Learn More
Alfa Aesar™ N-Boc-2-bromobenzylamine, 97%
Brand: Alfa Aesar™ H55190.03
Additional Details : CAS : 162356-90-3 Weight : 0.00100kg Transport : UN number : 3077 Chem class : 9 Pack group : III
| Quantity | 1g |
|---|
Chemical Identifiers
| 162356-90-3 | |
| 286.169 | |
| DFNZFCPEUDSNEO-UHFFFAOYSA-N | |
| 7018300 | |
| CC(C)(C)OC(=O)NCC1=CC=CC=C1Br |
| C12H16BrNO2 | |
| MFCD05664385 | |
| tert-butyl 2-bromobenzylcarbamate, n-boc-2-bromobenzylamine, n-tert-butoxycarbonyl-2-bromobenzylamine, tert-butyl n-2-bromophenyl methyl carbamate, 2-bromo-benzyl-carbamic acid tert-butyl ester, tert-butyl 2-bromobenzyl carbamate, 2-bromobenzyl carbamic acid tert-butyl ester, 1-tert-butoxycarbonylaminomethyl-2-bromobenzene, carbamic acid, 2-bromophenyl methyl-, 1,1-dimethylethyl ester, pubchem7804 | |
| tert-butyl N-[(2-bromophenyl)methyl]carbamate |
Specifications
| N-Boc-2-bromobenzylamine | |
| White to Brown | |
| 1g | |
| C12H16BrNO2 | |
| UN3077 | |
| DFNZFCPEUDSNEO-UHFFFAOYSA-N | |
| tert-butyl N-[(2-bromophenyl)methyl]carbamate | |
| 7018300 | |
| Solid |
| >110°C (230°F) | |
| 50°C to 54°C | |
| 162356-90-3 | |
| MFCD05664385 | |
| tert-butyl 2-bromobenzylcarbamate, n-boc-2-bromobenzylamine, n-tert-butoxycarbonyl-2-bromobenzylamine, tert-butyl n-2-bromophenyl methyl carbamate, 2-bromo-benzyl-carbamic acid tert-butyl ester, tert-butyl 2-bromobenzyl carbamate, 2-bromobenzyl carbamic acid tert-butyl ester, 1-tert-butoxycarbonylaminomethyl-2-bromobenzene, carbamic acid, 2-bromophenyl methyl-, 1,1-dimethylethyl ester, pubchem7804 | |
| CC(C)(C)OC(=O)NCC1=CC=CC=C1Br | |
| 286.169 | |
| 286.17 | |
| 97% |