Organic compounds
Organic compounds are a class of chemical compounds that contain one or more atoms of carbon covalently bonded to each other and atoms of other elements such as hydrogen, oxygen, nitrogen, sulfur, etc.
Compounds or allotropes of carbon that contain only carbon atoms are classified as inorganic compounds and exhibit novel properties.
This class of chemicals has a wide range of applications and includes graphite, diamond, and the more recently discovered graphene, fullerenes, and other carbon nanotubes. In fact, the majority of elements in the periodic table of elements are inorganic compounds.
Filtered Search Results
N-Hydroxysuccinimide, 98+%
CAS: 6066-82-6 Molecular Formula: C4H5NO3 Molecular Weight (g/mol): 115.09 MDL Number: MFCD00005516 InChI Key: NQTADLQHYWFPDB-UHFFFAOYSA-N Synonym: n-hydroxysuccinimide,hosu,1-hydroxysuccinimide,2,5-pyrrolidinedione, 1-hydroxy,1-hydroxy-2,5-pyrrolidinedione,succinimide, n-hydroxy,n-hydroxysuccinimde,n-hydroxysuccinimid,unii-mje3791m4t,ccris 2604 PubChem CID: 80170 IUPAC Name: 1-hydroxypyrrolidine-2,5-dione SMILES: C1CC(=O)N(C1=O)O
| PubChem CID | 80170 |
|---|---|
| CAS | 6066-82-6 |
| Molecular Weight (g/mol) | 115.09 |
| MDL Number | MFCD00005516 |
| SMILES | C1CC(=O)N(C1=O)O |
| Synonym | n-hydroxysuccinimide,hosu,1-hydroxysuccinimide,2,5-pyrrolidinedione, 1-hydroxy,1-hydroxy-2,5-pyrrolidinedione,succinimide, n-hydroxy,n-hydroxysuccinimde,n-hydroxysuccinimid,unii-mje3791m4t,ccris 2604 |
| IUPAC Name | 1-hydroxypyrrolidine-2,5-dione |
| InChI Key | NQTADLQHYWFPDB-UHFFFAOYSA-N |
| Molecular Formula | C4H5NO3 |
1-Octanesulfonic acid, sodium salt, HPLC grade
Greener Choice Product
This product offers one or more environmental benefits itemized in the U.S. FTC Green Guides.
Learn More About the Greener Choice Program
This product offers one or more environmental benefits itemized in the U.S. FTC Green Guides.
Learn More About the Greener Choice Program
CAS: 5324-84-5 Molecular Formula: C8H17NaO3S Molecular Weight (g/mol): 216.27 MDL Number: MFCD00007544 InChI Key: HRQDCDQDOPSGBR-UHFFFAOYSA-M Synonym: sodium 1-octanesulfonate,sodium octane-1-sulfonate,1-octanesulfonic acid sodium salt,sodium octanesulfonate,1-octanesulfonic acid, sodium salt,1-octanesulfonate, sodium,sodium octylsulfonate,unii-j46ez5jyb3,octyl sodium sulfonate,ipc-alks-8 PubChem CID: 23669624 SMILES: [Na+].CCCCCCCCS([O-])(=O)=O
| PubChem CID | 23669624 |
|---|---|
| CAS | 5324-84-5 |
| Molecular Weight (g/mol) | 216.27 |
| MDL Number | MFCD00007544 |
| SMILES | [Na+].CCCCCCCCS([O-])(=O)=O |
| Synonym | sodium 1-octanesulfonate,sodium octane-1-sulfonate,1-octanesulfonic acid sodium salt,sodium octanesulfonate,1-octanesulfonic acid, sodium salt,1-octanesulfonate, sodium,sodium octylsulfonate,unii-j46ez5jyb3,octyl sodium sulfonate,ipc-alks-8 |
| InChI Key | HRQDCDQDOPSGBR-UHFFFAOYSA-M |
| Molecular Formula | C8H17NaO3S |
| CAS | 9000-01-5 |
|---|---|
| MDL Number | MFCD00081264 |
| Synonym | Acacia |
Dimethylglyoxime, disodium salt octahydrate, 99%
CAS: 75006-64-3 Molecular Formula: C4H22N2Na2O10 Molecular Weight (g/mol): 304.20 MDL Number: MFCD00150288 InChI Key: IJJDRGUPRATWQX-UHFFFAOYSA-L Synonym: dimethylglyoxime disodium salt octahydrate,c4h6n2o2.2na.8h2o,sodium dimethylglyoxime octahydrate,dimethylglyoxime di-sodium salt octahydrate PubChem CID: 71310106 SMILES: O.O.O.O.O.O.O.O.[Na+].[Na+].CC(=N[O-])C(C)=N[O-]
| PubChem CID | 71310106 |
|---|---|
| CAS | 75006-64-3 |
| Molecular Weight (g/mol) | 304.20 |
| MDL Number | MFCD00150288 |
| SMILES | O.O.O.O.O.O.O.O.[Na+].[Na+].CC(=N[O-])C(C)=N[O-] |
| Synonym | dimethylglyoxime disodium salt octahydrate,c4h6n2o2.2na.8h2o,sodium dimethylglyoxime octahydrate,dimethylglyoxime di-sodium salt octahydrate |
| InChI Key | IJJDRGUPRATWQX-UHFFFAOYSA-L |
| Molecular Formula | C4H22N2Na2O10 |
Benzoic acid, 99%, extra pure
CAS: 65-85-0 Molecular Formula: C7H6O2 Molecular Weight (g/mol): 122.12 MDL Number: MFCD00002398 InChI Key: WPYMKLBDIGXBTP-UHFFFAOYSA-N Synonym: benzenecarboxylic acid,dracylic acid,benzeneformic acid,carboxybenzene,phenylformic acid,benzenemethanoic acid,phenylcarboxylic acid,retardex,benzoesaeure gk,benzoesaeure gv PubChem CID: 243 ChEBI: CHEBI:30746 IUPAC Name: benzoic acid SMILES: C1=CC=C(C=C1)C(=O)O
| PubChem CID | 243 |
|---|---|
| CAS | 65-85-0 |
| Molecular Weight (g/mol) | 122.12 |
| ChEBI | CHEBI:30746 |
| MDL Number | MFCD00002398 |
| SMILES | C1=CC=C(C=C1)C(=O)O |
| Synonym | benzenecarboxylic acid,dracylic acid,benzeneformic acid,carboxybenzene,phenylformic acid,benzenemethanoic acid,phenylcarboxylic acid,retardex,benzoesaeure gk,benzoesaeure gv |
| IUPAC Name | benzoic acid |
| InChI Key | WPYMKLBDIGXBTP-UHFFFAOYSA-N |
| Molecular Formula | C7H6O2 |
Oleamide
CAS: 301-02-0 Molecular Formula: C18H35NO Molecular Weight (g/mol): 281.48 InChI Key: FATBGEAMYMYZAF-MDZDMXLPSA-N IUPAC Name: (9E)-octadec-9-enamide SMILES: CCCCCCCC\C=C\CCCCCCCC(N)=O
| CAS | 301-02-0 |
|---|---|
| Molecular Weight (g/mol) | 281.48 |
| SMILES | CCCCCCCC\C=C\CCCCCCCC(N)=O |
| IUPAC Name | (9E)-octadec-9-enamide |
| InChI Key | FATBGEAMYMYZAF-MDZDMXLPSA-N |
| Molecular Formula | C18H35NO |
4-Aminobenzoic acid, 99%
CAS: 150-13-0 Molecular Formula: C7H7NO2 Molecular Weight (g/mol): 137.14 MDL Number: MFCD00007894 InChI Key: ALYNCZNDIQEVRV-UHFFFAOYSA-N Synonym: p-aminobenzoic acid,paba,para-aminobenzoic acid,vitamin bx,sunbrella,p-carboxyaniline,4-carboxyaniline,hachemina,paraminol,benzoic acid, 4-amino PubChem CID: 978 ChEBI: CHEBI:30753 IUPAC Name: 4-aminobenzoic acid SMILES: NC1=CC=C(C=C1)C(O)=O
| PubChem CID | 978 |
|---|---|
| CAS | 150-13-0 |
| Molecular Weight (g/mol) | 137.14 |
| ChEBI | CHEBI:30753 |
| MDL Number | MFCD00007894 |
| SMILES | NC1=CC=C(C=C1)C(O)=O |
| Synonym | p-aminobenzoic acid,paba,para-aminobenzoic acid,vitamin bx,sunbrella,p-carboxyaniline,4-carboxyaniline,hachemina,paraminol,benzoic acid, 4-amino |
| IUPAC Name | 4-aminobenzoic acid |
| InChI Key | ALYNCZNDIQEVRV-UHFFFAOYSA-N |
| Molecular Formula | C7H7NO2 |
Nocodazole, 98%
CAS: 31430-18-9 Molecular Formula: C14H11N3O3S Molecular Weight (g/mol): 301.32 MDL Number: MFCD00005588 InChI Key: KYRVNWMVYQXFEU-UHFFFAOYSA-N Synonym: nocodazole,oncodazole,nocodazol,nocodazolum,nocidazole,nocodazole usan:inn,nocodazol inn-spanish,nocodazolum inn-latin,unii-sh1wy3r615,methyl 5-2-thenoyl-2-benzimidazolecarbamate PubChem CID: 4122 ChEBI: CHEBI:34892 IUPAC Name: methyl N-[6-(thiophene-2-carbonyl)-1H-benzimidazol-2-yl]carbamate SMILES: COC(=O)NC1=NC2=C(N1)C=C(C=C2)C(=O)C3=CC=CS3
| PubChem CID | 4122 |
|---|---|
| CAS | 31430-18-9 |
| Molecular Weight (g/mol) | 301.32 |
| ChEBI | CHEBI:34892 |
| MDL Number | MFCD00005588 |
| SMILES | COC(=O)NC1=NC2=C(N1)C=C(C=C2)C(=O)C3=CC=CS3 |
| Synonym | nocodazole,oncodazole,nocodazol,nocodazolum,nocidazole,nocodazole usan:inn,nocodazol inn-spanish,nocodazolum inn-latin,unii-sh1wy3r615,methyl 5-2-thenoyl-2-benzimidazolecarbamate |
| IUPAC Name | methyl N-[6-(thiophene-2-carbonyl)-1H-benzimidazol-2-yl]carbamate |
| InChI Key | KYRVNWMVYQXFEU-UHFFFAOYSA-N |
| Molecular Formula | C14H11N3O3S |
N-Acryloxysuccinimide, 99%
CAS: 38862-24-7 Molecular Formula: C7H7NO4 Molecular Weight (g/mol): 169.14 MDL Number: MFCD00078261 InChI Key: YXMISKNUHHOXFT-UHFFFAOYSA-N Synonym: 2,5-dioxopyrrolidin-1-yl acrylate,n-acryloxysuccinimide,n-succinimidyl acrylate,acrylic acid n-hydroxysuccinimide ester,1-acryloyloxy-2,5-pyrrolidinedione,n-acryloyloxysuccinimide,2,5-pyrrolidinedione, 1-1-oxo-2-propenyl oxy,2,5-dioxopyrrolidin-1-yl prop-2-enoate,poly n-acryloxysuccinimide PubChem CID: 181508 IUPAC Name: (2,5-dioxopyrrolidin-1-yl) prop-2-enoate SMILES: C=CC(=O)ON1C(=O)CCC1=O
| PubChem CID | 181508 |
|---|---|
| CAS | 38862-24-7 |
| Molecular Weight (g/mol) | 169.14 |
| MDL Number | MFCD00078261 |
| SMILES | C=CC(=O)ON1C(=O)CCC1=O |
| Synonym | 2,5-dioxopyrrolidin-1-yl acrylate,n-acryloxysuccinimide,n-succinimidyl acrylate,acrylic acid n-hydroxysuccinimide ester,1-acryloyloxy-2,5-pyrrolidinedione,n-acryloyloxysuccinimide,2,5-pyrrolidinedione, 1-1-oxo-2-propenyl oxy,2,5-dioxopyrrolidin-1-yl prop-2-enoate,poly n-acryloxysuccinimide |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) prop-2-enoate |
| InChI Key | YXMISKNUHHOXFT-UHFFFAOYSA-N |
| Molecular Formula | C7H7NO4 |
Graphite, powder
CAS: 7782-42-5 Molecular Formula: C Molecular Weight (g/mol): 12.01 MDL Number: MFCD00133992 MFCD00144065 MFCD00146977 MFCD00211867 MFCD06411993 MFCD07370731 InChI Key: OKTJSMMVPCPJKN-UHFFFAOYSA-N Synonym: graphite,activated charcoal,norit,mineral,carbon-12,carbono,graphene,acticarbone,anthrasorb,carbosieve PubChem CID: 5462310 ChEBI: CHEBI:27594 IUPAC Name: carbon SMILES: [C]
| PubChem CID | 5462310 |
|---|---|
| CAS | 7782-42-5 |
| Molecular Weight (g/mol) | 12.01 |
| ChEBI | CHEBI:27594 |
| MDL Number | MFCD00133992 MFCD00144065 MFCD00146977 MFCD00211867 MFCD06411993 MFCD07370731 |
| SMILES | [C] |
| Synonym | graphite,activated charcoal,norit,mineral,carbon-12,carbono,graphene,acticarbone,anthrasorb,carbosieve |
| IUPAC Name | carbon |
| InChI Key | OKTJSMMVPCPJKN-UHFFFAOYSA-N |
| Molecular Formula | C |
trans-1,2-Diaminocyclohexane-N,N,N',N'-tetraacetic Acid Monohydrate, 98%
CAS: 125572-95-4 Molecular Formula: C14H20N2O8 Molecular Weight (g/mol): 344.32 MDL Number: MFCD00149243,MFCD00066429,MFCD00003845 InChI Key: FCKYPQBAHLOOJQ-NXEZZACHSA-L Synonym: 2,2',2,2'-trans-cyclohexane-1,2-diylbis azanetriyl tetraacetic acid hydrate,dcyta,trans-1,2-diaminocyclohexane-n,n,n',n'-tetraacetic acid monohydrate,1,2-cyclohexanedinitrilotetraacetic acid,2,2',2,2'-1r,2r-rel-cyclohexane-1,2-diylbis azanetriyl tetraacetic acid hydrate,trans-1,2-cyclohexanediaminetetraacetic acid monohydrate,cdta monohydrate,ctda monohydrate,chel-cd,chel r-cd PubChem CID: 2723844 SMILES: [O-]C(=O)C[NH+](CC([O-])=O)[C@@H]1CCCC[C@H]1[NH+](CC([O-])=O)CC([O-])=O
| PubChem CID | 2723844 |
|---|---|
| CAS | 125572-95-4 |
| Molecular Weight (g/mol) | 344.32 |
| MDL Number | MFCD00149243,MFCD00066429,MFCD00003845 |
| SMILES | [O-]C(=O)C[NH+](CC([O-])=O)[C@@H]1CCCC[C@H]1[NH+](CC([O-])=O)CC([O-])=O |
| Synonym | 2,2',2,2'-trans-cyclohexane-1,2-diylbis azanetriyl tetraacetic acid hydrate,dcyta,trans-1,2-diaminocyclohexane-n,n,n',n'-tetraacetic acid monohydrate,1,2-cyclohexanedinitrilotetraacetic acid,2,2',2,2'-1r,2r-rel-cyclohexane-1,2-diylbis azanetriyl tetraacetic acid hydrate,trans-1,2-cyclohexanediaminetetraacetic acid monohydrate,cdta monohydrate,ctda monohydrate,chel-cd,chel r-cd |
| InChI Key | FCKYPQBAHLOOJQ-NXEZZACHSA-L |
| Molecular Formula | C14H20N2O8 |
Thermo Scientific Chemicals Thiamine hydrochloride, 98.5-101.5%
CAS: 67-03-8 Molecular Formula: C12H17ClN4OS·HCl Molecular Weight (g/mol): 337.26 MDL Number: MFCD00012780 InChI Key: DPJRMOMPQZCRJU-UHFFFAOYSA-M Synonym: thiamine hydrochloride,vitamin b1 hydrochloride,thiamine hcl,aneurine hydrochloride,berin,thiamine chloride hydrochloride,trophite,thiamin chloride,thiamine dichloride,thiaminium chloride PubChem CID: 6202 ChEBI: CHEBI:49105 IUPAC Name: 2-[3-[(4-amino-2-methylpyrimidin-5-yl)methyl]-4-methyl-1,3-thiazol-3-ium-5-yl]ethanol;chloride;hydrochloride SMILES: CC1=C(SC=[N+]1CC2=CN=C(N=C2N)C)CCO.Cl.[Cl-]
| PubChem CID | 6202 |
|---|---|
| CAS | 67-03-8 |
| Molecular Weight (g/mol) | 337.26 |
| ChEBI | CHEBI:49105 |
| MDL Number | MFCD00012780 |
| SMILES | CC1=C(SC=[N+]1CC2=CN=C(N=C2N)C)CCO.Cl.[Cl-] |
| Synonym | thiamine hydrochloride,vitamin b1 hydrochloride,thiamine hcl,aneurine hydrochloride,berin,thiamine chloride hydrochloride,trophite,thiamin chloride,thiamine dichloride,thiaminium chloride |
| IUPAC Name | 2-[3-[(4-amino-2-methylpyrimidin-5-yl)methyl]-4-methyl-1,3-thiazol-3-ium-5-yl]ethanol;chloride;hydrochloride |
| InChI Key | DPJRMOMPQZCRJU-UHFFFAOYSA-M |
| Molecular Formula | C12H17ClN4OS·HCl |
Phenazine methosulfate, 98%
CAS: 299-11-6 Molecular Formula: C13H11N2·CH3O4S Molecular Weight (g/mol): 306.33 MDL Number: MFCD00011923 InChI Key: RXGJTUSBYWCRBK-UHFFFAOYSA-M Synonym: phenazine methosulfate,5-methylphenazin-5-ium methyl sulfate,5-methylphenazinium methyl sulfate,n-methylphenazonium methosulfate,phenazine methosulphate,methylphenazonium methosulfate,5-methylphenazine methylsulfate,n-methylphenazinium methosulfate,n-methylphenazonium methosulphate,phenazinium, 5-methyl-, methyl sulfate PubChem CID: 9285 ChEBI: CHEBI:8055 IUPAC Name: 5-methylphenazin-5-ium;methyl sulfate SMILES: C[N+]1=C2C=CC=CC2=NC3=CC=CC=C31.COS(=O)(=O)[O-]
| PubChem CID | 9285 |
|---|---|
| CAS | 299-11-6 |
| Molecular Weight (g/mol) | 306.33 |
| ChEBI | CHEBI:8055 |
| MDL Number | MFCD00011923 |
| SMILES | C[N+]1=C2C=CC=CC2=NC3=CC=CC=C31.COS(=O)(=O)[O-] |
| Synonym | phenazine methosulfate,5-methylphenazin-5-ium methyl sulfate,5-methylphenazinium methyl sulfate,n-methylphenazonium methosulfate,phenazine methosulphate,methylphenazonium methosulfate,5-methylphenazine methylsulfate,n-methylphenazinium methosulfate,n-methylphenazonium methosulphate,phenazinium, 5-methyl-, methyl sulfate |
| IUPAC Name | 5-methylphenazin-5-ium;methyl sulfate |
| InChI Key | RXGJTUSBYWCRBK-UHFFFAOYSA-M |
| Molecular Formula | C13H11N2·CH3O4S |
Thermo Scientific Chemicals Propidium iodide, 95%
CAS: 25535-16-4 Molecular Formula: C27H34I2N4 Molecular Weight (g/mol): 668.39 InChI Key: XJMOSONTPMZWPB-UHFFFAOYSA-M Synonym: propidium iodide,propidium diiodide,3,8-diamino-5-3-diethyl methyl ammonio propyl-6-phenylphenanthridin-5-ium iodide,unii-tp416o228t,3,8-diamino-5-3-diethylmethylammonio propyl-6-phenylphenanthridinium diiodide,3,8-diamino-5-3-diethylaminopropyl-6-phenylphenanthridinium iodide methiodide,phenanthridinium, 3,8-diamino-5-3-diethylmethylammonio propyl-6-phenyl-, diiodide PubChem CID: 104981 ChEBI: CHEBI:51240 IUPAC Name: 3-(3,8-diamino-6-phenylphenanthridin-5-ium-5-yl)propyl-diethyl-methylazanium;diiodide SMILES: CC[N+](C)(CC)CCC[N+]1=C2C=C(C=CC2=C3C=CC(=CC3=C1C4=CC=CC=C4)N)N.[I-].[I-]
| PubChem CID | 104981 |
|---|---|
| CAS | 25535-16-4 |
| Molecular Weight (g/mol) | 668.39 |
| ChEBI | CHEBI:51240 |
| SMILES | CC[N+](C)(CC)CCC[N+]1=C2C=C(C=CC2=C3C=CC(=CC3=C1C4=CC=CC=C4)N)N.[I-].[I-] |
| Synonym | propidium iodide,propidium diiodide,3,8-diamino-5-3-diethyl methyl ammonio propyl-6-phenylphenanthridin-5-ium iodide,unii-tp416o228t,3,8-diamino-5-3-diethylmethylammonio propyl-6-phenylphenanthridinium diiodide,3,8-diamino-5-3-diethylaminopropyl-6-phenylphenanthridinium iodide methiodide,phenanthridinium, 3,8-diamino-5-3-diethylmethylammonio propyl-6-phenyl-, diiodide |
| IUPAC Name | 3-(3,8-diamino-6-phenylphenanthridin-5-ium-5-yl)propyl-diethyl-methylazanium;diiodide |
| InChI Key | XJMOSONTPMZWPB-UHFFFAOYSA-M |
| Molecular Formula | C27H34I2N4 |
5,5'-Dithiobis-(2-nitrobenzoic acid), 99%
CAS: 69-78-3 Molecular Formula: C14H8N2O8S2 Molecular Weight (g/mol): 396.34 MDL Number: MFCD00007140 InChI Key: KIUMMUBSPKGMOY-UHFFFAOYSA-N Synonym: dtnb,5,5'-dithiobis 2-nitrobenzoic acid,ellman's reagent,3-carboxy-4-nitrophenyl disulfide,dithionitrobenzoic acid,dithiobisnitrobenzoic acid,5,5'-disulfanediylbis 2-nitrobenzoic acid,benzoic acid, 3,3'-dithiobis 6-nitro,3,3'-dithiobis 6-nitrobenzoic acid,5,5'-dithio-bis 2-nitrobenzoic acid PubChem CID: 6254 ChEBI: CHEBI:86228 IUPAC Name: 5-[(3-carboxy-4-nitrophenyl)disulfanyl]-2-nitrobenzoic acid SMILES: OC(=O)C1=CC(SSC2=CC=C(C(=C2)C(O)=O)[N+]([O-])=O)=CC=C1[N+]([O-])=O
| PubChem CID | 6254 |
|---|---|
| CAS | 69-78-3 |
| Molecular Weight (g/mol) | 396.34 |
| ChEBI | CHEBI:86228 |
| MDL Number | MFCD00007140 |
| SMILES | OC(=O)C1=CC(SSC2=CC=C(C(=C2)C(O)=O)[N+]([O-])=O)=CC=C1[N+]([O-])=O |
| Synonym | dtnb,5,5'-dithiobis 2-nitrobenzoic acid,ellman's reagent,3-carboxy-4-nitrophenyl disulfide,dithionitrobenzoic acid,dithiobisnitrobenzoic acid,5,5'-disulfanediylbis 2-nitrobenzoic acid,benzoic acid, 3,3'-dithiobis 6-nitro,3,3'-dithiobis 6-nitrobenzoic acid,5,5'-dithio-bis 2-nitrobenzoic acid |
| IUPAC Name | 5-[(3-carboxy-4-nitrophenyl)disulfanyl]-2-nitrobenzoic acid |
| InChI Key | KIUMMUBSPKGMOY-UHFFFAOYSA-N |
| Molecular Formula | C14H8N2O8S2 |