Hydroxybenzoic Acid Derivatives
Filtered Search Results
3-Chloroperoxybenzoic Acid, 70-75%, balance 3-Chlorobenzoic Acid and water
3-Chloroperoxybenzoic acid, 70-75%, C7H5ClO3, CAS Number-937-14-4, 535-80-8, 7732-18-5 | CAS: 937-14-4 | C7H5ClO3 | 172.56 g/mol
| Linear Formula | ClC6H4CO3H |
|---|---|
| Molecular Weight (g/mol) | 172.56 |
| ChEBI | CHEBI:52091 |
| CAS Min % | 25.0 |
| InChI Key | NHQDETIJWKXCTC-UHFFFAOYSA-N |
| Density | 0.5600g/mL |
| PubChem CID | 70297 |
| Name Note | 70 - 75% |
| Percent Purity | 70-75% |
| Fieser | 01,135; 02,68; 03,49; 04,85; 05,120; 06,110; 07,62; 08,97; 09,108; 10,92; 11,122; 12,118; 13,76; 15,86; 16,80; 17,76 |
| RTECS Number | SD9470000 |
| Formula Weight | 172.57 |
| Melting Point | 92.0°C to 94.0°C |
| CAS Max % | 30.0 |
| Color | White |
| Physical Form | Moist Powder |
| SMILES | OOC(=O)C1=CC=CC(Cl)=C1 |
| Merck Index | 15,2154 |
| Assay Percent Range | di-m-Chlorobenzoyl peroxide: < 0.1% Typical (HPLC) |
| CAS | 7732-18-5 |
| Health Hazard 3 | GHS P Statement Wear protective gloves/protective clothing/eye protection/face protection. Keep away from heat/sparks/open flames/hot surfaces. - No smoking. Keep/Store away from clothing/ combustible materials. IF SWALLOWED: rin |
| MDL Number | MFCD00002127 |
| Health Hazard 2 | GHS H Statement Causes severe skin burns and eye damage. Harmful if swallowed. Heating may cause a fire. |
| Solubility Information | Solubility in water: insoluble. Other solubilities: soluble in koh, soluble in chloroform and acetone |
| Health Hazard 1 | GHS Signal Word: Danger |
| Synonym | 3-chloroperoxybenzoic acid,3-chloroperbenzoic acid,mcpba,m-chloroperbenzoic acid,m-chloroperoxybenzoic acid,meta-chloroperoxybenzoic acid,benzenecarboperoxoic acid, 3-chloro,m-chlorobenzoyl hydroperoxide,meta-chloroperbenzoic acid,3-chlorobenzoperoxoic acid |
| TSCA | TSCA |
| IUPAC Name | 3-chlorobenzenecarboperoxoic acid |
| Beilstein | 09,IV,972 |
| Molecular Formula | C7H5ClO3 |
| EINECS Number | 213-322-3 |
| Specific Gravity | 0.56 |
3,3',4',5-Tetrachlorosalicylanilide, 97%
CAS: 1154-59-2 Molecular Formula: C13H7Cl4NO2 Molecular Weight (g/mol): 351.01 MDL Number: MFCD00041745 InChI Key: SJQBHPJLLIJASD-UHFFFAOYSA-N Synonym: tcsa,3,3',4',5-tetrachlorosalicylanilide,3,5-dichloro-n-3,4-dichlorophenyl-2-hydroxybenzamide,3,5,3',4'-tetrachlorosalicylanilide,irgasan bs-200,3,5-dichlorosalicyl 3,4-dichloroanilide,caswell no. 833,3,5-dichlorosalicyl-3,4-dichloroanilide,benzamide, 3,5-dichloro-n-3,4-dichlorophenyl-2-hydroxy,unii-hne676755i PubChem CID: 14385 ChEBI: CHEBI:188648 IUPAC Name: 3,5-dichloro-N-(3,4-dichlorophenyl)-2-hydroxybenzamide SMILES: C1=CC(=C(C=C1NC(=O)C2=CC(=CC(=C2O)Cl)Cl)Cl)Cl
| PubChem CID | 14385 |
|---|---|
| CAS | 1154-59-2 |
| Molecular Weight (g/mol) | 351.01 |
| ChEBI | CHEBI:188648 |
| MDL Number | MFCD00041745 |
| SMILES | C1=CC(=C(C=C1NC(=O)C2=CC(=CC(=C2O)Cl)Cl)Cl)Cl |
| Synonym | tcsa,3,3',4',5-tetrachlorosalicylanilide,3,5-dichloro-n-3,4-dichlorophenyl-2-hydroxybenzamide,3,5,3',4'-tetrachlorosalicylanilide,irgasan bs-200,3,5-dichlorosalicyl 3,4-dichloroanilide,caswell no. 833,3,5-dichlorosalicyl-3,4-dichloroanilide,benzamide, 3,5-dichloro-n-3,4-dichlorophenyl-2-hydroxy,unii-hne676755i |
| IUPAC Name | 3,5-dichloro-N-(3,4-dichlorophenyl)-2-hydroxybenzamide |
| InChI Key | SJQBHPJLLIJASD-UHFFFAOYSA-N |
| Molecular Formula | C13H7Cl4NO2 |
4-chlorosalicylic acid, 98%
CAS: 5106-98-9 Molecular Formula: C7H5ClO3 Molecular Weight (g/mol): 172.56 MDL Number: MFCD00002449 InChI Key: LWXFCZXRFBUOOR-UHFFFAOYSA-N Synonym: 4-chlorosalicylic acid,4-chloro salicylic acid,benzoic acid, 4-chloro-2-hydroxy,2-hydroxy-4-chlorobenzoic acid,4-chloro-2-hydroxy benzoic acid,4-chloro-2-hydroxy-benzoic acid,salicylic acid, 4-chloro,4-chlorosalicylicacid,pubchem3845,4-chloro-salicylic acid PubChem CID: 78782 IUPAC Name: 4-chloro-2-hydroxybenzoic acid SMILES: OC(=O)C1=CC=C(Cl)C=C1O
| PubChem CID | 78782 |
|---|---|
| CAS | 5106-98-9 |
| Molecular Weight (g/mol) | 172.56 |
| MDL Number | MFCD00002449 |
| SMILES | OC(=O)C1=CC=C(Cl)C=C1O |
| Synonym | 4-chlorosalicylic acid,4-chloro salicylic acid,benzoic acid, 4-chloro-2-hydroxy,2-hydroxy-4-chlorobenzoic acid,4-chloro-2-hydroxy benzoic acid,4-chloro-2-hydroxy-benzoic acid,salicylic acid, 4-chloro,4-chlorosalicylicacid,pubchem3845,4-chloro-salicylic acid |
| IUPAC Name | 4-chloro-2-hydroxybenzoic acid |
| InChI Key | LWXFCZXRFBUOOR-UHFFFAOYSA-N |
| Molecular Formula | C7H5ClO3 |