Xylenes
Xylenes are any one of three isomers of dimethylbenzene, or a combination thereof. All are colorless, flammable liquids composed of a central benzene ring with two methyl groups attached at substituents. They can be applied as precursor chemicals and solvents.
Xylenes are flammable petrochemical products that can be produced via catalytic reforming and coal carbonization during coke production and found in crude oil, gasoline, and aircraft fuel. Xylenes were first isolated from wood tar and named by the French chemist Auguste Cahours.
What Is Xylene?
Xylene, more appropriately called xylenes, refers to any single or combination of the three isomers of dimethylbenzene. The isomeric forms are designated as ortho- (o-), meta- (m-), and para- (p-), a reference to the carbon in the benzene ring to which the two methyl groups are attached.
- o-isomer: 1,2-dimethylbenzene
- m-isomer: 1,3-dimethylbenzene
- p-isomer: 1,4-dimethylbenzene
Xylenes are colorless and can be detected by odor at concentrations as low as 0.08 to 3.7 ppm in air and tasted in water at 0.53 to 1.8 ppm.
Refer to the Certificate of Analysis or the Safety Data Sheet for specific information about xylene density and safety hazards.
What Is Xylene Used For?
Industrial Uses
p-Xylene is a precursor to terephthalic acid and dimethyl terephthalate, used to make polyethylene terephthalate plastic bottles and polyester clothing.
Xylene can be used as a solvent and is a common component of ink, rubber, adhesives, and paint and varnish thinners. Xylenes may be used to clean steel, silicon wafers, and integrated circuits. Medical applications include use as a solvent of dental materials and ear wax.
Laboratory Uses
Xylene can be used with dry ice in baths, to remove oil from microscope objectives, and as a cleaning agent or mounting material in histology procedures.
Filtered Search Results
2-Chloro-N-(2,3-dimethylphenyl)benzamide, 97%
CAS: 196617-88-6 Molecular Formula: C15H14ClNO Molecular Weight (g/mol): 259.733 MDL Number: MFCD00018254 InChI Key: OUAGJVUPQKYHDU-UHFFFAOYSA-N Synonym: 2-chloro-n-2,3-dimethylphenyl benzamide,cambridge id 5328590,2-chloro-2',3'-benzoxylidide,2-chloro-n-2,3-dimethyl-phenyl-benzamide,n-2,3-dimethylphenyl 2-chlorophenyl carboxamide PubChem CID: 295079 IUPAC Name: 2-chloro-N-(2,3-dimethylphenyl)benzamide SMILES: CC1=C(C(=CC=C1)NC(=O)C2=CC=CC=C2Cl)C
| PubChem CID | 295079 |
|---|---|
| CAS | 196617-88-6 |
| Molecular Weight (g/mol) | 259.733 |
| MDL Number | MFCD00018254 |
| SMILES | CC1=C(C(=CC=C1)NC(=O)C2=CC=CC=C2Cl)C |
| Synonym | 2-chloro-n-2,3-dimethylphenyl benzamide,cambridge id 5328590,2-chloro-2',3'-benzoxylidide,2-chloro-n-2,3-dimethyl-phenyl-benzamide,n-2,3-dimethylphenyl 2-chlorophenyl carboxamide |
| IUPAC Name | 2-chloro-N-(2,3-dimethylphenyl)benzamide |
| InChI Key | OUAGJVUPQKYHDU-UHFFFAOYSA-N |
| Molecular Formula | C15H14ClNO |
2,4-Dimethylbenzeneboronic acid, 97%
CAS: 55499-44-0 Molecular Formula: C8H11BO2 Molecular Weight (g/mol): 149.984 MDL Number: MFCD02683101 InChI Key: TYONHSPZXLFWKI-UHFFFAOYSA-N Synonym: 2,4-dimethylphenyl boronic acid,2,4-dimethylbenzeneboronic acid,2,4-dimethyl phenyl boronic acid,2,4-dimethylphenylboronicacid,4-dimethylphenylboronic acid,boronic acid, 2,4-dimethylphenyl,4-borono-m-xylene,pubchem9565,m-xylene-4-boronic acid,acmc-1ay9d PubChem CID: 4198739 IUPAC Name: (2,4-dimethylphenyl)boronic acid SMILES: B(C1=C(C=C(C=C1)C)C)(O)O
| PubChem CID | 4198739 |
|---|---|
| CAS | 55499-44-0 |
| Molecular Weight (g/mol) | 149.984 |
| MDL Number | MFCD02683101 |
| SMILES | B(C1=C(C=C(C=C1)C)C)(O)O |
| Synonym | 2,4-dimethylphenyl boronic acid,2,4-dimethylbenzeneboronic acid,2,4-dimethyl phenyl boronic acid,2,4-dimethylphenylboronicacid,4-dimethylphenylboronic acid,boronic acid, 2,4-dimethylphenyl,4-borono-m-xylene,pubchem9565,m-xylene-4-boronic acid,acmc-1ay9d |
| IUPAC Name | (2,4-dimethylphenyl)boronic acid |
| InChI Key | TYONHSPZXLFWKI-UHFFFAOYSA-N |
| Molecular Formula | C8H11BO2 |
3,4-Dimethylphenylacetic acid, 98%
CAS: 17283-16-8 Molecular Formula: C10H11O2 Molecular Weight (g/mol): 163.20 MDL Number: MFCD02664684 InChI Key: OTTPBKINJOYJGW-UHFFFAOYSA-M PubChem CID: 296013 IUPAC Name: 2-(3,4-dimethylphenyl)acetic acid SMILES: CC1=CC=C(CC([O-])=O)C=C1C
| PubChem CID | 296013 |
|---|---|
| CAS | 17283-16-8 |
| Molecular Weight (g/mol) | 163.20 |
| MDL Number | MFCD02664684 |
| SMILES | CC1=CC=C(CC([O-])=O)C=C1C |
| IUPAC Name | 2-(3,4-dimethylphenyl)acetic acid |
| InChI Key | OTTPBKINJOYJGW-UHFFFAOYSA-M |
| Molecular Formula | C10H11O2 |
3,5-Dimethylphenylacetic acid, 98+%
CAS: 42288-46-0 Molecular Formula: C10H11O2 Molecular Weight (g/mol): 163.20 MDL Number: MFCD00082776 InChI Key: HDNBKTWQBJJYPD-UHFFFAOYSA-M Synonym: 3,5-dimethylphenylacetic acid,2-3,5-dimethylphenyl acetic acid,3,5-dimethylphenyl acetic acid,benzeneacetic acid, 3,5-dimethyl,3,5-xylyl acetic acid,acmc-20anc9,ksc238q4h,3,5-dimethylbenzeneacetic acid,3,5-dimethyl-phenyl-acetic acid PubChem CID: 4749495 IUPAC Name: 2-(3,5-dimethylphenyl)acetic acid SMILES: CC1=CC(CC([O-])=O)=CC(C)=C1
| PubChem CID | 4749495 |
|---|---|
| CAS | 42288-46-0 |
| Molecular Weight (g/mol) | 163.20 |
| MDL Number | MFCD00082776 |
| SMILES | CC1=CC(CC([O-])=O)=CC(C)=C1 |
| Synonym | 3,5-dimethylphenylacetic acid,2-3,5-dimethylphenyl acetic acid,3,5-dimethylphenyl acetic acid,benzeneacetic acid, 3,5-dimethyl,3,5-xylyl acetic acid,acmc-20anc9,ksc238q4h,3,5-dimethylbenzeneacetic acid,3,5-dimethyl-phenyl-acetic acid |
| IUPAC Name | 2-(3,5-dimethylphenyl)acetic acid |
| InChI Key | HDNBKTWQBJJYPD-UHFFFAOYSA-M |
| Molecular Formula | C10H11O2 |
2,6-Dimethylphenyl isocyanate, 98%
CAS: 28556-81-2 Molecular Formula: C9H9NO Molecular Weight (g/mol): 147.18 MDL Number: MFCD00002012 InChI Key: YQLRKXVEALTVCZ-UHFFFAOYSA-N Synonym: 2,6-dimethylphenyl isocyanate,benzene, 2-isocyanato-1,3-dimethyl,2,6-dimethylphenylisocyanate,2,6-xylyl isocyanate,unii-2ql5mu0e0c,2ql5mu0e0c,isocyanic acid 2,6-dimethylphenyl ester,2,6-dimethylbenzenisocyanate,2,6-dimethyl phenyl isocyanate,2-isocyanato-1,3-dimethyl-benzene PubChem CID: 98787 IUPAC Name: 2-isocyanato-1,3-dimethylbenzene SMILES: CC1=CC=CC(C)=C1N=C=O
| PubChem CID | 98787 |
|---|---|
| CAS | 28556-81-2 |
| Molecular Weight (g/mol) | 147.18 |
| MDL Number | MFCD00002012 |
| SMILES | CC1=CC=CC(C)=C1N=C=O |
| Synonym | 2,6-dimethylphenyl isocyanate,benzene, 2-isocyanato-1,3-dimethyl,2,6-dimethylphenylisocyanate,2,6-xylyl isocyanate,unii-2ql5mu0e0c,2ql5mu0e0c,isocyanic acid 2,6-dimethylphenyl ester,2,6-dimethylbenzenisocyanate,2,6-dimethyl phenyl isocyanate,2-isocyanato-1,3-dimethyl-benzene |
| IUPAC Name | 2-isocyanato-1,3-dimethylbenzene |
| InChI Key | YQLRKXVEALTVCZ-UHFFFAOYSA-N |
| Molecular Formula | C9H9NO |
4,4'-Bis(2,5-dimethylstyryl)biphenyl, 99+%, Thermo Scientific™
CAS: 72814-85-8 Molecular Formula: C32H30 Molecular Weight (g/mol): 414.59 MDL Number: MFCD00051223 InChI Key: AMDSCXLLKXHWOJ-IWGRKNQJSA-N Synonym: 4,4'-bis 2,5-dimethylstyryl-1,1'-biphenyl,1,1'-biphenyl, 4,4'-bis 2-2,5-dimethylphenyl ethenyl,4,4'-bis 2,5-dimethylstyryl biphenyl,4,4'-bis-2,5-dimethylstyryl biphenyl,4,4'-bis e-2-2,5-dimethylphenyl ethenyl-1,1'-biphenyl,2-1e-2-4-4-1e-2-2,5-dimethylphenyl vinyl phenyl phenyl vinyl-1,4-dim ethylbenzene,2-e-2-4-4-e-2-2,5-dimethylphenyl ethenyl phenyl phenyl ethenyl-1,4-dimethylbenzene PubChem CID: 6442034 IUPAC Name: 2-[(E)-2-[4-[4-[(E)-2-(2,5-dimethylphenyl)ethenyl]phenyl]phenyl]ethenyl]-1,4-dimethylbenzene SMILES: CC1=CC=C(C)C(\C=C\C2=CC=C(C=C2)C2=CC=C(\C=C\C3=CC(C)=CC=C3C)C=C2)=C1
| PubChem CID | 6442034 |
|---|---|
| CAS | 72814-85-8 |
| Molecular Weight (g/mol) | 414.59 |
| MDL Number | MFCD00051223 |
| SMILES | CC1=CC=C(C)C(\C=C\C2=CC=C(C=C2)C2=CC=C(\C=C\C3=CC(C)=CC=C3C)C=C2)=C1 |
| Synonym | 4,4'-bis 2,5-dimethylstyryl-1,1'-biphenyl,1,1'-biphenyl, 4,4'-bis 2-2,5-dimethylphenyl ethenyl,4,4'-bis 2,5-dimethylstyryl biphenyl,4,4'-bis-2,5-dimethylstyryl biphenyl,4,4'-bis e-2-2,5-dimethylphenyl ethenyl-1,1'-biphenyl,2-1e-2-4-4-1e-2-2,5-dimethylphenyl vinyl phenyl phenyl vinyl-1,4-dim ethylbenzene,2-e-2-4-4-e-2-2,5-dimethylphenyl ethenyl phenyl phenyl ethenyl-1,4-dimethylbenzene |
| IUPAC Name | 2-[(E)-2-[4-[4-[(E)-2-(2,5-dimethylphenyl)ethenyl]phenyl]phenyl]ethenyl]-1,4-dimethylbenzene |
| InChI Key | AMDSCXLLKXHWOJ-IWGRKNQJSA-N |
| Molecular Formula | C32H30 |
1-(2,5-Dimethylphenyl)piperazine, 96%, Thermo Scientific™
CAS: 1013-25-8 Molecular Formula: C12H19N2 Molecular Weight (g/mol): 191.30 MDL Number: MFCD00038378 InChI Key: YRIFWVMRUFKWLM-UHFFFAOYSA-O Synonym: 1-2,5-dimethylphenyl piperazine,1-2,5-xylyl piperazine,piperazine, 1-2,5-dimethylphenyl,2,5-dimethylphenyl piperazine,acmc-1bpa9,2,5-dimethylphenylpiperazine,n-2,5-dimethylphenyl piperazine,1-2,5-dimethylphenyl-piperazine,4-2,5-dimethyl-phenyl piperazine,1-2,5-dimethyl-phenyl-piperazine PubChem CID: 70542 IUPAC Name: 1-(2,5-dimethylphenyl)piperazine SMILES: CC1=CC=C(C)C(=C1)N1CC[NH2+]CC1
| PubChem CID | 70542 |
|---|---|
| CAS | 1013-25-8 |
| Molecular Weight (g/mol) | 191.30 |
| MDL Number | MFCD00038378 |
| SMILES | CC1=CC=C(C)C(=C1)N1CC[NH2+]CC1 |
| Synonym | 1-2,5-dimethylphenyl piperazine,1-2,5-xylyl piperazine,piperazine, 1-2,5-dimethylphenyl,2,5-dimethylphenyl piperazine,acmc-1bpa9,2,5-dimethylphenylpiperazine,n-2,5-dimethylphenyl piperazine,1-2,5-dimethylphenyl-piperazine,4-2,5-dimethyl-phenyl piperazine,1-2,5-dimethyl-phenyl-piperazine |
| IUPAC Name | 1-(2,5-dimethylphenyl)piperazine |
| InChI Key | YRIFWVMRUFKWLM-UHFFFAOYSA-O |
| Molecular Formula | C12H19N2 |
4-Bromo-N-(2,4-dimethylphenyl)benzamide, 97%, Thermo Scientific™
CAS: 282091-66-1 Molecular Formula: C15H14BrNO Molecular Weight (g/mol): 304.19 MDL Number: MFCD00436496 InChI Key: CGUNDMXTDHRITR-UHFFFAOYSA-N Synonym: 4-bromo-n-2,4-dimethylphenyl benzamide,4-bromo-n-2,4-dimethyl-phenyl-benzamide PubChem CID: 774375 IUPAC Name: 4-bromo-N-(2,4-dimethylphenyl)benzamide SMILES: CC1=CC(C)=C(NC(=O)C2=CC=C(Br)C=C2)C=C1
| PubChem CID | 774375 |
|---|---|
| CAS | 282091-66-1 |
| Molecular Weight (g/mol) | 304.19 |
| MDL Number | MFCD00436496 |
| SMILES | CC1=CC(C)=C(NC(=O)C2=CC=C(Br)C=C2)C=C1 |
| Synonym | 4-bromo-n-2,4-dimethylphenyl benzamide,4-bromo-n-2,4-dimethyl-phenyl-benzamide |
| IUPAC Name | 4-bromo-N-(2,4-dimethylphenyl)benzamide |
| InChI Key | CGUNDMXTDHRITR-UHFFFAOYSA-N |
| Molecular Formula | C15H14BrNO |
2-Fluoro-N-(3,5-dimethylphenyl)benzamide, 97%, Thermo Scientific™
CAS: 332168-85-1 Molecular Formula: C15H14FNO Molecular Weight (g/mol): 243.28 MDL Number: MFCD01115438 InChI Key: GKEBWXLAFINVJG-UHFFFAOYSA-N Synonym: n-3,5-dimethylphenyl-2-fluorobenzamide,2-fluoro-n-3,5-dimethylphenyl benzamide,n-3,5-dimethyl-phenyl-2-fluoro-benzamide,n-3,5-dimethylphenyl 2-fluorophenyl carboxamide PubChem CID: 803512 IUPAC Name: N-(3,5-dimethylphenyl)-2-fluorobenzamide SMILES: CC1=CC(NC(=O)C2=CC=CC=C2F)=CC(C)=C1
| PubChem CID | 803512 |
|---|---|
| CAS | 332168-85-1 |
| Molecular Weight (g/mol) | 243.28 |
| MDL Number | MFCD01115438 |
| SMILES | CC1=CC(NC(=O)C2=CC=CC=C2F)=CC(C)=C1 |
| Synonym | n-3,5-dimethylphenyl-2-fluorobenzamide,2-fluoro-n-3,5-dimethylphenyl benzamide,n-3,5-dimethyl-phenyl-2-fluoro-benzamide,n-3,5-dimethylphenyl 2-fluorophenyl carboxamide |
| IUPAC Name | N-(3,5-dimethylphenyl)-2-fluorobenzamide |
| InChI Key | GKEBWXLAFINVJG-UHFFFAOYSA-N |
| Molecular Formula | C15H14FNO |
2,4-Dimethylphenylacetic acid, 98%, Thermo Scientific™
CAS: 6331-04-0 Molecular Formula: C10H12O2 Molecular Weight (g/mol): 164.20 MDL Number: MFCD02664685 InChI Key: MWBXCWLRASBZFB-UHFFFAOYSA-N Synonym: 2,4-dimethylphenylacetic acid,2-2,4-dimethylphenyl acetic acid,2,4-dimethylphenyl acetic acid,2,4-dimethyphenylacetic acid,acetic acid, 2,4-xylyl,2,4-dimethylphenylaceticacid,acetic acid,4-xylyl,ksc495a3d,2,4-dimethylphenyl-acetic acid,2,4-dimethyl phenyl acetic acid PubChem CID: 138729 IUPAC Name: 2-(2,4-dimethylphenyl)acetic acid SMILES: CC1=CC=C(CC(O)=O)C(C)=C1
| PubChem CID | 138729 |
|---|---|
| CAS | 6331-04-0 |
| Molecular Weight (g/mol) | 164.20 |
| MDL Number | MFCD02664685 |
| SMILES | CC1=CC=C(CC(O)=O)C(C)=C1 |
| Synonym | 2,4-dimethylphenylacetic acid,2-2,4-dimethylphenyl acetic acid,2,4-dimethylphenyl acetic acid,2,4-dimethyphenylacetic acid,acetic acid, 2,4-xylyl,2,4-dimethylphenylaceticacid,acetic acid,4-xylyl,ksc495a3d,2,4-dimethylphenyl-acetic acid,2,4-dimethyl phenyl acetic acid |
| IUPAC Name | 2-(2,4-dimethylphenyl)acetic acid |
| InChI Key | MWBXCWLRASBZFB-UHFFFAOYSA-N |
| Molecular Formula | C10H12O2 |
3,4-Dimethylphenyl isocyanate, 97%
CAS: 51163-27-0 Molecular Formula: C9H9NO Molecular Weight (g/mol): 147.18 MDL Number: MFCD00013867 InChI Key: AYCDBMRVKSXYKW-UHFFFAOYSA-N Synonym: 3,4-dimethylphenyl isocyanate,3,4-dimethylphenylisocyanate,benzene, 4-isocyanato-1,2-dimethyl,3,4-dimethyl phenylisocyanate,3,4-dimethylbenzenisocyanate,acmc-1aump,ksc265g2l,3,4-dimethyl phenyl isocyanate,1-isocyanato-3,4-dimethyl-benzene,4-isocyanato-1,2-dimethyl benzene PubChem CID: 4389663 ChEBI: CHEBI:60098 IUPAC Name: 4-isocyanato-1,2-dimethylbenzene SMILES: CC1=C(C)C=C(C=C1)N=C=O
| PubChem CID | 4389663 |
|---|---|
| CAS | 51163-27-0 |
| Molecular Weight (g/mol) | 147.18 |
| ChEBI | CHEBI:60098 |
| MDL Number | MFCD00013867 |
| SMILES | CC1=C(C)C=C(C=C1)N=C=O |
| Synonym | 3,4-dimethylphenyl isocyanate,3,4-dimethylphenylisocyanate,benzene, 4-isocyanato-1,2-dimethyl,3,4-dimethyl phenylisocyanate,3,4-dimethylbenzenisocyanate,acmc-1aump,ksc265g2l,3,4-dimethyl phenyl isocyanate,1-isocyanato-3,4-dimethyl-benzene,4-isocyanato-1,2-dimethyl benzene |
| IUPAC Name | 4-isocyanato-1,2-dimethylbenzene |
| InChI Key | AYCDBMRVKSXYKW-UHFFFAOYSA-N |
| Molecular Formula | C9H9NO |
4-Bromo-2,5-dimethybenzeneboronic acid, 96%, Thermo Scientific™
CAS: 130870-00-7 Molecular Formula: C8H10BBrO2 Molecular Weight (g/mol): 228.88 MDL Number: MFCD04115647 InChI Key: FUVZURQKCDUKIR-UHFFFAOYSA-N Synonym: 4-bromo-2,5-dimethylphenyl boronic acid,4-bromo-2,5-dimethylboronic acid,4-bromo-2,5-dimethyl-phenyl boronic acid,4-bromo-2,5-dimethylbenzeneboronic acid,bromo-2,5-dimethylphenylboronic acid,4-bromo-2,5-dimethylphenylboronicacid,acmc-209bjs,4-bromo-25-dimethylphenylboronic acid,2,5-dimethyl-4-bromophenylboronic acid,4-bromo-2,5-dimethylphenyl boronicacid PubChem CID: 3775186 IUPAC Name: (4-bromo-2,5-dimethylphenyl)boronic acid SMILES: CC1=CC(B(O)O)=C(C)C=C1Br
| PubChem CID | 3775186 |
|---|---|
| CAS | 130870-00-7 |
| Molecular Weight (g/mol) | 228.88 |
| MDL Number | MFCD04115647 |
| SMILES | CC1=CC(B(O)O)=C(C)C=C1Br |
| Synonym | 4-bromo-2,5-dimethylphenyl boronic acid,4-bromo-2,5-dimethylboronic acid,4-bromo-2,5-dimethyl-phenyl boronic acid,4-bromo-2,5-dimethylbenzeneboronic acid,bromo-2,5-dimethylphenylboronic acid,4-bromo-2,5-dimethylphenylboronicacid,acmc-209bjs,4-bromo-25-dimethylphenylboronic acid,2,5-dimethyl-4-bromophenylboronic acid,4-bromo-2,5-dimethylphenyl boronicacid |
| IUPAC Name | (4-bromo-2,5-dimethylphenyl)boronic acid |
| InChI Key | FUVZURQKCDUKIR-UHFFFAOYSA-N |
| Molecular Formula | C8H10BBrO2 |
4-Methoxy-3,5-dimethylbenzeneboronic acid, 98%, Thermo Scientific™
CAS: 301699-39-8 Molecular Formula: C9H13BO3 Molecular Weight (g/mol): 180.01 MDL Number: MFCD01114648 InChI Key: WZUCSPWZHRVOSD-UHFFFAOYSA-N Synonym: 3,5-dimethyl-4-methoxyphenylboronic acid,3,5-dimethyl-4-methoxybenzeneboronic acid,4-methoxy-3,5-dimethylphenyl boronic acid,4-methoxy-3,5-dimethyl-phenyl boronic acid,4-methoxy-3,5-dimethylbenzeneboronic acid,4-methoxy-3,5-dimethylphenyl boranediol,boronic acid, 4-methoxy-3,5-dimethylphenyl,pubchem6937,acmc-209hdl,3,5-dimethyl-4-methoxybenzeneboronicacid PubChem CID: 3817586 IUPAC Name: (4-methoxy-3,5-dimethylphenyl)boronic acid SMILES: B(C1=CC(=C(C(=C1)C)OC)C)(O)O
| PubChem CID | 3817586 |
|---|---|
| CAS | 301699-39-8 |
| Molecular Weight (g/mol) | 180.01 |
| MDL Number | MFCD01114648 |
| SMILES | B(C1=CC(=C(C(=C1)C)OC)C)(O)O |
| Synonym | 3,5-dimethyl-4-methoxyphenylboronic acid,3,5-dimethyl-4-methoxybenzeneboronic acid,4-methoxy-3,5-dimethylphenyl boronic acid,4-methoxy-3,5-dimethyl-phenyl boronic acid,4-methoxy-3,5-dimethylbenzeneboronic acid,4-methoxy-3,5-dimethylphenyl boranediol,boronic acid, 4-methoxy-3,5-dimethylphenyl,pubchem6937,acmc-209hdl,3,5-dimethyl-4-methoxybenzeneboronicacid |
| IUPAC Name | (4-methoxy-3,5-dimethylphenyl)boronic acid |
| InChI Key | WZUCSPWZHRVOSD-UHFFFAOYSA-N |
| Molecular Formula | C9H13BO3 |
3,5-Dimethyl-4-ethoxybenzeneboronic acid, 98%, Thermo Scientific™
CAS: 850568-59-1 Molecular Formula: C10H15BO3 Molecular Weight (g/mol): 194.04 MDL Number: MFCD02179463 InChI Key: FMJASQDMWVBTOJ-UHFFFAOYSA-N Synonym: 4-ethoxy-3,5-dimethylphenyl boronic acid,3,5-dimethyl-4-ethoxyphenylboronic acid,3,5-dimethyl-4-ethoxybenzeneboronic acid,boronic acid,b-4-ethoxy-3,5-dimethylphenyl,akos brn-0705,acmc-209q2b,4-ethoxy-3,5-dimethylphenyl boronicacid,4-ethoxy-3,5-dimethylbenzeneboronic acid,3,5-dimethyl-4-ethoxy benzeneboronic acid,4-ethoxy-3,5-dimethyl-phenyl boronic acid PubChem CID: 16217513 IUPAC Name: (4-ethoxy-3,5-dimethylphenyl)boronic acid SMILES: CCOC1=C(C)C=C(C=C1C)B(O)O
| PubChem CID | 16217513 |
|---|---|
| CAS | 850568-59-1 |
| Molecular Weight (g/mol) | 194.04 |
| MDL Number | MFCD02179463 |
| SMILES | CCOC1=C(C)C=C(C=C1C)B(O)O |
| Synonym | 4-ethoxy-3,5-dimethylphenyl boronic acid,3,5-dimethyl-4-ethoxyphenylboronic acid,3,5-dimethyl-4-ethoxybenzeneboronic acid,boronic acid,b-4-ethoxy-3,5-dimethylphenyl,akos brn-0705,acmc-209q2b,4-ethoxy-3,5-dimethylphenyl boronicacid,4-ethoxy-3,5-dimethylbenzeneboronic acid,3,5-dimethyl-4-ethoxy benzeneboronic acid,4-ethoxy-3,5-dimethyl-phenyl boronic acid |
| IUPAC Name | (4-ethoxy-3,5-dimethylphenyl)boronic acid |
| InChI Key | FMJASQDMWVBTOJ-UHFFFAOYSA-N |
| Molecular Formula | C10H15BO3 |
2,4-Dimethylphenyl isothiocyanate, 98%, Thermo Scientific™
CAS: 39842-01-8 Molecular Formula: C9H9NS Molecular Weight (g/mol): 163.24 MDL Number: MFCD00022054 InChI Key: HOHSBFCSOARUBF-UHFFFAOYSA-N Synonym: 2,4-dimethylphenyl isothiocyanate,2,4-dimethylphenylisothiocyanate,2,4-xylyl isothiocyanate,1-isothiocyanato-2,4-dimethyl-benzene,2,4-dimethylbenzenisothiocyanate,xylyl isothiocyanate,4-isothiocyanato-m-xylene,acmc-1agr7,2,4-dimethylphenyl-isothiocyanate,2,4-dimethyl-phenyl isothiocyanate PubChem CID: 142386 IUPAC Name: 1-isothiocyanato-2,4-dimethylbenzene SMILES: CC1=CC=C(N=C=S)C(C)=C1
| PubChem CID | 142386 |
|---|---|
| CAS | 39842-01-8 |
| Molecular Weight (g/mol) | 163.24 |
| MDL Number | MFCD00022054 |
| SMILES | CC1=CC=C(N=C=S)C(C)=C1 |
| Synonym | 2,4-dimethylphenyl isothiocyanate,2,4-dimethylphenylisothiocyanate,2,4-xylyl isothiocyanate,1-isothiocyanato-2,4-dimethyl-benzene,2,4-dimethylbenzenisothiocyanate,xylyl isothiocyanate,4-isothiocyanato-m-xylene,acmc-1agr7,2,4-dimethylphenyl-isothiocyanate,2,4-dimethyl-phenyl isothiocyanate |
| IUPAC Name | 1-isothiocyanato-2,4-dimethylbenzene |
| InChI Key | HOHSBFCSOARUBF-UHFFFAOYSA-N |
| Molecular Formula | C9H9NS |