Learn More
Alfa Aesar™ (2-Bromophenylethynyl)trimethylsilane, 98%
Brand: Alfa Aesar™ H53402.03
Additional Details : CAS : 38274-16-7 Weight : 0.00100kg
| Quantity | 1g |
|---|
Description
Applications(2-Bromophenylethynyl)trimethylsilane finds wide range application in the medicine and electronic industry. Reaction of (2-bromophenylethynyl)trimethylsilane 1 with trimethyl borate yielded the alkynearylboronic acid.
Solubility
Slightly soluble in water.
Notes
Store in cool place. Keep container tightly closed in a dry and well-ventilated place. Store away from strong oxidizing agents.
Chemical Identifiers
| 38274-16-7 | |
| 253.214 | |
| FABNGXSCLHXUOH-UHFFFAOYSA-N | |
| 4547398 | |
| C[Si](C)(C)C#CC1=CC=CC=C1Br |
| C11H13BrSi | |
| MFCD01321391 | |
| 2-bromophenylethynyl trimethylsilane, 2-bromophenyl ethynyl trimethylsilane, 2-2-bromophenyl ethynyl trimethylsilane, acmc-20appv, 2-bromophenyl trimethylsilyl acetylene, 2-2-bromophenyl ethynyl-trimethylsilane, benzene,1-bromo-2-2-trimethylsilyl ethynyl | |
| 2-(2-bromophenyl)ethynyl-trimethylsilane |
Specifications
| (2-Bromophenylethynyl)trimethylsilane | |
| C11H13BrSi | |
| 2-bromophenylethynyl trimethylsilane, 2-bromophenyl ethynyl trimethylsilane, 2-2-bromophenyl ethynyl trimethylsilane, acmc-20appv, 2-bromophenyl trimethylsilyl acetylene, 2-2-bromophenyl ethynyl-trimethylsilane, benzene,1-bromo-2-2-trimethylsilyl ethynyl | |
| FABNGXSCLHXUOH-UHFFFAOYSA-N | |
| 2-(2-bromophenyl)ethynyl-trimethylsilane | |
| 4547398 | |
| 98% | |
| 1.554 | |
| 1g |
| 38274-16-7 | |
| MFCD01321391 | |
| Slightly soluble in water. | |
| C[Si](C)(C)C#CC1=CC=CC=C1Br | |
| 253.214 | |
| 253.21 | |
| 1.19 | |
| 60°C to 80°C (2mmHg) | |
| >113°C (235°F) |