Learn More
Honeywell Fluka™ Potassium Hydrogen Diiodate, ≥99.8% (RT), Honeywell™ Fluka™
Puriss. p.a.,≥99.8% (RT)
Brand: Honeywell Fluka™ 60350-100G
Additional Details : CAS : 13455-24-8 Poids : 0.10000kg
| Packaging | Glass bottle |
|---|---|
| Quantity | 100g |
Description
- Leading the Industry For Over 65 Years
- Honeywell now delivers Fluka™ premium grade inorganic reagents worldwide – with consistency, purity, and accuracy assured
Chemical Identifiers
| 13455-24-8 | |
| 389.909 | |
| ACAYDTMSDROWHW-UHFFFAOYSA-M | |
| 23700942 | |
| OI(=O)=O.[O-]I(=O)=O.[K+] |
| HI2KO6 | |
| MFCD00011400 | |
| potassium hydrogen diiodate, potassium biiodate, kaliumhydrogendijodat, iodic acid hio3 , potassium salt 2:1, potassium biiodate solution, potassium iodic acid iodate, io3.k.hio3, potassium ion iodic acid iodate, potassium hydrogen iodate powder, potassium hydrogen diiodate, p.a | |
| potassium;iodic acid;iodate |
Specifications
| Potassium hydrogen diiodate | |
| HI2KO6 | |
| MFCD00011400 | |
| potassium hydrogen diiodate, potassium biiodate, kaliumhydrogendijodat, iodic acid hio3 , potassium salt 2:1, potassium biiodate solution, potassium iodic acid iodate, io3.k.hio3, potassium ion iodic acid iodate, potassium hydrogen iodate powder, potassium hydrogen diiodate, p.a | |
| OI(=O)=O.[O-]I(=O)=O.[K+] | |
| 389.909 | |
| 389.91g/mol | |
| Glass bottle | |
| White |
| 13455-24-8 | |
| KH(IO3)2 | |
| UN3085 | |
| ACAYDTMSDROWHW-UHFFFAOYSA-M | |
| potassium;iodic acid;iodate | |
| 23700942 | |
| ≥99.8% (RT) | |
| Powder | |
| 100g |