Hydroxybenzoic Acid Derivatives
Filtered Search Results
Salicylic acid, sodium salt, 99+%, Thermo Scientific Chemicals
CAS: 54-21-7 Molecular Formula: C7H5NaO3 Molecular Weight (g/mol): 160.104 MDL Number: MFCD00002440 InChI Key: ABBQHOQBGMUPJH-UHFFFAOYSA-M Synonym: sodium salicylate,sodium 2-hydroxybenzoate,salsonin,clin,enterosalicyl,enterosalil,entrosalyl,glutosalyl,kerasalicyl,magsalyl PubChem CID: 16760658 ChEBI: CHEBI:9180 IUPAC Name: sodium;2-hydroxybenzoate SMILES: C1=CC=C(C(=C1)C(=O)[O-])O.[Na+]
| PubChem CID | 16760658 |
|---|---|
| CAS | 54-21-7 |
| Molecular Weight (g/mol) | 160.104 |
| ChEBI | CHEBI:9180 |
| MDL Number | MFCD00002440 |
| SMILES | C1=CC=C(C(=C1)C(=O)[O-])O.[Na+] |
| Synonym | sodium salicylate,sodium 2-hydroxybenzoate,salsonin,clin,enterosalicyl,enterosalil,entrosalyl,glutosalyl,kerasalicyl,magsalyl |
| IUPAC Name | sodium;2-hydroxybenzoate |
| InChI Key | ABBQHOQBGMUPJH-UHFFFAOYSA-M |
| Molecular Formula | C7H5NaO3 |
3-Chloroperoxybenzoic Acid, 70-75%, balance 3-Chlorobenzoic Acid and water
3-Chloroperoxybenzoic acid, 70-75%, C7H5ClO3, CAS Number-937-14-4, 535-80-8, 7732-18-5 | CAS: 937-14-4 | C7H5ClO3 | 172.56 g/mol
| Linear Formula | ClC6H4CO3H |
|---|---|
| Molecular Weight (g/mol) | 172.56 |
| ChEBI | CHEBI:52091 |
| CAS Min % | 25.0 |
| InChI Key | NHQDETIJWKXCTC-UHFFFAOYSA-N |
| Density | 0.5600g/mL |
| PubChem CID | 70297 |
| Name Note | 70 - 75% |
| Percent Purity | 70-75% |
| Fieser | 01,135; 02,68; 03,49; 04,85; 05,120; 06,110; 07,62; 08,97; 09,108; 10,92; 11,122; 12,118; 13,76; 15,86; 16,80; 17,76 |
| RTECS Number | SD9470000 |
| Formula Weight | 172.57 |
| Melting Point | 92.0°C to 94.0°C |
| CAS Max % | 30.0 |
| Color | White |
| Physical Form | Moist Powder |
| SMILES | OOC(=O)C1=CC=CC(Cl)=C1 |
| Merck Index | 15,2154 |
| Assay Percent Range | di-m-Chlorobenzoyl peroxide: < 0.1% Typical (HPLC) |
| CAS | 7732-18-5 |
| Health Hazard 3 | GHS P Statement Wear protective gloves/protective clothing/eye protection/face protection. Keep away from heat/sparks/open flames/hot surfaces. - No smoking. Keep/Store away from clothing/ combustible materials. IF SWALLOWED: rin |
| MDL Number | MFCD00002127 |
| Health Hazard 2 | GHS H Statement Causes severe skin burns and eye damage. Harmful if swallowed. Heating may cause a fire. |
| Solubility Information | Solubility in water: insoluble. Other solubilities: soluble in koh, soluble in chloroform and acetone |
| Health Hazard 1 | GHS Signal Word: Danger |
| Synonym | 3-chloroperoxybenzoic acid,3-chloroperbenzoic acid,mcpba,m-chloroperbenzoic acid,m-chloroperoxybenzoic acid,meta-chloroperoxybenzoic acid,benzenecarboperoxoic acid, 3-chloro,m-chlorobenzoyl hydroperoxide,meta-chloroperbenzoic acid,3-chlorobenzoperoxoic acid |
| TSCA | TSCA |
| IUPAC Name | 3-chlorobenzenecarboperoxoic acid |
| Beilstein | 09,IV,972 |
| Molecular Formula | C7H5ClO3 |
| EINECS Number | 213-322-3 |
| Specific Gravity | 0.56 |
4-Chloro-3-iodobenzoic acid, 97%, Thermo Scientific™
CAS: 42860-04-8 Molecular Formula: C7H4ClIO2 Molecular Weight (g/mol): 282.46 MDL Number: MFCD00079732 InChI Key: SDRURVZKYHGDAP-UHFFFAOYSA-N Synonym: 3-iodo-4-chlorobenzoic acid,4-chloro-3-iodo-benzoic acid,benzoic acid, 4-chloro-3-iodo,pubchem12500,4-chloro-3-iodo benzoicacid,benzoic acid,4-chloro-3-iodo,zerenex e/9071913,buttpark 100\01-50 PubChem CID: 2757616 IUPAC Name: 4-chloro-3-iodobenzoic acid SMILES: OC(=O)C1=CC(I)=C(Cl)C=C1
| PubChem CID | 2757616 |
|---|---|
| CAS | 42860-04-8 |
| Molecular Weight (g/mol) | 282.46 |
| MDL Number | MFCD00079732 |
| SMILES | OC(=O)C1=CC(I)=C(Cl)C=C1 |
| Synonym | 3-iodo-4-chlorobenzoic acid,4-chloro-3-iodo-benzoic acid,benzoic acid, 4-chloro-3-iodo,pubchem12500,4-chloro-3-iodo benzoicacid,benzoic acid,4-chloro-3-iodo,zerenex e/9071913,buttpark 100\01-50 |
| IUPAC Name | 4-chloro-3-iodobenzoic acid |
| InChI Key | SDRURVZKYHGDAP-UHFFFAOYSA-N |
| Molecular Formula | C7H4ClIO2 |
6-Methylsalicylic acid, 98%
CAS: 567-61-3 Molecular Formula: C8H8O3 Molecular Weight (g/mol): 152.15 MDL Number: MFCD01194284 InChI Key: HCJMNOSIAGSZBM-UHFFFAOYSA-N Synonym: 6-methylsalicylic acid,6-hydroxy-o-toluic acid,2,6-cresotic acid,6-msa,benzoic acid, 2-hydroxy-6-methyl,6-ms,methylsalicylic acid,2-hydroxy-6-methylbenzoicacid,unii-l5352fe23y,2-carboxy-3-methylphenol PubChem CID: 11279 ChEBI: CHEBI:17637 IUPAC Name: 2-hydroxy-6-methylbenzoic acid SMILES: CC1=CC=CC(O)=C1C(O)=O
| PubChem CID | 11279 |
|---|---|
| CAS | 567-61-3 |
| Molecular Weight (g/mol) | 152.15 |
| ChEBI | CHEBI:17637 |
| MDL Number | MFCD01194284 |
| SMILES | CC1=CC=CC(O)=C1C(O)=O |
| Synonym | 6-methylsalicylic acid,6-hydroxy-o-toluic acid,2,6-cresotic acid,6-msa,benzoic acid, 2-hydroxy-6-methyl,6-ms,methylsalicylic acid,2-hydroxy-6-methylbenzoicacid,unii-l5352fe23y,2-carboxy-3-methylphenol |
| IUPAC Name | 2-hydroxy-6-methylbenzoic acid |
| InChI Key | HCJMNOSIAGSZBM-UHFFFAOYSA-N |
| Molecular Formula | C8H8O3 |
2-Iodobenzoic acid, 98%
CAS: 88-67-5 Molecular Formula: C7H5IO2 Molecular Weight (g/mol): 248.01 InChI Key: CJNZAXGUTKBIHP-UHFFFAOYSA-N Synonym: o-iodobenzoic acid,benzoic acid, 2-iodo,iodobenzoic acid,benzoic acid, o-iodo,usaf ek-572,2-iodo benzoic acid,2-iodo-benzoic acid,benzoic acid, iodo,kyselina o-jodbenzoova,o-jod-benzoesaeure PubChem CID: 6941 ChEBI: CHEBI:287979 IUPAC Name: 2-iodobenzoic acid SMILES: C1=CC=C(C(=C1)C(=O)O)I
| PubChem CID | 6941 |
|---|---|
| CAS | 88-67-5 |
| Molecular Weight (g/mol) | 248.01 |
| ChEBI | CHEBI:287979 |
| SMILES | C1=CC=C(C(=C1)C(=O)O)I |
| Synonym | o-iodobenzoic acid,benzoic acid, 2-iodo,iodobenzoic acid,benzoic acid, o-iodo,usaf ek-572,2-iodo benzoic acid,2-iodo-benzoic acid,benzoic acid, iodo,kyselina o-jodbenzoova,o-jod-benzoesaeure |
| IUPAC Name | 2-iodobenzoic acid |
| InChI Key | CJNZAXGUTKBIHP-UHFFFAOYSA-N |
| Molecular Formula | C7H5IO2 |
3-Bromobenzamide, 98+%
CAS: 22726-00-7 Molecular Formula: C7H6BrNO Molecular Weight (g/mol): 200.035 MDL Number: MFCD00017127 InChI Key: ODJFDWIECLJWSR-UHFFFAOYSA-N Synonym: m-bromobenzamide,benzamide, 3-bromo,3-bromo-benzamide,benzamide, m-bromo,3-carbamoyl bromobenzene,3-bromanylbenzamide,pubchem3734,3-bromophenylcarboxamide,acmc-209fyc,3-bromobenzoic acid amide PubChem CID: 89807 IUPAC Name: 3-bromobenzamide SMILES: C1=CC(=CC(=C1)Br)C(=O)N
| PubChem CID | 89807 |
|---|---|
| CAS | 22726-00-7 |
| Molecular Weight (g/mol) | 200.035 |
| MDL Number | MFCD00017127 |
| SMILES | C1=CC(=CC(=C1)Br)C(=O)N |
| Synonym | m-bromobenzamide,benzamide, 3-bromo,3-bromo-benzamide,benzamide, m-bromo,3-carbamoyl bromobenzene,3-bromanylbenzamide,pubchem3734,3-bromophenylcarboxamide,acmc-209fyc,3-bromobenzoic acid amide |
| IUPAC Name | 3-bromobenzamide |
| InChI Key | ODJFDWIECLJWSR-UHFFFAOYSA-N |
| Molecular Formula | C7H6BrNO |
2-(Acetyloxy)-3-methylbenzoic acid, 97%, Thermo Scientific™
CAS: 4386-39-4 Molecular Formula: C10H10O4 Molecular Weight (g/mol): 194.19 MDL Number: MFCD00085683 InChI Key: XRBMKGUDDJPAMH-UHFFFAOYSA-N Synonym: 2-acetyloxy-3-methylbenzoic acid,2-acetoxy-3-methylbenzoic acid,2-acetoxy-m-toluic acid,unii-2g83e641hz,2-acetoxy-3-methyl-benzoic acid,3-methylacetylsalicylic acid,benzoic acid,2-acetyloxy-3-methyl,3-methyl-2-acetoxybenzoic acid,cresopirine,cresopyrine PubChem CID: 78094 IUPAC Name: 2-acetyloxy-3-methylbenzoic acid SMILES: CC(=O)OC1=C(C)C=CC=C1C(O)=O
| PubChem CID | 78094 |
|---|---|
| CAS | 4386-39-4 |
| Molecular Weight (g/mol) | 194.19 |
| MDL Number | MFCD00085683 |
| SMILES | CC(=O)OC1=C(C)C=CC=C1C(O)=O |
| Synonym | 2-acetyloxy-3-methylbenzoic acid,2-acetoxy-3-methylbenzoic acid,2-acetoxy-m-toluic acid,unii-2g83e641hz,2-acetoxy-3-methyl-benzoic acid,3-methylacetylsalicylic acid,benzoic acid,2-acetyloxy-3-methyl,3-methyl-2-acetoxybenzoic acid,cresopirine,cresopyrine |
| IUPAC Name | 2-acetyloxy-3-methylbenzoic acid |
| InChI Key | XRBMKGUDDJPAMH-UHFFFAOYSA-N |
| Molecular Formula | C10H10O4 |
Methyl 4-bromo-3-methylbenzoate, 95%
CAS: 148547-19-7 Molecular Formula: C9H9BrO2 Molecular Weight (g/mol): 229.07 InChI Key: GTZTYNPAPQKIIR-UHFFFAOYSA-N Synonym: 4-bromo-3-methylbenzoic acid methyl ester,methyl4-bromo-3-methylbenzoate,methyl 4-bromo-m-toluate,4-bromo-3-methyl-benzoic acid methyl ester,methyl 4-bromo-3-methyl-benzoate,4-bromo-m-toluic acid methyl ester,benzoic acid, 4-bromo-3-methyl-, methyl ester,2-bromo-5-methoxycarbonyl toluene,3-methyl-4-bromobenzoic acid methyl ester,pubchem3970 PubChem CID: 3294148 IUPAC Name: methyl 4-bromo-3-methylbenzoate SMILES: CC1=C(C=CC(=C1)C(=O)OC)Br
| PubChem CID | 3294148 |
|---|---|
| CAS | 148547-19-7 |
| Molecular Weight (g/mol) | 229.07 |
| SMILES | CC1=C(C=CC(=C1)C(=O)OC)Br |
| Synonym | 4-bromo-3-methylbenzoic acid methyl ester,methyl4-bromo-3-methylbenzoate,methyl 4-bromo-m-toluate,4-bromo-3-methyl-benzoic acid methyl ester,methyl 4-bromo-3-methyl-benzoate,4-bromo-m-toluic acid methyl ester,benzoic acid, 4-bromo-3-methyl-, methyl ester,2-bromo-5-methoxycarbonyl toluene,3-methyl-4-bromobenzoic acid methyl ester,pubchem3970 |
| IUPAC Name | methyl 4-bromo-3-methylbenzoate |
| InChI Key | GTZTYNPAPQKIIR-UHFFFAOYSA-N |
| Molecular Formula | C9H9BrO2 |
5-Fluoro-2-methylbenzamide, 97%, Thermo Scientific™
CAS: 175278-28-1 Molecular Formula: C8H8FNO Molecular Weight (g/mol): 153.156 MDL Number: MFCD00205105 InChI Key: VPAFHFHYJHZKSR-UHFFFAOYSA-N Synonym: benzamide,5-fluoro-2-methyl,benzamide, 5-fluoro-2-methyl-9ci,5-fluoro-2-methyl-benzamide,5-fluoranyl-2-methyl-benzamide,5-fluoro-2-methylbenzamide,benzamide, 5-fluoro-2-methyl,2-carbamoyl-4-fluorotoluene, 5-fluoro-o-toluamide PubChem CID: 2737374 IUPAC Name: 5-fluoro-2-methylbenzamide SMILES: CC1=C(C=C(C=C1)F)C(=O)N
| PubChem CID | 2737374 |
|---|---|
| CAS | 175278-28-1 |
| Molecular Weight (g/mol) | 153.156 |
| MDL Number | MFCD00205105 |
| SMILES | CC1=C(C=C(C=C1)F)C(=O)N |
| Synonym | benzamide,5-fluoro-2-methyl,benzamide, 5-fluoro-2-methyl-9ci,5-fluoro-2-methyl-benzamide,5-fluoranyl-2-methyl-benzamide,5-fluoro-2-methylbenzamide,benzamide, 5-fluoro-2-methyl,2-carbamoyl-4-fluorotoluene, 5-fluoro-o-toluamide |
| IUPAC Name | 5-fluoro-2-methylbenzamide |
| InChI Key | VPAFHFHYJHZKSR-UHFFFAOYSA-N |
| Molecular Formula | C8H8FNO |
4-Bromobenzoic acid, 97%
CAS: 586-76-5 Molecular Formula: C7H5BrO2 Molecular Weight (g/mol): 201.02 MDL Number: MFCD00002529 InChI Key: TUXYZHVUPGXXQG-UHFFFAOYSA-N Synonym: p-bromobenzoic acid,benzoic acid, 4-bromo,p-carboxybromobenzene,benzoic acid, p-bromo,p-bromobenzenecarboxylic acid,4-bromo-benzoic acid,4-brom-benzoesaeure,4-carboxybromobenzene,para bromo benzoic acid,4bromo-benzoic acid PubChem CID: 11464 ChEBI: CHEBI:60698 IUPAC Name: 4-bromobenzoic acid SMILES: OC(=O)C1=CC=C(Br)C=C1
| PubChem CID | 11464 |
|---|---|
| CAS | 586-76-5 |
| Molecular Weight (g/mol) | 201.02 |
| ChEBI | CHEBI:60698 |
| MDL Number | MFCD00002529 |
| SMILES | OC(=O)C1=CC=C(Br)C=C1 |
| Synonym | p-bromobenzoic acid,benzoic acid, 4-bromo,p-carboxybromobenzene,benzoic acid, p-bromo,p-bromobenzenecarboxylic acid,4-bromo-benzoic acid,4-brom-benzoesaeure,4-carboxybromobenzene,para bromo benzoic acid,4bromo-benzoic acid |
| IUPAC Name | 4-bromobenzoic acid |
| InChI Key | TUXYZHVUPGXXQG-UHFFFAOYSA-N |
| Molecular Formula | C7H5BrO2 |
Methyl pentafluorobenzoate, 99%
CAS: 36629-42-2 Molecular Formula: C8H3F5O2 Molecular Weight (g/mol): 226.10 MDL Number: MFCD00012172 InChI Key: UXJRQNXHCZKHRJ-UHFFFAOYSA-N Synonym: methyl pentafluorobenzoate,pentafluorobenzoic acid methyl ester,benzoic acid, pentafluoro-, methyl ester,benzoic acid,2,3,4,5,6-pentafluoro-, methyl ester,methylpentafluorobenzoate,methyl perfluorobenzoate,acmc-209inq,methyl pentafluorbenzoate,perfluorobenzoic acid methyl ester PubChem CID: 606853 IUPAC Name: methyl 2,3,4,5,6-pentafluorobenzoate SMILES: COC(=O)C1=C(F)C(F)=C(F)C(F)=C1F
| PubChem CID | 606853 |
|---|---|
| CAS | 36629-42-2 |
| Molecular Weight (g/mol) | 226.10 |
| MDL Number | MFCD00012172 |
| SMILES | COC(=O)C1=C(F)C(F)=C(F)C(F)=C1F |
| Synonym | methyl pentafluorobenzoate,pentafluorobenzoic acid methyl ester,benzoic acid, pentafluoro-, methyl ester,benzoic acid,2,3,4,5,6-pentafluoro-, methyl ester,methylpentafluorobenzoate,methyl perfluorobenzoate,acmc-209inq,methyl pentafluorbenzoate,perfluorobenzoic acid methyl ester |
| IUPAC Name | methyl 2,3,4,5,6-pentafluorobenzoate |
| InChI Key | UXJRQNXHCZKHRJ-UHFFFAOYSA-N |
| Molecular Formula | C8H3F5O2 |
2-Fluoro-4-methoxycarbonylphenylboronic acid, 98%, Thermo Scientific™
CAS: 603122-84-5 Molecular Formula: C8H8BFO4 Molecular Weight (g/mol): 197.96 MDL Number: MFCD08436034 InChI Key: BKWRLCIYMAYFPA-UHFFFAOYSA-N Synonym: 2-fluoro-4-methoxycarbonyl phenylboronic acid,2-fluoro-4-methoxycarbonyl benzeneboronic acid,4-methoxycarbonyl-2-fluorophenylboronic acid,2-fluoro-4-methoxycarbonyl phenyl boronic acid,o-fluoro p-methoxy carbonyl phenyl boronic acid,pubchem17434,acmc-209mj4,2-fluoro-4-methoxycarbonyl phenylboronicacid,2-fluoro-4-methoxycarbonyl-phenylboronic acid PubChem CID: 24824345 IUPAC Name: (2-fluoro-4-methoxycarbonylphenyl)boronic acid SMILES: COC(=O)C1=CC(F)=C(C=C1)B(O)O
| PubChem CID | 24824345 |
|---|---|
| CAS | 603122-84-5 |
| Molecular Weight (g/mol) | 197.96 |
| MDL Number | MFCD08436034 |
| SMILES | COC(=O)C1=CC(F)=C(C=C1)B(O)O |
| Synonym | 2-fluoro-4-methoxycarbonyl phenylboronic acid,2-fluoro-4-methoxycarbonyl benzeneboronic acid,4-methoxycarbonyl-2-fluorophenylboronic acid,2-fluoro-4-methoxycarbonyl phenyl boronic acid,o-fluoro p-methoxy carbonyl phenyl boronic acid,pubchem17434,acmc-209mj4,2-fluoro-4-methoxycarbonyl phenylboronicacid,2-fluoro-4-methoxycarbonyl-phenylboronic acid |
| IUPAC Name | (2-fluoro-4-methoxycarbonylphenyl)boronic acid |
| InChI Key | BKWRLCIYMAYFPA-UHFFFAOYSA-N |
| Molecular Formula | C8H8BFO4 |
6-Methoxysalicylic acid, 98%, Thermo Scientific™
CAS: 3147-64-6 Molecular Formula: C8H8O4 Molecular Weight (g/mol): 168.15 InChI Key: AAUQLHHARJUJEH-UHFFFAOYSA-N Synonym: 6-methoxysalicylic acid,6-hydroxy-o-anisic acid,benzoic acid, 2-hydroxy-6-methoxy,6-methoxysalicylicacid,6-methoxysalicylsaure,pubchem18380,acmc-1cldg,6-methoxy-salicylic acid,2-carboxy-3-methoxyphenol,2-carboxy-3-hydroxyanisole PubChem CID: 591524 IUPAC Name: 2-hydroxy-6-methoxybenzoic acid SMILES: COC1=CC=CC(=C1C(=O)O)O
| PubChem CID | 591524 |
|---|---|
| CAS | 3147-64-6 |
| Molecular Weight (g/mol) | 168.15 |
| SMILES | COC1=CC=CC(=C1C(=O)O)O |
| Synonym | 6-methoxysalicylic acid,6-hydroxy-o-anisic acid,benzoic acid, 2-hydroxy-6-methoxy,6-methoxysalicylicacid,6-methoxysalicylsaure,pubchem18380,acmc-1cldg,6-methoxy-salicylic acid,2-carboxy-3-methoxyphenol,2-carboxy-3-hydroxyanisole |
| IUPAC Name | 2-hydroxy-6-methoxybenzoic acid |
| InChI Key | AAUQLHHARJUJEH-UHFFFAOYSA-N |
| Molecular Formula | C8H8O4 |
4-Methylsalicylic acid, 98%
CAS: 50-85-1 MDL Number: MFCD00002454 InChI Key: NJESAXZANHETJV-UHFFFAOYSA-N Synonym: 4-methylsalicylic acid,m-cresotic acid,2,4-cresotic acid,m-cresotinic acid,2-hydroxy-p-toluic acid,m-homosalicylic acid,4-methyl-2-hydroxybenzoic acid,gamma-cresotic acid,benzoic acid, 2-hydroxy-4-methyl,4-methylsalicylate PubChem CID: 5788 ChEBI: CHEBI:20450 IUPAC Name: 2-hydroxy-4-methylbenzoic acid SMILES: CC1=CC(=C(C=C1)C(=O)O)O
| PubChem CID | 5788 |
|---|---|
| CAS | 50-85-1 |
| ChEBI | CHEBI:20450 |
| MDL Number | MFCD00002454 |
| SMILES | CC1=CC(=C(C=C1)C(=O)O)O |
| Synonym | 4-methylsalicylic acid,m-cresotic acid,2,4-cresotic acid,m-cresotinic acid,2-hydroxy-p-toluic acid,m-homosalicylic acid,4-methyl-2-hydroxybenzoic acid,gamma-cresotic acid,benzoic acid, 2-hydroxy-4-methyl,4-methylsalicylate |
| IUPAC Name | 2-hydroxy-4-methylbenzoic acid |
| InChI Key | NJESAXZANHETJV-UHFFFAOYSA-N |