Learn More
Carbamazepine, 98%, Thermo Scientific™
Brand: Thermo Scientific Alfa Aesar J62590.14
| Quantity | 25g |
|---|
Description
This Thermo Scientific brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific.
SolubilitySoluble in ethanol, acetone, propylene glycol, chloroform, dimethyl sulfoxide, methanol, dimethyl fluoride,ethylene glycol and monoethyl ether. Slightly soluble in glacial acetic acid. Insoluble in water.
Notes
Store in cool place. Incompatible with strong oxidizing agents.
Chemical Identifiers
| 298-46-4 | |
| 236.27 | |
| FFGPTBGBLSHEPO-UHFFFAOYSA-N | |
| 2554 | |
| 2-azatricyclo[9.4.0.0³,⁸]pentadeca-1(15),3,5,7,9,11,13-heptaene-2-carboxamide |
| C15H12N2O | |
| MFCD00005073 | |
| carbamazepine, tegretol, 5h-dibenzo b,f azepine-5-carboxamide, carbamazepen, carbazepine, finlepsin, carbamezepine, equetro, tegretal, biston | |
| CHEBI:3387 | |
| NC(=O)N1C2=CC=CC=C2C=CC2=CC=CC=C12 |
Specifications
| 298-46-4 | |
| MFCD00005073 | |
| 14,1781 | |
| Soluble in ethanol,acetone,propylene glycol,chloroform,dimethyl sulfoxide,methanol,dimethyl fluoride,ethylene glycol and monoethyl ether. Slightly soluble in glacial acetic acid. Insoluble in water. | |
| NC(=O)N1C2=CC=CC=C2C=CC2=CC=CC=C12 | |
| 236.27 | |
| CHEBI:3387 | |
| 98% |
| C15H12N2O | |
| 25g | |
| carbamazepine, tegretol, 5h-dibenzo b,f azepine-5-carboxamide, carbamazepen, carbazepine, finlepsin, carbamezepine, equetro, tegretal, biston | |
| FFGPTBGBLSHEPO-UHFFFAOYSA-N | |
| 2-azatricyclo[9.4.0.0³,⁸]pentadeca-1(15),3,5,7,9,11,13-heptaene-2-carboxamide | |
| 2554 | |
| 236.27 | |
| Carbamazepine |
Indem Sie auf Absenden klicken, erklären Sie sich damit einverstanden, dass Fisher Scientific sich mit Ihnen in Verbindung setzen kann, um Ihr Feedback in diesem Formular zu bearbeiten. Wir werden Ihre Informationen nicht für andere Zwecke weitergeben. Alle bereitgestellten Kontaktinformationen werden in Übereinstimmung mit unserer Datenschutzrichtlinie aufbewahrt. Datenschutzrichtlinie.