Learn More
Alfa Aesar™ 1-Boc-4-(2-chloroethyl)piperazine, 97%
Brand: Alfa Aesar™ H33349.03
Additional Details : CAS : 208167-83-3 Weight : 0.00100kg
| Quantity | 1g |
|---|
Description
ApplicationsBy the direct condensation of chloroalkyl piperazine, nitrogen mustard benzaldehyde, and pyrrole anticancer activity to bel-7404 liver cancer cells was found.
Solubility
Slightly Soluble (7.2 g/L) (25°C).
Notes
Store in cool place. Keep container tightly closed in a dry and well-ventilated place. Store away from strong oxidizing agents.
Chemical Identifiers
| 208167-83-3 | |
| 248.751 | |
| MYOWELLYEZMECA-UHFFFAOYSA-N | |
| 22106269 | |
| CC(C)(C)OC(=O)N1CCN(CC1)CCCl |
| C11H21ClN2O2 | |
| MFCD08443993 | |
| tert-butyl 4-2-chloroethyl piperazine-1-carboxylate, tert-butyl 4-2-chloroethyl tetrahydro-1 2h-pyrazinecarboxylate, 1-boc-4-2-chloroethyl piperazine, tert-butyl 4-2-chloroethyl piperazinecarboxylate, 1-piperazinecarboxylic acid, 4-2-chloroethyl-, 1,1-dimethylethyl ester, 4-2-chloroethyl piperazine, n1-boc protected, 4-2-chloroethyl piperazine,n1-boc protected, tertbutylchloroethyltetrahydropyrazinecarboxylate, tert-butyl 4-2-chloroethyl tetrahydro-1 2h-pyraz | |
| tert-butyl 4-(2-chloroethyl)piperazine-1-carboxylate |
Specifications
| 1-Boc-4-(2-chloroethyl)piperazine | |
| 1g | |
| C11H21ClN2O2 | |
| tert-butyl 4-2-chloroethyl piperazine-1-carboxylate, tert-butyl 4-2-chloroethyl tetrahydro-1 2h-pyrazinecarboxylate, 1-boc-4-2-chloroethyl piperazine, tert-butyl 4-2-chloroethyl piperazinecarboxylate, 1-piperazinecarboxylic acid, 4-2-chloroethyl-, 1,1-dimethylethyl ester, 4-2-chloroethyl piperazine, n1-boc protected, 4-2-chloroethyl piperazine,n1-boc protected, tertbutylchloroethyltetrahydropyrazinecarboxylate, tert-butyl 4-2-chloroethyl tetrahydro-1 2h-pyraz | |
| MYOWELLYEZMECA-UHFFFAOYSA-N | |
| tert-butyl 4-(2-chloroethyl)piperazine-1-carboxylate | |
| 22106269 | |
| 97% |
| 63°C to 65°C | |
| 208167-83-3 | |
| MFCD08443993 | |
| Slightly Soluble (7.2g/L) (25°C). | |
| CC(C)(C)OC(=O)N1CCN(CC1)CCCl | |
| 248.751 | |
| 248.76 |