Learn More
4-Hydroxy-3-nitrophenylacetic acid, 99%, ACROS Organics™
Brand: Acros Organics 204890050
Additional Details : CAS : 10463-20-4 Poids : 0.01000kg
| Packaging | Glass bottle |
|---|---|
| Quantity | 5g |
Chemical Identifiers
| 10463-20-4 | |
| 197.15 | |
| 4-hydroxy-3-nitrophenylacetic acid, 2-4-hydroxy-3-nitrophenyl acetic acid, 4-hydroxy-3-nitrophenyl acetic acid, 3-nitro-4-hydroxyphenylacetic acid, 3-nitro-4-hydroxy phenylacetic acid, benzeneacetic acid, 4-hydroxy-3-nitro, no2hpa, hydroxynitrophenylaceticacid, acmc-2098cj, epitope id:158629 | |
| CHEBI:546274 |
| C8H7NO5 | |
| QBHBHOSRLDPIHG-UHFFFAOYSA-N | |
| 447364 | |
| C1=CC(=C(C=C1CC(=O)O)[N+](=O)[O-])O |
Specifications
| 4-Hydroxy-3-nitrophenylacetic acid | |
| Glass bottle | |
| 144.0°C to 147.0°C | |
| 99% | |
| 98.5 | |
| 98.5% min. (HPLC) | |
| HOC6H3(NO2)CH2CO2H | |
| 4-hydroxy-3-nitrophenylacetic acid, 2-4-hydroxy-3-nitrophenyl acetic acid, 4-hydroxy-3-nitrophenyl acetic acid, 3-nitro-4-hydroxyphenylacetic acid, 3-nitro-4-hydroxy phenylacetic acid, benzeneacetic acid, 4-hydroxy-3-nitro, no2hpa, hydroxynitrophenylaceticacid, acmc-2098cj, epitope id:158629 | |
| C1=CC(=C(C=C1CC(=O)O)[N+](=O)[O-])O | |
| 447364 | |
| 197.15 | |
| 99% |
| Authentic | |
| Colorless to Yellow | |
| 5g | |
| 10463-20-4 | |
| 100.0 | |
| C8H7NO5 | |
| 10,IV,562 | |
| QBHBHOSRLDPIHG-UHFFFAOYSA-N | |
| 197.15 | |
| CHEBI:546274 | |
| Liquid |
Safety and Handling
- 4-Hydroxy-3-nitrophenylacetic acid
Signal Word
- Warning
Hazard Category
- Serious eye damage/eye irritation Category 2
- Skin corrosion/irritation Category 2
- Specific target organ toxicity Category 3
Hazard Statement
- H319-Causes serious eye irritation.
- H335-May cause respiratory irritation.
- H315-Causes skin irritation.
Precautionary Statement
- P280-Wear protective gloves/protective clothing/eye protection/face protection.
- P305+P351+P338-IF IN EYES: Rinse cautiously with water for several minutes. Remove contact lenses, if present and easy to do. Continue rinsing.