Learn More
Alfa Aesar™ Bis(pentafluorophenyl) carbonate, 98+%
Brand: Alfa Aesar™ H54880.14
Additional Details : CAS : 59483-84-0 Weight : 0.02500kg
| Quantity | 25g |
|---|
Description
ApplicationsBis(pentafluorophenyl) carbonate is a reagent used as a carbonyl equivalent and for various coupling reactions, especially for azapeptides.
Solubility
Soluble in chloroform, ethyl acetate and methylene chloride.
Notes
Incompatible with oxidizing agents.
Chemical Identifiers
| 59483-84-0 | |
| 394.124 | |
| IOVVFSGCNWQFQT-UHFFFAOYSA-N | |
| 2734833 | |
| C1(=C(C(=C(C(=C1F)F)F)F)F)OC(=O)OC2=C(C(=C(C(=C2F)F)F)F)F |
| C13F10O3 | |
| MFCD00368353 | |
| bis pentafluorophenyl carbonate, bis perfluorophenyl carbonate, dipentafluorophenylcarbonate, pentafluorophenyl carbonate, di-pentafluorophenyl carbonate, bis 2,3,4,5,6-pentafluorophenyl carbonate, carbonic acid bis pentafluorophenyl ester, dpfpc, acmc-209mds | |
| bis(2,3,4,5,6-pentafluorophenyl) carbonate |
Specifications
| Bis(pentafluorophenyl) carbonate | |
| 47°C to 50°C | |
| 59483-84-0 | |
| (C6F5O)2CO | |
| 2029727 | |
| Soluble in chloroform,ethyl acetate and methylene chloride. | |
| C1(=C(C(=C(C(=C1F)F)F)F)F)OC(=O)OC2=C(C(=C(C(=C2F)F)F)F)F | |
| 394.124 | |
| 394.12 |
| 110°C (230°F) | |
| 25g | |
| C13F10O3 | |
| MFCD00368353 | |
| bis pentafluorophenyl carbonate, bis perfluorophenyl carbonate, dipentafluorophenylcarbonate, pentafluorophenyl carbonate, di-pentafluorophenyl carbonate, bis 2,3,4,5,6-pentafluorophenyl carbonate, carbonic acid bis pentafluorophenyl ester, dpfpc, acmc-209mds | |
| IOVVFSGCNWQFQT-UHFFFAOYSA-N | |
| bis(2,3,4,5,6-pentafluorophenyl) carbonate | |
| 2734833 | |
| ≥98% |