC Name: triazanium;5-[(3-carboxy-4-oxidophenyl)-(3-carboxy-4-oxocyclohexa-2,5-dien-1-ylidene)methyl]-2-oxidobenzoate SMILES: C1=CC(=C(C=C1C(=C2C=CC(=O)C(=C2)C(=O)O)C3=CC(=C(C=C3)[O-])C(=O)[O-])C(=O)O)[O-].[NH4+].[NH4+].[NH4+]
| PubChem CID | 54729869 |
|---|---|
| CAS | 569-58-4 |
| Molecular Weight (g/mol) | 473.44 |
| ChEBI | CHEBI:87398 |
| SMILES | C1=CC(=C(C=C1C(=C2C=CC(=O)C(=C2)C(=O)O)C3=CC(=C(C=C3)[O-])C(=O)[O-])C(=O)O)[O-].[NH4+].[NH4+].[NH4+] |
| Synonym | aluminon,ammonium aurintricarboxylate,aurintricarboxylic acid ammonium salt,aurintricarboxylic acid, acs |
| IUPAC Name | triazanium;5-[(3-carboxy-4-oxidophenyl)-(3-carboxy-4-oxocyclohexa-2,5-dien-1-ylidene)methyl]-2-oxidobenzoate |
| InChI Key | AIPNSHNRCQOTRI-UHFFFAOYSA-N |
| Molecular Formula | C22H23N3O9 |
Diphenylacetic Acid, 99+%
CAS: 117-34-0 MDL Number: MFCD00004251 InChI Key: PYHXGXCGESYPCW-UHFFFAOYSA-N Synonym: diphenylacetic acid,diphenylethanoic acid,acetic acid, diphenyl,benzeneacetic acid, .alpha.-phenyl,1,1-diphenylacetic acid,unii-658ncz0nko,diphenyl-acetic acid,alpha-toluic acid, alpha-phenyl,658ncz0nko,benzeneacetic acid, alpha-phenyl PubChem CID: 8333 ChEBI: CHEBI:41967 IUPAC Name: 2,2-diphenylacetic acid SMILES: C1=CC=C(C=C1)C(C2=CC=CC=C2)C(=O)O
| PubChem CID | 8333 |
|---|---|
| CAS | 117-34-0 |
| ChEBI | CHEBI:41967 |
| MDL Number | MFCD00004251 |
| SMILES | C1=CC=C(C=C1)C(C2=CC=CC=C2)C(=O)O |
| Synonym | diphenylacetic acid,diphenylethanoic acid,acetic acid, diphenyl,benzeneacetic acid, .alpha.-phenyl,1,1-diphenylacetic acid,unii-658ncz0nko,diphenyl-acetic acid,alpha-toluic acid, alpha-phenyl,658ncz0nko,benzeneacetic acid, alpha-phenyl |
| IUPAC Name | 2,2-diphenylacetic acid |
| InChI Key | PYHXGXCGESYPCW-UHFFFAOYSA-N |
Benzophenone imine, 97%, stabilized
CAS: 1013-88-3 Molecular Formula: C13H11N Molecular Weight (g/mol): 181.23 MDL Number: MFCD00001760 InChI Key: SXZIXHOMFPUIRK-UHFFFAOYSA-N Synonym: benzophenone imine,benzophenoneimine,benzhydrylideneamine,1,1-diphenylmethanimine,unii-ejj21na7vi,benzhydrylimine,benzophenonimine,diphenylmethanimineimine,1,1-diphenylmethylimine,benzenemethanimine, .alpha.-phenyl PubChem CID: 136809 IUPAC Name: diphenylmethanimine SMILES: C1=CC=C(C=C1)C(=N)C2=CC=CC=C2
| PubChem CID | 136809 |
|---|---|
| CAS | 1013-88-3 |
| Molecular Weight (g/mol) | 181.23 |
| MDL Number | MFCD00001760 |
| SMILES | C1=CC=C(C=C1)C(=N)C2=CC=CC=C2 |
| Synonym | benzophenone imine,benzophenoneimine,benzhydrylideneamine,1,1-diphenylmethanimine,unii-ejj21na7vi,benzhydrylimine,benzophenonimine,diphenylmethanimineimine,1,1-diphenylmethylimine,benzenemethanimine, .alpha.-phenyl |
| IUPAC Name | diphenylmethanimine |
| InChI Key | SXZIXHOMFPUIRK-UHFFFAOYSA-N |
| Molecular Formula | C13H11N |
Benzophenone hydrazone, 98+%
CAS: 5350-57-2 Molecular Formula: C13H12N2 Molecular Weight (g/mol): 196.253 MDL Number: MFCD00007624 InChI Key: QYCSNMDOZNUZIT-UHFFFAOYSA-N Synonym: benzophenone hydrazone,diphenylmethylene hydrazine,benzophenonehydrazone,methanone, diphenyl-, hydrazone,diphenylmethanone hydrazone,benzophenone, hydrazone,diphenylmethylidene hydrazine,diphenyl ketone hydrazone,benzophenone hydrozone,nsc 43 PubChem CID: 79304 IUPAC Name: benzhydrylidenehydrazine SMILES: C1=CC=C(C=C1)C(=NN)C2=CC=CC=C2
| PubChem CID | 79304 |
|---|---|
| CAS | 5350-57-2 |
| Molecular Weight (g/mol) | 196.253 |
| MDL Number | MFCD00007624 |
| SMILES | C1=CC=C(C=C1)C(=NN)C2=CC=CC=C2 |
| Synonym | benzophenone hydrazone,diphenylmethylene hydrazine,benzophenonehydrazone,methanone, diphenyl-, hydrazone,diphenylmethanone hydrazone,benzophenone, hydrazone,diphenylmethylidene hydrazine,diphenyl ketone hydrazone,benzophenone hydrozone,nsc 43 |
| IUPAC Name | benzhydrylidenehydrazine |
| InChI Key | QYCSNMDOZNUZIT-UHFFFAOYSA-N |
| Molecular Formula | C13H12N2 |
4,4'-Methylenebis(phenyl isocyanate), 98%
CAS: 101-68-8 Molecular Formula: C15H10N2O2 Molecular Weight (g/mol): 250.257 MDL Number: MFCD00036131 InChI Key: UPMLOUAZCHDJJD-UHFFFAOYSA-N Synonym: 4,4'-diphenylmethane diisocyanate,diphenylmethane diisocyanate,isonate,4,4'-diisocyanatodiphenylmethane,p,p'-diphenylmethane diisocyanate,bis 4-isocyanatophenyl methane,4,4'-methylenebis phenyl isocyanate,methylbisphenyl isocyanate,1,1'-methylenebis 4-isocyanatobenzene,methylene diphenyl diisocyanate PubChem CID: 7570 ChEBI: CHEBI:53218 IUPAC Name: 1-isocyanato-4-[(4-isocyanatophenyl)methyl]benzene SMILES: C1=CC(=CC=C1CC2=CC=C(C=C2)N=C=O)N=C=O
| PubChem CID | 7570 |
|---|---|
| CAS | 101-68-8 |
| Molecular Weight (g/mol) | 250.257 |
| ChEBI | CHEBI:53218 |
| MDL Number | MFCD00036131 |
| SMILES | C1=CC(=CC=C1CC2=CC=C(C=C2)N=C=O)N=C=O |
| Synonym | 4,4'-diphenylmethane diisocyanate,diphenylmethane diisocyanate,isonate,4,4'-diisocyanatodiphenylmethane,p,p'-diphenylmethane diisocyanate,bis 4-isocyanatophenyl methane,4,4'-methylenebis phenyl isocyanate,methylbisphenyl isocyanate,1,1'-methylenebis 4-isocyanatobenzene,methylene diphenyl diisocyanate |
| IUPAC Name | 1-isocyanato-4-[(4-isocyanatophenyl)methyl]benzene |
| InChI Key | UPMLOUAZCHDJJD-UHFFFAOYSA-N |
| Molecular Formula | C15H10N2O2 |