Carboxylic acid esters
Filtered Search Results
tert-Butyl propiolate, 98%
CAS: 13831-03-3 Molecular Formula: C7H10O2 Molecular Weight (g/mol): 126.16 MDL Number: MFCD00060100 InChI Key: XGTPDIIFEPTULX-UHFFFAOYSA-N Synonym: tert-butyl propiolate,propiolic acid tert-butyl ester,t-butyl propiolate,2-propynoic acid, 1,1-dimethylethyl ester,boc-acetylene,tert-butyl propalate,tert-butyl propargylate,acmc-209chj,tert-butyl propiolate # PubChem CID: 543038 IUPAC Name: tert-butyl prop-2-ynoate SMILES: CC(C)(C)OC(=O)C#C
| PubChem CID | 543038 |
|---|---|
| CAS | 13831-03-3 |
| Molecular Weight (g/mol) | 126.16 |
| MDL Number | MFCD00060100 |
| SMILES | CC(C)(C)OC(=O)C#C |
| Synonym | tert-butyl propiolate,propiolic acid tert-butyl ester,t-butyl propiolate,2-propynoic acid, 1,1-dimethylethyl ester,boc-acetylene,tert-butyl propalate,tert-butyl propargylate,acmc-209chj,tert-butyl propiolate # |
| IUPAC Name | tert-butyl prop-2-ynoate |
| InChI Key | XGTPDIIFEPTULX-UHFFFAOYSA-N |
| Molecular Formula | C7H10O2 |
2,2,3,3,3-Pentafluoropropyl methacrylate, 97%, stab.
CAS: 45115-53-5 Molecular Formula: C7H7F5O2 Molecular Weight (g/mol): 218.123 MDL Number: MFCD00039256 InChI Key: CLISWDZSTWQFNX-UHFFFAOYSA-N Synonym: 1h,1h-pentafluoropropyl methacrylate,2,2,3,3,3-pentafluoropropyl methacrylate,2-propenoic acid, 2-methyl-, 2,2,3,3,3-pentafluoropropyl ester,1h,1h-pentafluoro-n-propyl methacrylate,2,2,3,3,3-pentafluoro-n-propyl methacrylate,methacrylic acid 2,2,3,3,3-pentafluoropropyl ester,2,2,3,3,3-pentafluoropropyl methacrylate stabilized with tbc,2,2,3,3,3-pentafluoropropyl methacrylate, contains 100 ppm 4-tert-butylcatechol as inhibitor PubChem CID: 123516 IUPAC Name: 2,2,3,3,3-pentafluoropropyl 2-methylprop-2-enoate SMILES: CC(=C)C(=O)OCC(C(F)(F)F)(F)F
| PubChem CID | 123516 |
|---|---|
| CAS | 45115-53-5 |
| Molecular Weight (g/mol) | 218.123 |
| MDL Number | MFCD00039256 |
| SMILES | CC(=C)C(=O)OCC(C(F)(F)F)(F)F |
| Synonym | 1h,1h-pentafluoropropyl methacrylate,2,2,3,3,3-pentafluoropropyl methacrylate,2-propenoic acid, 2-methyl-, 2,2,3,3,3-pentafluoropropyl ester,1h,1h-pentafluoro-n-propyl methacrylate,2,2,3,3,3-pentafluoro-n-propyl methacrylate,methacrylic acid 2,2,3,3,3-pentafluoropropyl ester,2,2,3,3,3-pentafluoropropyl methacrylate stabilized with tbc,2,2,3,3,3-pentafluoropropyl methacrylate, contains 100 ppm 4-tert-butylcatechol as inhibitor |
| IUPAC Name | 2,2,3,3,3-pentafluoropropyl 2-methylprop-2-enoate |
| InChI Key | CLISWDZSTWQFNX-UHFFFAOYSA-N |
| Molecular Formula | C7H7F5O2 |
Methyl trimethylacetate, 99%
CAS: 598-98-1 Molecular Formula: C6H12O2 Molecular Weight (g/mol): 116.16 MDL Number: MFCD00008843 InChI Key: CNMFHDIDIMZHKY-UHFFFAOYSA-N Synonym: methyl pivalate,methyl trimethylacetate,propanoic acid, 2,2-dimethyl-, methyl ester,pivalic acid, methyl ester,unii-bfx9w386ox,bfx9w386ox,pivalic acid methyl ester,methyl pivaloate,methyltrimethylacetate,tert-c4h9cooch3 PubChem CID: 69027 IUPAC Name: methyl 2,2-dimethylpropanoate SMILES: CC(C)(C)C(=O)OC
| PubChem CID | 69027 |
|---|---|
| CAS | 598-98-1 |
| Molecular Weight (g/mol) | 116.16 |
| MDL Number | MFCD00008843 |
| SMILES | CC(C)(C)C(=O)OC |
| Synonym | methyl pivalate,methyl trimethylacetate,propanoic acid, 2,2-dimethyl-, methyl ester,pivalic acid, methyl ester,unii-bfx9w386ox,bfx9w386ox,pivalic acid methyl ester,methyl pivaloate,methyltrimethylacetate,tert-c4h9cooch3 |
| IUPAC Name | methyl 2,2-dimethylpropanoate |
| InChI Key | CNMFHDIDIMZHKY-UHFFFAOYSA-N |
| Molecular Formula | C6H12O2 |
Methyl trimethylacetate, 99%
CAS: 598-98-1 Molecular Formula: C6H12O2 Molecular Weight (g/mol): 116.16 MDL Number: MFCD00008843 InChI Key: CNMFHDIDIMZHKY-UHFFFAOYSA-N Synonym: methyl pivalate,methyl trimethylacetate,propanoic acid, 2,2-dimethyl-, methyl ester,pivalic acid, methyl ester,unii-bfx9w386ox,bfx9w386ox,pivalic acid methyl ester,methyl pivaloate,methyltrimethylacetate,tert-c4h9cooch3 PubChem CID: 69027 IUPAC Name: methyl 2,2-dimethylpropanoate SMILES: CC(C)(C)C(=O)OC
| PubChem CID | 69027 |
|---|---|
| CAS | 598-98-1 |
| Molecular Weight (g/mol) | 116.16 |
| MDL Number | MFCD00008843 |
| SMILES | CC(C)(C)C(=O)OC |
| Synonym | methyl pivalate,methyl trimethylacetate,propanoic acid, 2,2-dimethyl-, methyl ester,pivalic acid, methyl ester,unii-bfx9w386ox,bfx9w386ox,pivalic acid methyl ester,methyl pivaloate,methyltrimethylacetate,tert-c4h9cooch3 |
| IUPAC Name | methyl 2,2-dimethylpropanoate |
| InChI Key | CNMFHDIDIMZHKY-UHFFFAOYSA-N |
| Molecular Formula | C6H12O2 |
| CAS | 2309-07-1 |
|---|---|
| MDL Number | MFCD00017208 |
2,2,3,3-Tetrafluoropropyl methacrylate, 97%, stab. with 50ppm 4-methoxyphenol, Thermo Scientific Chemicals
CAS: 45102-52-1 Molecular Formula: C7H8F4O2 Molecular Weight (g/mol): 200.133 MDL Number: MFCD00042381 InChI Key: RSVZYSKAPMBSMY-UHFFFAOYSA-N Synonym: 2,2,3,3-tetrafluoropropyl methacrylate,2-propenoic acid, 2-methyl-, 2,2,3,3-tetrafluoropropyl ester,methacrylic acid 2,2,3,3-tetrafluoropropyl ester,1h,1h,3h-tetrafluoropropyl methacrylate,2,2,3,3-tetrafluoropropyl methacrylate, stab. with 2,2'-methylenebis 6-tert-butyl-4-methyl-phenol,acmc-1ajz7,ksc489s8d,rsvzyskapmbsmy-uhfffaoysa,2,2,3,3-tetrafluoroprop-1-yl methacrylat PubChem CID: 123515 IUPAC Name: 2,2,3,3-tetrafluoropropyl 2-methylprop-2-enoate SMILES: CC(=C)C(=O)OCC(C(F)F)(F)F
| PubChem CID | 123515 |
|---|---|
| CAS | 45102-52-1 |
| Molecular Weight (g/mol) | 200.133 |
| MDL Number | MFCD00042381 |
| SMILES | CC(=C)C(=O)OCC(C(F)F)(F)F |
| Synonym | 2,2,3,3-tetrafluoropropyl methacrylate,2-propenoic acid, 2-methyl-, 2,2,3,3-tetrafluoropropyl ester,methacrylic acid 2,2,3,3-tetrafluoropropyl ester,1h,1h,3h-tetrafluoropropyl methacrylate,2,2,3,3-tetrafluoropropyl methacrylate, stab. with 2,2'-methylenebis 6-tert-butyl-4-methyl-phenol,acmc-1ajz7,ksc489s8d,rsvzyskapmbsmy-uhfffaoysa,2,2,3,3-tetrafluoroprop-1-yl methacrylat |
| IUPAC Name | 2,2,3,3-tetrafluoropropyl 2-methylprop-2-enoate |
| InChI Key | RSVZYSKAPMBSMY-UHFFFAOYSA-N |
| Molecular Formula | C7H8F4O2 |