Learn More
L-Ascorbic acid sodium salt, 99%, ACROS Organics™
Brand: Acros Organics 352680050
Additional Details : CAS : 134-03-2 Weight : 0.05500kg
Packaging | Glass bottle |
---|---|
Quantity | 5g |
Chemical Identifiers
134-03-2 | |
198.11 | |
WHPNKQBYKGWBQD-PQYRJTSOSA-N | |
131674100 | |
[HH].C(C(C1C(=C(C(=O)O1)O)O)O)O.[Na] |
C6H7NaO6 | |
MFCD00082340 | |
sodium ascorbate, l-ascorbic acid sodium salt, sodium l-ascorbate, vitamin c sodium, ascorbicin, sodascorbate, cebitate, aminofenitrooxon, natrii ascorbas, monosodium l-ascorbate | |
(2R)-2-[(1S)-1,2-dihydroxyethyl]-3,4-dihydroxy-2H-furan-5-one;molecular hydrogen;sodium |
Specifications
L-Ascorbic acid sodium salt | |
Glass bottle | |
White to Yellow | |
5g | |
134-03-2 | |
C6H7NaO6 | |
15,819 | |
(5% in water) Clear colorless to light yellow | |
[HH].C(C(C1C(=C(C(=O)O1)O)O)O)O.[Na] | |
198.11 | |
198.11 | |
99% |
Authentic | |
+ 104.00 | |
219.0°C to 221.0°C | |
99% | |
98.5 to 101.5% (Iodimetry) | |
MFCD00082340 | |
sodium ascorbate, l-ascorbic acid sodium salt, sodium l-ascorbate, vitamin c sodium, ascorbicin, sodascorbate, cebitate, aminofenitrooxon, natrii ascorbas, monosodium l-ascorbate | |
WHPNKQBYKGWBQD-PQYRJTSOSA-N | |
(2R)-2-[(1S)-1,2-dihydroxyethyl]-3,4-dihydroxy-2H-furan-5-one;molecular hydrogen;sodium | |
131674100 | |
Crystalline Powder |