Learn More
Prednisone, 98%, ACROS Organics™
Brand: Acros Organics 448950250
Additional Details : CAS : 53-03-2 Poids : 0.03000kg
| Packaging | Glass Bottle |
|---|---|
| Quantity | 25g |
Chemical Identifiers
| 53-03-2 | |
| 358.434 | |
| prednisone, deltasone, dehydrocortisone, decortin, meticorten, orasone, prednison, rectodelt, ultracorten, dacortin | |
| CHEBI:8382 | |
| CC12CC(=O)C3C(C1CCC2(C(=O)CO)O)CCC4=CC(=O)C=CC34C |
| C21H26O5 | |
| XOFYZVNMUHMLCC-ZPOLXVRWSA-N | |
| 5865 | |
| (8S,9S,10R,13S,14S,17R)-17-hydroxy-17-(2-hydroxyacetyl)-10,13-dimethyl-6,7,8,9,12,14,15,16-octahydrocyclopenta[a]phenanthrene-3,11-dione |
Specifications
| Prednisone | |
| 225.0°C to 229.0°C | |
| 53-03-2 | |
| C21H26O5 | |
| XOFYZVNMUHMLCC-ZPOLXVRWSA-N | |
| (8S,9S,10R,13S,14S,17R)-17-hydroxy-17-(2-hydroxyacetyl)-10,13-dimethyl-6,7,8,9,12,14,15,16-octahydrocyclopenta[a]phenanthrene-3,11-dione | |
| 5865 | |
| 358.43 |
| Glass Bottle | |
| 25g | |
| 98% | |
| prednisone, deltasone, dehydrocortisone, decortin, meticorten, orasone, prednison, rectodelt, ultracorten, dacortin | |
| CC12CC(=O)C3C(C1CCC2(C(=O)CO)O)CCC4=CC(=O)C=CC34C | |
| 358.434 | |
| CHEBI:8382 |
Safety and Handling
- Prednisone
Signal Word
- Warning
Hazard Category
- Reproductive toxicity Category 2
Hazard Statement
- H361-Suspected of damaging fertility or the unborn child.
Precautionary Statement
- P201-Obtain special instructions before use.
- P202-Do not handle until all safety precautions have been read and understood.
- P280-Wear protective gloves/protective clothing/eye protection/face protection.
- P308+P313-IF exposed or concerned: Get medical advice/attention.