Learn More
Alfa Aesar™ 4-(trans-3-Methoxy-3-oxo-1-propen-1-yl)benzeneboronic acid, 97%
Brand: Alfa Aesar™ H53292.MD
Additional Details : CAS : 380430-58-0 Weight : 0.00025kg
| Quantity | 250mg |
|---|
Description
Applications4-(trans-3-Methoxy-3-oxo-1-propen-1-yl)benzeneboronic acid used as reagents for suzuki-miyaura cross-coupling reacion.
Solubility
Slightly soluble in water.
Notes
Store in cool place. Keep container tightly closed in a dry and well-ventilated place. Store away from strong oxidizing agents. Refrigerate.
Chemical Identifiers
| 380430-58-0 | |
| 206.004 | |
| BIKAXBPCHWDATP-QPJJXVBHSA-N | |
| 5708389 | |
| B(C1=CC=C(C=C1)C=CC(=O)OC)(O)O |
| C10H11BO4 | |
| MFCD02179476 | |
| 4-e-3-methoxy-3-oxo-1-propen-1-yl phenyl boronic acid, 4-3-methoxy-3-oxoprop-1-en-1-yl phenyl boronic acid, 4-e-3-methoxy-3-oxo-1-propen-1-yl phenylboronic acid, 4-trans-3-methoxy-3-oxo-1-propen-1-yl benzeneboronic acid, 4-3-methoxy-3-oxoprop-1-enyl phenylboronic acid, 4-1e-3-methoxy-3-oxoprop-1-en-1-yl phenylboronic acid, 4-3-methoxy-3-oxoprop-1-en-1-yl phenylboronic acid, 4-e-3-methoxy-3-oxoprop-1-enyl phenyl boronic acid, 4-1e-3-methoxy-3-oxoprop-1-en-1-yl phenyl boronic acid, 2-propenoic acid, 3-4-boronophenyl-, 1-methyl ester, 2e | |
| [4-[(E)-3-methoxy-3-oxoprop-1-enyl]phenyl]boronic acid |
Specifications
| 4-(trans-3-Methoxy-3-oxo-1-propen-1-yl)benzeneboronic acid | |
| 250mg | |
| C10H11BO4 | |
| 4-e-3-methoxy-3-oxo-1-propen-1-yl phenyl boronic acid, 4-3-methoxy-3-oxoprop-1-en-1-yl phenyl boronic acid, 4-e-3-methoxy-3-oxo-1-propen-1-yl phenylboronic acid, 4-trans-3-methoxy-3-oxo-1-propen-1-yl benzeneboronic acid, 4-3-methoxy-3-oxoprop-1-enyl phenylboronic acid, 4-1e-3-methoxy-3-oxoprop-1-en-1-yl phenylboronic acid, 4-3-methoxy-3-oxoprop-1-en-1-yl phenylboronic acid, 4-e-3-methoxy-3-oxoprop-1-enyl phenyl boronic acid, 4-1e-3-methoxy-3-oxoprop-1-en-1-yl phenyl boronic acid, 2-propenoic acid, 3-4-boronophenyl-, 1-methyl ester, 2e | |
| BIKAXBPCHWDATP-QPJJXVBHSA-N | |
| [4-[(E)-3-methoxy-3-oxoprop-1-enyl]phenyl]boronic acid | |
| 5708389 | |
| 97% |
| 234°C to 240°C | |
| 380430-58-0 | |
| MFCD02179476 | |
| Slightly soluble in water. | |
| B(C1=CC=C(C=C1)C=CC(=O)OC)(O)O | |
| 206.004 | |
| 206 |