Learn More
L-Ascorbic acid sodium salt, 99%, ACROS Organics™
Brand: Acros Organics 352680050
Additional Details : CAS : 134-03-2 Weight : 0.05500kg
| Packaging | Glass bottle |
|---|---|
| Quantity | 5g |
Chemical Identifiers
| 134-03-2 | |
| 198.11 | |
| WHPNKQBYKGWBQD-PQYRJTSOSA-N | |
| 131674100 | |
| [HH].C(C(C1C(=C(C(=O)O1)O)O)O)O.[Na] |
| C6H7NaO6 | |
| MFCD00082340 | |
| sodium ascorbate, l-ascorbic acid sodium salt, sodium l-ascorbate, vitamin c sodium, ascorbicin, sodascorbate, cebitate, aminofenitrooxon, natrii ascorbas, monosodium l-ascorbate | |
| (2R)-2-[(1S)-1,2-dihydroxyethyl]-3,4-dihydroxy-2H-furan-5-one;molecular hydrogen;sodium |
Specifications
| L-Ascorbic acid sodium salt | |
| Glass bottle | |
| White to Yellow | |
| 5g | |
| 134-03-2 | |
| C6H7NaO6 | |
| 15,819 | |
| (5% in water) Clear colorless to light yellow | |
| [HH].C(C(C1C(=C(C(=O)O1)O)O)O)O.[Na] | |
| 198.11 | |
| 198.11 | |
| 99% |
| Authentic | |
| + 104.00 | |
| 219.0°C to 221.0°C | |
| 99% | |
| 98.5 to 101.5% (Iodimetry) | |
| MFCD00082340 | |
| sodium ascorbate, l-ascorbic acid sodium salt, sodium l-ascorbate, vitamin c sodium, ascorbicin, sodascorbate, cebitate, aminofenitrooxon, natrii ascorbas, monosodium l-ascorbate | |
| WHPNKQBYKGWBQD-PQYRJTSOSA-N | |
| (2R)-2-[(1S)-1,2-dihydroxyethyl]-3,4-dihydroxy-2H-furan-5-one;molecular hydrogen;sodium | |
| 131674100 | |
| Crystalline Powder |