Metalloid Salts
Filtered Search Results
Antimony trichloride, ACS reagent
CAS: 10025-91-9 Molecular Formula: Cl3Sb Molecular Weight (g/mol): 228.11 MDL Number: MFCD00011212 InChI Key: FAPDDOBMIUGHIN-UHFFFAOYSA-K Synonym: antimony trichloride,trichlorostibine,antimony chloride,antimony iii chloride,stibine, trichloro,antimontrichlorid,antimonous chloride,butter of antimony,antimony butter,caustic antimony PubChem CID: 24814 ChEBI: CHEBI:74856 SMILES: [Cl-].[Cl-].[Cl-].[Sb+3]
| PubChem CID | 24814 |
|---|---|
| CAS | 10025-91-9 |
| Molecular Weight (g/mol) | 228.11 |
| ChEBI | CHEBI:74856 |
| MDL Number | MFCD00011212 |
| SMILES | [Cl-].[Cl-].[Cl-].[Sb+3] |
| Synonym | antimony trichloride,trichlorostibine,antimony chloride,antimony iii chloride,stibine, trichloro,antimontrichlorid,antimonous chloride,butter of antimony,antimony butter,caustic antimony |
| InChI Key | FAPDDOBMIUGHIN-UHFFFAOYSA-K |
| Molecular Formula | Cl3Sb |
Sodium tetraborate decahydrate, 99.5+%, ACS reagent
CAS: 1303-96-4 Molecular Formula: B4Na2O7·10H2O Molecular Weight (g/mol): 381.36 MDL Number: MFCD00149193 Synonym: Borax,Sodium borate decahydrate
| CAS | 1303-96-4 |
|---|---|
| Molecular Weight (g/mol) | 381.36 |
| MDL Number | MFCD00149193 |
| Synonym | Borax,Sodium borate decahydrate |
| Molecular Formula | B4Na2O7·10H2O |
Boron trifluoride, 12% (1.5M) in methanol
Boron trifluoride, 12% (1.5M) in methanol, Quantity: 500g, Packaging: Glass bottle, Boiling Point: 65.0 deg.C, CAS: 373-57-9, 67-56-1, Amber to Colorless, Melting Point: -98.0 deg.C, Molecular Formula: BF3, Molecular Weight: 67.81, Percent Purity: 10 to 15% (w/v BF3) | CAS: 373-57-9 | BF3 | 67.81 g/mol
| Linear Formula | BF3 |
|---|---|
| Molecular Weight (g/mol) | 67.81 |
| InChI Key | WTEOIRVLGSZEPR-UHFFFAOYSA-N |
| Density | 0.8700g/mL |
| PubChem CID | 11062313 |
| Name Note | 1.5M solution in methanol |
| Percent Purity | 10 to 15% (w/v BF3) |
| RTECS Number | ED2275000 |
| Formula Weight | 67.81 |
| Melting Point | -98.0°C |
| Boiling Point | 65.0°C |
| Color | Amber to Colorless |
| Physical Form | Solution |
| Chemical Name or Material | Boron trifluoride |
| SMILES | FB(F)F |
| Merck Index | 14, 1349 |
| CAS | 67-56-1 |
| Health Hazard 3 | GHS P Statement IF IN EYES: Rinse cautiously with water for several minutes. Remove contact lenses,if present and easy to do. Continue rinsing. Immediately call a POISON CENTER or doctor/physician. Wear protective gloves/protective |
| MDL Number | MFCD00011316 |
| Health Hazard 2 | GHS H Statement Highly flammable liquid and vapor. Causes severe skin burns and eye damage. Fatal if inhaled. Toxic if swallowed. Reacts violently with water. Toxic in contact with skin. Causes damage to organs |
| Packaging | Glass bottle |
| Solubility Information | Solubility in water: may decompose |
| Flash Point | 4°C |
| Health Hazard 1 | GHS Signal Word: Danger |
| Synonym | boron trifluoride-methanol solution,boron trifluoride-methanol complex,boron trifluoride methanol,boron trifluoride-methanol solution in methanol,bf3 methanol,.bf3 in methanol,boron fluoride methanol,bf3 meoh,borontrifluoride methanol,boron trifluoride solution |
| TSCA | TSCA |
| Molecular Formula | BF3 |
| EINECS Number | 206-766-4 |
| Specific Gravity | 0.87 |
Tellurium, 99+%, (trace metal basis), powder
CAS: 13494-80-9 Molecular Formula: Te Molecular Weight (g/mol): 127.60 MDL Number: MFCD00134062 InChI Key: PORWMNRCUJJQNO-UHFFFAOYSA-N Synonym: tellurium, elemental,telloy,tellur,aurum paradoxum,element,tellur polish,metallum problematum,tellurium, metallic,unii-nqa0o090zj,and compounds PubChem CID: 6327182 ChEBI: CHEBI:30452 IUPAC Name: tellurium SMILES: [Te]
| PubChem CID | 6327182 |
|---|---|
| CAS | 13494-80-9 |
| Molecular Weight (g/mol) | 127.60 |
| ChEBI | CHEBI:30452 |
| MDL Number | MFCD00134062 |
| SMILES | [Te] |
| Synonym | tellurium, elemental,telloy,tellur,aurum paradoxum,element,tellur polish,metallum problematum,tellurium, metallic,unii-nqa0o090zj,and compounds |
| IUPAC Name | tellurium |
| InChI Key | PORWMNRCUJJQNO-UHFFFAOYSA-N |
| Molecular Formula | Te |
Silicon(IV) oxide, powder, 0.5 micron, 99.9%
CAS: 7631-86-9 Molecular Formula: O2Si Molecular Weight (g/mol): 60.08 MDL Number: MFCD00011232 MFCD00217788 MFCD00163736 MFCD00148266 MFCD00603035 MFCD02100519 MFCD06202255 MFCD07370733 InChI Key: VYPSYNLAJGMNEJ-UHFFFAOYSA-N Synonym: silica,silicon dioxide,quartz,cristobalite,diatomaceous earth,tridymite,silicic anhydride,aerosil,infusorial earth,silica, amorphous PubChem CID: 24261 ChEBI: CHEBI:30563 IUPAC Name: dioxosilane SMILES: O=[Si]=O
| PubChem CID | 24261 |
|---|---|
| CAS | 7631-86-9 |
| Molecular Weight (g/mol) | 60.08 |
| ChEBI | CHEBI:30563 |
| MDL Number | MFCD00011232 MFCD00217788 MFCD00163736 MFCD00148266 MFCD00603035 MFCD02100519 MFCD06202255 MFCD07370733 |
| SMILES | O=[Si]=O |
| Synonym | silica,silicon dioxide,quartz,cristobalite,diatomaceous earth,tridymite,silicic anhydride,aerosil,infusorial earth,silica, amorphous |
| IUPAC Name | dioxosilane |
| InChI Key | VYPSYNLAJGMNEJ-UHFFFAOYSA-N |
| Molecular Formula | O2Si |
Germanium tetrachloride, 99.99%, (trace metal basis)
CAS: 10038-98-9 Molecular Formula: Cl4GeH8 Molecular Weight (g/mol): 222.49 MDL Number: MFCD00011029 InChI Key: VDHBHZZBEGQJRK-UHFFFAOYSA-N Synonym: germanium tetrachloride,germanium chloride,germane, tetrachloro,germanium iv chloride,germanium, tetrachloro,gecl4,germanium chloride gecl4,unii-ysv1r803c0,wln: .ge..g4,germanium chloride gecl4 8ci PubChem CID: 66226 SMILES: Cl.Cl.Cl.Cl.[GeH4]
| PubChem CID | 66226 |
|---|---|
| CAS | 10038-98-9 |
| Molecular Weight (g/mol) | 222.49 |
| MDL Number | MFCD00011029 |
| SMILES | Cl.Cl.Cl.Cl.[GeH4] |
| Synonym | germanium tetrachloride,germanium chloride,germane, tetrachloro,germanium iv chloride,germanium, tetrachloro,gecl4,germanium chloride gecl4,unii-ysv1r803c0,wln: .ge..g4,germanium chloride gecl4 8ci |
| InChI Key | VDHBHZZBEGQJRK-UHFFFAOYSA-N |
| Molecular Formula | Cl4GeH8 |
Selenium, 99+%, powder
CAS: 7782-49-2 Molecular Formula: Se Molecular Weight (g/mol): 78.97 MDL Number: MFCD00134090 MFCD00011224 InChI Key: BUGBHKTXTAQXES-UHFFFAOYSA-N Synonym: selenium, elemental,selen,hydride,atom,elemental,selenio,vandex,alloy,and compounds,gray PubChem CID: 6326970 ChEBI: CHEBI:27568 IUPAC Name: selenium SMILES: [Se]
| PubChem CID | 6326970 |
|---|---|
| CAS | 7782-49-2 |
| Molecular Weight (g/mol) | 78.97 |
| ChEBI | CHEBI:27568 |
| MDL Number | MFCD00134090 MFCD00011224 |
| SMILES | [Se] |
| Synonym | selenium, elemental,selen,hydride,atom,elemental,selenio,vandex,alloy,and compounds,gray |
| IUPAC Name | selenium |
| InChI Key | BUGBHKTXTAQXES-UHFFFAOYSA-N |
| Molecular Formula | Se |
1H,1H,2H,2H-Perfluorooctyltrichlorosilane, 97%
CAS: 78560-45-9 Molecular Formula: C8H4Cl3F13Si Molecular Weight (g/mol): 481.534 MDL Number: MFCD00042363 InChI Key: PISDRBMXQBSCIP-UHFFFAOYSA-N Synonym: trichloro 3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl silane,1h,1h,2h,2h-perfluorooctyltrichlorosilane,silane, trichloro 3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl,tridecafluoro-1,1,2,2-tetrahydrooctyl trichlorosilane,trichloro 1h,1h,2h,2h-perfluorooctyl silane,2-tridecafluorohexyl ethyltrichlorosilane,1h,1h,2h,2h-perfluorooctyl trichlorosilane,trichloro 1h,1h,2h,2h-perfluoro-n-octyl silane,trichloro 1h,1h,2h,2h-tridecafluoro-n-octyl silane PubChem CID: 123578 IUPAC Name: trichloro(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl)silane SMILES: C(C[Si](Cl)(Cl)Cl)C(C(C(C(C(C(F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F
| PubChem CID | 123578 |
|---|---|
| CAS | 78560-45-9 |
| Molecular Weight (g/mol) | 481.534 |
| MDL Number | MFCD00042363 |
| SMILES | C(C[Si](Cl)(Cl)Cl)C(C(C(C(C(C(F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F |
| Synonym | trichloro 3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl silane,1h,1h,2h,2h-perfluorooctyltrichlorosilane,silane, trichloro 3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl,tridecafluoro-1,1,2,2-tetrahydrooctyl trichlorosilane,trichloro 1h,1h,2h,2h-perfluorooctyl silane,2-tridecafluorohexyl ethyltrichlorosilane,1h,1h,2h,2h-perfluorooctyl trichlorosilane,trichloro 1h,1h,2h,2h-perfluoro-n-octyl silane,trichloro 1h,1h,2h,2h-tridecafluoro-n-octyl silane |
| IUPAC Name | trichloro(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl)silane |
| InChI Key | PISDRBMXQBSCIP-UHFFFAOYSA-N |
| Molecular Formula | C8H4Cl3F13Si |
Antimony trichloride, 99.5%
CAS: 10025-91-9 Molecular Formula: Cl3Sb Molecular Weight (g/mol): 228.11 MDL Number: MFCD00011212 InChI Key: FAPDDOBMIUGHIN-UHFFFAOYSA-K Synonym: antimony trichloride,trichlorostibine,antimony chloride,antimony iii chloride,stibine, trichloro,antimontrichlorid,antimonous chloride,butter of antimony,antimony butter,caustic antimony PubChem CID: 24814 ChEBI: CHEBI:74856 SMILES: [Cl-].[Cl-].[Cl-].[Sb+3]
| PubChem CID | 24814 |
|---|---|
| CAS | 10025-91-9 |
| Molecular Weight (g/mol) | 228.11 |
| ChEBI | CHEBI:74856 |
| MDL Number | MFCD00011212 |
| SMILES | [Cl-].[Cl-].[Cl-].[Sb+3] |
| Synonym | antimony trichloride,trichlorostibine,antimony chloride,antimony iii chloride,stibine, trichloro,antimontrichlorid,antimonous chloride,butter of antimony,antimony butter,caustic antimony |
| InChI Key | FAPDDOBMIUGHIN-UHFFFAOYSA-K |
| Molecular Formula | Cl3Sb |
Selenium(IV) oxide, 99.999%, (trace metal basis)
CAS: 7446-08-4 Molecular Formula: O2Se Molecular Weight (g/mol): 110.97 MDL Number: MFCD00003562 InChI Key: JPJALAQPGMAKDF-UHFFFAOYSA-N Synonym: selenium oxide,selenium iv oxide,oxoselane oxide,selenious anhydride,selenium oxide seo2,seleniumdioxide,dimer,selenous acid anhydride,selenium iv dioxide 1:2,selenium oxide se2o4 PubChem CID: 24007 IUPAC Name: selenium dioxide SMILES: O=[Se]=O
| PubChem CID | 24007 |
|---|---|
| CAS | 7446-08-4 |
| Molecular Weight (g/mol) | 110.97 |
| MDL Number | MFCD00003562 |
| SMILES | O=[Se]=O |
| Synonym | selenium oxide,selenium iv oxide,oxoselane oxide,selenious anhydride,selenium oxide seo2,seleniumdioxide,dimer,selenous acid anhydride,selenium iv dioxide 1:2,selenium oxide se2o4 |
| IUPAC Name | selenium dioxide |
| InChI Key | JPJALAQPGMAKDF-UHFFFAOYSA-N |
| Molecular Formula | O2Se |
1H,1H,2H,2H-Perfluorodecyltrichlorosilane, 96%, Thermo Scientific™
CAS: 78560-44-8 Molecular Formula: C10H4Cl3F17Si Molecular Weight (g/mol): 581.55 MDL Number: MFCD00042344 InChI Key: VIFIHLXNOOCGLJ-UHFFFAOYSA-N Synonym: 1h,1h,2h,2h-perfluorodecyltrichlorosilane,trichloro 3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecyl silane,silane, trichloro 3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecyl,1h,1h,2h,2h-perfluorotrichlorosilane,trichloro 1h,1h,2h,2h-perfluorodecyl silane,trichloro 1h,1h,2h,2h-heptadecafluorodecyl silane,1-trichlorosilyl-1h,1h,2h,2h-heptadecafluorodecane,1h,1h,2h,2h-perfluorodecyltrichlorosilane 1g,heptadecafluoro-1,1,2,2-tetrahydrodecyl trichlorosilane,heptadecafluoro-1,1,2,2-tetrahydrodecyl-1-trichlorosilane PubChem CID: 123577 IUPAC Name: trichloro(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecyl)silane SMILES: FC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)CC[Si](Cl)(Cl)Cl
| PubChem CID | 123577 |
|---|---|
| CAS | 78560-44-8 |
| Molecular Weight (g/mol) | 581.55 |
| MDL Number | MFCD00042344 |
| SMILES | FC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)CC[Si](Cl)(Cl)Cl |
| Synonym | 1h,1h,2h,2h-perfluorodecyltrichlorosilane,trichloro 3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecyl silane,silane, trichloro 3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecyl,1h,1h,2h,2h-perfluorotrichlorosilane,trichloro 1h,1h,2h,2h-perfluorodecyl silane,trichloro 1h,1h,2h,2h-heptadecafluorodecyl silane,1-trichlorosilyl-1h,1h,2h,2h-heptadecafluorodecane,1h,1h,2h,2h-perfluorodecyltrichlorosilane 1g,heptadecafluoro-1,1,2,2-tetrahydrodecyl trichlorosilane,heptadecafluoro-1,1,2,2-tetrahydrodecyl-1-trichlorosilane |
| IUPAC Name | trichloro(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecyl)silane |
| InChI Key | VIFIHLXNOOCGLJ-UHFFFAOYSA-N |
| Molecular Formula | C10H4Cl3F17Si |