Learn More
Sodium benzoate, 99%, for biochemistry, ACROS Organics™
Brand: Acros Organics 447802500
Additional Details : CAS : 532-32-1 Weight : 0.25000kg
| Quantity | 250g |
|---|
Chemical Identifiers
| 532-32-1 | |
| 144.11 | |
| sodium benzoate, benzoic acid, sodium salt, benzoic acid sodium salt, sobenate, antimol, benzoate sodium, benzoate of soda, benzoate, sodium, natrium benzoicum, caswell no. 746 | |
| sodium;benzoate |
| C7H5NaO2 | |
| WXMKPNITSTVMEF-UHFFFAOYSA-M | |
| 517055 | |
| C1=CC=C(C=C1)C(=O)[O-].[Na+] |
Specifications
| Sodium benzoate | |
| Plastic bottle | |
| >300.0°C | |
| 532-32-1 | |
| C7H5NaO2 | |
| 15,8718 | |
| (1 M in water) Clear colorless to light yellow | |
| C1=CC=C(C=C1)C(=O)[O-].[Na+] | |
| 144.11 | |
| 144.11 | |
| Biochemistry |
| 0.05% max | |
| 0.05% max | |
| 250g | |
| 99% | |
| C6H5CO2Na | |
| sodium benzoate, benzoic acid, sodium salt, benzoic acid sodium salt, sobenate, antimol, benzoate sodium, benzoate of soda, benzoate, sodium, natrium benzoicum, caswell no. 746 | |
| WXMKPNITSTVMEF-UHFFFAOYSA-M | |
| sodium;benzoate | |
| 517055 | |
| 99% |
Safety and Handling
- Benzoic acid, sodium salt
Signal Word
- Warning
Hazard Category
- Serious eye damage/eye irritation Category 2
Hazard Statement
- H319-Causes serious eye irritation.
Precautionary Statement
- P280-Wear protective gloves/protective clothing/eye protection/face protection.
- P305+P351+P338-IF IN EYES: Rinse cautiously with water for several minutes. Remove contact lenses, if present and easy to do. Continue rinsing.