Filtered Search Results
Tris(dibenzylideneacetone)dipalladium(0), 97%
CAS: 51364-51-3 Molecular Formula: C51H42O3Pd2 Molecular Weight (g/mol): 915.73 MDL Number: MFCD00013310 InChI Key: CYPYTURSJDMMMP-UHFFFAOYSA-N Synonym: tris dibenzylideneacetone dipalladium 0,tris dibenzylideneacetone dipalladium,pd2 dba 3,tris dibezylideneacetone dipalladium,tris dibenzylideneacetone dipalladium o,tris dibenzylideneacetonyl bis-palladium,tris dba,tris 1e,4e-1,5-diphenylpenta-1,4-dien-3-one dipalladium PubChem CID: 9811564 IUPAC Name: (1E,4E)-1,5-diphenylpenta-1,4-dien-3-one;palladium SMILES: [Pd].[Pd].O=C(C=CC1=CC=CC=C1)C=CC1=CC=CC=C1.O=C(C=CC1=CC=CC=C1)C=CC1=CC=CC=C1.O=C(C=CC1=CC=CC=C1)C=CC1=CC=CC=C1
| PubChem CID | 9811564 |
|---|---|
| CAS | 51364-51-3 |
| Molecular Weight (g/mol) | 915.73 |
| MDL Number | MFCD00013310 |
| SMILES | [Pd].[Pd].O=C(C=CC1=CC=CC=C1)C=CC1=CC=CC=C1.O=C(C=CC1=CC=CC=C1)C=CC1=CC=CC=C1.O=C(C=CC1=CC=CC=C1)C=CC1=CC=CC=C1 |
| Synonym | tris dibenzylideneacetone dipalladium 0,tris dibenzylideneacetone dipalladium,pd2 dba 3,tris dibezylideneacetone dipalladium,tris dibenzylideneacetone dipalladium o,tris dibenzylideneacetonyl bis-palladium,tris dba,tris 1e,4e-1,5-diphenylpenta-1,4-dien-3-one dipalladium |
| IUPAC Name | (1E,4E)-1,5-diphenylpenta-1,4-dien-3-one;palladium |
| InChI Key | CYPYTURSJDMMMP-UHFFFAOYSA-N |
| Molecular Formula | C51H42O3Pd2 |
Palladium wire, 0.5mm (0.02in) dia, Premion™, 99.99+% (metals basis)
CAS: 5-3-7440 Molecular Formula: Pd Molecular Weight (g/mol): 106.42 MDL Number: MFCD00011167 MFCD03457879 MFCD03427452 MFCD03613602 MFCD03613603 MFCD03613604 MFCD03613605 MFCD06798745 InChI Key: KDLHZDBZIXYQEI-UHFFFAOYSA-N Synonym: black,on carbon,paladio,palladium/carbon,element,charcoal,palladium, element,palladex 600,on charcoal,palladium-activated carbon PubChem CID: 23938 ChEBI: CHEBI:33363 IUPAC Name: palladium SMILES: [Pd]
| PubChem CID | 23938 |
|---|---|
| CAS | 5-3-7440 |
| Molecular Weight (g/mol) | 106.42 |
| ChEBI | CHEBI:33363 |
| MDL Number | MFCD00011167 MFCD03457879 MFCD03427452 MFCD03613602 MFCD03613603 MFCD03613604 MFCD03613605 MFCD06798745 |
| SMILES | [Pd] |
| Synonym | black,on carbon,paladio,palladium/carbon,element,charcoal,palladium, element,palladex 600,on charcoal,palladium-activated carbon |
| IUPAC Name | palladium |
| InChI Key | KDLHZDBZIXYQEI-UHFFFAOYSA-N |
| Molecular Formula | Pd |
Tetrakis(triphenylphosphine)palladium(0), 99%
CAS: 14221-01-3 Molecular Formula: C72H60P4Pd Molecular Weight (g/mol): 1155.59 MDL Number: MFCD00010012 InChI Key: NFHFRUOZVGFOOS-UHFFFAOYSA-N Synonym: tetrakis triphenylphosphine palladium,tetrakis triphenylphosphine palladium 0,pd pph3 4,tetrakis triphenylphosphine palladium o,tetra triphenylphosphine palladium,palladium-tetrakis triphenylphosphine,palladium 0 tetrakis triphenylphosphine,palladium, tetrakis triphenylphosphine-, t-4 PubChem CID: 11979704 IUPAC Name: palladium;triphenylphosphane SMILES: [Pd].C1=CC=C(C=C1)P(C1=CC=CC=C1)C1=CC=CC=C1.C1=CC=C(C=C1)P(C1=CC=CC=C1)C1=CC=CC=C1.C1=CC=C(C=C1)P(C1=CC=CC=C1)C1=CC=CC=C1.C1=CC=C(C=C1)P(C1=CC=CC=C1)C1=CC=CC=C1
| PubChem CID | 11979704 |
|---|---|
| CAS | 14221-01-3 |
| Molecular Weight (g/mol) | 1155.59 |
| MDL Number | MFCD00010012 |
| SMILES | [Pd].C1=CC=C(C=C1)P(C1=CC=CC=C1)C1=CC=CC=C1.C1=CC=C(C=C1)P(C1=CC=CC=C1)C1=CC=CC=C1.C1=CC=C(C=C1)P(C1=CC=CC=C1)C1=CC=CC=C1.C1=CC=C(C=C1)P(C1=CC=CC=C1)C1=CC=CC=C1 |
| Synonym | tetrakis triphenylphosphine palladium,tetrakis triphenylphosphine palladium 0,pd pph3 4,tetrakis triphenylphosphine palladium o,tetra triphenylphosphine palladium,palladium-tetrakis triphenylphosphine,palladium 0 tetrakis triphenylphosphine,palladium, tetrakis triphenylphosphine-, t-4 |
| IUPAC Name | palladium;triphenylphosphane |
| InChI Key | NFHFRUOZVGFOOS-UHFFFAOYSA-N |
| Molecular Formula | C72H60P4Pd |
Allylpalladium chloride dimer, 98%
CAS: 12012-95-2 Molecular Formula: C6H10Cl2Pd2 Molecular Weight (g/mol): 365.89 MDL Number: MFCD00044874 InChI Key: PENAXHPKEVTBLF-UHFFFAOYSA-L Synonym: allylpalladium chloride dimer,bis allyl dichlorodipalladium,diallyldipalladium dichloride,palladium allyl chloride dimer,diallydichlorodipalladium,pi-allyl palladium chloride,allylpalladium ii chloride,bis chloro-pi-allylpalladium,allyl palladium chloride dimer,bis pi-allyl chloropalladium PubChem CID: 61538 IUPAC Name: chloropalladium(1+);prop-1-ene SMILES: Cl[Pd].Cl[Pd].c:c:c.c:c:c
| PubChem CID | 61538 |
|---|---|
| CAS | 12012-95-2 |
| Molecular Weight (g/mol) | 365.89 |
| MDL Number | MFCD00044874 |
| SMILES | Cl[Pd].Cl[Pd].c:c:c.c:c:c |
| Synonym | allylpalladium chloride dimer,bis allyl dichlorodipalladium,diallyldipalladium dichloride,palladium allyl chloride dimer,diallydichlorodipalladium,pi-allyl palladium chloride,allylpalladium ii chloride,bis chloro-pi-allylpalladium,allyl palladium chloride dimer,bis pi-allyl chloropalladium |
| IUPAC Name | chloropalladium(1+);prop-1-ene |
| InChI Key | PENAXHPKEVTBLF-UHFFFAOYSA-L |
| Molecular Formula | C6H10Cl2Pd2 |
Palladium(II) acetate, 99.9%, (trace metal basis)
CAS: 3375-31-3 Molecular Formula: C4H6O4Pd Molecular Weight (g/mol): 224.51 MDL Number: MFCD00012453 InChI Key: YJVFFLUZDVXJQI-UHFFFAOYSA-L Synonym: palladium ii acetate,palladium diacetate,palladium acetate,diacetoxypalladium,bis acetato palladium,bisacetylpalladium,diacetatopalladium,palladium 2+ acetate,palladous acetate PubChem CID: 167845 IUPAC Name: palladium(2+);diacetate SMILES: [Pd++].CC([O-])=O.CC([O-])=O
| PubChem CID | 167845 |
|---|---|
| CAS | 3375-31-3 |
| Molecular Weight (g/mol) | 224.51 |
| MDL Number | MFCD00012453 |
| SMILES | [Pd++].CC([O-])=O.CC([O-])=O |
| Synonym | palladium ii acetate,palladium diacetate,palladium acetate,diacetoxypalladium,bis acetato palladium,bisacetylpalladium,diacetatopalladium,palladium 2+ acetate,palladous acetate |
| IUPAC Name | palladium(2+);diacetate |
| InChI Key | YJVFFLUZDVXJQI-UHFFFAOYSA-L |
| Molecular Formula | C4H6O4Pd |
Palladium on activated carbon, 10% Pd, unreduced, dry
CAS: 7440-05-3 Molecular Formula: Pd Molecular Weight (g/mol): 106.42 MDL Number: MFCD00011167 MFCD03457879 MFCD03427452 MFCD03613602 MFCD03613603 MFCD03613604 MFCD03613605 MFCD06798745 InChI Key: KDLHZDBZIXYQEI-UHFFFAOYSA-N Synonym: black,on carbon,paladio,palladium/carbon,element,charcoal,palladium, element,palladex 600,on charcoal,palladium-activated carbon PubChem CID: 23938 ChEBI: CHEBI:33363 IUPAC Name: palladium SMILES: [Pd]
| PubChem CID | 23938 |
|---|---|
| CAS | 7440-05-3 |
| Molecular Weight (g/mol) | 106.42 |
| ChEBI | CHEBI:33363 |
| MDL Number | MFCD00011167 MFCD03457879 MFCD03427452 MFCD03613602 MFCD03613603 MFCD03613604 MFCD03613605 MFCD06798745 |
| SMILES | [Pd] |
| Synonym | black,on carbon,paladio,palladium/carbon,element,charcoal,palladium, element,palladex 600,on charcoal,palladium-activated carbon |
| IUPAC Name | palladium |
| InChI Key | KDLHZDBZIXYQEI-UHFFFAOYSA-N |
| Molecular Formula | Pd |
Palladium(II) nitrate hydrate
CAS: 207596-32-5 Molecular Formula: N2O6Pd Molecular Weight (g/mol): 230.43 MDL Number: MFCD00149818 InChI Key: GPNDARIEYHPYAY-UHFFFAOYSA-N Synonym: palladium ii nitrate hydrate,palladium nitrate hydrate,palladium 2+ hydrate dinitrate,acmc-1bnae,palladous nitrate hydrate,palladium dinitrate hydrate,2no3.pd.h2o,ksc492s0r,palladium ii nitrate,hydrate,palladium,diaquabis nitrato-o-9ci PubChem CID: 16211503 SMILES: [Pd++].[O-][N+]([O-])=O.[O-][N+]([O-])=O
| PubChem CID | 16211503 |
|---|---|
| CAS | 207596-32-5 |
| Molecular Weight (g/mol) | 230.43 |
| MDL Number | MFCD00149818 |
| SMILES | [Pd++].[O-][N+]([O-])=O.[O-][N+]([O-])=O |
| Synonym | palladium ii nitrate hydrate,palladium nitrate hydrate,palladium 2+ hydrate dinitrate,acmc-1bnae,palladous nitrate hydrate,palladium dinitrate hydrate,2no3.pd.h2o,ksc492s0r,palladium ii nitrate,hydrate,palladium,diaquabis nitrato-o-9ci |
| InChI Key | GPNDARIEYHPYAY-UHFFFAOYSA-N |
| Molecular Formula | N2O6Pd |
Palladium on activated carbon, 10% Pd, (50% wet with water for safety), unreduced
CAS: 7440-05-3 Molecular Formula: Pd Molecular Weight (g/mol): 106.42 MDL Number: MFCD00011167 MFCD03457879 MFCD03427452 MFCD03613602 MFCD03613603 MFCD03613604 MFCD03613605 MFCD06798745 InChI Key: KDLHZDBZIXYQEI-UHFFFAOYSA-N Synonym: black,on carbon,paladio,palladium/carbon,element,charcoal,palladium, element,palladex 600,on charcoal,palladium-activated carbon PubChem CID: 23938 ChEBI: CHEBI:33363 IUPAC Name: palladium SMILES: [Pd]
| PubChem CID | 23938 |
|---|---|
| CAS | 7440-05-3 |
| Molecular Weight (g/mol) | 106.42 |
| ChEBI | CHEBI:33363 |
| MDL Number | MFCD00011167 MFCD03457879 MFCD03427452 MFCD03613602 MFCD03613603 MFCD03613604 MFCD03613605 MFCD06798745 |
| SMILES | [Pd] |
| Synonym | black,on carbon,paladio,palladium/carbon,element,charcoal,palladium, element,palladex 600,on charcoal,palladium-activated carbon |
| IUPAC Name | palladium |
| InChI Key | KDLHZDBZIXYQEI-UHFFFAOYSA-N |
| Molecular Formula | Pd |
Palladium(II) chloride, 99.9% (metals basis), Pd 59.0% min
CAS: 7647-10-1 Molecular Formula: Cl2Pd Molecular Weight (g/mol): 177.32 MDL Number: MFCD00003558 InChI Key: PIBWKRNGBLPSSY-UHFFFAOYSA-L PubChem CID: 24290 ChEBI: CHEBI:53434 SMILES: [Cl-].[Cl-].[Pd++]
| PubChem CID | 24290 |
|---|---|
| CAS | 7647-10-1 |
| Molecular Weight (g/mol) | 177.32 |
| ChEBI | CHEBI:53434 |
| MDL Number | MFCD00003558 |
| SMILES | [Cl-].[Cl-].[Pd++] |
| InChI Key | PIBWKRNGBLPSSY-UHFFFAOYSA-L |
| Molecular Formula | Cl2Pd |
Palladium(II) chloride, solution, Pd 9.0-11.0% w/w (cont. Pd)
CAS: 7647-10-1 Molecular Formula: Cl2Pd Molecular Weight (g/mol): 177.32 MDL Number: MFCD00003558 InChI Key: PIBWKRNGBLPSSY-UHFFFAOYSA-L Synonym: palladium chloride,palladium ii chloride,palladium dichloride,palladous chloride,pdcl2,palladium 2+ chloride,palladium chloride pdcl2,enplate activator 440 PubChem CID: 24290 ChEBI: CHEBI:53434 IUPAC Name: dichloropalladium SMILES: [Cl-].[Cl-].[Pd++]
| PubChem CID | 24290 |
|---|---|
| CAS | 7647-10-1 |
| Molecular Weight (g/mol) | 177.32 |
| ChEBI | CHEBI:53434 |
| MDL Number | MFCD00003558 |
| SMILES | [Cl-].[Cl-].[Pd++] |
| Synonym | palladium chloride,palladium ii chloride,palladium dichloride,palladous chloride,pdcl2,palladium 2+ chloride,palladium chloride pdcl2,enplate activator 440 |
| IUPAC Name | dichloropalladium |
| InChI Key | PIBWKRNGBLPSSY-UHFFFAOYSA-L |
| Molecular Formula | Cl2Pd |
Palladium, 10% on carbon, Type 487, dry
CAS: 5-3-7440 Molecular Formula: Pd Molecular Weight (g/mol): 106.42 MDL Number: MFCD00011167 MFCD03457879 MFCD03427452 MFCD03613602 MFCD03613603 MFCD03613604 MFCD03613605 MFCD06798745 InChI Key: KDLHZDBZIXYQEI-UHFFFAOYSA-N Synonym: black,on carbon,paladio,palladium/carbon,element,charcoal,palladium, element,palladex 600,on charcoal,palladium-activated carbon PubChem CID: 23938 ChEBI: CHEBI:33363 IUPAC Name: palladium SMILES: [Pd]
| PubChem CID | 23938 |
|---|---|
| CAS | 5-3-7440 |
| Molecular Weight (g/mol) | 106.42 |
| ChEBI | CHEBI:33363 |
| MDL Number | MFCD00011167 MFCD03457879 MFCD03427452 MFCD03613602 MFCD03613603 MFCD03613604 MFCD03613605 MFCD06798745 |
| SMILES | [Pd] |
| Synonym | black,on carbon,paladio,palladium/carbon,element,charcoal,palladium, element,palladex 600,on charcoal,palladium-activated carbon |
| IUPAC Name | palladium |
| InChI Key | KDLHZDBZIXYQEI-UHFFFAOYSA-N |
| Molecular Formula | Pd |
Di-^m-bromobis(tri-tert-butylphosphine)dipalladium(I)
CAS: 185812-86-6 Molecular Formula: C24H56Br2P2Pd2 Molecular Weight (g/mol): 779.31 MDL Number: MFCD04114019 InChI Key: JWWUTWDBVLEWDQ-UHFFFAOYSA-P Synonym: palladium i tri-tert-butylphosphine bromide,acmc-1c5o0,qmkdjymohbicon-uhfffaoysa-m,palladium i tri-tertbutylphosphine bromide PubChem CID: 71317307 IUPAC Name: bis(tri-tert-butyl-λ⁵-phosphanyl)cyclodipalladabromane SMILES: CC(C)(C)P([Pd]1[Br][Pd]([Br]1)P(C(C)(C)C)(C(C)(C)C)C(C)(C)C)(C(C)(C)C)C(C)(C)C
| PubChem CID | 71317307 |
|---|---|
| CAS | 185812-86-6 |
| Molecular Weight (g/mol) | 779.31 |
| MDL Number | MFCD04114019 |
| SMILES | CC(C)(C)P([Pd]1[Br][Pd]([Br]1)P(C(C)(C)C)(C(C)(C)C)C(C)(C)C)(C(C)(C)C)C(C)(C)C |
| Synonym | palladium i tri-tert-butylphosphine bromide,acmc-1c5o0,qmkdjymohbicon-uhfffaoysa-m,palladium i tri-tertbutylphosphine bromide |
| IUPAC Name | bis(tri-tert-butyl-λ⁵-phosphanyl)cyclodipalladabromane |
| InChI Key | JWWUTWDBVLEWDQ-UHFFFAOYSA-P |
| Molecular Formula | C24H56Br2P2Pd2 |
Palladium(II) acetylacetonate --force to the web--, 35% Pd
CAS: 14024-61-4 Molecular Formula: C10H14O4Pd Molecular Weight (g/mol): 304.64 MDL Number: MFCD00000025 MFCD00000025 InChI Key: JKDRQYIYVJVOPF-FDGPNNRMSA-L Synonym: palladium diacetonate,acetylacetone palladium ii salt,bis 2,4-pentanedionato palladium ii PubChem CID: 53384484 IUPAC Name: (E)-4-oxopent-2-en-2-olate;palladium(2+) SMILES: [Pd++].C\C([O-])=C\C(C)=O.C\C([O-])=C\C(C)=O
| PubChem CID | 53384484 |
|---|---|
| CAS | 14024-61-4 |
| Molecular Weight (g/mol) | 304.64 |
| MDL Number | MFCD00000025 MFCD00000025 |
| SMILES | [Pd++].C\C([O-])=C\C(C)=O.C\C([O-])=C\C(C)=O |
| Synonym | palladium diacetonate,acetylacetone palladium ii salt,bis 2,4-pentanedionato palladium ii |
| IUPAC Name | (E)-4-oxopent-2-en-2-olate;palladium(2+) |
| InChI Key | JKDRQYIYVJVOPF-FDGPNNRMSA-L |
| Molecular Formula | C10H14O4Pd |
Palladium(II) chloride, 99.999%, (trace metal basis)
CAS: 7647-10-1 Molecular Formula: Cl2Pd Molecular Weight (g/mol): 177.32 MDL Number: MFCD00003558 InChI Key: PIBWKRNGBLPSSY-UHFFFAOYSA-L Synonym: palladium chloride,palladium ii chloride,palladium dichloride,palladous chloride,pdcl2,palladium 2+ chloride,palladium chloride pdcl2,enplate activator 440 PubChem CID: 24290 ChEBI: CHEBI:53434 SMILES: [Cl-].[Cl-].[Pd++]
| PubChem CID | 24290 |
|---|---|
| CAS | 7647-10-1 |
| Molecular Weight (g/mol) | 177.32 |
| ChEBI | CHEBI:53434 |
| MDL Number | MFCD00003558 |
| SMILES | [Cl-].[Cl-].[Pd++] |
| Synonym | palladium chloride,palladium ii chloride,palladium dichloride,palladous chloride,pdcl2,palladium 2+ chloride,palladium chloride pdcl2,enplate activator 440 |
| InChI Key | PIBWKRNGBLPSSY-UHFFFAOYSA-L |
| Molecular Formula | Cl2Pd |
Palladium, 5% on calcium carbonate, Type A306060-5, lead poisoned
CAS: 5-3-7440 Molecular Formula: Pd Molecular Weight (g/mol): 106.42 MDL Number: MFCD00011167 MFCD03457879 MFCD03427452 MFCD03613602 MFCD03613603 MFCD03613604 MFCD03613605 MFCD06798745 InChI Key: KDLHZDBZIXYQEI-UHFFFAOYSA-N Synonym: black,on carbon,paladio,palladium/carbon,element,charcoal,palladium, element,palladex 600,on charcoal,palladium-activated carbon PubChem CID: 23938 ChEBI: CHEBI:33363 IUPAC Name: palladium SMILES: [Pd]
| PubChem CID | 23938 |
|---|---|
| CAS | 5-3-7440 |
| Molecular Weight (g/mol) | 106.42 |
| ChEBI | CHEBI:33363 |
| MDL Number | MFCD00011167 MFCD03457879 MFCD03427452 MFCD03613602 MFCD03613603 MFCD03613604 MFCD03613605 MFCD06798745 |
| SMILES | [Pd] |
| Synonym | black,on carbon,paladio,palladium/carbon,element,charcoal,palladium, element,palladex 600,on charcoal,palladium-activated carbon |
| IUPAC Name | palladium |
| InChI Key | KDLHZDBZIXYQEI-UHFFFAOYSA-N |
| Molecular Formula | Pd |