Learn More
Alfa Aesar™ Proadifen hydrochloride
Brand: Alfa Aesar™ J63833.04
Additional Details : CAS : 62-68-0 Weight : 0.00200kg
| Quantity | 2g |
|---|
Description
ApplicationsProadifen hydrochloride is an inhibitor of NOS1, AChR, cytochrome P-450, and KIR6. Proadifen hydrochloride bind to the protein moiety of P-450, also reduced the hypoxic response. of Proadifen hydrochloride have good antiarrhythmic effects. SKF-525A substantially reduced the depletion of cardiac norepinephrine.
Solubility
Soluble in methanol or water
Notes
Store in cool place. Keep container tightly closed in a dry and well-ventilated place. Store away from strong oxidizing agents, heat.
Chemical Identifiers
| 62-68-0 | |
| 389.964 | |
| FHIKZROVIDCMJA-UHFFFAOYSA-N | |
| 65341 | |
| CCCC(C1=CC=CC=C1)(C2=CC=CC=C2)C(=O)OCCN(CC)CC.Cl |
| C23H32ClNO2 | |
| MFCD00055151 | |
| proadifen hydrochloride, proadifen hcl, propyladiphenin, skf-525a hydrochloride, skf 525a, sk&f 525-a, proadifen hydrochloride usan, skf 525-a, skf-525a, hydrochloride | |
| 2-(diethylamino)ethyl 2,2-diphenylpentanoate;hydrochloride |
Specifications
| Proadifen hydrochloride | |
| 122°C to 123°C | |
| 62-68-0 | |
| MFCD00055151 | |
| Soluble in methanol or water | |
| CCCC(C1=CC=CC=C1)(C2=CC=CC=C2)C(=O)OCCN(CC)CC.Cl | |
| 389.964 | |
| 389.97 |
| White | |
| 2g | |
| C23H32ClNO2 | |
| proadifen hydrochloride, proadifen hcl, propyladiphenin, skf-525a hydrochloride, skf 525a, sk&f 525-a, proadifen hydrochloride usan, skf 525-a, skf-525a, hydrochloride | |
| FHIKZROVIDCMJA-UHFFFAOYSA-N | |
| 2-(diethylamino)ethyl 2,2-diphenylpentanoate;hydrochloride | |
| 65341 | |
| Powder |