Learn More
Honeywell Fluka™ Phenol Red Indicator, ACS Reagent, Honeywell™ Fluka™
Indicator, ACS reagent
Brand: Honeywell Fluka™ 32661-10G
Additional Details : CAS : 143-74-8 Poids : 0.01000kg
| Packaging | Glass Bottle |
|---|---|
| Quantity | 10g |
Description
- Leading the Industry For Over 65 Years
- Honeywell now delivers Fluka™ premium grade inorganic reagents worldwide – with consistency, purity, and accuracy assured
Chemical Identifiers
| 143-74-8 | |
| 354.376 | |
| BELBBZDIHDAJOR-UHFFFAOYSA-N | |
| 4766 | |
| 4-[3-(4-hydroxyphenyl)-1,1-dioxo-2,1$l^{6}-benzoxathiol-3-yl]phenol |
| C19H14O5S | |
| MFCD00003552 | |
| Phenolsulfonphthalein | |
| CHEBI:31991 | |
| C1=CC=C2C(=C1)C(OS2(=O)=O)(C3=CC=C(C=C3)O)C4=CC=C(C=C4)O |
Specifications
| Phenol Red | |
| Powder | |
| MFCD00003552 | |
| 326470 | |
| BELBBZDIHDAJOR-UHFFFAOYSA-N | |
| 4-[3-(4-hydroxyphenyl)-1,1-dioxo-2,1$l^{6}-benzoxathiol-3-yl]phenol | |
| 4766 | |
| 354.38g/mol | |
| Glass Bottle | |
| Red |
| 143-74-8 | |
| C19H14O5S | |
| NONH for all modes of transport | |
| Phenolsulfonphthalein | |
| C1=CC=C2C(=C1)C(OS2(=O)=O)(C3=CC=C(C=C3)O)C4=CC=C(C=C4)O | |
| 354.376 | |
| CHEBI:31991 | |
| ACS Reagent | |
| 6.8 to 8.2 (yellow to red) | |
| 10g |