Learn More
Alfa Aesar™ 4-Nitrobenzeneboronic acid pinacol ester, 98%
Brand: Alfa Aesar™ H52848.06
Additional Details : CAS : 171364-83-3 Weight : 0.00500kg
| Quantity | 5g |
|---|
Description
Applications4-Nitrobenzeneboronic acid pinacol ester is a reactant involved in synthesis of aryl azides, arylation of allylic chlorides, synthesis of RNA conjugates, alkoxycarbonylation, synthesis of mTOR and PI3K inhibitors as antitumor agents, electro oxidative synthesis of biaryls.
Solubility
Slightly soluble in water.
Notes
Store in a cool, dry place, in a well sealed container. Store away from oxidizing agents.
Chemical Identifiers
| 171364-83-3 | |
| 249.073 | |
| LUWACRUAJXZANC-UHFFFAOYSA-N | |
| 2773555 | |
| B1(OC(C(O1)(C)C)(C)C)C2=CC=C(C=C2)[N+](=O)[O-] |
| C12H16BNO4 | |
| MFCD02179437 | |
| 4,4,5,5-tetramethyl-2-4-nitrophenyl-1,3,2-dioxaborolane, 4-nitrophenylboronic acid pinacol ester, 4-nitrophenylboronic acid, pinacol ester, 4-4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl nitrobenzene, 4-nitrophenyl boronic acid, pinacol ester, 1,3,2-dioxaborolane, 4,4,5,5-tetramethyl-2-4-nitrophenyl, pubchem8088, pinacol 4-nitrophenyl boronate;, 4-nitrophenylboronate pinacol ester;, para-nitrobenzeneboronic acid pinacol ester; | |
| 4,4,5,5-tetramethyl-2-(4-nitrophenyl)-1,3,2-dioxaborolane |
Specifications
| 4-Nitrobenzeneboronic acid pinacol ester | |
| 5g | |
| C12H16BNO4 | |
| 4,4,5,5-tetramethyl-2-4-nitrophenyl-1,3,2-dioxaborolane, 4-nitrophenylboronic acid pinacol ester, 4-nitrophenylboronic acid, pinacol ester, 4-4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl nitrobenzene, 4-nitrophenyl boronic acid, pinacol ester, 1,3,2-dioxaborolane, 4,4,5,5-tetramethyl-2-4-nitrophenyl, pubchem8088, pinacol 4-nitrophenyl boronate;, 4-nitrophenylboronate pinacol ester;, para-nitrobenzeneboronic acid pinacol ester; | |
| LUWACRUAJXZANC-UHFFFAOYSA-N | |
| 4,4,5,5-tetramethyl-2-(4-nitrophenyl)-1,3,2-dioxaborolane | |
| 2773555 | |
| 98% |
| 108°C to 109°C | |
| 171364-83-3 | |
| MFCD02179437 | |
| Slightly soluble in water. | |
| B1(OC(C(O1)(C)C)(C)C)C2=CC=C(C=C2)[N+](=O)[O-] | |
| 249.073 | |
| 249.08 |