Phthalic acid and derivatives
- (2)
- (5)
- (2)
- (3)
- (2)
- (1)
- (2)
- (3)
- (2)
- (2)
- (3)
- (1)
- (3)
- (1)
- (5)
- (1)
- (1)
- (5)
- (1)
- (1)
- (2)
- (2)
- (2)
- (10)
- (3)
- (5)
- (3)
- (3)
- (5)
- (2)
Filtered Search Results
Thermo Scientific Chemicals 5(6)-Carboxyfluorescein
CAS: 72088-94-9 Molecular Formula: C42H24O14 Molecular Weight (g/mol): 752.64 MDL Number: MFCD00151081 InChI Key: BPVHBBXCESDRKW-UHFFFAOYSA-N Synonym: 5 6-fam,3',6'-dihydroxy-3-oxo-3h-spiro isobenzofuran-1,9'-xanthene-5-carboxylic acid compound with 3',6'-dihydroxy-3-oxo-3h-spiro isobenzofuran-1,9'-xanthene-6-carboxylic acid 1:1,5-and-6-fam,5-and-6-carboxyfluorescein,5-carboxyfluorescein; carboxyfluorescein,5 6-carboxyfluorescein, dye content 90 %,5 6-carboxyfluorescein; carboxyfluorescein,5 6-carboxyfluorescein, bioreagent, suitable for fluorescence hplc,3,6-dihydroxy-3-oxo-3h-spiro isobenzofuran-1,9-xanthene-5-carboxylic acid compound with 3,6-dihydroxy-3-oxo-3h-spiro isobenzofuran-1,9-xanthene-6-carboxylic acid 1:1,4 5-carboxyfluorescein; 3',6'-dihydroxy-3-oxospiro 2-benzofuran-1,9'-xanthene-5 6-carboxylic acid PubChem CID: 44119975 IUPAC Name: 3',6'-dihydroxy-1-oxospiro[2-benzofuran-3,9'-xanthene]-5-carboxylic acid;3',6'-dihydroxy-3-oxospiro[2-benzofuran-1,9'-xanthene]-5-carboxylic acid SMILES: OC(=O)C1=CC2=C(C=C1)C1(OC2=O)C2=C(OC3=C1C=CC(O)=C3)C=C(O)C=C2.OC(=O)C1=CC2=C(C=C1)C(=O)OC21C2=C(OC3=C1C=CC(O)=C3)C=C(O)C=C2
| PubChem CID | 44119975 |
|---|---|
| CAS | 72088-94-9 |
| Molecular Weight (g/mol) | 752.64 |
| MDL Number | MFCD00151081 |
| SMILES | OC(=O)C1=CC2=C(C=C1)C1(OC2=O)C2=C(OC3=C1C=CC(O)=C3)C=C(O)C=C2.OC(=O)C1=CC2=C(C=C1)C(=O)OC21C2=C(OC3=C1C=CC(O)=C3)C=C(O)C=C2 |
| Synonym | 5 6-fam,3',6'-dihydroxy-3-oxo-3h-spiro isobenzofuran-1,9'-xanthene-5-carboxylic acid compound with 3',6'-dihydroxy-3-oxo-3h-spiro isobenzofuran-1,9'-xanthene-6-carboxylic acid 1:1,5-and-6-fam,5-and-6-carboxyfluorescein,5-carboxyfluorescein; carboxyfluorescein,5 6-carboxyfluorescein, dye content 90 %,5 6-carboxyfluorescein; carboxyfluorescein,5 6-carboxyfluorescein, bioreagent, suitable for fluorescence hplc,3,6-dihydroxy-3-oxo-3h-spiro isobenzofuran-1,9-xanthene-5-carboxylic acid compound with 3,6-dihydroxy-3-oxo-3h-spiro isobenzofuran-1,9-xanthene-6-carboxylic acid 1:1,4 5-carboxyfluorescein; 3',6'-dihydroxy-3-oxospiro 2-benzofuran-1,9'-xanthene-5 6-carboxylic acid |
| IUPAC Name | 3',6'-dihydroxy-1-oxospiro[2-benzofuran-3,9'-xanthene]-5-carboxylic acid;3',6'-dihydroxy-3-oxospiro[2-benzofuran-1,9'-xanthene]-5-carboxylic acid |
| InChI Key | BPVHBBXCESDRKW-UHFFFAOYSA-N |
| Molecular Formula | C42H24O14 |
Methyl hydrogen isophthalate, 97%
CAS: 1877-71-0 Molecular Formula: C9H8O4 Molecular Weight (g/mol): 180.159 MDL Number: MFCD00029972 InChI Key: WMZNGTSLFSJHMZ-UHFFFAOYSA-N Synonym: 3-methoxycarbonyl benzoic acid,mono-methyl isophthalate,methyl hydrogen isophthalate,isophthalic acid monomethyl ester,monomethyl isophthalate,isophthalic acid methyl ester,isophthalic acid, methyl ester,isophthalic acid, monomethyl ester,methyl m-phthalate,methyl 3-carboxybenzoate PubChem CID: 601880 IUPAC Name: 3-methoxycarbonylbenzoic acid SMILES: COC(=O)C1=CC=CC(=C1)C(=O)O
| PubChem CID | 601880 |
|---|---|
| CAS | 1877-71-0 |
| Molecular Weight (g/mol) | 180.159 |
| MDL Number | MFCD00029972 |
| SMILES | COC(=O)C1=CC=CC(=C1)C(=O)O |
| Synonym | 3-methoxycarbonyl benzoic acid,mono-methyl isophthalate,methyl hydrogen isophthalate,isophthalic acid monomethyl ester,monomethyl isophthalate,isophthalic acid methyl ester,isophthalic acid, methyl ester,isophthalic acid, monomethyl ester,methyl m-phthalate,methyl 3-carboxybenzoate |
| IUPAC Name | 3-methoxycarbonylbenzoic acid |
| InChI Key | WMZNGTSLFSJHMZ-UHFFFAOYSA-N |
| Molecular Formula | C9H8O4 |
Thermo Scientific Chemicals 6-Carboxyfluorescein, 96%
CAS: 3301-79-9 Molecular Formula: C21H12O7 Molecular Weight (g/mol): 376.32 MDL Number: MFCD00036873 InChI Key: BZTDTCNHAFUJOG-UHFFFAOYSA-N Synonym: 6-carboxyfluorescein,6-fam,carboxyfluorescein,spiro isobenzofuran-1 3h ,9'-9h xanthene-6-carboxylic acid, 3',6'-dihydroxy-3-oxo,3,6,9-trihydroxyxanthen-9-yl terephthalic acid,3',6'-dihydroxy-3-oxo-3h-spiro 2-benzofuran-1,9'-xanthene-6-carboxylic acid,3',6'-dihydroxy-3-oxo-3h-spiro isobenzofuran-1,9'-xanthene-6-carboxylic acid,5 6-carboxy fluorescein,bidd:gt0504 PubChem CID: 76806 ChEBI: CHEBI:39073 IUPAC Name: 3',6'-dihydroxy-1-oxospiro[2-benzofuran-3,9'-xanthene]-5-carboxylic acid SMILES: C1=CC2=C(C=C1C(=O)O)C3(C4=C(C=C(C=C4)O)OC5=C3C=CC(=C5)O)OC2=O
| PubChem CID | 76806 |
|---|---|
| CAS | 3301-79-9 |
| Molecular Weight (g/mol) | 376.32 |
| ChEBI | CHEBI:39073 |
| MDL Number | MFCD00036873 |
| SMILES | C1=CC2=C(C=C1C(=O)O)C3(C4=C(C=C(C=C4)O)OC5=C3C=CC(=C5)O)OC2=O |
| Synonym | 6-carboxyfluorescein,6-fam,carboxyfluorescein,spiro isobenzofuran-1 3h ,9'-9h xanthene-6-carboxylic acid, 3',6'-dihydroxy-3-oxo,3,6,9-trihydroxyxanthen-9-yl terephthalic acid,3',6'-dihydroxy-3-oxo-3h-spiro 2-benzofuran-1,9'-xanthene-6-carboxylic acid,3',6'-dihydroxy-3-oxo-3h-spiro isobenzofuran-1,9'-xanthene-6-carboxylic acid,5 6-carboxy fluorescein,bidd:gt0504 |
| IUPAC Name | 3',6'-dihydroxy-1-oxospiro[2-benzofuran-3,9'-xanthene]-5-carboxylic acid |
| InChI Key | BZTDTCNHAFUJOG-UHFFFAOYSA-N |
| Molecular Formula | C21H12O7 |
mono-Methyl terephthalate, 97%
CAS: 1679-64-7 Molecular Formula: C9H8O4 Molecular Weight (g/mol): 180.16 MDL Number: MFCD00002557 InChI Key: REIDAMBAPLIATC-UHFFFAOYSA-N Synonym: 4-methoxycarbonyl benzoic acid,mono-methyl terephthalate,monomethyl terephthalate,methyl terephthalate,methyl hydrogen terephthalate,1,4-benzenedicarboxylic acid, monomethyl ester,terephthalic acid monomethyl ester,1,4-benzenedicarboxylic acid monomethyl ester,terephthalic acid, monomethyl ester,hydrogen methyl terephthalate PubChem CID: 15513 IUPAC Name: 4-methoxycarbonylbenzoic acid SMILES: COC(=O)C1=CC=C(C=C1)C(=O)O
| PubChem CID | 15513 |
|---|---|
| CAS | 1679-64-7 |
| Molecular Weight (g/mol) | 180.16 |
| MDL Number | MFCD00002557 |
| SMILES | COC(=O)C1=CC=C(C=C1)C(=O)O |
| Synonym | 4-methoxycarbonyl benzoic acid,mono-methyl terephthalate,monomethyl terephthalate,methyl terephthalate,methyl hydrogen terephthalate,1,4-benzenedicarboxylic acid, monomethyl ester,terephthalic acid monomethyl ester,1,4-benzenedicarboxylic acid monomethyl ester,terephthalic acid, monomethyl ester,hydrogen methyl terephthalate |
| IUPAC Name | 4-methoxycarbonylbenzoic acid |
| InChI Key | REIDAMBAPLIATC-UHFFFAOYSA-N |
| Molecular Formula | C9H8O4 |
Methyl 2-amino-3-carboxybenzoate, 97%, Thermo Scientific™
CAS: 253120-47-7 Molecular Formula: C9H9NO4 Molecular Weight (g/mol): 195.17 MDL Number: MFCD06200897 InChI Key: UXQCFHRNRAGKOY-UHFFFAOYSA-N PubChem CID: 2794812 IUPAC Name: 2-amino-3-methoxycarbonylbenzoic acid SMILES: COC(=O)C1=CC=CC(C(O)=O)=C1N
| PubChem CID | 2794812 |
|---|---|
| CAS | 253120-47-7 |
| Molecular Weight (g/mol) | 195.17 |
| MDL Number | MFCD06200897 |
| SMILES | COC(=O)C1=CC=CC(C(O)=O)=C1N |
| IUPAC Name | 2-amino-3-methoxycarbonylbenzoic acid |
| InChI Key | UXQCFHRNRAGKOY-UHFFFAOYSA-N |
| Molecular Formula | C9H9NO4 |
Dimethyl 5-hydroxyisophthalate, 99%
CAS: 13036-02-7 Molecular Formula: C10H10O5 Molecular Weight (g/mol): 210.19 MDL Number: MFCD00134367 InChI Key: DOSDTCPDBPRFHQ-UHFFFAOYSA-N PubChem CID: 83065 SMILES: COC(=O)C1=CC(=CC(O)=C1)C(=O)OC
| PubChem CID | 83065 |
|---|---|
| CAS | 13036-02-7 |
| Molecular Weight (g/mol) | 210.19 |
| MDL Number | MFCD00134367 |
| SMILES | COC(=O)C1=CC(=CC(O)=C1)C(=O)OC |
| InChI Key | DOSDTCPDBPRFHQ-UHFFFAOYSA-N |
| Molecular Formula | C10H10O5 |
2-Bromoterephthalic acid, 95%, Thermo Scientific Chemicals
CAS: 586-35-6 Molecular Formula: C8H5BrO4 Molecular Weight (g/mol): 245.03 MDL Number: MFCD00002403 InChI Key: QPBGNSFASPVGTP-UHFFFAOYSA-N Synonym: bromoterephthalic acid,2-bromobenzene-1,4-dicarboxylic acid,2-bromoterephthalicacid,2-bromo-terephthalic acid,2-bromo-1,4-benzenedicarboxylic acid,1,4-benzenedicarboxylic acid, 2-bromo,labotest-bb lt00454996,pubchem12798,2-bromo terephthalic acid,acmc-1aoy9 PubChem CID: 68513 IUPAC Name: 2-bromoterephthalic acid SMILES: C1=CC(=C(C=C1C(=O)O)Br)C(=O)O
| PubChem CID | 68513 |
|---|---|
| CAS | 586-35-6 |
| Molecular Weight (g/mol) | 245.03 |
| MDL Number | MFCD00002403 |
| SMILES | C1=CC(=C(C=C1C(=O)O)Br)C(=O)O |
| Synonym | bromoterephthalic acid,2-bromobenzene-1,4-dicarboxylic acid,2-bromoterephthalicacid,2-bromo-terephthalic acid,2-bromo-1,4-benzenedicarboxylic acid,1,4-benzenedicarboxylic acid, 2-bromo,labotest-bb lt00454996,pubchem12798,2-bromo terephthalic acid,acmc-1aoy9 |
| IUPAC Name | 2-bromoterephthalic acid |
| InChI Key | QPBGNSFASPVGTP-UHFFFAOYSA-N |
| Molecular Formula | C8H5BrO4 |
Dimethyl aminoterephthalate, 99%
CAS: 5372-81-6 Molecular Formula: C10H11NO4 Molecular Weight (g/mol): 209.2 MDL Number: MFCD00008427 InChI Key: DSSKDXUDARIMTR-UHFFFAOYSA-N Synonym: dimethyl 2-aminoterephthalate,dimethyl aminoterephthalate,dimethyl 3-aminoterephthalate,1,4-benzenedicarboxylic acid, 2-amino-, dimethyl ester,aminoterephthalic acid dimethyl ester,1,4-dimethyl 2-aminobenzene-1,4-dicarboxylate,unii-91sf4e6i9w,2-aminoterephthalic acid, dimethyl ester,3-amino-4-methoxycarbonylbenzoic acid, methyl ester,terephthalic acid, amino-, dimethyl ester PubChem CID: 79336 IUPAC Name: dimethyl 2-aminobenzene-1,4-dicarboxylate SMILES: COC(=O)C1=CC(=C(C=C1)C(=O)OC)N
| PubChem CID | 79336 |
|---|---|
| CAS | 5372-81-6 |
| Molecular Weight (g/mol) | 209.2 |
| MDL Number | MFCD00008427 |
| SMILES | COC(=O)C1=CC(=C(C=C1)C(=O)OC)N |
| Synonym | dimethyl 2-aminoterephthalate,dimethyl aminoterephthalate,dimethyl 3-aminoterephthalate,1,4-benzenedicarboxylic acid, 2-amino-, dimethyl ester,aminoterephthalic acid dimethyl ester,1,4-dimethyl 2-aminobenzene-1,4-dicarboxylate,unii-91sf4e6i9w,2-aminoterephthalic acid, dimethyl ester,3-amino-4-methoxycarbonylbenzoic acid, methyl ester,terephthalic acid, amino-, dimethyl ester |
| IUPAC Name | dimethyl 2-aminobenzene-1,4-dicarboxylate |
| InChI Key | DSSKDXUDARIMTR-UHFFFAOYSA-N |
| Molecular Formula | C10H11NO4 |
Dimethyl 5-sulfoisophthalate sodium salt, 98%, Thermo Scientific™
CAS: 3965-55-7 Molecular Formula: C10H9NaO7S Molecular Weight (g/mol): 296.225 MDL Number: MFCD00007493 InChI Key: LLHSEQCZSNZLRI-UHFFFAOYSA-M Synonym: sodium 3,5-bis methoxycarbonyl benzenesulfonate,sodium dimethyl 5-sulphonatoisophthalate,dimethyl 5-sulfoisophthalate sodium salt,unii-7l3g5x9vdu,sodium 1,3-dimethyl 5-sulfoisophthalate,7l3g5x9vdu,5-sulfoisophthalic acid, dimethyl ester, sodium salt,sodium dimethyl 5-sulfoisophthalate,1,3-benzenedicarboxylic acid, 5-sulfo-, 1,3-dimethyl ester, sodium salt,3,5-bis-methylkarboxy-benzensulfonan sodny czech PubChem CID: 23675796 IUPAC Name: sodium;3,5-bis(methoxycarbonyl)benzenesulfonate SMILES: COC(=O)C1=CC(=CC(=C1)S(=O)(=O)[O-])C(=O)OC.[Na+]
| PubChem CID | 23675796 |
|---|---|
| CAS | 3965-55-7 |
| Molecular Weight (g/mol) | 296.225 |
| MDL Number | MFCD00007493 |
| SMILES | COC(=O)C1=CC(=CC(=C1)S(=O)(=O)[O-])C(=O)OC.[Na+] |
| Synonym | sodium 3,5-bis methoxycarbonyl benzenesulfonate,sodium dimethyl 5-sulphonatoisophthalate,dimethyl 5-sulfoisophthalate sodium salt,unii-7l3g5x9vdu,sodium 1,3-dimethyl 5-sulfoisophthalate,7l3g5x9vdu,5-sulfoisophthalic acid, dimethyl ester, sodium salt,sodium dimethyl 5-sulfoisophthalate,1,3-benzenedicarboxylic acid, 5-sulfo-, 1,3-dimethyl ester, sodium salt,3,5-bis-methylkarboxy-benzensulfonan sodny czech |
| IUPAC Name | sodium;3,5-bis(methoxycarbonyl)benzenesulfonate |
| InChI Key | LLHSEQCZSNZLRI-UHFFFAOYSA-M |
| Molecular Formula | C10H9NaO7S |
mono-Methyl isophthalate, 97%
CAS: 1877-71-0 Molecular Formula: C9H8O4 Molecular Weight (g/mol): 180.16 MDL Number: MFCD00029972 InChI Key: WMZNGTSLFSJHMZ-UHFFFAOYSA-N Synonym: 3-methoxycarbonyl benzoic acid,mono-methyl isophthalate,methyl hydrogen isophthalate,isophthalic acid monomethyl ester,monomethyl isophthalate,isophthalic acid methyl ester,isophthalic acid, methyl ester,isophthalic acid, monomethyl ester,methyl m-phthalate,methyl 3-carboxybenzoate PubChem CID: 601880 IUPAC Name: 3-methoxycarbonylbenzoic acid SMILES: COC(=O)C1=CC=CC(=C1)C(=O)O
| PubChem CID | 601880 |
|---|---|
| CAS | 1877-71-0 |
| Molecular Weight (g/mol) | 180.16 |
| MDL Number | MFCD00029972 |
| SMILES | COC(=O)C1=CC=CC(=C1)C(=O)O |
| Synonym | 3-methoxycarbonyl benzoic acid,mono-methyl isophthalate,methyl hydrogen isophthalate,isophthalic acid monomethyl ester,monomethyl isophthalate,isophthalic acid methyl ester,isophthalic acid, methyl ester,isophthalic acid, monomethyl ester,methyl m-phthalate,methyl 3-carboxybenzoate |
| IUPAC Name | 3-methoxycarbonylbenzoic acid |
| InChI Key | WMZNGTSLFSJHMZ-UHFFFAOYSA-N |
| Molecular Formula | C9H8O4 |