Zinc (Zn)
Before zinc was identified as an element, it was used to make brass. The metal was rediscovered in Europe in 1746.
As a bluish-white, lustrous metal, zinc is brittle at ambient temperatures and, above 100 °C, becomes malleable and displays superplasticity. A fair conductor of electricity, it burns in air at high heat.
Principal sources of zinc are sphalerite (sulfide), smithsonite (carbonate), calamine (silicate), and franklinite (zinc, manganese, iron oxide) ores. Naturally occurring zinc includes five stable isotopes, and sixteen other unstable isotopes are known.
Zinc is also used to galvanize other metals to prevent rusting.
Filtered Search Results
Zinc, granular, 30 mesh
CAS: 7440-66-6 Molecular Formula: Zn Molecular Weight (g/mol): 65.38 MDL Number: MFCD00011291 InChI Key: HCHKCACWOHOZIP-UHFFFAOYSA-N Synonym: dust,cinc,powder,merrillite,rheinzink,jasad,blue powder,granular,zinc, elemental,emanay dust PubChem CID: 23994 ChEBI: CHEBI:30185 IUPAC Name: zinc SMILES: [Zn]
| PubChem CID | 23994 |
|---|---|
| CAS | 7440-66-6 |
| Molecular Weight (g/mol) | 65.38 |
| ChEBI | CHEBI:30185 |
| MDL Number | MFCD00011291 |
| SMILES | [Zn] |
| Synonym | dust,cinc,powder,merrillite,rheinzink,jasad,blue powder,granular,zinc, elemental,emanay dust |
| IUPAC Name | zinc |
| InChI Key | HCHKCACWOHOZIP-UHFFFAOYSA-N |
| Molecular Formula | Zn |
Zinc, granular, 20 mesh
CAS: 7440-66-6 Molecular Formula: Zn Molecular Weight (g/mol): 65.38 MDL Number: MFCD00011291 InChI Key: HCHKCACWOHOZIP-UHFFFAOYSA-N Synonym: dust,cinc,powder,merrillite,rheinzink,jasad,blue powder,granular,zinc, elemental,emanay dust PubChem CID: 23994 ChEBI: CHEBI:30185 IUPAC Name: zinc SMILES: [Zn]
| PubChem CID | 23994 |
|---|---|
| CAS | 7440-66-6 |
| Molecular Weight (g/mol) | 65.38 |
| ChEBI | CHEBI:30185 |
| MDL Number | MFCD00011291 |
| SMILES | [Zn] |
| Synonym | dust,cinc,powder,merrillite,rheinzink,jasad,blue powder,granular,zinc, elemental,emanay dust |
| IUPAC Name | zinc |
| InChI Key | HCHKCACWOHOZIP-UHFFFAOYSA-N |
| Molecular Formula | Zn |
Zinc, 98+%, dust (stable acc. to UN classification class 4)
CAS: 7440-66-6 Molecular Formula: Zn Molecular Weight (g/mol): 65.38 MDL Number: MFCD00011291 InChI Key: HCHKCACWOHOZIP-UHFFFAOYSA-N Synonym: dust,cinc,powder,merrillite,rheinzink,jasad,blue powder,granular,zinc, elemental,emanay dust PubChem CID: 23994 ChEBI: CHEBI:30185 IUPAC Name: zinc SMILES: [Zn]
| PubChem CID | 23994 |
|---|---|
| CAS | 7440-66-6 |
| Molecular Weight (g/mol) | 65.38 |
| ChEBI | CHEBI:30185 |
| MDL Number | MFCD00011291 |
| SMILES | [Zn] |
| Synonym | dust,cinc,powder,merrillite,rheinzink,jasad,blue powder,granular,zinc, elemental,emanay dust |
| IUPAC Name | zinc |
| InChI Key | HCHKCACWOHOZIP-UHFFFAOYSA-N |
| Molecular Formula | Zn |
Zinc, 99+%, mossy
CAS: 7440-66-6 Molecular Formula: Zn Molecular Weight (g/mol): 65.38 MDL Number: MFCD00011291 InChI Key: HCHKCACWOHOZIP-UHFFFAOYSA-N Synonym: dust,cinc,powder,merrillite,rheinzink,jasad,blue powder,granular,zinc, elemental,emanay dust PubChem CID: 23994 ChEBI: CHEBI:30185 IUPAC Name: zinc SMILES: [Zn]
| PubChem CID | 23994 |
|---|---|
| CAS | 7440-66-6 |
| Molecular Weight (g/mol) | 65.38 |
| ChEBI | CHEBI:30185 |
| MDL Number | MFCD00011291 |
| SMILES | [Zn] |
| Synonym | dust,cinc,powder,merrillite,rheinzink,jasad,blue powder,granular,zinc, elemental,emanay dust |
| IUPAC Name | zinc |
| InChI Key | HCHKCACWOHOZIP-UHFFFAOYSA-N |
| Molecular Formula | Zn |
Zinc, 99.995%, (trace metal basis), powder, Thermo Scientific Chemicals
CAS: 7440-66-6 Molecular Formula: Zn Molecular Weight (g/mol): 65.38 MDL Number: MFCD00011291 InChI Key: HCHKCACWOHOZIP-UHFFFAOYSA-N Synonym: dust,cinc,powder,merrillite,rheinzink,jasad,blue powder,granular,zinc, elemental,emanay dust PubChem CID: 23994 ChEBI: CHEBI:30185 IUPAC Name: zinc SMILES: [Zn]
| PubChem CID | 23994 |
|---|---|
| CAS | 7440-66-6 |
| Molecular Weight (g/mol) | 65.38 |
| ChEBI | CHEBI:30185 |
| MDL Number | MFCD00011291 |
| SMILES | [Zn] |
| Synonym | dust,cinc,powder,merrillite,rheinzink,jasad,blue powder,granular,zinc, elemental,emanay dust |
| IUPAC Name | zinc |
| InChI Key | HCHKCACWOHOZIP-UHFFFAOYSA-N |
| Molecular Formula | Zn |
Zinc, 99.999%, (trace metal basis), powder, 40 mesh
CAS: 7440-66-6 Molecular Formula: Zn Molecular Weight (g/mol): 65.38 MDL Number: MFCD00011291 InChI Key: HCHKCACWOHOZIP-UHFFFAOYSA-N Synonym: dust,cinc,powder,merrillite,rheinzink,jasad,blue powder,granular,zinc, elemental,emanay dust PubChem CID: 23994 ChEBI: CHEBI:30185 IUPAC Name: zinc SMILES: [Zn]
| PubChem CID | 23994 |
|---|---|
| CAS | 7440-66-6 |
| Molecular Weight (g/mol) | 65.38 |
| ChEBI | CHEBI:30185 |
| MDL Number | MFCD00011291 |
| SMILES | [Zn] |
| Synonym | dust,cinc,powder,merrillite,rheinzink,jasad,blue powder,granular,zinc, elemental,emanay dust |
| IUPAC Name | zinc |
| InChI Key | HCHKCACWOHOZIP-UHFFFAOYSA-N |
| Molecular Formula | Zn |
Zinc Standard Metal Solution 1000ppm, for AAS, Solution HNO3 1M, Fisher Chemical™
CAS: 7779-88-6 Molecular Formula: N2O6Zn Molecular Weight (g/mol): 189.388 MDL Number: 11291 InChI Key: ONDPHDOFVYQSGI-UHFFFAOYSA-N Synonym: zinc nitrate,celloxan,zinc dinitrate,nitric acid, zinc salt,unii-edo66f5u49,nitric acid, zinc salt 2:1,nitrate de zinc,x 4 nitrate,nitrate de zinc french,zinc nitrate zn no3 2 PubChem CID: 24518 IUPAC Name: zinc;dinitrate SMILES: [N+](=O)([O-])[O-].[N+](=O)([O-])[O-].[Zn+2]
| PubChem CID | 24518 |
|---|---|
| CAS | 7779-88-6 |
| Molecular Weight (g/mol) | 189.388 |
| MDL Number | 11291 |
| SMILES | [N+](=O)([O-])[O-].[N+](=O)([O-])[O-].[Zn+2] |
| Synonym | zinc nitrate,celloxan,zinc dinitrate,nitric acid, zinc salt,unii-edo66f5u49,nitric acid, zinc salt 2:1,nitrate de zinc,x 4 nitrate,nitrate de zinc french,zinc nitrate zn no3 2 |
| IUPAC Name | zinc;dinitrate |
| InChI Key | ONDPHDOFVYQSGI-UHFFFAOYSA-N |
| Molecular Formula | N2O6Zn |