Xylenes
Xylenes are any one of three isomers of dimethylbenzene, or a combination thereof. All are colorless, flammable liquids composed of a central benzene ring with two methyl groups attached at substituents. They can be applied as precursor chemicals and solvents.
Xylenes are flammable petrochemical products that can be produced via catalytic reforming and coal carbonization during coke production and found in crude oil, gasoline, and aircraft fuel. Xylenes were first isolated from wood tar and named by the French chemist Auguste Cahours.
What Is Xylene?
Xylene, more appropriately called xylenes, refers to any single or combination of the three isomers of dimethylbenzene. The isomeric forms are designated as ortho- (o-), meta- (m-), and para- (p-), a reference to the carbon in the benzene ring to which the two methyl groups are attached.
- o-isomer: 1,2-dimethylbenzene
- m-isomer: 1,3-dimethylbenzene
- p-isomer: 1,4-dimethylbenzene
Xylenes are colorless and can be detected by odor at concentrations as low as 0.08 to 3.7 ppm in air and tasted in water at 0.53 to 1.8 ppm.
Refer to the Certificate of Analysis or the Safety Data Sheet for specific information about xylene density and safety hazards.
What Is Xylene Used For?
Industrial Uses
p-Xylene is a precursor to terephthalic acid and dimethyl terephthalate, used to make polyethylene terephthalate plastic bottles and polyester clothing.
Xylene can be used as a solvent and is a common component of ink, rubber, adhesives, and paint and varnish thinners. Xylenes may be used to clean steel, silicon wafers, and integrated circuits. Medical applications include use as a solvent of dental materials and ear wax.
Laboratory Uses
Xylene can be used with dry ice in baths, to remove oil from microscope objectives, and as a cleaning agent or mounting material in histology procedures.
Filtered Search Results
2,5-Dimethylbenzeneboronic acid, 98%
CAS: 85199-06-0 Molecular Formula: C8H11BO2 Molecular Weight (g/mol): 149.98 MDL Number: MFCD01863525 InChI Key: OOMZKLJLVGQZGV-UHFFFAOYSA-N Synonym: 2,5-dimethylphenyl boronic acid,2,5-dimethylbenzeneboronic acid,2,5-dimethylphenylboronicacid,2,5-dimethylphenyl boranediol,p-xylene-2-boronic acid,boronic acid, 2,5-dimethylphenyl,pubchem1831,p-xyleneboronic acid,ksc448a1r,2,5-dimehylphenylboronic acid PubChem CID: 2734347 IUPAC Name: (2,5-dimethylphenyl)boronic acid SMILES: CC1=CC=C(C)C(=C1)B(O)O
| PubChem CID | 2734347 |
|---|---|
| CAS | 85199-06-0 |
| Molecular Weight (g/mol) | 149.98 |
| MDL Number | MFCD01863525 |
| SMILES | CC1=CC=C(C)C(=C1)B(O)O |
| Synonym | 2,5-dimethylphenyl boronic acid,2,5-dimethylbenzeneboronic acid,2,5-dimethylphenylboronicacid,2,5-dimethylphenyl boranediol,p-xylene-2-boronic acid,boronic acid, 2,5-dimethylphenyl,pubchem1831,p-xyleneboronic acid,ksc448a1r,2,5-dimehylphenylboronic acid |
| IUPAC Name | (2,5-dimethylphenyl)boronic acid |
| InChI Key | OOMZKLJLVGQZGV-UHFFFAOYSA-N |
| Molecular Formula | C8H11BO2 |
3,5-Dimethylphenylacetic acid, 98+%
CAS: 42288-46-0 Molecular Formula: C10H11O2 Molecular Weight (g/mol): 163.20 MDL Number: MFCD00082776 InChI Key: HDNBKTWQBJJYPD-UHFFFAOYSA-M Synonym: 3,5-dimethylphenylacetic acid,2-3,5-dimethylphenyl acetic acid,3,5-dimethylphenyl acetic acid,benzeneacetic acid, 3,5-dimethyl,3,5-xylyl acetic acid,acmc-20anc9,ksc238q4h,3,5-dimethylbenzeneacetic acid,3,5-dimethyl-phenyl-acetic acid PubChem CID: 4749495 IUPAC Name: 2-(3,5-dimethylphenyl)acetic acid SMILES: CC1=CC(CC([O-])=O)=CC(C)=C1
| PubChem CID | 4749495 |
|---|---|
| CAS | 42288-46-0 |
| Molecular Weight (g/mol) | 163.20 |
| MDL Number | MFCD00082776 |
| SMILES | CC1=CC(CC([O-])=O)=CC(C)=C1 |
| Synonym | 3,5-dimethylphenylacetic acid,2-3,5-dimethylphenyl acetic acid,3,5-dimethylphenyl acetic acid,benzeneacetic acid, 3,5-dimethyl,3,5-xylyl acetic acid,acmc-20anc9,ksc238q4h,3,5-dimethylbenzeneacetic acid,3,5-dimethyl-phenyl-acetic acid |
| IUPAC Name | 2-(3,5-dimethylphenyl)acetic acid |
| InChI Key | HDNBKTWQBJJYPD-UHFFFAOYSA-M |
| Molecular Formula | C10H11O2 |
4-Iodo-o-xylene, 98+%
CAS: 31599-61-8 Molecular Formula: C8H9I Molecular Weight (g/mol): 232.064 MDL Number: MFCD00040989 InChI Key: CSFRCLYFVINMBZ-UHFFFAOYSA-N Synonym: 4-iodo-o-xylene,1,2-dimethyl-4-iodobenzene,benzene, 4-iodo-1,2-dimethyl,3,4-dimethyliodobenzene,1-iodo-3,4-dimethylbenzene,4-iodo-ortho-xylene,3,4-dimethyl-1-iodobenzene,4-iodo-orthoxylene,4-iodo-0-xylene,pubchem3105 PubChem CID: 141646 IUPAC Name: 4-iodo-1,2-dimethylbenzene SMILES: CC1=C(C=C(C=C1)I)C
| PubChem CID | 141646 |
|---|---|
| CAS | 31599-61-8 |
| Molecular Weight (g/mol) | 232.064 |
| MDL Number | MFCD00040989 |
| SMILES | CC1=C(C=C(C=C1)I)C |
| Synonym | 4-iodo-o-xylene,1,2-dimethyl-4-iodobenzene,benzene, 4-iodo-1,2-dimethyl,3,4-dimethyliodobenzene,1-iodo-3,4-dimethylbenzene,4-iodo-ortho-xylene,3,4-dimethyl-1-iodobenzene,4-iodo-orthoxylene,4-iodo-0-xylene,pubchem3105 |
| IUPAC Name | 4-iodo-1,2-dimethylbenzene |
| InChI Key | CSFRCLYFVINMBZ-UHFFFAOYSA-N |
| Molecular Formula | C8H9I |
2,6-Dimethylphenyl isocyanide
CAS: 2769-71-3 Molecular Formula: C9H9N Molecular Weight (g/mol): 131.18 MDL Number: MFCD00013479 InChI Key: DNJLFZHMJDSJFN-UHFFFAOYSA-N Synonym: 2,6-dimethylphenyl isocyanide,2,6-dimethylphenylisonitrile,2,6-dimethylphenylisocyanide,2,6-xyleneisonitrile,2,6-xylyl isocyanide,benzene,2-isocyano-1,3-dimethyl,benzene, 2-isocyano-1,3-dimethyl-9ci,vic.-m-xylyl isocyanide,acmc-20ao80,2,6-dimethyiphenyl isocyanide PubChem CID: 76009 IUPAC Name: 2-isocyano-1,3-dimethylbenzene SMILES: CC1=CC=CC(C)=C1[N+]#[C-]
| PubChem CID | 76009 |
|---|---|
| CAS | 2769-71-3 |
| Molecular Weight (g/mol) | 131.18 |
| MDL Number | MFCD00013479 |
| SMILES | CC1=CC=CC(C)=C1[N+]#[C-] |
| Synonym | 2,6-dimethylphenyl isocyanide,2,6-dimethylphenylisonitrile,2,6-dimethylphenylisocyanide,2,6-xyleneisonitrile,2,6-xylyl isocyanide,benzene,2-isocyano-1,3-dimethyl,benzene, 2-isocyano-1,3-dimethyl-9ci,vic.-m-xylyl isocyanide,acmc-20ao80,2,6-dimethyiphenyl isocyanide |
| IUPAC Name | 2-isocyano-1,3-dimethylbenzene |
| InChI Key | DNJLFZHMJDSJFN-UHFFFAOYSA-N |
| Molecular Formula | C9H9N |
3,5-Dimethylaniline, 97+%
CAS: 108-69-0 Molecular Formula: C8H11N Molecular Weight (g/mol): 121.183 MDL Number: MFCD00007813 InChI Key: MKARNSWMMBGSHX-UHFFFAOYSA-N Synonym: 3,5-xylidine,benzenamine, 3,5-dimethyl,3,5-xylylamine,3,5-dimethylphenylamine,3,5-xylidene,5-amino-1,3-xylene,1-amino-3,5-dimethylbenzene,3,5-dimethylbenzenamine,3,5-dimethylbenzeneamine,5-amino-1,3-dimethylbenzene PubChem CID: 7949 IUPAC Name: 3,5-dimethylaniline SMILES: CC1=CC(=CC(=C1)N)C
| PubChem CID | 7949 |
|---|---|
| CAS | 108-69-0 |
| Molecular Weight (g/mol) | 121.183 |
| MDL Number | MFCD00007813 |
| SMILES | CC1=CC(=CC(=C1)N)C |
| Synonym | 3,5-xylidine,benzenamine, 3,5-dimethyl,3,5-xylylamine,3,5-dimethylphenylamine,3,5-xylidene,5-amino-1,3-xylene,1-amino-3,5-dimethylbenzene,3,5-dimethylbenzenamine,3,5-dimethylbenzeneamine,5-amino-1,3-dimethylbenzene |
| IUPAC Name | 3,5-dimethylaniline |
| InChI Key | MKARNSWMMBGSHX-UHFFFAOYSA-N |
| Molecular Formula | C8H11N |
4-Benzyloxy-3,5-dimethylbenzaldehyde, 95%
CAS: 144896-51-5 Molecular Formula: C16H16O2 Molecular Weight (g/mol): 240.30 MDL Number: MFCD00800683 InChI Key: GSYUTKRSEZMBNC-UHFFFAOYSA-N Synonym: 4-benzyloxy-3,5-dimethylbenzaldehyde,3,5-dimethyl-4-phenylmethoxy benzaldehyde,zlchem 1072,acmc-1bxy6,3,5-dimethyl-4-benzyloxybenzaldehyde,3,5-dimethyl-4-benzyloxy benzaldehyde,4-benzyloxy-3,5-dimethyl-benzaldehyde PubChem CID: 563557 IUPAC Name: 3,5-dimethyl-4-phenylmethoxybenzaldehyde SMILES: CC1=CC(C=O)=CC(C)=C1OCC1=CC=CC=C1
| PubChem CID | 563557 |
|---|---|
| CAS | 144896-51-5 |
| Molecular Weight (g/mol) | 240.30 |
| MDL Number | MFCD00800683 |
| SMILES | CC1=CC(C=O)=CC(C)=C1OCC1=CC=CC=C1 |
| Synonym | 4-benzyloxy-3,5-dimethylbenzaldehyde,3,5-dimethyl-4-phenylmethoxy benzaldehyde,zlchem 1072,acmc-1bxy6,3,5-dimethyl-4-benzyloxybenzaldehyde,3,5-dimethyl-4-benzyloxy benzaldehyde,4-benzyloxy-3,5-dimethyl-benzaldehyde |
| IUPAC Name | 3,5-dimethyl-4-phenylmethoxybenzaldehyde |
| InChI Key | GSYUTKRSEZMBNC-UHFFFAOYSA-N |
| Molecular Formula | C16H16O2 |
2,2',5,5'-Tetramethylbiphenyl, 98%
CAS: 3075-84-1 Molecular Formula: C16H18 Molecular Weight (g/mol): 210.32 MDL Number: MFCD00151846 InChI Key: ZHTROMYSDSTCCE-UHFFFAOYSA-N PubChem CID: 137818 IUPAC Name: 2-(2,5-dimethylphenyl)-1,4-dimethylbenzene SMILES: CC1=CC=C(C)C(=C1)C1=CC(C)=CC=C1C
| PubChem CID | 137818 |
|---|---|
| CAS | 3075-84-1 |
| Molecular Weight (g/mol) | 210.32 |
| MDL Number | MFCD00151846 |
| SMILES | CC1=CC=C(C)C(=C1)C1=CC(C)=CC=C1C |
| IUPAC Name | 2-(2,5-dimethylphenyl)-1,4-dimethylbenzene |
| InChI Key | ZHTROMYSDSTCCE-UHFFFAOYSA-N |
| Molecular Formula | C16H18 |
3,5-Dimethylaniline, 97+%
CAS: 108-69-0 Molecular Formula: C8H11N Molecular Weight (g/mol): 121.18 MDL Number: MFCD00007813 InChI Key: MKARNSWMMBGSHX-UHFFFAOYSA-N Synonym: 3,5-xylidine,benzenamine, 3,5-dimethyl,3,5-xylylamine,3,5-dimethylphenylamine,3,5-xylidene,5-amino-1,3-xylene,1-amino-3,5-dimethylbenzene,3,5-dimethylbenzenamine,3,5-dimethylbenzeneamine,5-amino-1,3-dimethylbenzene PubChem CID: 7949 IUPAC Name: 3,5-dimethylaniline SMILES: CC1=CC(=CC(=C1)N)C
| PubChem CID | 7949 |
|---|---|
| CAS | 108-69-0 |
| Molecular Weight (g/mol) | 121.18 |
| MDL Number | MFCD00007813 |
| SMILES | CC1=CC(=CC(=C1)N)C |
| Synonym | 3,5-xylidine,benzenamine, 3,5-dimethyl,3,5-xylylamine,3,5-dimethylphenylamine,3,5-xylidene,5-amino-1,3-xylene,1-amino-3,5-dimethylbenzene,3,5-dimethylbenzenamine,3,5-dimethylbenzeneamine,5-amino-1,3-dimethylbenzene |
| IUPAC Name | 3,5-dimethylaniline |
| InChI Key | MKARNSWMMBGSHX-UHFFFAOYSA-N |
| Molecular Formula | C8H11N |
Thermo Scientific Chemicals Gemfibrozil, 98%
CAS: 25812-30-0 Molecular Formula: C15H22O3 Molecular Weight (g/mol): 250.34 MDL Number: MFCD00079335 InChI Key: HEMJJKBWTPKOJG-UHFFFAOYSA-N Synonym: gemfibrozil,lopid,5-2,5-dimethylphenoxy-2,2-dimethylpentanoic acid,jezil,decrelip,lipur,bolutol,apo-gemfibrozil,gemfibromax,cholespid PubChem CID: 3463 ChEBI: CHEBI:5296 IUPAC Name: 5-(2,5-dimethylphenoxy)-2,2-dimethylpentanoic acid SMILES: CC1=CC=C(C)C(OCCCC(C)(C)C(O)=O)=C1
| PubChem CID | 3463 |
|---|---|
| CAS | 25812-30-0 |
| Molecular Weight (g/mol) | 250.34 |
| ChEBI | CHEBI:5296 |
| MDL Number | MFCD00079335 |
| SMILES | CC1=CC=C(C)C(OCCCC(C)(C)C(O)=O)=C1 |
| Synonym | gemfibrozil,lopid,5-2,5-dimethylphenoxy-2,2-dimethylpentanoic acid,jezil,decrelip,lipur,bolutol,apo-gemfibrozil,gemfibromax,cholespid |
| IUPAC Name | 5-(2,5-dimethylphenoxy)-2,2-dimethylpentanoic acid |
| InChI Key | HEMJJKBWTPKOJG-UHFFFAOYSA-N |
| Molecular Formula | C15H22O3 |
3,5-Dimethylbenzeneboronic acid, 98%
CAS: 172975-69-8 Molecular Formula: C8H11BO2 Molecular Weight (g/mol): 149.984 MDL Number: MFCD00185689 InChI Key: DJGHSJBYKIQHIK-UHFFFAOYSA-N Synonym: 3,5-dimethylphenyl boronic acid,3,5-dimethylbenzeneboronic acid,3,5-dimethylphenyl boranediol,m-xylene-5-boronic acid,boronic acid, 3,5-dimethylphenyl,pubchem1833,acmc-209e5l,ksc174i6l,3.5-dimethylphenylboronic acid PubChem CID: 2734349 IUPAC Name: (3,5-dimethylphenyl)boronic acid SMILES: B(C1=CC(=CC(=C1)C)C)(O)O
| PubChem CID | 2734349 |
|---|---|
| CAS | 172975-69-8 |
| Molecular Weight (g/mol) | 149.984 |
| MDL Number | MFCD00185689 |
| SMILES | B(C1=CC(=CC(=C1)C)C)(O)O |
| Synonym | 3,5-dimethylphenyl boronic acid,3,5-dimethylbenzeneboronic acid,3,5-dimethylphenyl boranediol,m-xylene-5-boronic acid,boronic acid, 3,5-dimethylphenyl,pubchem1833,acmc-209e5l,ksc174i6l,3.5-dimethylphenylboronic acid |
| IUPAC Name | (3,5-dimethylphenyl)boronic acid |
| InChI Key | DJGHSJBYKIQHIK-UHFFFAOYSA-N |
| Molecular Formula | C8H11BO2 |
2,3-Dimethylbenzeneboronic acid, 98%
CAS: 183158-34-1 Molecular Formula: C8H11BO2 Molecular Weight (g/mol): 149.984 MDL Number: MFCD01863524 InChI Key: ZYYANAWVBDFAHY-UHFFFAOYSA-N Synonym: 2,3-dimethylbenzeneboronic acid,2,3-dimethylphenyl boronic acid,o-xylene-3-boronic acid,2,3-dimethylphenyl boranediol,2,3-dimethylbenzeneboronicacid,2,3-dimethylphenylboronicacid,pubchem5037,acmc-1bxk2,amtb394,ksc174k9l PubChem CID: 2773395 IUPAC Name: (2,3-dimethylphenyl)boronic acid SMILES: B(C1=C(C(=CC=C1)C)C)(O)O
| PubChem CID | 2773395 |
|---|---|
| CAS | 183158-34-1 |
| Molecular Weight (g/mol) | 149.984 |
| MDL Number | MFCD01863524 |
| SMILES | B(C1=C(C(=CC=C1)C)C)(O)O |
| Synonym | 2,3-dimethylbenzeneboronic acid,2,3-dimethylphenyl boronic acid,o-xylene-3-boronic acid,2,3-dimethylphenyl boranediol,2,3-dimethylbenzeneboronicacid,2,3-dimethylphenylboronicacid,pubchem5037,acmc-1bxk2,amtb394,ksc174k9l |
| IUPAC Name | (2,3-dimethylphenyl)boronic acid |
| InChI Key | ZYYANAWVBDFAHY-UHFFFAOYSA-N |
| Molecular Formula | C8H11BO2 |
4-Benzyloxy-3,5-dimethylbenzoic acid, 98+%
CAS: 97888-80-7 Molecular Formula: C16H16O3 Molecular Weight (g/mol): 256.301 MDL Number: MFCD00272572 InChI Key: JABUPJCJZZNUFK-UHFFFAOYSA-N Synonym: 4-benzyloxy-3,5-dimethylbenzoic acid,4-benzyloxy-3,5-dimethyl-benzoic acid,3,5-dimethyl-4-phenylmethoxy benzoic acid,4-benzyloxy-3,5-dimethyl-benzoate PubChem CID: 2733993 IUPAC Name: 3,5-dimethyl-4-phenylmethoxybenzoic acid SMILES: CC1=CC(=CC(=C1OCC2=CC=CC=C2)C)C(=O)O
| PubChem CID | 2733993 |
|---|---|
| CAS | 97888-80-7 |
| Molecular Weight (g/mol) | 256.301 |
| MDL Number | MFCD00272572 |
| SMILES | CC1=CC(=CC(=C1OCC2=CC=CC=C2)C)C(=O)O |
| Synonym | 4-benzyloxy-3,5-dimethylbenzoic acid,4-benzyloxy-3,5-dimethyl-benzoic acid,3,5-dimethyl-4-phenylmethoxy benzoic acid,4-benzyloxy-3,5-dimethyl-benzoate |
| IUPAC Name | 3,5-dimethyl-4-phenylmethoxybenzoic acid |
| InChI Key | JABUPJCJZZNUFK-UHFFFAOYSA-N |
| Molecular Formula | C16H16O3 |
2,3-Dimethylanisole, 97%
CAS: 2944-49-2 Molecular Formula: C9H12O Molecular Weight (g/mol): 136.194 MDL Number: MFCD00008376 InChI Key: BLMBNEVGYRXFNA-UHFFFAOYSA-N Synonym: 2,3-dimethylanisole,3-methoxy-o-xylene,benzene, 1-methoxy-2,3-dimethyl,benzene, methoxydimethyl,1,2-dimethyl-6-methoxybenzene,1-methoxy-2,3-dimethyl-benzene,dimethylanisole,pubchem4114,2,3-dimethyl anisole,2,3-dimethyl-anisole PubChem CID: 76269 IUPAC Name: 1-methoxy-2,3-dimethylbenzene SMILES: CC1=C(C(=CC=C1)OC)C
| PubChem CID | 76269 |
|---|---|
| CAS | 2944-49-2 |
| Molecular Weight (g/mol) | 136.194 |
| MDL Number | MFCD00008376 |
| SMILES | CC1=C(C(=CC=C1)OC)C |
| Synonym | 2,3-dimethylanisole,3-methoxy-o-xylene,benzene, 1-methoxy-2,3-dimethyl,benzene, methoxydimethyl,1,2-dimethyl-6-methoxybenzene,1-methoxy-2,3-dimethyl-benzene,dimethylanisole,pubchem4114,2,3-dimethyl anisole,2,3-dimethyl-anisole |
| IUPAC Name | 1-methoxy-2,3-dimethylbenzene |
| InChI Key | BLMBNEVGYRXFNA-UHFFFAOYSA-N |
| Molecular Formula | C9H12O |
3-Nitro-o-xylene, 99%
CAS: 83-41-0 Molecular Formula: C8H9NO2 Molecular Weight (g/mol): 151.17 MDL Number: MFCD00007162 InChI Key: FVHAWXWFPBPFOS-UHFFFAOYSA-N Synonym: 3-nitro-o-xylene,2,3-dimethylnitrobenzene,nitroxylene,o-xylene, 3-nitro,benzene, 1,2-dimethyl-3-nitro,xylene, ar-nitro,benzene, dimethylnitro,unii-49gnx4cy5w,ccris 3117,49gnx4cy5w PubChem CID: 6739 IUPAC Name: 1,2-dimethyl-3-nitrobenzene SMILES: CC1=CC=CC(=C1C)[N+]([O-])=O
| PubChem CID | 6739 |
|---|---|
| CAS | 83-41-0 |
| Molecular Weight (g/mol) | 151.17 |
| MDL Number | MFCD00007162 |
| SMILES | CC1=CC=CC(=C1C)[N+]([O-])=O |
| Synonym | 3-nitro-o-xylene,2,3-dimethylnitrobenzene,nitroxylene,o-xylene, 3-nitro,benzene, 1,2-dimethyl-3-nitro,xylene, ar-nitro,benzene, dimethylnitro,unii-49gnx4cy5w,ccris 3117,49gnx4cy5w |
| IUPAC Name | 1,2-dimethyl-3-nitrobenzene |
| InChI Key | FVHAWXWFPBPFOS-UHFFFAOYSA-N |
| Molecular Formula | C8H9NO2 |