Learn More
Honeywell Fluka™ Bromothymol Blue Sultone Form, ACS Reagent, Reag. Ph. Eur., Honeywell™ Fluka™
Indicator, ACS Reagent, Reag. Ph. Eur.
Brand: Honeywell Fluka™ 32714-25G
Additional Details : CAS : 76-59-5 Poids : 0.02500kg
| Packaging | Glass Bottle |
|---|---|
| Quantity | 25g |
Description
- Leading the Industry For Over 65 Years
- Honeywell now delivers Fluka™ premium grade inorganic reagents worldwide – with consistency, purity, and accuracy assured
Chemical Identifiers
| 76-59-5 | |
| 624.384 | |
| NUHCTOLBWMJMLX-UHFFFAOYSA-N | |
| 6450 | |
| 2-bromo-4-[3-(3-bromo-4-hydroxy-2-methyl-5-propan-2-ylphenyl)-1,1-dioxo-2,1$l^{6}-benzoxathiol-3-yl]-3-methyl-6-propan-2-ylphenol |
| C27H28Br2O5S | |
| MFCD00005872 | |
| 3′,3″-Dibromothymolsulfonphthalein | |
| CHEBI:86155 | |
| CC1=C(C(=C(C=C1C2(C3=CC=CC=C3S(=O)(=O)O2)C4=CC(=C(C(=C4C)Br)O)C(C)C)C(C)C)O)Br |
Specifications
| Bromothymol Blue Sultone Form | |
| 76-59-5 | |
| C27H28Br2O5S | |
| NONH for all modes of transport | |
| 3′,3″-Dibromothymolsulfonphthalein | |
| CC1=C(C(=C(C=C1C2(C3=CC=CC=C3S(=O)(=O)O2)C4=CC(=C(C(=C4C)Br)O)C(C)C)C(C)C)O)Br | |
| 624.384 | |
| CHEBI:86155 | |
| ACS Reagent | |
| Complies for clarity of solution | |
| Violet |
| Reag. Ph. Eur. | |
| Powder | |
| MFCD00005872 | |
| 373934 | |
| NUHCTOLBWMJMLX-UHFFFAOYSA-N | |
| 2-bromo-4-[3-(3-bromo-4-hydroxy-2-methyl-5-propan-2-ylphenyl)-1,1-dioxo-2,1$l^{6}-benzoxathiol-3-yl]-3-methyl-6-propan-2-ylphenol | |
| 6450 | |
| 624.38g/mol | |
| Glass Bottle | |
| 5.8 to 7.4 | |
| 25g |