Learn More
Ecdysterone, Thermo Scientific™
An insect steroid hormone that induces apoptosis
Brand: Thermo Scientific Alfa Aesar J63091.MF
| Quantity | 50mg |
|---|
Description
This Thermo Scientific brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific.
ApplicationsEcdysterone is an insect steroid hormone that induces apoptosis, cell proliferation, growth by controlling gene expression involved in molting and metamorphosis. And it is also used as a ecdysteroid in both plant and animal species that controls cell death.
Solubility
Soluble in alcohol
Notes
Keep container tightly closed. Store away from oxidizing agents.
Chemical Identifiers
| 5289-74-7 | |
| 480.64 | |
| NKDFYOWSKOHCCO-YPVLXUMRSA-N | |
| 5459840 | |
| (1S,3aS,5aR,7R,8S,9aR,9bR,11aR)-3a,7,8-trihydroxy-9a,11a-dimethyl-1-[(2R,3R)-2,3,6-trihydroxy-6-methylheptan-2-yl]-1H,2H,3H,3aH,5H,5aH,6H,7H,8H,9H,9aH,9bH,10H,11H,11aH-cyclopenta[a]phenanthren-5-one |
| C27H44O7 | |
| MFCD00036740 | |
| 20-hydroxyecdysone, ecdysterone, beta-ecdysone, crustecdysone, 20-oh ecdysone, the-7, polypodine a, insect moulting hormone, commisterone, crustecdyson | |
| CHEBI:16587 | |
| CC(C)(O)CC[C@@H](O)[C@](C)(O)[C@H]1CC[C@@]2(O)C3=CC(=O)[C@@H]4C[C@@H](O)[C@@H](O)C[C@]4(C)[C@H]3CC[C@]12C |
Specifications
| 5289-74-7 | |
| MFCD00036740 | |
| 1917578 | |
| 20-hydroxyecdysone, ecdysterone, beta-ecdysone, crustecdysone, 20-oh ecdysone, the-7, polypodine a, insect moulting hormone, commisterone, crustecdyson | |
| NKDFYOWSKOHCCO-YPVLXUMRSA-N | |
| (1S,3aS,5aR,7R,8S,9aR,9bR,11aR)-3a,7,8-trihydroxy-9a,11a-dimethyl-1-[(2R,3R)-2,3,6-trihydroxy-6-methylheptan-2-yl]-1H,2H,3H,3aH,5H,5aH,6H,7H,8H,9H,9aH,9bH,10H,11H,11aH-cyclopenta[a]phenanthren-5-one | |
| 5459840 | |
| 480.64 |
| C27H44O7 | |
| 50mg | |
| 14,3491 | |
| Soluble in alcohol | |
| CC(C)(O)CC[C@@H](O)[C@](C)(O)[C@H]1CC[C@@]2(O)C3=CC(=O)[C@@H]4C[C@@H](O)[C@@H](O)C[C@]4(C)[C@H]3CC[C@]12C | |
| 480.64 | |
| CHEBI:16587 | |
| Ecdysterone |
Your input is important to us. Please complete this form to provide feedback related to the content on this product.