Resins and Supports
Filtered Search Results
Thermo Scientific Chemicals Agar powder
CAS: 9002-18-0 Molecular Formula: C14H24O9 Molecular Weight (g/mol): 336.337 MDL Number: MFCD00081288 InChI Key: GYYDPBCUIJTIBM-DYOGSRDZSA-N Synonym: agar,agar, pure, powder,agar agar bacteriological,3r,4s,5s,6r-2-4r,5s-4-hydroxy-3-methyl-2,6-dioxabicyclo 3.2.1 octan-8-yl oxy-6-hydroxymethyl-4-methoxyoxane-3,5-diol PubChem CID: 71571511 IUPAC Name: (2R,3S,4S,5R)-2-(hydroxymethyl)-6-[[(4R,5S)-4-hydroxy-3-methyl-2,6-dioxabicyclo[3.2.1]octan-8-yl]oxy]-4-methoxyoxane-3,5-diol SMILES: CC1C(C2C(C(O1)CO2)OC3C(C(C(C(O3)CO)O)OC)O)O
| PubChem CID | 71571511 |
|---|---|
| CAS | 9002-18-0 |
| Molecular Weight (g/mol) | 336.337 |
| MDL Number | MFCD00081288 |
| SMILES | CC1C(C2C(C(O1)CO2)OC3C(C(C(C(O3)CO)O)OC)O)O |
| Synonym | agar,agar, pure, powder,agar agar bacteriological,3r,4s,5s,6r-2-4r,5s-4-hydroxy-3-methyl-2,6-dioxabicyclo 3.2.1 octan-8-yl oxy-6-hydroxymethyl-4-methoxyoxane-3,5-diol |
| IUPAC Name | (2R,3S,4S,5R)-2-(hydroxymethyl)-6-[[(4R,5S)-4-hydroxy-3-methyl-2,6-dioxabicyclo[3.2.1]octan-8-yl]oxy]-4-methoxyoxane-3,5-diol |
| InChI Key | GYYDPBCUIJTIBM-DYOGSRDZSA-N |
| Molecular Formula | C14H24O9 |
| CAS | 39339-85-0 |
|---|---|
| MDL Number | MFCD00145579 |
| CAS | 37380-42-0 |
|---|---|
| MDL Number | MFCD00132704 |
| CAS | 9002-26-0 |
|---|---|
| MDL Number | MFCD00132710 |
Amberlyst™ 15(H), ion exchange resin
CAS: 39389-20-3 Molecular Formula: C18H18O3S Molecular Weight (g/mol): 314.399 MDL Number: MFCD00145841 InChI Key: SIWVGXQOXWGJCI-UHFFFAOYSA-N Synonym: amberlyst 15, wet, ion exchange resin,2-ethenylbenzenesulfonic acid; divinylbenzene,benzenesulfonic acid, ethenyl-, polymer with diethenylbenzene,ksc581g2r,amberlyst 15 ion-exchange resin,amberlite? ir120 hydrogen form,2-ethenylbenzenesulfonic acid-1,2-diethenylbenzene 1:1,amberlite r ir120 hydrogen form,divinylbenzene-styrenesulfonic acid copolymer,1,2-bis ethenyl benzene; 2-ethenylbenzenesulfonic acid PubChem CID: 170197 IUPAC Name: 1,2-bis(ethenyl)benzene;2-ethenylbenzenesulfonic acid SMILES: C=CC1=CC=CC=C1C=C.C=CC1=CC=CC=C1S(=O)(=O)O
| PubChem CID | 170197 |
|---|---|
| CAS | 39389-20-3 |
| Molecular Weight (g/mol) | 314.399 |
| MDL Number | MFCD00145841 |
| SMILES | C=CC1=CC=CC=C1C=C.C=CC1=CC=CC=C1S(=O)(=O)O |
| Synonym | amberlyst 15, wet, ion exchange resin,2-ethenylbenzenesulfonic acid; divinylbenzene,benzenesulfonic acid, ethenyl-, polymer with diethenylbenzene,ksc581g2r,amberlyst 15 ion-exchange resin,amberlite? ir120 hydrogen form,2-ethenylbenzenesulfonic acid-1,2-diethenylbenzene 1:1,amberlite r ir120 hydrogen form,divinylbenzene-styrenesulfonic acid copolymer,1,2-bis ethenyl benzene; 2-ethenylbenzenesulfonic acid |
| IUPAC Name | 1,2-bis(ethenyl)benzene;2-ethenylbenzenesulfonic acid |
| InChI Key | SIWVGXQOXWGJCI-UHFFFAOYSA-N |
| Molecular Formula | C18H18O3S |
Amberlite™ IRN-78, ion exchange resin, nuclear grade
CAS: 11128-95-3 Molecular Formula: Styrene-DVB MDL Number: MFCD00145822
| CAS | 11128-95-3 |
|---|---|
| MDL Number | MFCD00145822 |
| Molecular Formula | Styrene-DVB |
Amberlite™ IRN-77, ion exchange resin, nuclear grade
CAS: 11128-94-2 Molecular Formula: Styrene-DVB MDL Number: MFCD00145822
| CAS | 11128-94-2 |
|---|---|
| MDL Number | MFCD00145822 |
| Molecular Formula | Styrene-DVB |
Amberlite™ IRN-150, ion exchange resin
Styrene-DVB; Mix of strongly acidic and basic gel type resin | Styrene-DVB
| Health Hazard 3 | P280-P305+P351+P338-P310 |
|---|---|
| MDL Number | MFCD00145822 |
| Solubility Information | Insoluble in water,acids and bases. |
| Health Hazard 1 | H318 |
| TSCA | Yes |
| Recommended Storage | Ambient temperatures |
| Molecular Formula | Styrene-DVB |
| Odor | Odorless |
Amberlyst™ 15(H), wet, ion exchange resin
CAS: 39389-20-3 Molecular Formula: C18H18O3S Molecular Weight (g/mol): 314.399 MDL Number: MFCD00145841 InChI Key: SIWVGXQOXWGJCI-UHFFFAOYSA-N Synonym: amberlyst 15, wet, ion exchange resin,2-ethenylbenzenesulfonic acid; divinylbenzene,benzenesulfonic acid, ethenyl-, polymer with diethenylbenzene,ksc581g2r,amberlyst 15 ion-exchange resin,amberlite? ir120 hydrogen form,2-ethenylbenzenesulfonic acid-1,2-diethenylbenzene 1:1,amberlite r ir120 hydrogen form,divinylbenzene-styrenesulfonic acid copolymer,1,2-bis ethenyl benzene; 2-ethenylbenzenesulfonic acid PubChem CID: 170197 IUPAC Name: 1,2-bis(ethenyl)benzene;2-ethenylbenzenesulfonic acid SMILES: C=CC1=CC=CC=C1C=C.C=CC1=CC=CC=C1S(=O)(=O)O
| PubChem CID | 170197 |
|---|---|
| CAS | 39389-20-3 |
| Molecular Weight (g/mol) | 314.399 |
| MDL Number | MFCD00145841 |
| SMILES | C=CC1=CC=CC=C1C=C.C=CC1=CC=CC=C1S(=O)(=O)O |
| Synonym | amberlyst 15, wet, ion exchange resin,2-ethenylbenzenesulfonic acid; divinylbenzene,benzenesulfonic acid, ethenyl-, polymer with diethenylbenzene,ksc581g2r,amberlyst 15 ion-exchange resin,amberlite? ir120 hydrogen form,2-ethenylbenzenesulfonic acid-1,2-diethenylbenzene 1:1,amberlite r ir120 hydrogen form,divinylbenzene-styrenesulfonic acid copolymer,1,2-bis ethenyl benzene; 2-ethenylbenzenesulfonic acid |
| IUPAC Name | 1,2-bis(ethenyl)benzene;2-ethenylbenzenesulfonic acid |
| InChI Key | SIWVGXQOXWGJCI-UHFFFAOYSA-N |
| Molecular Formula | C18H18O3S |
| CAS | 80747-90-6 |
|---|---|
| MDL Number | MFCD00145567 |
| CAS | 97396-56-0 |
|---|---|
| MDL Number | MFCD00145830 |
| CAS | 9017-79-2 |
|---|---|
| MDL Number | MFCD00802695 |
| CAS | 9002-26-0 |
|---|---|
| MDL Number | MFCD00132710 |
| CAS | 39339-85-0 |
|---|---|
| MDL Number | MFCD00145579 |