Salts and Inorganics
A variety of inorganic salts and elemental metals that can be used for large-scale, industrial purposes and everyday laboratory applications. Products are available in a range of chemical compositions, quantities, purities, and reagent grades.
Inorganics are elements and compounds, including carbon monoxide, carbon dioxide, carbonates, cyanides, cyanates, and carbides, that do not contain a carbon-hydrogen bond. This group also includes carbon allotropes such as graphite and graphene.
Because organic chemicals include only those that contain carbon atoms bonded to hydrogen atoms, the majority of elements in the periodic table and most substances in the material world are considered to be inorganic chemicals.
Filtered Search Results
1-Phenyl-1-trimethylsiloxyethylene, 95%
CAS: 13735-81-4 Molecular Formula: C11H16OSi Molecular Weight (g/mol): 192.333 MDL Number: MFCD00008582 InChI Key: AFFPCIMDERUIST-UHFFFAOYSA-N Synonym: 1-phenyl-1-trimethylsiloxyethylene,trimethyl 1-phenylvinyl oxy silane,1-phenyl-1-trimethylsilyloxyethylene,1-phenyl-1-trimethylsiloxy ethylene,1-phenyl-1-trimethylsilyloxy ethylene,benzene, 1-trimethylsilyl oxy ethenyl,silane, trimethyl 1-phenylethenyl oxy,acmc-209ccf PubChem CID: 117406 IUPAC Name: trimethyl(1-phenylethenoxy)silane SMILES: C[Si](C)(C)OC(=C)C1=CC=CC=C1
| PubChem CID | 117406 |
|---|---|
| CAS | 13735-81-4 |
| Molecular Weight (g/mol) | 192.333 |
| MDL Number | MFCD00008582 |
| SMILES | C[Si](C)(C)OC(=C)C1=CC=CC=C1 |
| Synonym | 1-phenyl-1-trimethylsiloxyethylene,trimethyl 1-phenylvinyl oxy silane,1-phenyl-1-trimethylsilyloxyethylene,1-phenyl-1-trimethylsiloxy ethylene,1-phenyl-1-trimethylsilyloxy ethylene,benzene, 1-trimethylsilyl oxy ethenyl,silane, trimethyl 1-phenylethenyl oxy,acmc-209ccf |
| IUPAC Name | trimethyl(1-phenylethenoxy)silane |
| InChI Key | AFFPCIMDERUIST-UHFFFAOYSA-N |
| Molecular Formula | C11H16OSi |
1-Phenyl-3-trimethylsilyl-2-propyn-1-ol, 97%
CAS: 89530-34-7 Molecular Formula: C12H16OSi Molecular Weight (g/mol): 204.344 MDL Number: MFCD05864336 InChI Key: RVTDALNDYLDVMN-UHFFFAOYSA-N Synonym: 1-phenyl-3-trimethylsilyl-2-propyn-1-ol,1-phenyl-3-trimethylsilyl prop-2-yn-1-ol,benzenemethanol, a-2-trimethylsilyl ethynyl,acmc-20ln8h,alpha-trimethylsilyl ethynylbenzyl alcohol,4,4-dimethyl-1-phenyl-4-silapent-2-yn-1-ol,alpha-trimethylsilyl ethynyl-benzenemethanol,alpha-trimethylsilyl-ethynyl-benzenemethanol,alpha-trimethylsilyl ethynyl-benzene-methanol,1-phenyl-3-1,1,1-trimethylsilyl-2-propyn-1-ol PubChem CID: 2760416 IUPAC Name: 1-phenyl-3-trimethylsilylprop-2-yn-1-ol SMILES: C[Si](C)(C)C#CC(C1=CC=CC=C1)O
| PubChem CID | 2760416 |
|---|---|
| CAS | 89530-34-7 |
| Molecular Weight (g/mol) | 204.344 |
| MDL Number | MFCD05864336 |
| SMILES | C[Si](C)(C)C#CC(C1=CC=CC=C1)O |
| Synonym | 1-phenyl-3-trimethylsilyl-2-propyn-1-ol,1-phenyl-3-trimethylsilyl prop-2-yn-1-ol,benzenemethanol, a-2-trimethylsilyl ethynyl,acmc-20ln8h,alpha-trimethylsilyl ethynylbenzyl alcohol,4,4-dimethyl-1-phenyl-4-silapent-2-yn-1-ol,alpha-trimethylsilyl ethynyl-benzenemethanol,alpha-trimethylsilyl-ethynyl-benzenemethanol,alpha-trimethylsilyl ethynyl-benzene-methanol,1-phenyl-3-1,1,1-trimethylsilyl-2-propyn-1-ol |
| IUPAC Name | 1-phenyl-3-trimethylsilylprop-2-yn-1-ol |
| InChI Key | RVTDALNDYLDVMN-UHFFFAOYSA-N |
| Molecular Formula | C12H16OSi |
Triphenylsilane, 97%
CAS: 789-25-3 Molecular Formula: C18H15Si Molecular Weight (g/mol): 259.403 MDL Number: MFCD00003003 InChI Key: BZLZKLMROPIZSR-UHFFFAOYSA-N Synonym: triphenylsilane,benzene, 1,1',1-silylidynetris,triphenylsilyl,tri phenyl silicon,triphenylsilyl radical,triphenylsilane 5g,1,1 inverted exclamation marka,1 inverted exclamation marka inverted exclamation marka-silylidynetrisbenzene; nsc 12565; triphenylhydrosilane PubChem CID: 6327682 IUPAC Name: triphenylsilicon SMILES: C1=CC=C(C=C1)[Si](C2=CC=CC=C2)C3=CC=CC=C3
| PubChem CID | 6327682 |
|---|---|
| CAS | 789-25-3 |
| Molecular Weight (g/mol) | 259.403 |
| MDL Number | MFCD00003003 |
| SMILES | C1=CC=C(C=C1)[Si](C2=CC=CC=C2)C3=CC=CC=C3 |
| Synonym | triphenylsilane,benzene, 1,1',1-silylidynetris,triphenylsilyl,tri phenyl silicon,triphenylsilyl radical,triphenylsilane 5g,1,1 inverted exclamation marka,1 inverted exclamation marka inverted exclamation marka-silylidynetrisbenzene; nsc 12565; triphenylhydrosilane |
| IUPAC Name | triphenylsilicon |
| InChI Key | BZLZKLMROPIZSR-UHFFFAOYSA-N |
| Molecular Formula | C18H15Si |
4-(Trimethylsilyl)diphenylacetylene, 99%
CAS: 136459-72-8 Molecular Formula: C17H18Si Molecular Weight (g/mol): 250.416 MDL Number: MFCD09953470 InChI Key: UZRJWRFLYPENFH-UHFFFAOYSA-N Synonym: 4-trimethylsilyl diphenylacetylene,trimethyl 4-phenylethynyl phenyl silane,trimethyl 4-2-phenylethynyl phenyl silane,acmc-20ajdj,4-phenylethynyl phenyltrimethylsilane,trimethyl-4-2-phenylethynyl phenyl silane,1-2-phenylethynyl-4-trimethylsilyl benzene,1-phenyl-2-p-trimethylsilyl phenyl acetylene PubChem CID: 21093331 IUPAC Name: trimethyl-[4-(2-phenylethynyl)phenyl]silane SMILES: C[Si](C)(C)C1=CC=C(C=C1)C#CC2=CC=CC=C2
| PubChem CID | 21093331 |
|---|---|
| CAS | 136459-72-8 |
| Molecular Weight (g/mol) | 250.416 |
| MDL Number | MFCD09953470 |
| SMILES | C[Si](C)(C)C1=CC=C(C=C1)C#CC2=CC=CC=C2 |
| Synonym | 4-trimethylsilyl diphenylacetylene,trimethyl 4-phenylethynyl phenyl silane,trimethyl 4-2-phenylethynyl phenyl silane,acmc-20ajdj,4-phenylethynyl phenyltrimethylsilane,trimethyl-4-2-phenylethynyl phenyl silane,1-2-phenylethynyl-4-trimethylsilyl benzene,1-phenyl-2-p-trimethylsilyl phenyl acetylene |
| IUPAC Name | trimethyl-[4-(2-phenylethynyl)phenyl]silane |
| InChI Key | UZRJWRFLYPENFH-UHFFFAOYSA-N |
| Molecular Formula | C17H18Si |
Dimethylphenylsilanol sodium salt, 97%
CAS: 7646-75-5 Molecular Formula: C8H11NaOSi Molecular Weight (g/mol): 174.25 MDL Number: MFCD09266151 InChI Key: NPZJKOMUCXNLBN-UHFFFAOYSA-N Synonym: dimethylphenylsilanol sodium salt,sodium dimethyl phenyl silanolate,sodium dimethylphenylsilanolate,amtsi046,sodium phenyldimethylsilanolate,dimethyl phenyl sodiooxy silane,sodium phenyl dimethylsilanolate PubChem CID: 23713317 IUPAC Name: sodium;dimethyl-oxido-phenylsilane SMILES: C[Si](C)(C1=CC=CC=C1)[O-].[Na+]
| PubChem CID | 23713317 |
|---|---|
| CAS | 7646-75-5 |
| Molecular Weight (g/mol) | 174.25 |
| MDL Number | MFCD09266151 |
| SMILES | C[Si](C)(C1=CC=CC=C1)[O-].[Na+] |
| Synonym | dimethylphenylsilanol sodium salt,sodium dimethyl phenyl silanolate,sodium dimethylphenylsilanolate,amtsi046,sodium phenyldimethylsilanolate,dimethyl phenyl sodiooxy silane,sodium phenyl dimethylsilanolate |
| IUPAC Name | sodium;dimethyl-oxido-phenylsilane |
| InChI Key | NPZJKOMUCXNLBN-UHFFFAOYSA-N |
| Molecular Formula | C8H11NaOSi |
Phenyltrichlorosilane, 97%
CAS: 98-13-5 Molecular Formula: C6H5Cl3Si Molecular Weight (g/mol): 211.541 MDL Number: MFCD00000479 InChI Key: ORVMIVQULIKXCP-UHFFFAOYSA-N Synonym: trichloro phenyl silane,phenyltrichlorosilane,silane, trichlorophenyl,phenyl trichlorosilane,phenylsilicon trichloride,silane, phenyltrichloro,silicon phenyl trichloride,benzene, trichlorosilyl,unii-m7199jl06m,phenyl-trichloro-silane PubChem CID: 7372 IUPAC Name: trichloro(phenyl)silane SMILES: C1=CC=C(C=C1)[Si](Cl)(Cl)Cl
| PubChem CID | 7372 |
|---|---|
| CAS | 98-13-5 |
| Molecular Weight (g/mol) | 211.541 |
| MDL Number | MFCD00000479 |
| SMILES | C1=CC=C(C=C1)[Si](Cl)(Cl)Cl |
| Synonym | trichloro phenyl silane,phenyltrichlorosilane,silane, trichlorophenyl,phenyl trichlorosilane,phenylsilicon trichloride,silane, phenyltrichloro,silicon phenyl trichloride,benzene, trichlorosilyl,unii-m7199jl06m,phenyl-trichloro-silane |
| IUPAC Name | trichloro(phenyl)silane |
| InChI Key | ORVMIVQULIKXCP-UHFFFAOYSA-N |
| Molecular Formula | C6H5Cl3Si |
3,5-Bis(trifluoromethyl)phenyldimethylchlorosilane, 95%
CAS: 732306-23-9 Molecular Formula: C10H9ClF6Si Molecular Weight (g/mol): 306.707 MDL Number: MFCD01862186 InChI Key: JZWDIKPZWMXPMG-UHFFFAOYSA-N Synonym: 3,5-bis trifluoromethyl phenyldimethylchlorosilane,3,5-bis trifluoromethyl phenyl chloro dimethylsilane,3,5-bis trifluoromethyl phenyl chloro dimethyl silane,3,5-bis trifluoromethyl phenyl-chloro-dimethylsilane,3,5-bis trifluoromethyl phenyl dimethylsilyl chloride,benzene,1-chlorodimethylsilyl-3,5-bis trifluoromethyl PubChem CID: 2783240 IUPAC Name: [3,5-bis(trifluoromethyl)phenyl]-chloro-dimethylsilane SMILES: C[Si](C)(C1=CC(=CC(=C1)C(F)(F)F)C(F)(F)F)Cl
| PubChem CID | 2783240 |
|---|---|
| CAS | 732306-23-9 |
| Molecular Weight (g/mol) | 306.707 |
| MDL Number | MFCD01862186 |
| SMILES | C[Si](C)(C1=CC(=CC(=C1)C(F)(F)F)C(F)(F)F)Cl |
| Synonym | 3,5-bis trifluoromethyl phenyldimethylchlorosilane,3,5-bis trifluoromethyl phenyl chloro dimethylsilane,3,5-bis trifluoromethyl phenyl chloro dimethyl silane,3,5-bis trifluoromethyl phenyl-chloro-dimethylsilane,3,5-bis trifluoromethyl phenyl dimethylsilyl chloride,benzene,1-chlorodimethylsilyl-3,5-bis trifluoromethyl |
| IUPAC Name | [3,5-bis(trifluoromethyl)phenyl]-chloro-dimethylsilane |
| InChI Key | JZWDIKPZWMXPMG-UHFFFAOYSA-N |
| Molecular Formula | C10H9ClF6Si |
3,5-Bis(trifluoromethyl)phenyldimethylsilane, 95%
CAS: 33558-36-0 Molecular Formula: C10H9F6Si Molecular Weight (g/mol): 271.257 MDL Number: MFCD02093948 InChI Key: HJQABLGRCWBCDT-UHFFFAOYSA-N Synonym: 3,5-bis trifluoromethyl phenyl dimethylsilane,3,5-bis trifluoromethyl phenyl-dimethyl-silicon,3,5-bis-trifluoromethyl phenyldimethylsilane,3,5-bis trifluoromethyl phenyl-dimethylsilicon,3,5-bis trifluoromethyl phenyldimethylsilane PubChem CID: 11219490 IUPAC Name: [3,5-bis(trifluoromethyl)phenyl]-dimethylsilicon SMILES: C[Si](C)C1=CC(=CC(=C1)C(F)(F)F)C(F)(F)F
| PubChem CID | 11219490 |
|---|---|
| CAS | 33558-36-0 |
| Molecular Weight (g/mol) | 271.257 |
| MDL Number | MFCD02093948 |
| SMILES | C[Si](C)C1=CC(=CC(=C1)C(F)(F)F)C(F)(F)F |
| Synonym | 3,5-bis trifluoromethyl phenyl dimethylsilane,3,5-bis trifluoromethyl phenyl-dimethyl-silicon,3,5-bis-trifluoromethyl phenyldimethylsilane,3,5-bis trifluoromethyl phenyl-dimethylsilicon,3,5-bis trifluoromethyl phenyldimethylsilane |
| IUPAC Name | [3,5-bis(trifluoromethyl)phenyl]-dimethylsilicon |
| InChI Key | HJQABLGRCWBCDT-UHFFFAOYSA-N |
| Molecular Formula | C10H9F6Si |
1,4-Bis[(trimethylsilyl)ethynyl]benzene, 98%
CAS: 17938-13-5 Molecular Formula: C16H22Si2 Molecular Weight (g/mol): 270.522 MDL Number: MFCD00135433 InChI Key: CMTMWEXUJQSPCA-UHFFFAOYSA-N Synonym: 1,4-bis trimethylsilyl ethynyl benzene,1,4-bis trimethylsilylethynyl benzene,1,4-bis 2-trimethylsilyl ethynyl benzene,trimethyl-2-4-2-trimethylsilylethynyl phenyl ethynyl silane,trimethyl 2-4-2-trimethylsilyl ethynyl phenyl ethynyl silane,acmc-20ap2w,trimethyl 4-trimethylsilyl ethynyl phenyl ethynyl silane,benzene,1,4-bis 2-trimethylsilyl ethynyl PubChem CID: 522492 IUPAC Name: trimethyl-[2-[4-(2-trimethylsilylethynyl)phenyl]ethynyl]silane SMILES: C[Si](C)(C)C#CC1=CC=C(C=C1)C#C[Si](C)(C)C
| PubChem CID | 522492 |
|---|---|
| CAS | 17938-13-5 |
| Molecular Weight (g/mol) | 270.522 |
| MDL Number | MFCD00135433 |
| SMILES | C[Si](C)(C)C#CC1=CC=C(C=C1)C#C[Si](C)(C)C |
| Synonym | 1,4-bis trimethylsilyl ethynyl benzene,1,4-bis trimethylsilylethynyl benzene,1,4-bis 2-trimethylsilyl ethynyl benzene,trimethyl-2-4-2-trimethylsilylethynyl phenyl ethynyl silane,trimethyl 2-4-2-trimethylsilyl ethynyl phenyl ethynyl silane,acmc-20ap2w,trimethyl 4-trimethylsilyl ethynyl phenyl ethynyl silane,benzene,1,4-bis 2-trimethylsilyl ethynyl |
| IUPAC Name | trimethyl-[2-[4-(2-trimethylsilylethynyl)phenyl]ethynyl]silane |
| InChI Key | CMTMWEXUJQSPCA-UHFFFAOYSA-N |
| Molecular Formula | C16H22Si2 |
Phenyltrimethylsilane, 98%
CAS: 768-32-1 Molecular Formula: C9H14Si Molecular Weight (g/mol): 150.30 MDL Number: MFCD00008271 InChI Key: KXFSUVJPEQYUGN-UHFFFAOYSA-N Synonym: phenyltrimethylsilane,trimethyl phenyl silane,silane, trimethylphenyl,trimethylsilyl benzene,unii-px1sg1q5yp,benzene, trimethylsilyl,silane, trimethyl phenyl,px1sg1q5yp,phenyl trimethylsilane,trimethyl-phenylsilane PubChem CID: 69849 IUPAC Name: trimethyl(phenyl)silane SMILES: C[Si](C)(C)C1=CC=CC=C1
| PubChem CID | 69849 |
|---|---|
| CAS | 768-32-1 |
| Molecular Weight (g/mol) | 150.30 |
| MDL Number | MFCD00008271 |
| SMILES | C[Si](C)(C)C1=CC=CC=C1 |
| Synonym | phenyltrimethylsilane,trimethyl phenyl silane,silane, trimethylphenyl,trimethylsilyl benzene,unii-px1sg1q5yp,benzene, trimethylsilyl,silane, trimethyl phenyl,px1sg1q5yp,phenyl trimethylsilane,trimethyl-phenylsilane |
| IUPAC Name | trimethyl(phenyl)silane |
| InChI Key | KXFSUVJPEQYUGN-UHFFFAOYSA-N |
| Molecular Formula | C9H14Si |
Phenyltrimethoxysilane, 97%
CAS: 2996-92-1 Molecular Formula: C9H14O3Si Molecular Weight (g/mol): 198.29 MDL Number: MFCD00025689 InChI Key: ZNOCGWVLWPVKAO-UHFFFAOYSA-N Synonym: phenyltrimethoxysilane,trimethoxy phenyl silane,silane, trimethoxyphenyl,silane, phenyltrimethoxy,unii-21tqe746s9,trimethoxysilyl benzene,benzene, trimethoxysilyl,phenyl trimethoxysilane,phenyl trimethoxy silane,phenyltri methoxy silane PubChem CID: 18137 IUPAC Name: trimethoxy(phenyl)silane SMILES: CO[Si](OC)(OC)C1=CC=CC=C1
| PubChem CID | 18137 |
|---|---|
| CAS | 2996-92-1 |
| Molecular Weight (g/mol) | 198.29 |
| MDL Number | MFCD00025689 |
| SMILES | CO[Si](OC)(OC)C1=CC=CC=C1 |
| Synonym | phenyltrimethoxysilane,trimethoxy phenyl silane,silane, trimethoxyphenyl,silane, phenyltrimethoxy,unii-21tqe746s9,trimethoxysilyl benzene,benzene, trimethoxysilyl,phenyl trimethoxysilane,phenyl trimethoxy silane,phenyltri methoxy silane |
| IUPAC Name | trimethoxy(phenyl)silane |
| InChI Key | ZNOCGWVLWPVKAO-UHFFFAOYSA-N |
| Molecular Formula | C9H14O3Si |
Dimethylphenylsilane, 97%
CAS: 766-77-8 Molecular Formula: C8H11Si Molecular Weight (g/mol): 135.261 MDL Number: MFCD00008257 InChI Key: OIKHZBFJHONJJB-UHFFFAOYSA-N Synonym: dimethylphenylsilane,dimethyl phenyl silane,phenyldimethylsilane,silane, dimethylphenyl,benzene, dimethylsilyl,dimethylphenyl silane,c8h12si,dimethyl phenyl silyl,dimethyl-phenylsilicon PubChem CID: 6327656 IUPAC Name: dimethyl(phenyl)silicon SMILES: C[Si](C)C1=CC=CC=C1
| PubChem CID | 6327656 |
|---|---|
| CAS | 766-77-8 |
| Molecular Weight (g/mol) | 135.261 |
| MDL Number | MFCD00008257 |
| SMILES | C[Si](C)C1=CC=CC=C1 |
| Synonym | dimethylphenylsilane,dimethyl phenyl silane,phenyldimethylsilane,silane, dimethylphenyl,benzene, dimethylsilyl,dimethylphenyl silane,c8h12si,dimethyl phenyl silyl,dimethyl-phenylsilicon |
| IUPAC Name | dimethyl(phenyl)silicon |
| InChI Key | OIKHZBFJHONJJB-UHFFFAOYSA-N |
| Molecular Formula | C8H11Si |