Learn More
Honeywell Fluka™ Molecular Sieves, 4A, Powder, Activated, −325 mesh, Honeywell™ Fluka™
Powder, activated, −325 mesh particle size
Brand: Honeywell Fluka™ 688363-25G
Additional Details : CAS : 70955-01-0 Poids : 0.02500kg
| Packaging | Poly bottle |
|---|---|
| Quantity | 25g |
Description
- Leading the Industry For Over 65 Years
- Honeywell now delivers Fluka™ premium grade inorganic reagents worldwide – with consistency, purity, and accuracy assured
Chemical Identifiers
| 70955-01-0 | |
| 440.424 | |
| FJUZEZRZKVMAMD-DRZCJDIDSA-N | |
| (2R,3S)-2-[[(2R)-2-acetamido-3-(3-fluorophenyl)propanoyl]amino]-5-methoxy-4-methoxycarbonyl-3-methyl-5-oxopentanoic acid |
| C20H25FN2O8 | |
| MFCD00147627 | |
| 73906282 | |
| CC(C(C(=O)OC)C(=O)OC)C(C(=O)O)NC(=O)C(CC1=CC(=CC=C1)F)NC(=O)C |
Specifications
| Molecular sieves, 4A | |
| Poly bottle | |
| 400°C | |
| 70955-01-0 | |
| Na12[(AlO2)12(SiO2)12] · xH2O | |
| NONH for all modes of transport | |
| CC(C(C(=O)OC)C(=O)OC)C(C(=O)O)NC(=O)C(CC1=CC(=CC=C1)F)NC(=O)C | |
| 440.424 | |
| Powder, activated |
| 2g/cm3 | |
| Tan | |
| 25g | |
| C20H25FN2O8 | |
| MFCD00147627 | |
| FJUZEZRZKVMAMD-DRZCJDIDSA-N | |
| (2R,3S)-2-[[(2R)-2-acetamido-3-(3-fluorophenyl)propanoyl]amino]-5-methoxy-4-methoxycarbonyl-3-methyl-5-oxopentanoic acid | |
| 73906282 |