Learn More
Alfa Aesar™ 4-(4-Fluorobenzyl)piperidine hydrochloride, 97%
Brand: Alfa Aesar™ H63860.03
Additional Details : CAS : 193357-52-7 Weight : 0.00100kg
| Quantity | 1g |
|---|
Description
ApplicationsReactant in the synthesis of 4-(Substituted-benzyl)piperidines and (±)-3-(Substituted-benzyl)pyrrolidines. It an important and valuable pharmaceutical intermediate.
Notes
Store in cool place. Keep container tightly closed in a dry and well-ventilated place. Store away from strong oxidizing agents, heat.
Chemical Identifiers
| 193357-52-7 | |
| 229.723 | |
| OJKWWANXBGLGQN-UHFFFAOYSA-N | |
| 17039492 | |
| C1CNCCC1CC2=CC=C(C=C2)F.Cl |
| C12H17ClFN | |
| MFCD03840140 | |
| 4-4-fluorobenzyl piperidine hydrochloride, 4-4-fluorobenzyl piperidine hcl, 4-4-fluoro-benzyl-piperidine hydrochloride, 4-4'-fluorobenzyl piperidine hydrochloride, piperidine, 4-4-fluorophenyl methyl-, hydrochloride, 4-4-fluorophenyl methyl piperidine hydrochloride, 4-4-fluorobenzyl piperidine hydrochloride salt, 4-4-fluorobenzyl piperidine hydrobromide, 4-4-fluorobenzyl piperidinehydrochloride, 4-4-fluorobenzyl-piperidine hydrochloride | |
| 4-[(4-fluorophenyl)methyl]piperidine;hydrochloride |
Specifications
| 4-(4-Fluorobenzyl)piperidine hydrochloride | |
| 193357-52-7 | |
| MFCD03840140 | |
| OJKWWANXBGLGQN-UHFFFAOYSA-N | |
| 4-[(4-fluorophenyl)methyl]piperidine;hydrochloride | |
| 17039492 | |
| Solid |
| 1g | |
| C12H17ClFN | |
| 4-4-fluorobenzyl piperidine hydrochloride, 4-4-fluorobenzyl piperidine hcl, 4-4-fluoro-benzyl-piperidine hydrochloride, 4-4'-fluorobenzyl piperidine hydrochloride, piperidine, 4-4-fluorophenyl methyl-, hydrochloride, 4-4-fluorophenyl methyl piperidine hydrochloride, 4-4-fluorobenzyl piperidine hydrochloride salt, 4-4-fluorobenzyl piperidine hydrobromide, 4-4-fluorobenzyl piperidinehydrochloride, 4-4-fluorobenzyl-piperidine hydrochloride | |
| C1CNCCC1CC2=CC=C(C=C2)F.Cl | |
| 229.723 | |
| 229.72 | |
| 97% |